You want an average of at least 30 active minutes each day during the week. How many active minutes do you need on Sunday to achieve your goal? Make an argument for your answer using a bar graph.

You Want An Average Of At Least 30 Active Minutes Each Day During The Week. How Many Active Minutes Do

Answers

Answer 1

Using the mean concept, it is found that you need at least 40 active minutes on Sunday to achieve your goal.

What is the mean?

The mean of a data-set is given by the sum of all observations in the data-set divided by the number of observations.

In a week, there will be 7 observations, and a bar graph can represent each observation(time in minutes). They are given as follows:

15, 45, 20, 0, 60, 30 and x.

We want the mean to be of 30, hence:

30 = (15 + 45 + 20 + 0 + 60 + 30 + x)/7

170 + x = 210

x = 210 - 170

x = 40.

You need at least 40 active minutes on Sunday to achieve your goal.

More can be learned about the mean of a data-set at https://brainly.com/question/24628525

#SPJ1


Related Questions

There are twelve doughnuts in a dozen. How many doughnuts are there in ten dozen?

Answers

I’m think it’s 120 since
One dozen =12
You would multiply it by 10
10x12=120

What number makes the equation true fill in the answer _____ divided by 5=9

Answers

Answer:

45

Step-by-step explanation:

9x5=45,

45 divided by 9 =5

45 divided by 5 =9

(Fact Families)

Determine whether y varies directly with x in the equation 6x − 3 = 2y − 3. If so, what is the constant of variation?

Answers

Answer:

I am pretty sure it is 3

Step-by-step explanation:

A cashier checks the price of a hockey stick that is marked $44, because it usually rings up at $80. What is the discount percentage?

Answers

Answer:

The discount percentage is 45%.

Step-by-step explanation:

To be able to determine the discount percentage, you can use the following formula:

Discount percentage=(final price-original price/original price)*100

Original price=80

Final price=44

Now, you can replace the values in the formula:

Discount percentage=(44-80/80)*100

Discount percentage=-45%

According to this, the answer is that the discount percentage is 45%.

There are 200 end-of-the-year school dance tickets available. Students who have erfect attendance are able to purchase them in advance. If 18 tickets were urchased in advance, then what percent of the tickets were purchased in advance? A. 18% B. 22% C. 9% D. 14%​

Answers

The percent of tickets purchased in advance is 9%.

To calculate the percent of tickets purchased in advance, we divide the number of tickets purchased in advance by the total number of tickets and multiply by 100%.

18 tickets purchased in advance / 200 total tickets * 100% = 9%

Therefore, the percent of tickets purchased in advance is 9%.

For more questions like Number click the link below:

https://brainly.com/question/17429689

#SPJ11

Solve the equation.
7- 3n = 11n+ 2

Answers

if ur solving for n then its -2
n=-1/4
3n-11n=11n+2-11n

find the principal unit normal vector to the curve at the specified value of the parameter.

Answers

The tangent vector to the curve at t = n is given by the derivative of the parametric equations: \(\frac{dx}{dt} = nt \ and\ \frac{dy}{dt} = n't^2\)

To find the principal unit normal vector to a curve at a specified value of the parameter, you will need to do the following:

Find the tangent vector to the curve at the specified value of the parameter. The tangent vector is a vector that is tangent to the curve at the point in question and points in the direction of the curve at that point.Find the normal vector to the curve at the specified value of the parameter. The normal vector is a vector that is perpendicular to the tangent vector and points in a direction that is normal (perpendicular) to the curve at the point in question. Normalize the normal vector to find the principal unit normal vector. Normalization is the process of dividing a vector by its magnitude (length) to obtain a vector of length 1, which is called a unit vector.

Here is an example to illustrate this process:

Suppose we have a curve given by the parametric equations \(x = t^2\) and y = t^3. The tangent vector to the curve at t = 2 is given by the derivative of the parametric equations:

\(\frac{dx}{dt} = 2t \ and\ \frac{dy}{dt} = 3t^2\)

Evaluating these at t = 2, we find that the tangent vector is (4,12).

The normal vector to the curve at t = 2 is perpendicular to the tangent vector, so we can find it by rotating the tangent vector 90 degrees counterclockwise. This can be done by taking the negative of the second component and swapping the components: (-12,4).

To normalize the normal vector, we divide it by its magnitude:

\((-12,4)\sqrt((-12)^2 + 4^2) = (-12\sqrt164,4\sqrt164) = (-0.73,0.24)\)

This is the principal unit normal vector to the curve at t = 2.

To learn more about tangent, visit:

brainly.com/question/19064965

#SPJ4

Florida has about 66 tornadoes each year, which is approximately 5.7% of all tornadoes in the United States annually. Estimate how many tornadoes occur in the United States each year

Answers

The number of tornadoes that occur in the United States each year is 1158

How to determine the tornadoes each year

Let's call the number of tornadoes in the United States each year "x".

The number of tornadoes in Florida each year is 5.7% of this total

So we can write:

66 = x * 5.7%

Divide both sides by 5.7%

x = 66/5.7%

Evaluate

x = approximately 1158

So, approximately 1162 tornadoes occur in the United States each year.

Read more about rate at

https://brainly.com/question/24178013

#SPJ1

the sum of two numbers is 41. the smaller number is 13 less than the larger number. what are the numbers

Answers

Answer:

another number =27

Step-by-step explanation:

Let X stand for the larger number. The smaller number is therefore X - 13. We can now write the sum of the two numbers as:

X + (X - 13) = 4

X + X - 13 = 41

Gather the X’s and rewrite as,

2X - 13 = 41

Add 13 to both sides to get

2X = 54

Divide both sides by 2 to solve for X,

X = 27

A square pyramid and its net are shown below. What is the surface area of the pyramid?
17 cm
16 cm
Type the answer in the box.
square centimeters
17 cm
16 cm
...15 sm
15 cm.

A square pyramid and its net are shown below. What is the surface area of the pyramid?17 cm16 cmType

Answers

Check the picture below.

so the area of it, is really the area of a 16x16 square and four triangles with a base of 16 and a height of 15.

\(\stackrel{ \textit{\LARGE Areas}}{\stackrel{ square }{(16)(16)}~~ + ~~\stackrel{ \textit{four triangles} }{4\left[\cfrac{1}{2}(16)(15) \right]}}\implies 256~~ + ~~480\implies \text{\LARGE 736}~cm^2\)

A square pyramid and its net are shown below. What is the surface area of the pyramid?17 cm16 cmType

Someone help with geometry please the answer I put isn’t correct

Someone help with geometry please the answer I put isnt correct

Answers

The △ABC is congruent to △DCB (△ABC ≅ △DCB) under the SAS condition.

What is the congruency of triangles?Triangle congruence: If all three corresponding sides and all three corresponding angles are equal in size, two triangles are said to be congruent. Slide, rotate, flip, and turn these triangles to create an identical appearance. They are in alignment with one another when moved.

So, △ABC ≅ △DCB:

CB = CB (Common line - Given)AC = DB  (Similar lines - Given)∠ABC = ∠DCB = (Right angle - Given)

So, △ABC ≅ △DCB is under SAS condition.

Therefore, the △ABC is congruent to △DCB (△ABC ≅ △DCB) under the SAS condition.

Know more about the congruency of triangles here:

https://brainly.com/question/2938476

#SPJ13

Find the area AND perimeter of this shape.

Find the area AND perimeter of this shape.

Answers

Answer:

Area: 2206.86 square m

Perimeter: 194.25 m

Step-by-step explanation:

Area:

30 x 50 = 1500 square m

30/2 = 15 = the radius of the semi circles

pi x 15^2 = 706.86 square m

1500 + 706.86 = 2206.86 square m

Perimeter:

pi x 15 x 2 = 94.25 m

94.25 (perimeter of both semi circles) + (50 x 2) = 194.25 m

In your own words, explain the discriminant test on page 600 in your ebook. Use the discriminant test to decide whether the equation represents a parabola, ellipse or a hyperbola and explain why you know this is true. 2 х 4xy + 3x + 25y – 6 = 0

Answers

Using the discriminant test to decide what the equation represents, we know that it represents a Hyperbola.

How does it represent a hyperbola ?

The discriminant is a value that can be calculated from the coefficients of the quadratic equation that represents the conic section. The value of the discriminant tells us whether the conic section is a parabola, an ellipse, or a hyperbola.

To use the discriminant test, we first need to write the quadratic equation in standard form. The equation 2x + 4xy + 3x + 25y – 6 = 0 can be rewritten in standard form as follows:

(2x + 3)(y + 2) = 6

The discriminant is:

b² - 4ac

Using the equation once more:

= 3²- 4(2)(-6)

= 9 + 48

= 57

Since the discriminant is greater than zero, we know that the conic section is a hyperbola.

Find out more on discriminant test at https://brainly.com/question/32270671

#SPJ4

Pls help me asapppppppppp

Pls help me asapppppppppp

Answers

Answer:

I have to show the work gimme a sec

Step-by-step explanation:

Which of the following represents the polar equation r = (tan 2θ)(csc θ) as a rectangular equation?

Which of the following represents the polar equation r = (tan 2)(csc ) as a rectangular equation?

Answers

We will have the following:

\(r=\tan ^2(\theta)\csc (\theta)\Rightarrow r=(\frac{\sin(\theta)}{\cos(\theta)})^2(\frac{1}{\sin(\theta)})\)\(\Rightarrow r=\frac{\sin^2(\theta)}{\sin(\theta)\cos^2(\theta)}\Rightarrow r=\frac{\sin(\theta)}{\cos^2(\theta)}\)

Now, we corroborate with one of the expression, in our case we will analyze y = x^2:

\(r\sin (\theta)=(r\cos (\theta))^2\Rightarrow r\sin (\theta)=r^2\cos ^2(\theta)\Rightarrow r=\frac{\sin (\theta)}{\cos ^2(\theta)}\)

So, the expression taht represents the value given is:

\(y=x^2\)

What’s the answer????

Whats the answer????

Answers

Step-by-step explanation:

Q7) 10% of 30=3

40% of 30 =3×4=12

30-12=18

the sale price of radio is 18

q8)purchase lose lemmons:0.99÷2=0.495

Bag of 6=2.50÷6=0.4166666667

so the better value is the bag of 6 for 2.50.

factor completely.
n² - 5n + 4​

Answers

Answer:

(n-4)(n-1)

Step-by-step explanation:

n2 -5n +4

n2- n - 4n - 4

n(n-1) - 4(n-1)

(n-4)(n-1)

A population numbers 20,000 organisms initially and grows by 2.3% each year. Suppose P represents population, and t the number of years of growth. An exponential model for the population can be written in the form P=a⋅b
t
where P=

Answers

In the exponential model for population growth, P represents the population, a represents the initial population size (20,000 organisms), and b represents the growth factor (1 + 2.3%/100).

In the given scenario, the population initially numbers 20,000 organisms, and it grows by 2.3% each year. To construct an exponential model for the population growth, we can write it in the form P = a * b.

Here, P represents the population at any given time, a represents the initial population size (20,000 organisms), and b represents the growth factor.

The growth factor, b, can be calculated by adding 1 to the growth rate (2.3%) expressed as a decimal. So, b = 1 + 2.3%/100 = 1 + 0.023 = 1.023.

Therefore, the exponential model for the population growth is P = 20,000 * 1.023.

Hence, in the equation P = a * b, P represents the population and is given by P = 20,000 * 1.023, where 20,000 is the initial population size and 1.023 is the growth factor.

Learn more about growth factor here:

brainly.com/question/33248098

#SPJ11

please help I don't get it ​

please help I don't get it

Answers

2. Using proportion, the value of x = 38, the length of FC = 36 in.

3. Applying the angle bisection theorem, the value of x = 13. The length of CD = 39 cm.

What is the Angle Bisector Theorem?

The Angle Bisector Theorem states that in a triangle, an angle bisector divides the opposite side into segments that are proportional to the lengths of the other two sides of the triangle.

2. The proportion we would set up to find x is:

(x - 2) / 4 = 27 / 3

Solve for x:

3 * (x - 2) = 4 * 27

3x - 6 = 108

3x = 108 + 6

Simplifying:

3x = 114

x = 114 / 3

x = 38

Length of FC = x - 2 = 38 - 2

FC = 36 in.

3. The proportion we would set up to find x based on the angle bisector theorem is:

13 / 3x = 7 / (2x - 5)

Cross multiply:

13 * (2x - 5) = 7 * 3x

26x - 65 = 21x

26x - 21x - 65 = 0

5x - 65 = 0

5x = 65

x = 65 / 5

x = 13

Length of CD = 3x = 3(13)

CD = 39 cm

Learn more about Angle Bisector Theorem on:

https://brainly.com/question/30459648

#SPJ1

a man is standing on top of a cliff, 80 high, the angle of depression to a boat is 60° . calculate the distance of the boat from the base of the cliff.​

Answers

Answer:

20 :3

Step-by-step explanation:

Da distance is 20

80 - 60 = 20 BOOM PEEPS

Thom's restaurant bill is $45 and he leaves a 20 percent tip. What is the total cost for Thom's meal? O $20 $54 O $65 0 $90​

Answers

Answer:

$54

Step-by-step explanation:

Answer:

B.)$54

Step-by-step explanation:

20%->0.20

45(0.20)=9

45+9=54

MISSING QUESTIONSSSSSS!!!!!!! PLSSSSSSSSS ASAPPPPP

MISSING QUESTIONSSSSSS!!!!!!! PLSSSSSSSSS ASAPPPPP

Answers

Plot 1/2

Answer:

The opposite is -1/2 then just plot it on a number line.

construct triangle abc if ac=10cm angle bac=50 degrees and angle bca=50 degrees what type of triangle does this create

Answers

Answer:

Angle BAC =50

Step-by-step explanation:

Since O is the circumcenter and angle BOC is the angle subtended by the arc BC at the center and angle BAC is the angle subtended by arc BC

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant 4. Using the identity:

cos(A-B)=cosACosB+sinAsinB


find cos(A-B)

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant

Answers

Using trigonometric identity, cos(A-B) is:

\(cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}\)

How to find cos(A-B) using the trigonometric identity?

Trigonometry deals with the relationship between the ratios of the sides of a right-angled triangle with its angles.

If sin A = 1/3 and A terminates in Quadrant 1. All trigonometric functions in Quadrant 1  are positive

sin A = 1/3 (sine = opposite/hypotenuse)

adjacent = √(3² - 1²)

               = √8 units

cosine = adjacent/hypotenuse. Thus,

\(cos A = \frac{\sqrt{8} }{3}\)

If cos B = 2/3 and B terminates in Quadrant 4.

opposite = √(3² - 2²)

                = √5

In  Quadrant 4, sine is negative. Thus:

\(sin B = \frac{\sqrt{5} }{3}\)

We have:

cos(A-B) = cosA CosB + sinA sinB

\(cos (A-B) = \frac{\sqrt{8} }{3} * \frac{2}{3} + \left \frac{1}{3} * \frac{\sqrt{5} }{3}\)

\(cos (A-B) = \frac{2\sqrt{8} }{9} + \left\frac{\sqrt{5} }{9}\)

\(cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}\)

Learn more about Trigonometry on:

brainly.com/question/11967894

#SPJ1

Geraldo asked Ruth, "About how many people show up to play bingo each week?" Is this a statistical question? Choose 1 answer: A Yes B No​

Answers

A. Yes, this is a statistical question.

What is statistical problems?

A statistical problem has four main elements that define it: the manner in which the question is posed, the characteristics and function of the data, the specific methods used to analyze the data, and the inferences drawn from the investigation. In summary, a statistics problem usually consists of four essential components.

1. Ask a Question

2, Collect Data

3. Analyze Data

4. Interpret Results

A statistical question is a question that can be answered by collecting and analyzing data. In this case, Geraldo is asking about the number of people who show up to play bingo each week.

This question can be answered by collecting data over a period of time and calculating the average number of people who show up to play bingo each week.

Therefore, this question is a statistical question.

Learn more about statistical problems here:

https://brainly.com/question/29765147

#SPJ9

helppppppppppppppppppppppppppppppppppppppppppp

helppppppppppppppppppppppppppppppppppppppppppp

Answers

Answer:

hope you like my answer its 2/7

Find the missing terms in each geometric sequence.

1. 3, 12, 48 __, __

2. __, __, 32, 64, 128, ...

3. 120, 60, 30, __, __

4. 5, __, 20, 40, __, __

5. __, 4, 12, 36, __, __​

Answers

1. 192, 768 ( it was times 4 )
2. 8, 16 (it was adding the number together 8+8)
3. 15, 7.5 ( it was half of the number)
4. 10, 80, 160 ( times 2 )
5. .75, 108, 324 ( times 4 )

Hope this helped! Lmk if you need more help!

Help please I really need help, thank you

Help please I really need help, thank you

Answers

Answer:

What do you need help with? Answer and I will tell you anything you need.

Step-by-step explanation:

Suppose that an investment has 0.5% chance of a loss of $10
million and a 99.5% chance of a loss of $1 million. What is the
Value-at-Risk (VaR) for this investment when the confidence level
is 99%

Answers

To calculate the Value-at-Risk (VaR) for this investment at a 99% confidence level, we need to determine the loss amount that will be exceeded with a probability of only 1% (i.e., the worst-case loss that will occur with a 1% chance).

Given that there is a 0.5% chance of a loss of $10 million and a 99.5% chance of a loss of $1 million, we can express this as:

Loss Amount | Probability

$10 million | 0.5%

$1 million | 99.5%

To calculate the VaR, we need to find the loss amount that corresponds to the 1% probability threshold. Since the loss of $10 million has a probability of 0.5%, it is less likely to occur than the 1% threshold. Therefore, we can ignore the $10 million loss in this calculation.

The loss of $1 million has a probability of 99.5%, which is higher than the 1% threshold. This means that there is a 1% chance of the loss exceeding $1 million.

Therefore, the Value-at-Risk (VaR) for this investment at a 99% confidence level is $1 million.

The Value-at-Risk (VaR) for this investment at a 99% confidence level is $1,045,000.

To calculate the Value-at-Risk (VaR) for this investment at a 99% confidence level, we need to determine the loss amount that will be exceeded with only a 1% chance.

Given that the investment has a 0.5% chance of a loss of $10 million and a 99.5% chance of a loss of $1 million, we can calculate the VaR as follows:

VaR = (Probability of Loss of $10 million * Amount of Loss of $10 million) + (Probability of Loss of $1 million * Amount of Loss of $1 million)

VaR = (0.005 * $10,000,000) + (0.995 * $1,000,000)

VaR = $50,000 + $995,000

VaR = $1,045,000

Therefore, the Value-at-Risk (VaR) for this investment at a 99% confidence level is $1,045,000.

To learn more about 99% confidence level

https://brainly.com/question/15873157

#SPJ11

What is the measure of arc AB?
A. 153
B.140
C.142
D.180

What is the measure of arc AB?A. 153B.140C.142D.180

Answers

Answer:

153

Step-by-step explanation:

don't know explanation

Angles 38 and AB form a 180 degree
38+AB=180
AB=142

The arc measure is equal to the central point
Arc AB=142
Other Questions
Fiscal policy that involves changes in government spending affects which of the following components of aggregate demand?-Investment spending-Household consumption-Government spending-Total net exports Please help me ASAP due today please before beginning a patient's therapy with buproprion (wellbutrin), the nurse should assess for concurrent use of which medications or medication class? Why did you need to combine a convex lens that was more powerful than the concave lens to find the focal length of the concave lens in data sheet? A tree in Micahs yard has 120 leaves and loses an average of 4.5 leaves each day. A tree in Heathers yard has 45 leaves and gains an average of 0.5 leaves each day. Write and solve an equation to find the number of days it will take for both trees to have an equal number of leaves. What term describes analysis performed on an evidence disk or a forensic duplicate using the native operating system? Isacc is planning my on building his very own gaming pc. He is going to buy the new gtx 3090 for $3,340 and cpu his final bill is 3,420 what is the cost of the cpu HURRY PLEASR sabrina, vice president of development for a large automobile manufacturer, has developed a radically different marketing strategy. before she presents the idea to the ceo, she first consults with the other vice presidents to get their input and support. this step in building support for an idea is known as'' 11. Which of the following statements does NOT describe the way the Vietnam war was fought? a. The Vietcong were able to get food and information about American troop movement from peasants. b. The Vietcong used guerrilla tactics. c. The United States used intense air bombing. d. There were many large, clearly defined battles.PS it's not A! The antigen binding fragment of an immunoglobulin molecule, consisting of a combination of heavy and light chains whose molecular conformation is specific for the antigen is called the ________ region. In which region can you find the following physical features: Sahel, Mt. Kilimanjaro, Great Rift Valley, Kalahari Desert?Southwest AsiaNorth AfricaSub Saharan Africa an employee is eligible to qualify for the family and medical leave act benefits if the employee has worked at least question 20 options: 1,500 hours during the previous 12 months. 1,250 hours during the previous 12 months. 2,500 hours during the previous 12 months. 2,250 hours during the previous 24 months. 3,000 hours during the previous 24 months. how do i solve this? Select the INCORRECT statement about the action potential. Group of answer choices It occurs along a plasma membrane. It can summate just as graded potentials can. It has an all-or-none characteristic. It has a refractory period. It is triggered by depolarization to threshold. Suppose we have a rod of length n inches and we also have an array of prices P, where P[i] denotes the selling price ($) of a piece that is i inches long. In class, we introduced an algorithm that uses dynamic programming to find a way of cutting the rod into pieces that maximizes the revenue (See CLRS Ch15.1 for reference). Suppose now we have to pay a cost of $1 per cut. The profit can be defined as revenue minus the total cost of cutting. Suggest an algorithm to find a way to cut the rod that maximizes our profit. State a expression for the run time of your algorithm. A common early reason given for taking some people into slavery was that they werenot: a client with a diagnosis of diabetic ketoacidosis (dka) is being treated in the er. which finding would a nurse expect to note as confirming this diagnosis? Financial information for Accessories Unlimited includes the following selected data: Dividends (in millions) $ 75 Shares outstanding (in millions) 300 Stock price $ 20.00 What is the company's dividend yield Explain how each group's actions can affect our water supply. If the design is to have at least one foot of pavement over the drainage pipe what is the minimum depth of the ditch