Why should we write the report in very simple language?

To answer this question, we need to convert grams to moles and then use the Avogadro's number to convert moles to molecules.

The molar mass of Mg(OH)2 is 58.32 g/mol.

First, we need to find the number of moles of Mg(OH)2 in 75.0 g.

75.0 g / 58.32 g/mol = 1.287 mol

Next, we need to convert moles to molecules.

1.287 mol x 6.022 x 10^23 molecules/mol = 7.75 x 10^23 molecules

Finally, we can use the molecular formula of Mg(OH)2 to calculate the number of miles of Mg(OH)2.

1 molecule of Mg(OH)2 contains 3 atoms of oxygen (O) and 2 atoms of hydrogen (H).

So, the total number of miles of Mg(OH)2 is:

7.75 x 10^23 molecules x 2 miles/molecule = 1.55 x 10^24 miles

Therefore, there are 1.55 x 10^24 miles of magnesium hydroxide in 75.0 g of magnesium hydroxide.

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

It takes six molecules of carbon dioxide and six molecules of water to make one molecule of glucose.

Answer:

\(v_{solute}=160mL\)

Explanation:

Hello there!

In this case, according to the given information, it turns out possible for us to calculate the volume of methyl alcohol solute by using the definition of by-volume percentage:

\(\%v=\frac{v_{solute}}{v_{solution}} *100\%\)

Whereas we solve for the volume of the solute as shown below:

\(v_{solute}=\frac{\%v*v_{solution}}{100\%} \\\\v_{solute}=\frac{80\%*200mL}{100\%}\\\\ v_{solute}=160mL\)

Regards!

Answer :

1)composed substances=mix chemically, mixture=mix physically Composed substances are usually mix together through chemical process just like burning, titration and redox reaction. While mixture are mix together through physical process like dissolving and even putting together.

The aromatic ring in phenacetin exhibits an AB pattern because it has two mutually coupled nuclei that are unrelated to other protons or whose shift differences is equal to the coupling constant.

Deshielding occurs for the ring protons of benzene due to their larger chemical shift (7.3 ppm vs. 5.6 ppm for the vinylic protons in cyclohexene) and the fact that the magnetic field induced outside of the ring is the same orientation as that of the external field.

Protons are present in benzene at levels of 6–8 ppm.This value is larger than that of the protons in those other hydrocarbon like alkanes & alkenes because of the aromatic ring's deshielding effect.

To know more about protons visit:

https://brainly.com/question/1252435

#SPJ1

Complete Question

The complete question is shown on the first uploaded image

Answer:

The correct option is  ammonia

Explanation:

The mixture contains two base compound which are

           ammonia,

and     diethylamine

Now the addition of HCl which is  a strong acid in step 1  will cause the protonation of  the  two base compound , which makes the soluble hence resulting in them being extracted to the aqueous layer as represented in below

       \(NH_3 + HCl\to NH_4 ^{+} + Cl^-\)

and

     \((CH 3CH 2) 2NH + HCl \to (CH 3CH 2) 2NH_2^{+} + Cl\)

The number of grams of sulfuric acid in 1 gallon of battery acid if the solution has a density of 1.31 g/mL and is 38.5 % sulfuric acid by mass is 1854.62 g

To learn more about density visit:

https://brainly.com/question/15164682

#SPJ1

Answer:

3 Covalent Bonds and 1 Co ordinate Bond

Explanation:

4 bonds are in NH4¹+

NH4¹+ is the ammonium ion, which consists of a central nitrogen atom (N) and four hydrogen atoms (H). Nitrogen is located in group 15 of the periodic table and has 5 valence electrons. Hydrogen, on the other hand, has 1 valence electron.

To achieve a stable electron configuration, nitrogen needs to share electrons with the hydrogen atoms. Each hydrogen atom can form a single bond with the nitrogen atom by sharing its valence electron.

In NH4¹+, all four hydrogen atoms form single bonds with the central nitrogen atom. These bonds are represented by lines connecting each hydrogen atom to the nitrogen atom.

So, NH4¹+ has 4 bonds. Each bond represents a pair of electrons shared between the nitrogen atom and a hydrogen atom. The bonding arrangement ensures that the nitrogen atom has a complete octet (eight valence electrons) and each hydrogen atom has two electrons, following the stable configuration of helium.

The "+1" charge on NH4¹+ indicates that the ion has lost one electron, resulting in a positive charge. However, the number of bonds remains the same regardless of the charge.

Therefore, the correct answer is 4 for the number of bonds in NH4¹+.

Know more about the Ammonium ion here:

https://brainly.com/question/13796846

#SPJ8

Answer:

V=mass/Density

Explanation:

Since density is measured as grams/mL or grams/cm^3 and we are interested in converting mass to volume, we need to rewrite the equation.
Therefore, in order to convert the gram to mL, you just need to multiply the mass of the substance in grams with its density to get the volume in liters.

Answer:

Volume equals mass divided by density.

and

Mass equals density times volume.

Hope this helps :)

Pls brainliest...

B. Cao(s) (Calcium oxide)

The balanced equation would be:

Ca(s) + O2(g) --> Cao(s)

It is the product of Calcium oxide.

The product of the reaction between sodium and chlorine is sodium chloride (NaCl). When sodium (Na) and chlorine (Cl) react, they form an ionic bond, with the sodium atom losing one electron to the chlorine atom. This forms a positively charged sodium ion (Na+) and a negatively charged chloride ion (Cl-), which are held together by electrostatic attraction to form the compound sodium chloride. It is a white crystalline solid and is commonly known as table salt.

To know more about Sodium visit: https://brainly.com/question/24010534

#SPJ1

The parts of the Bunsen burner are;

P is the air hole and it should be closed before you light the Bunsen burner. This is to ensure that too much air does not enter.

Lighting a Bunsen burner without closing the air hole can be dangerous because it can cause the flame to become unstable and flare up, potentially leading to a fire or explosion. The air hole is used to regulate the amount of air that enters the burner and mixes with the gas. When the air hole is open, too much air can enter the burner and cause the flame to become oxygen-rich, which makes it hotter and more unstable.

In addition, an unstable flame can also release harmful byproducts such as carbon monoxide, a toxic gas that can cause headaches, dizziness, and nausea.

Learn more about Bunsen burner:https://brainly.com/question/743920

#SPJ1

Nitrogen G is a colorless, tasteless gas that is the most plentiful element in Earth's atmosphere and is a constituent of all living matter of nitrogen.

Nitrogen is an essential gaseous element with an atomic number of 7 and an atomic weight of 14.0067. Nitrogen gas has two particles of Nitrogen therefore, the molecular formula of this gas is N2. It is a non-metallic element that settled Group 15

nitrogen. [ nī′trə-jən ] N. A nonmetallic element that constructs up about 78 percent of the atmosphere by capacity, Nitrogen is a nonmetal and the lightest member of group 15 of the periodic table

So we can conclude that Nitrogen is the chemical element with the symbol N and atomic number 7.

Learn more about nitrogen here: https://brainly.com/question/1380063

#SPJ1

Answer: the answer is b

Explanation: the formation of bonds releases energy and the breaking of bonds always involves an absorption of energy

Answer:

396.92°C

Explanation:

Hello,

This question relates to heat transfer between objects and we can simply use the formula to solve this question.

Data;

Mass of silver (m) = 23g

Initial temperature of silver (T1) = 18°C

Final temperature of silver (T2) = ?

Heat absorbed = 2.05kJ = 2050J

Specific heat capacity of silver = 0.235J/g°C

Heat energy (Q) = mc∇T

Q = MC∇T

Q = heat energy

M = mass of substance

C = specific heat capacity of substance

∇T = change in temperature of substance = (T2 - T1)

Q = MC∇T

2050 = 23 × 0.235 × (T2 - 18)

2050 = 5.41 × (T2 - 18)

2050 = 5.41T2 - 97.38

Collect like terms

2050 + 97.38 = 5.41T2

2147.38 = 5.41T2

Divide both sides by 5.41

2147.38 / 5.41 = 5.41T2 / 5.41

T2 = 396.92°C

The final temperature of the sample after absorbing 2.05kJ of heat is 396.92°C

Have a nice day

A wind farm can also be located offshore in most of the state.

Why in most of the state wind frames are located in offshore?

Offshore, faster wind speeds allow for substantially greater energy production. The term "offshore wind energy" describes the installation of wind farms inside of bodies of water. To produce electricity, they use the sea winds. These wind farms may employ floating wind turbines or turbines with solid foundations. Also, compared to other renewable technologies, offshore wind is more similar to onshore wind in terms of resource accessibility and technological maturity. Offshore wind farms are starting to blend into the water and coastal environment as a result.

To know more about offshore, refer:-

https://brainly.in/question/51581294

SPJ1

Answer:

The answer is " 10.39"

Explanation:

Calculating acid moles:

\(= 0.02000 \ L \times 0.1000 \ M \\\\= 0.002000\)

Calculating NaOH moles:

\(= 0.02012 \ L \times 0.1000 \ M \\\\= 0.002012\)

calculating excess in OH-  Moles:

\(= 0.002012 - 0.002000\\\\=0.000012\)

calculating total volume:

\(= 20.00 + 20.12\\\\ = 40.12 mL \\\\= 0.04012 L\)

\([OH-]= \frac{0.000012} { 0.0472}\)

           \(=0.00025 M\)

\(pOH = - \log 0.00025\)

        = 3.6

\(pH = 14 - pOH\)

      = 10.39

Answer:

(1)There are 1.5 moles of water in a 27 gram sample of water. The molar mass of water is 18.02 gmol g m o l .(2)

AnswersChemistryGCSEArticle

What is the mass (g) of 0.25mols of NaCl?

What you need for these equations are a calculator, periodic table and the following equation:

Mass (g) = Mr x Moles (important equation to remember)

In this case we already know the moles as it's in the question, 0.25 moles.

to find the Mr, you need to look at your periodic table. Find the relative atomic mass of Na and Cl and add the two numbers together.

Na = 22.99

Cl = 35.45

NaCl = 58.4

Now just put all of the numbers into the equation.

0.25 x 58.4 = 14.6g

The question requires us to identify the molecular formula of a molecule formed between phosphorus (P) and chlorine (Cl).

The first step to solve this question is write the electronic configuration of both atoms involved (P and Cl) and, from the number of valence electrons, identify how many bonds each one should make.

P has atomic number 15, thus its electronic configuration is: 1s2 2s2 2p6 3s2 3p3

Cl has atomic number 17, thus its electronic configuration is: 1s2 2s2 2p6 3s2 3p5

Note that P has 5 valence electrons (3s2 and 3p3) while Cl has 7 valence electrons (3s2 3p5).

For P, we should expect 3 bonds to other atoms in order to reach the octet, while for Cl, we should expect 1 bond to another atom to achieve the octet.

With that in mind, we can say that each Cl will bond to one P, and we need 3 Cl. Therefore, the molecular formular is PCl3 (the last option).I

From each of the protein structures listed, the option with the highest level of protein structure as regards with order of amino acids and overall macromolecule structure is quaternary structure. That is option D.

The protein one of the essential nutrients that is found in and consumed by mammals.

There are different types of proteins and their functions depends on their shape, structure or conformation.

The structure of proteins include:

Therefore, the option with the highest level of protein structure as regards with order of amino acids and overall macromolecule structure is quaternary structure.

Learn more here:

https://brainly.com/question/18159696

The average atomic mass of the element is 12.0107 amu.

To calculate the average atomic mass of the element in question, we can use the following formula:

average atomic mass = (mass of isotope 1 x abundance of isotope 1) + (mass of isotope 2 x abundance of isotope 2)

where "mass of isotope 1" is the mass of the first stable isotope (13 amu in this case), "abundance of isotope 1" is the percentage of that isotope in the element (1.07% in this case), "mass of isotope 2" is the mass of the second stable isotope (12 amu in this case), and "abundance of isotope 2" is the percentage of that isotope in the element (98.93% in this case).

Substituting the given values in the formula, we get:

average atomic mass = (13 amu x 1.07%) + (12 amu x 98.93%)

average atomic mass = (0.1391 amu) + (11.8716 amu)

average atomic mass = 12.0107 amu

Therefore, the average atomic mass of the element is 12.0107 amu.

This means that on average, one atom of this element weighs 12.0107 atomic mass units (amu), which is slightly heavier than the most abundant isotope (12 amu) due to the presence of the less abundant isotope (13 amu). This concept is important in chemistry because the mass of atoms plays a crucial role in determining their chemical and physical properties. The knowledge of the average atomic mass of an element is important in a wide range of applications, including analytical chemistry, geochemistry, and nuclear physics.

Know  more about atomic mass here:

https://brainly.com/question/3187640

#SPJ11

Answer:

3 m/s^2

Explanation:

m = 3 kg

F = 9 N

Use Newton's Second Law: F = ma

9 = 3a

a = 3 m/s^2

The structure of  the alkyne 4 - decyne is shown in the image attached.

Alkyne functional group compounds with a triple bond made of carbon and carbon contain 4-decyne (C). The triple bond is found at the fourth carbon position in the ten-carbon chain (decyne) of 4-decyne.

Nine hydrogen atoms (H) are joined to the first nine carbon atoms (C), starting from the left side.

In conclusion, 4-decyne is made up of a chain of ten carbon atoms, with the fourth carbon atom serving as the center of a carbon-carbon triple bond (C). Except for the carbon involved in the triple bond, all carbon atoms are connected to hydrogen atoms.

Learn more about chemical structure:https://brainly.com/question/32300619

#SPJ1

The properties of a natural resource that make it useful for humans as a material or energy source is the ability to convert mass into energy and vice versa.

The expression natural resources make reference to all types of matter and energy extracted from nature that can be used to produce goods and services.

Some examples of natural resources include for example irreversible resources such as fossil fuels (i.e., oil, or coal, gas, minerals such as metals, rocks, etc) as well as those based on the use of reversible energy such as eolic air energy, solar radiation or sunlight, soil and hydric resources or water.

Therefore, with this data, we can see that natural resources can be defined as any material and or energy obtained from nature that may be irreversible or reversibly used to produce goods and services.

Learn more about natural resources here:

https://brainly.com/question/24514288

#SPJ1

There are\(6.02*10^{23}\) atoms of nitrogen in 0.50 mol of (NH4)2CO3. The correct answer is D. \(6.02*10^{23}\)

To determine the number of atoms of nitrogen in 0.50 mol of (NH4)2CO3, we first need to find the total number of moles of nitrogen in the compound.

(NH4)2CO3 contains two nitrogen atoms in each molecule, so the total number of moles of nitrogen is:

2 nitrogen atoms/molecule x 0.50 mol = 1.00 mol of nitrogen

We know that one mole of nitrogen contains Avogadro's number\((6.02 * 10^{23})\) atoms of nitrogen. Therefore, 1.00 mol of nitrogen also contains \((6.02 * 10^{23})\)atoms of nitrogen.

Therefore, there are \((6.02 * 10^{23})\)atoms of nitrogen in 0.50 mol of \((NH4)2CO3.\)

To learn more about atoms follow the given link: https://brainly.com/question/18859412

#SPJ1

The possible action your solution might contain is amongst \(Ag^+\), \(Pb^{2+}\), or \(Ca^{2+}\).

A solution is a homogeneous mixture of one or more solutes dissolved in a solvent.

NaCl: 20 drops of NaCl were used and no precipitate was formed.

No precipitation formed means the \(Cl^-\) cation is soluble in water. From your chart, you might see the halide of \(Ag^+\) and \(Pb^{2+}\) is insoluble in water, which means they should have formed precipitation but you didn't. This means there's less possibility it contains \(Ag^+\) or \(Pb^{2+}\), so we are left with only \(Ca^{2+}\). Let's confirm it with the rest.

\(Na_2SO_4\) : 20 drops of \(Na_2SO_4\) were used yellow precipitate was produced.

Even though all other sulfates form precipitation ( Insoluble in water)

\(Na_2CO_3\) : 20 drops of sodium carbonate were used and the silver-blue precipitate was produced.

It seems all of their Carbonate is insoluble in nature. ( which is our case too ).

From the above result, only the reaction with NaCl was deemed to be decisive and it indeed contains \(Ca^{2+}\) ions. Means you are correct.

Learn more about the solutions here:

https://brainly.com/question/1616939

#SPJ1

Answer:

wavelength = 2.81 m

Explanation:

Given that,

The frequency of the Sports  Fan radio station, f = 106.4 MHz

We need to find the wavelength (in meters) of the electromagnetic carrier wave. The relation between frequency and wavelength is given by :

\(c=f\lambda\)

Where,

\(\lambda\) is wavelength

\(\lambda=\dfrac{c}{f}\\\\\lambda=\dfrac{3\times 10^8}{106.4\times 10^6}\\\\\lambda=2.81\ m\)

So, the wavelength of the electromagnetic carrier wave is 2.81 m.

Answer:

Mitochondria is the powerhouse of the cell, but don't let this distract you from the fact that Mr. Krabs sold SpongeBob's soul for 62 cents

Answer:

mitochondria

Explanation: