Answer: Option 2
Step-by-step explanation:
For the ball to have hit the ground between 4 and 6 seconds, we need h(4) > 0 and h(6) < -0.
This eliminates options 1, 3, and 4.
Thus, answer is option 2
What is the remainder when x3 – 3x2 – 37 is divided by x - 5?(A)3(B)-27(C) 0(D) 73(E) 13
Given data:
The given equation is x^3-3x^2-37.
The given expression can be written as,
\(\begin{gathered} x^3-3x^2-37=x^2(x-5)+2x(x-5)+10(x-5)+13 \\ x^3-3x^2-37=(x-5)(x^2+2x+10)+13 \end{gathered}\)Thus, when x^3-3x^2-37 is divide by (x-5) we get 13 as a remainder, so the correct option is (E).
Un coche tarda 12 minutos en dar la vuelta a un circuito si va a una velocidad de 80 km/h. Cuánto tiempo tardara en recorrer el mismo circuito si va a una velocidad de 100 km/h?
A sample of matter experiences a decrease in average kinetic energy as it continues to cool. One would anticipate that the particles will eventually come to a complete stop. The temperature at which particles should theoretically stop moving is absolute zero. Thus, option B is correct.
What theory directly contradicts concept of absolute zero?
All molecules are predicted to have zero kinetic energy and, as a result, no molecular motion at absolute zero (273.15°C). Zero is a hypothetical value (it has never been reached).
Absolute zero signifies that there is no kinetic energy involved in random motion. A substance's atoms don't move relative to one another.
Therefore, Kinetic energy because it can create heat which goes against the absolute zero. A gas molecule's kinetic energy tends to zero when the temperature reaches absolute zero.
Learn more about theory here:
brainly.com/question/18996125
#SPJ2
Solve the equation and check your solution. (If an answer does not exist, enter DNE. If all real numbers are solutions, enter REALS.)
5x − 4 = 4x + 8
Picture included!
Find the unknowns in the graph below:
All the values of x, y and z are,
z = 12.99
y = 7.01
x = 28.3 degree
We have to given that;
In a triangle,
Two angles are, 61.7 degree and 90 degree
And, One side is, 14.76.
Now, We can formulate;
sin 61.7° = Perpendicular / Hypotenuse
sin 61.7° = z / 14.76
0.88 = z / 14.76
z = 0.88 x 14.76
z = 12.99
And, By Pythagoras theorem we get;
14.76² = z² + y²
14.76² = 12.99² + y²
217.85 = 168.74 + y²
y² = 217.85 - 168.74
y² = 49.1
y = 7.01
And, By sum of all the angles in triangle, we get;
x + 61.7 + 90 = 180
x + 151.7 = 180
x = 180 - 151.7
x = 28.3 degree
Learn more about the triangle visit;
brainly.com/question/1058720
#SPJ1
Keith drove to the mountains last weekend. There was heavy traffic on the way there, and the trip took 12 hours. When Keith drove home, there was no traffic and the trip only took 8 hours. If his average rate was 20 miles per hour faster on the trip home, how far away does Keith live from the mountains?
Do not do any rounding.
Keith live 480 miles far way from the mountains.
How far away does Keith live from the mountains?The distance between two locations is represented by the length of the line linking them. If the two points are on the same horizontal or vertical line, subtracting the various coordinates will show how far apart they are.
Consider the provided information.
Keith drove to the mountains last weekend. The trip took 12 hours because of the high traffic on the way there.
Let the distance is D and average rate or speed is x miles.
Distance = speed × time
Substitute the respective values.
D = x * 12
D= 12x
When Keith drove home, there was no traffic and the trip only took
hours. The average rate was 8 miles per hour faster on the trip home,
The average rate or speed during return is x+20 miles.
Substitute the respective values in the above formula.
D = (x+20) ×8
D= 8x+160
Equate both the equations.
8x+160 = 12x
4x= 160
x=160/4
=40
Substitute the value of x in D= 12x
D=12(40)
D= 480
Hence, Keith live 480 miles far way from the mountains.
To learn more about distance refer to :
https://brainly.com/question/17273444
#SPJ1
please help?!????????
If sine of the quantity x plus y end quantity equals radical 2 over 2 times sine of x plus radical 2 over 2 times cosine of x comma what is the value of y?.
If the sine of the quantity x plus y end quantity equals radical 2 over 2 times the sine of x plus radical 2 over 2 times cosine of x , the value of y is -2cos(x)
To determine the value of y in this equation, we can use the trigonometric identity sin(A+B)= sin(A)cos(B)+cos(A)sin(B).By rearranging this identity, we can isolate y on side of the equation and solve for it. first, we can isolate the sine of x by subtracting radical 2 over 2 times the cosine of x from both sides of the equation, and we can isolate radical 2 over 2 times the sine of x by dividing both sides of the equation by radical 2 over 2.
We then have the follwoing equation : sin(x+y)=sin(x). Now, we can use the same trigonometric identity from the beginning to isolate y. To do this, we subtract sin(x) from both sides of the equation, and we divide both sides of the equation by cos(x). We now have the following equation: y= -2xos(x). Therefore the value of y is equal to -2cos(x)/
To know more about trigonometric identity refer to the link brainly.com/question/24377281
#SPJ4
Question 3 of 15
Parvati goes to the movies with $16 in her wallet. She buys
a ticket for $6.25 and two snacks for $2.25 each. How
much money does she have left?
No links plsss remember no links pls
'D'
本题已由中国数学会官方解答(现有会员:3人)
D.
\(16 - (6.25 + 2 \times 2.25)\)
Convert the fraction below into a decimal 23/40?
Answer:
Step-by-step explanation:
23/40 = 0.575
The equation y=1/5x+3.5 can be used to find the amount of accumulated snow y in inches x hours after 5 P.M. on a certain day. Graph this equation.
The coordinates of the y-intercept are (0, 3.5) and the coordinates of the x-intercepts are (-17.5, 0). Using these coordinates, the graph of the equation is shown below.
Graphing linear equationsFrom the question, we are to graph the given linear equation.
To graph the equation,
We will determine the coordinates of the x-intercepts and y-intercepts.
When x = 0
y = 1/5x + 3.5
y = 1/5(0) + 3.5
y = 3.5
(0, 3.5)
When y = 0
y = 1/5x + 3.5
0 = 1/5x + 3.5
Multiply through by 5
0 = x + 17.5
x = -17.5
(-17.5, 0)
Using the coordinates of the x-axis and y-axis, the graph of the equation is shown below.
Learn more on Graphing linear equations here: https://brainly.com/question/11860022
#SPJ1
12 ^-3 wasnt at school the week we did negative integers help pls
1/1728 is the value of negative integers .
What in math is an integer?
A whole number that can be positive, negative, or zero is called an integer. It is not a fraction. Integer examples include: -5, 1, 5, 8, 97, and 3,043. 1.43, 1 3/4, 3.14, and other numbers are examples of non-integer numbers.Three sorts of integers exist: 0 (zero), positive integers (natural numbers), and negative integers (Additive inverse of Natural Numbers)= 12⁻³
= 1/12³
= 1/1728
Learn more about integer
brainly.com/question/15276410
#SPJ13
when time in hours (t) increases, how does distance in km (d) change?
Question seems incomplete but will be explained with assumptions
Answer and explanation:
If for example, a car travels 30 km per hour, then it would travel 60km in 2 hours and 90km in 3 hours and so on
We can apply the formula for distance as such:
Distance(d)= Speed(s) × time(t)
d=st
Where d is distance travelled say 60km
S is speed= 30km/hr
Time = 2 hrs
Also to calculate speed when distance and time is given, we can make speed the subject of the formula:
s=d/t
To calculate time when distance and speed are given, we can make time the subject of the formula:
t=d/s
Carlos read 150 words in one minute. He
read 5 times as many words as his younger
brother. How many words did his younger brother
read in one minute?
Answer:
30
Step-by-step explanation:
150/5 = 30
Answer: 30
Step-by-step explanation:
Solve the equation 2y+5=y-7
Answer: -12
Step-by-step explanation:
Sanjay has 2 1/3 cups of pretzels, Raul has 1 5/6 cups of chocolate pieces, and Sonny has 3 7/9 cups of granola. If they
combine all of their ingredients, how much trail mix can they
make?
Answer the question I need help
Answer:
the answer would be 38 :)
Step-by-step explanation:
24÷3=8
(8)+3+3 to the 3rd power
3×3×3=27
8+3=12 ->12+27=38
hopefully this helps :)
Answer:
Step-by-step explanation:
step 1: 24/3 which equals to 8.
Step 2: 8+3= 11
Step 3: 3*3*3=27
step four: 11+27=20 answer=38
HURRY PLEASE IM TIMED. Which list of numbers is shown on the number line below? A number line going from negative 3 to positive 2. There are 4 equal spaces between each number. A point is halfway between negative 3 and negative 2. A point is between the second and third mark between negative 2 and negative 1. A point is on the mark 1 space to the right of 0. A point is halfway between 1 and 2. Negative 2.5, 1 and three-fourths, 50 percent, 1.5 Negative 2.5, negative 1 and one-third, 50 percent, 1.5 Negative 2.5, negative 1 and three-fourths, 25 percent, 1.5 Negative 2.5, negative 1 and one-third, 25 percent, 1.5
Answer:
It is A The first one
Step-by-step explanation:
Negative 2.5, 1 and three-fourths, 50 percent, 1.5
Pls Mark Brainliest
Answer:
d
Step-by-step explanation:
I need some help with this question immediately!! Find the circumcenter through the given vertices x(3,-6) y(5,-3) z(8,-6) I need help graphing the triangle and finding the points.
The figure below represents the present problem:
After we draw the three given points and connect them, we have a triangle.
Then, we pick the middle point of each side, and we draw a line that goes from there until the opposite vertice. Once we do it for the three sides, we will find a position right in the center where these lines cross each other.
This is the circumcenter of the triangle.
From the drawing you sent, we have the following correction:
a) Suppose we were not sure if the distribution of a population was normal. In which of the following circumstances would we NOT be safe using a t procedure?
A. A histogram of the data shows moderate skewness.
B. The mean and median of the data are nearly equal.
C. A stemplot of the data has a large outlier.
D. The sample standard deviation is large.
(b) Which of the following is an example of a matched pairs design?
A. A teacher compares the pre-test and post-test scores of students.
B. A teacher calculates the average scores of students on a pair of tests and wishes to see if this average is larger than 80%.
C. A teacher compares the scores of students using a computer based method of instruction with scores of other students using a traditional method of instruction.
D. A teacher compares the scores of students in her class on a standardized test with the national average score.
(c) You are thinking of using a t procedure to test hypotheses about the mean of a population using a significance level of 0.05. You suspect the distribution of the population is not normal and may be moderately skewed. Which of the following statements is correct?
A. You may use the t procedure, but you should probably only claim the significance level is 0.10.
B. You may not use the t procedure. t procedures are robust to nonnormality for confidence intervals but not for tests of hypotheses.
C. You may use the t procedure, provided your sample size is large, say at least fifty.
D. You should not use the t procedure because the population does not have a normal distribution.
1. Answer: C) stemplot with a large outlier
The large outlier will skew the data to make it nonnormal. A moderate skew isn't as bad as a large one, so choice A is a fairly safer choice to go with in terms of using the T procedure. The size of the standard deviation does not affect the normality of the distribution.
============================================
2. Answer: A) Teacher comparing pre-test and post-test results
A matched pairs design is basically a before and after sort of thing, most of the time anyway. Each person's pre-test score is paired up with their post-test score to see if any significant improvement has been made. This is also known as a paired T test
============================================
3. Answer: C) You may use the t procedure, provided your sample size is large, say at least fifty.
Some textbooks say n > 30 is sufficient. It will depend on the textbook and your teacher of course. The idea is that if n is large enough, then by the CLT (central limit theorem), the distribution of sample means will be approximately normal, which allows you to use the T procedure and T distribution even if the underlying distribution may not be normal and/or skewed.
Will give brainliest!
Answer:
9: 71 , 10: 110, 11: 52
Step-by-step explanation:
the sum of angles in a triangel is 180°
so for 9:
180 = 78 + 31 + x
180 - 78 - 31 = x = 71
it's a sharp triangel because all angles are smaller than 90°
you can calculate the angles of 10 and 11 the same way
which gives 10: 110°
this is a stump triangel because there s an angle greater than 90°
The last one is a right triangel because it has a 90° angle (marked with the square)
What is the measure of angle ACB?
Answer: 48
Step-by-step explanation:
Real world problems are often presented as a word problems, what has worked for you In the past when you have done word problems
After answering the given query, we can state that To hone your abilities unitary method and develop as a word problem solver, practice handling various kinds of word problems.
What is unitary method ?The unit strategy is a method of problem-solving where you first calculate the value of just one unit, then multiply that value to get the answer. Simply stated, an individual value is extracted from an inputted multiple using the unit method. For instance, 40 pencils would set you back 400 rupees, or $1.01. The method used to accomplish this might be uniform. a solitary nation. anything with a distinctive component. (Mathematics, Algebra) Its adjoint or reciprocal are identical. (Linear Algebra, Mathematical Evaluation, Mathematics of Matrix or Operators)
Read the issue carefully: Make sure you comprehend the issue and the solution it seeks. Draw attention to or highlight crucial details that will aid in problem-solving.
Determine the variables: Determine the problem's unclear factors and give them variables or symbols.
Create formulae or inequalities to represent the issue: Create an equation or imbalance that illustrates the issue using the information you've marked.
Fix the discrepancy or equation: Apply algebraic methods to find the undetermined factors' values.
Verify your response: Make sure the context of the issue fits your answer.
To hone your abilities and develop as a word problem solver, practice handling various kinds of word problems.
To know more about unitary method visit:
https://brainly.com/question/28276953
#SPJ1
2x2 – 8x = 10
Complete the square
Answer:
this equation has no solution
Step-by-step explanation:
Zayn and Attia are thinking of a number each. What is Attia's number? My number is greater than 2. 12 and 20 are multiples of my number. My number is the 11th multiple of Zayn's number.
Answer:
Me: 60
Zayn and Attia: 6
Step-by-step explanation:
12 = 2 × 2 × 3
20 = 2 × 2 × 5
LCM of 12 and 20 = 2 × 2 × 3 × 5 = 60
My number is 60.
Zayn's and Attia's numbers are 6.
Wich measurement is closest to the cone in cubic feet?
We have that the diameter of the base of the cone measures 8 ft, then the radius is r=4. Now we can find the volume using the general formula:
\(\begin{gathered} V=\pi\cdot r^2\cdot\frac{h}{3} \\ \pi=3.1416 \\ r=4 \\ h=9 \\ \Rightarrow V=(3.1416)(4)^2(\frac{9}{3})=(3.1416)(16)(3)=48\cdot(3.1416)=150.8 \\ V=150.8ft^3 \end{gathered}\)therefore, the volume of the cone is v=150.8ft³
the ratio of a and b is 2:3. ten year later,their ages will be in the ratio of 4:5. what will be b's age after 5 year?
Answer:
soln,
let the given ratio be 2x and 3x.
the ratio after 10 yrs will be (2x+10) & (3x+10)
according to the question,
2x+10/3x+10 = 4/5
now do cross multiply & you will get your answer
Answer:
20 years
Step-by-step explanation:
The ratio of ages = 2 : 3 = 2x : 3x ( x is a multiplier )
After 10 years their ages will be
2x + 10 : 3x + 10 = 4 : 5
Express the ratio in fractional form
\(\frac{2x+10}{3x+10}\) = \(\frac{4}{5}\) ( cross- multiply )
4(3x + 10) = 5(2x + 10) ← distribute parenthesis on both sides )
12x + 40 = 10x + 50 ( subtract 10x from both sides )
2x + 40 = 50 ( subtract 40 from both sides )
2x = 10 ( divide both sides by 2 )
x = 5
Thus b's age = 3x = 3 × 5 = 15
So in 5 years b will be 15 + 5 = 20
A letter is randomly chosen from the word bell and another letter is chosen randomly from the word beep. How do I draw a tree diagram for this
To draw a tree diagram for randomly choosing a letter from the word "bell" and another letter from the word "beep," follow these steps:
Step 1: Start by drawing a horizontal line. This line represents the first letter selection.
Step 2: Label the branches of the first letter selection with the letters from the word "bell": b, e, l, and l. Each branch represents one of these letters being selected.
Step 3: Extend each branch from Step 2 by drawing vertical lines. These lines represent the second letter selection.
Step 4: Label the branches of the second letter selection with the letters from the word "beep": b, e, e, and p. Each branch represents one of these letters being selected.
Step 5: Connect each branch of the first letter selection (from Step 2) to the corresponding branches of the second letter selection (from Step 4). This creates the complete tree diagram.
Thus, this way, one can create tree diagram.
For more details regarding tree diagram, visit:
https://brainly.com/question/13311154
#SPJ1
Please help me on this
Answer: Not gonna spoon feed but the ratio is -3
6 * -3 = -18
-18 * -3 = 54
u should be able to get t4, t5 and t6 now by urself
4. Randi was driving on a concrete road. A deer ran into her lane, causing Randi
to slam on her brakes. Her tires left skid marks an average of 94 feet long.
The road has a drag factor of .92 and her brakes were 80% efficient. What
was Randi's speed when she pressed on the brakes?
Randi's speed when she pressed on the brakes was approximately 129.26 feet per second.
How to find Randi's speed when she pressed on the brakesTo calculate Randi's speed when she pressed on the brakes, we can use the following formula:
Speed = (Skid Mark Length / Drag Factor) * Square Root(2 * Efficiency)
Given information:
- Skid Mark Length = 94 feet
- Drag Factor = 0.92
- Efficiency = 80% = 0.8
Let's substitute these values into the formula to find Randi's speed:
Speed = (94 / 0.92) * √(2 * 0.8)
≈ 102.17 * √(1.6)
≈ 102.17 * 1.2649
≈ 129.26 feet per second
Therefore, Randi's speed when she pressed on the brakes was approximately 129.26 feet per second.
learn more about speed at https://brainly.com/question/27888149
#SPJ1
I need to solve the equation to get x, can someone please help:(