Which of the following will oxygen react with to cause combustion?
O A. A hydrocarbon
O B. Heat
O C. Carbon dioxide
O D. Water
HELP

The statement "Does mass affect how far a ball rolls?" is not a testable question as mass doesn't affect the speed directly.

When a solid object, like a stone, has an irregular shape, its volume can be determined by two methods. Measuring cylinder can be used as one method while using an overflow jar is another method.

Displacement of water or other liquids in a measuring cylinder determines the volume of irregular solid things that are heavier or lighter than water, including those that are soluble in water.

Milk chocolate takes longer to melt than dark chocolate.

Because dark chocolate has less fat than milk chocolate. Dark chocolate melts more quickly because the cocoa butter in it is crushed more finely.

More milk solids are found in milk chocolate, which raises the chocolate's melting point and increases its resistance to melting.

The researchers found that herbivorous or omnivorous species that were more than 10-100 kilometers (6-60 miles) from the ocean preferred salt over sugar.

They found out that the farther inland, the greater the preference for salt, by simply counting the ant species attracted to cotton balls soaked in sucrose (table sugar) or salt solutions.

While carnivorous ants showed little preference for salt over sugar, those that lived primarily on green plants showed a larger preference for salt than those that lived among the decomposing leaves of the forest floor.

Thus, all the other statements are testable except "Does mass affect how far a ball rolls?" as mass doesn't affect the speed directly, and hence we can't test it by a simple ball rolling experiment.

Learn more about mass:

https://brainly.com/question/19385703

#SPJ9

Answer:

unconsolidated material that contains nutrient matter and weathered rock

Explanation:

Earth's crust is made up of many layers. The top is soil, which provides the most nutrients for plants, like hummus( The organic nutrient for soil, form from the decaying of plants and animals)

The soil gets its texture from the bedrock, the bottom layer, which weathers, and goes into the soil.

-kiniwih426

when a beaker of water is heated with a yellow burner flame ;

Yellow burner flames are caused by incomplete combustion of gas and the incomplete combustion results to the presence of soot in the flame. yellow flame produces less heat energy than blue burner flames.

While when a blue burner flame is used to heat a water contained in a beaker the water gets heat up faster and the beaker remains clean ( void of soot deposits ).

Hence we can conclude that when a beaker of water is heated with a yellow burner flame the soot from the flame will be deposited on the outside of the beaker and it will take longer time to heat up the water.

Learn more : https://brainly.com/question/14624172

Explanation:

Transition of n 3→2 6→2

Name -H-α / Ba-α- H-δ- / Ba-δ

Wavelength (nm, air) -656.279 -410.1734

Energy difference (eV)- 1.89 -3.03

Color- Red -Violet

please Mark as brainliest and follow

Answer:

The chart is called the Periodic Table.

Hope this helps :)

\(pH=-\log[H^{+}]\\\\\implies [H^{+}] =10^{-pH}=10^{-2.47}=0.0034~M\)

The energy of combustion for one mole of butane to be approximately 2888.81 kJ/mol.

To calculate the energy of combustion for one mole of butane (C4H10), we need to use the information provided and apply the principle of calorimetry.

First, we need to convert the mass of the butane sample from grams to moles. The molar mass of butane (C4H10) can be calculated as follows:

C: 12.01 g/mol

H: 1.01 g/mol

Molar mass of C4H10 = (12.01 * 4) + (1.01 * 10) = 58.12 g/mol

Next, we calculate the moles of butane in the sample:

moles of butane = mass of butane sample / molar mass of butane

moles of butane = 0.367 g / 58.12 g/mol ≈ 0.00631 mol

Now, we can calculate the heat released by the combustion of the butane sample using the equation:

q = C * ΔT

where q is the heat released, C is the heat capacity of the calorimeter, and ΔT is the change in temperature.

Given that the heat capacity of the bomb calorimeter is 2.36 kJ/°C and the change in temperature is 7.73 °C, we can substitute these values into the equation:

q = (2.36 kJ/°C) * 7.73 °C = 18.2078 kJ

Since the heat released by the combustion of the butane sample is equal to the heat absorbed by the calorimeter, we can equate this value to the energy of combustion for one mole of butane.

Energy of combustion for one mole of butane = q / moles of butane

Energy of combustion for one mole of butane = 18.2078 kJ / 0.00631 mol ≈ 2888.81 kJ/mol

Therefore, the energy of combustion for one mole of butane is approximately 2888.81 kJ/mol.

In conclusion, by applying the principles of calorimetry and using the given data, we have calculated the energy of combustion for one mole of butane to be approximately 2888.81 kJ/mol.

For more questions on molar mass, click on:

https://brainly.com/question/837939

#SPJ8

Answer:

The answer is 1.63 × 1024 atoms Fe

Explanation:

The statement, that describes the atoms of Iron is "4.215 × \(10^{23}\) atoms."

The fundamental building block of chemistry is the atom. It is the smallest ordinary matter unit that makes up a chemical element.

The number of atoms in a volume of any substance is given by No of atoms = N * (density) * volume / (Molecular Weight).

N is an Avogadro's number constant equal to 6.022 ×\(10^{23}\) atoms/mole.

1 mole of Fe will be of 6.022 × \(10^{23}\) atoms

Then,= 0.70 mol × 6.022 × \(10^{23}\) atoms  = 4.215 ×\(10^{23}\) atoms

As a result, 0.70 mol of iron contains 4.215 × \(10^{23}\) atoms.

Hence, the correct option is 4.215 × \(10^{23}\)atoms.

Learn more about atoms here

https://brainly.com/question/1566330

#SPJ2

Answer:

Explanation:

Limiting is HCl and excess is Ca(OH)2

excess is 296 grams Ca(OH)2

2 moles H2O will be formed

Answer:

Medio, por otra parte, es lo que se halla en una posición central o entre dos puntas,

Explanation:

El término medio, en una de sus acepciones más comunes, representa la mitad de una cosa

The calculated formula masses to 133.5 amu, we find that the substance with a formula mass closest to 133.5 amu is (d) AlCl3. Therefore, the answer is option D.

To identify the substance with a formula mass of 133.5 amu, we need to calculate the formula mass of each given substance and compare it to 133.5 amu.

(a) MgCl2:

The formula mass of MgCl2 can be calculated by adding the atomic masses of magnesium (Mg) and chlorine (Cl).

Mg: atomic mass = 24.31 amu

Cl: atomic mass = 35.45 amu

Formula mass of MgCl2 = (24.31 amu) + 2(35.45 amu) = 95.21 amu

(b) SCl:

The formula mass of SCl can be calculated by adding the atomic masses of sulfur (S) and chlorine (Cl).

S: atomic mass = 32.07 amu

Cl: atomic mass = 35.45 amu

Formula mass of SCl = 32.07 amu + 35.45 amu = 67.52 amu

(c) BCl:

The formula mass of BCl can be calculated by adding the atomic mass of boron (B) and chlorine (Cl).

B: atomic mass = 10.81 amu

Cl: atomic mass = 35.45 amu

Formula mass of BCl = 10.81 amu + 35.45 amu = 46.26 amu

(d) AlCl3:

The formula mass of AlCl3 can be calculated by adding the atomic mass of aluminum (Al) and 3 times the atomic mass of chlorine (Cl).

Al: atomic mass = 26.98 amu

Cl: atomic mass = 35.45 amu

Formula mass of AlCl3 = 26.98 amu + 3(35.45 amu) = 133.78 amu. Option D

For more such questions on masses visit:

https://brainly.com/question/24191825

#SPJ8

The micromorphology is a process  we are going to use to find an organisms in that dirt sample.

Micromorphology is defined as the fine level structure or morphology of an organism, mineral, soil and dirt component visible through microscope.

It is the microscopic study of soil, dirt and sediments.

It is a branch of soil science that is concerned with the description, interpretation and to a increasing extant the measurement of components,  features and fabrics in soil or dirt at microscopic level.

Thus, the micromorphology  is a process  we are going to use to find an organisms in that dirt sample.

To learn more about morphology, refer to the link below:

https://brainly.com/question/23673404

#SPJ1

Answer:

A

Explanation:

An element is a substance, made up of atoms of the same substance and has independent existence. An element cannot be broken up by physical or chemical processes.

If we look at the images closely, image A represents a substance made up of the same kind of atoms. All the balls are exactly of the same colour and type, hence the answer.

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

\(\Delta H=-29.7kJ\)

Explanation:

Hello!

In this case, since the undergoing chemical reaction is:

\(N_2+3H_2\rightarrow 2NH_3\)

We first need to identify the limiting reactant given the masses of nitrogen and hydrogen:

\(n_{NH_3}^{by\ H_2}=1.96gH_2*\frac{1molH_2}{2.02gH_2}*\frac{2molNH_3}{3molH_2}=0.647molNH_3\\\\ n_{NH_3}^{by\ N_2}=9.51gN_2*\frac{1molN_2}{28.02gN_2}*\frac{2molNH_3}{1molN_2}=0.679molNH_3\)

It means that only 0.647 moles of ammonia are yielded, so the resulting enthalpy change is:

\(\Delta H=0.647molNH_3*\frac{-45.9kJ}{1molNH_3}\\\\ \Delta H=-29.7kJ\)

Best regards!

Pour water and put near sunlight :)

Answer:

                                                                2CO(g) + O2(g) ⇌ 2CO2(g)

Increasing the concentration of CO -         ↓         ↓                 ↑

Increasing the concentration of CO2 -       ↑         ↑                 ↓

Explanation:

The given reaction is

2CO(g) + O2(g) ⇌ 2CO2(g)

a) When the concentration of CO is increased, the stress is relieved as the reaction that consumes the added CO occurs more rapidly than its reverse reaction, for example., the forward reaction rate increases. The equilibrium will shift in favor of the product. However, the concentration of reactants (CO and O2) decreases and product concentration (CO2) increases.

b) When the concentration of CO2 is increased, the stress is relieved as the reaction that consumes the added CO2 occurs more rapidly than its reverse reaction, for example., the rate of backward reaction increases. The equilibrium will shift in favor of the reactant. Therefore, the concentration of reactants (CO and O2) increases, and the product concentration (CO2) decreases.

Hope this helps!

The new volume of the balloon after heating it to a temperature of 51 °C is approximately 2.39 L.

Charles's law states that "the volume occupied by a definite quantity of gas is directly proportional to its absolute temperature.

It is expressed as;

\(\frac{V_1}{T_1} =\frac{V_2}{T_2}\)

Given that:

Substituting the given values and solve for V₂:

\(V_1T_2 = V_2T_1\\\\V_2 = \frac{V_1T_2}{T_1} \\\\V_2 = \frac{2.2\ *\ 324.15}{298.15 }\\ \\V_2 = 2.39 \ L\)

Therefore, the final volume is 2.39 litres.

Learn more about Charles's law here: https://brainly.com/question/23122443

#SPJ1

We need 147.5 ml of 10% CuSO4 solution and 33.6 ml of 20% NaOH solution to obtain 10 g of Cu(OH)2.

To obtain 10 g of Cu(OH)2, we need to start by writing the balanced chemical equation for the reaction between copper sulphate (CuSO4) and sodium hydroxide (NaOH):

CuSO4 + 2NaOH -> Cu(OH)2 + Na2SO4

From the balanced equation, we can see that one mole of CuSO4 reacts with two moles of NaOH to produce one mole of Cu(OH)2 and one mole of Na2SO4.

The molar mass of Cu(OH)2 is 97.56 g/mol. Therefore, we need 10 g / 97.56 g/mol = 0.1024 mol of Cu(OH)2.

To determine how much CuSO4 solution and NaOH solution we need, we can use the following equations:

Amount of CuSO4 required = 0.1024 mol x (159.61 g/mol) / 0.1 = 163.38 g

Amount of NaOH required = 0.2048 mol x (40.00 g/mol) / 0.2 = 40.96 g

Where the first equation is using the molar mass of CuSO4 and the density of the solution to determine the required volume. The same idea is used in the second equation but with NaOH.

Using the density of the solutions, we can convert the required mass to volume:

Volume of CuSO4 solution = 163.38 g / 1.107 g/ml = 147.5 ml

Volume of NaOH solution = 40.96 g / 1.219 g/ml = 33.6 ml

Therefore, we need 147.5 ml of 10% CuSO4 solution and 33.6 ml of 20% NaOH solution to obtain 10 g of Cu(OH)2.

For such more questions on solution

https://brainly.com/question/25326161

#SPJ11

Answer:

The concentration of an acid in a solution can be determined by making an acid-base titration. To do this, a known volume of the acid solution is gradually added alkali solution whose concentration is known, until a neutral pH is reached.

Explanation:

Answer:

c

Explanation:

Answer:

We can use the ideal gas law, PV = nRT, to solve for the density at STP (standard temperature and pressure). At STP, the temperature is 273.15 K and the pressure is 1 atm. We know the molar mass of NO2 is 46.01 g/mol. We also know that 1 mole of any gas at STP occupies a volume of 22.4 L.

First, we can calculate the number of moles of NO2 at STP:

n = PV/RT = (1 atm)(22.4 L)/(0.08206 L·atm/mol·K)(273.15 K) = 1.00 mol

Next, we can calculate the mass of 1 mole of NO2:

46.01 g/mol

Finally, we can calculate the density of NO2 at STP:

density = mass/volume = (46.01 g/mol)/(22.4 L) = 2.054 g/L

Therefore, the density at STP of NO2 gas (molar mass = 46.01 g/mol) in grams per liter is 2.054 g/L.

Explanation:

Answer:

\(8.314\ \text{m}^3\text{Pa/mol K}\)

Explanation:

Let us find the unit of the gas constant R from the ideal gas equation. We substitute the units of the quantities rearrange them and get the units of the gas constant.

P = Pressure = Pa

V = Volume = \(\text{m}^3\)

n = Moles = mol

T = Temperature = K

\(PV=nRT\\\Rightarrow R=\dfrac{PV}{nT}\\\Rightarrow R=\dfrac{\text{Pa m}^3}{\text{mol K}}\)

Here, \(\text{Pa}\) is used so the gas constant value that must be used is \(8.314\ \text{m}^3\text{Pa/mol K}\).

A rainbow is produced through a proces that includes refraction, reflection, and dispersion of  sunlight.

A rainbow is formed when sulinght is refracted and reflected by rain drops in the atmospher.

The sunlight is split into its component colors, which is why rainbows appear as having an array of colors. This is due to each color being bent by a different amount during refraction.

The colors of a rainbow are always in the same order, with red on the outside and violet on the inside.

Find more exercises on rainbows;

https://brainly.com/question/7965811

#SPJ1

The ideal gas law equation is: PV = nRT, where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature.

To determine the mass of NaCl that reacted with F2 at 290 K and 1.5 atm, we can rearrange the equation as follows: n = PV/RT. Substituting in the values for P, V, R, and T, we get: n = (1.5 atm)(18.0 L)/(0.0821 atm*L/mol*K)(290 K) = 0.835 mol NaCl.

To determine the mass of sodium chloride that can react with the same volume of fluorine gas at STP (standard temperature and pressure), we would use the same equation but with the values for P, V, R, and T corresponding to STP. At STP, P = 0.987 atm, V = 18 L, R = 0.0821 atm*L/mol*K, and T = 273 K. Therefore, n = (0.987 atm)(18 L)/(0.0821 atm*L/mol*K)(273 K) = 0.792 mol NaCl.

What is Sodium chloride?

Sodium chloride, also known as table salt, is an ionic compound composed of sodium and chloride ions in equal proportions. It is a mineral found naturally in most bodies of water, including sea water, and is widely used as a seasoning and preservative in food.

To know more about sodium chloride,

https://brainly.com/question/28106660

#SPJ1

Answer:

The ideal gas law equation is: PV = nRT, where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature.

To determine the mass of NaCl that reacted with F2 at 290 K and 1.5 atm, we can rearrange the equation as follows: n = PV/RT. Substituting in the values for P, V, R, and T, we get: n = (1.5 atm)(18.0 L)/(0.0821 atm*L/mol*K)(290 K) = 0.835 mol NaCl.

To determine the mass of sodium chloride that can react with the same volume of fluorine gas at STP (standard temperature and pressure), we would use the same equation but with the values for P, V, R, and T corresponding to STP. At STP, P = 0.987 atm, V = 18 L, R = 0.0821 atm*L/mol*K, and T = 273 K. Therefore, n = (0.987 atm)(18 L)/(0.0821 atm*L/mol*K)(273 K) = 0.792 mol NaCl.

Explanation:

Answer

0.975609756 mol

Explanation

Given:

Pressure, P = 6 atm

Volume, V = 4 L

Temperature, T = 300 K

Molar gas constant, R = 0.082

What to find:

The moles, n present.

Step-by-step solution:

The mole, n present can be calculated using the ideal gas equation, PV = nRT

6 x 4 = n x 0.082 x 300

24 = 24.6n

Diivide both sides by 24.6

24/24.6 = 24.6n/24.6

n = 0.975609756 mol

Hence, the moles that are present = 0.975609756 mol

Answer:

About 14.45 seconds

Explanation:

If a object is going 4.5m/s and its destination is 65m then you need to divide.

65÷4.5 = 14.444444

due to the constant 4 you need to round 14.444 so it would be 14.45 seconds.

Answer:

Solids cant react to each other because they are the same room temperature

Answer:

A is the correct answer.

Explanation:

A mixture of solids is the correct answer.