Answer: C i believe
Explanation: Common sense
A metallurgist begins with 1250 grams of vanadium (pb5(vo4)3cl) and ends up with 135 g of pure vanadium and 950 g of pure lead. The percent composition of vanadium in the ore is
Answer: 1.) 10.8 and 2.)73.2
Explanation: Really hope this helps you
How does an electric generator work?
Answer:
A conductor coil (a copper coil tightly wound onto a metal core) is rotated rapidly between the poles of a horseshoe type magnet. ... The magnetic field will interfere with the electrons in the conductor to induce a flow of electric current inside it.
if two substance are moving with same speed ?why chromatography is not suitable?
It is included in it's purpose or function that it will move the components at different speeds. The dyes which cover slowly. ... if two substances have similar chemical or physical properties they will behave the same as they travel through the medium and thus will not be separated.
Explanation:
HOPE ITS HELP
AND MARK ME AS BRAINLIST PLEASE ;)
The problem is the relationship between speed and surface area
slower the speed higher the surface areaAs they are moving with same speed they would have same surface area also same physical and chemical properties
This can't be separated by chromatography
What type of solution would you have if you have a sealed container with 100g of water and 0.15g of dissolved CO2 at 40°C?
What relationship exists between distance and the strength of the electric reading?
Answer:
The strength of an electric field as created by source charge Q is inversely related to square of the distance from the source. This is known as an inverse square law. Electric field strength is location dependent, and its magnitude decreases as the distance from a location to the source increases.
Explanation:
Question 1
Which of the following is a false
Answer:
1.A 2.C 3.B
4. d
Explanation:
When naming an acid, which of the following is true?
chlorite changes to chloric acid
chlorate changes to chloric acid
none of these is true
chlorate changes to chlorous acid
Answer:
chlorate changes to chlorous acid
the concentration of pb21 in a solution saturated with pbbr2(s) is 2.14 3 1022 m. calculate ksp for pbbr2.
The Ksp of PbBr2 is effectively zero, which indicates that it is an extremely insoluble salt.
The solubility product constant (Ksp) is the product of the concentrations of the ions in a saturated solution, each raised to the power of their stoichiometric coefficient. For the reaction:
PbBr2(s) ⇌ Pb2+(aq) + 2Br-(aq)
The Ksp expression is: Ksp = [Pb2+][Br-]^2
We are given the concentration of Pb2+ in the saturated solution, which is 2.14 × 10^-22 M. However, we need to determine the concentration of Br-.
Since PbBr2 is a sparingly soluble salt, we can assume that the amount of PbBr2 that dissolves is small compared to its initial amount, so we can assume that the concentration of Pb2+ that comes from the dissociation of PbBr2 is negligible compared to the initial amount of PbBr2. Therefore, we can assume that [Pb2+] ≈ 0 and [Br-] ≈ 2[S] (where S is the solubility of PbBr2).
Substituting this into the Ksp expression, we get:
Ksp = [Pb2+][Br-]^2
≈ 0 × (2[S])^2
= 0
This means that the Ksp of PbBr2 is effectively zero, which indicates that it is an extremely insoluble salt.
For more such questions on insoluble salt
https://brainly.com/question/29751738
#SPJ11
please help me
16 1 point What is the decay rate of a sample of Oxygen-21 if the sample has 8.31x1017 atoms and a decay constant of 0.203/s? 4.09x1018Bq 1.69x10¹7Bq 0.203Bq 2.44x10-1⁹Bq Previous
decay rate of approximately 1.69x10^17 Bq (becquerels),
The decay rate of a radioactive sample is determined by the number of radioactive atoms present and the decay constant, which represents the probability of decay per unit of time.
To calculate the decay rate, we multiply the number of atoms in the sample by the decay constant. In this case, the sample has 8.31x10^17 atoms and a decay constant of 0.203/s. Multiplying these values gives a decay rate of approximately 1.69x10^17 Bq (becquerels), which represents the number of decays per second in the sample.
Learn more about Oxygen here : brainly.com/question/13905823
#SPJ11
Which of the elements shown has an atomic mass of 20 amu?
A) A
B) B
C) C
D) D
The elements shown have an atomic mass of 20 amu is Neon.
What is atomic mass?
The atomic number of an atom is its total number of protons and neutrons.
Neon has an atomic mass of about 20 this isotope contains 10 protons and 10 neutrons.
Actually, Neon would be listed as having an atomic mass of about 20.18 because of a mixture of isotopes.
Z= Atomic number the number of protons in the nucleus which defines the element.
In this case, Z=10 and this means neon but there are also 10 neurons in the nucleus of the major isotope which gives it 20Ne.
Hence, option D is the correct answer.
Learn more about the atomic mass here:
https://brainly.com/question/11673503
#SPJ2
Which agreement resulted from the informal compromise of 1877 between southern democrats and northern republicans?.
The informal compromise of 1877 between southern Democrats and northern Republicans resulted in the Compromise of 1877, which ended the disputed 1876 presidential election between Rutherford B. Hayes (Republican) and Samuel J. Tilden (Democrat).
As part of the agreement, the Democrats agreed to recognize Hayes as the winner in exchange for the removal of federal troops from the South and the appointment of a Southern Democrat to the president's cabinet. This effectively ended Reconstruction and led to the rise of Jim Crow laws and segregation in the South.
The agreement resulting from the informal Compromise of 1877 between Southern Democrats and Northern Republicans is known as the "End of Reconstruction." This compromise led to the removal of federal troops from the Southern states, allowing Democrats to regain control of the region and effectively ending the Reconstruction era following the American Civil War.
To know more about democrats visit:
https://brainly.com/question/14320124
#SPJ11
a sample of helium gas initially at 37.0 c, 785 torr, and 2 l was heated to 58.0c while the volume expanded to 3.24 l what is the final pressure in atm
Sample of helium gas initially at 37.0 c, 785 torr and 2 l was heated to 58.0c while the volume expanded to 3.24 l .The final pressure of the helium gas is 8.66 atm.
What is helium ?
Helium is a chemical element with the symbol He and atomic number 2. It is the second lightest and second most abundant element in the universe. Helium is a colourless, odourless, tasteless, non-toxic, inert monatomic gas. It is the most common element in the universe, making up about 24% of its mass.
The ideal gas law can be used to solve this problem. The ideal gas law states that PV = nRT, where P is the pressure, V is the volume, n is the number of moles of the gas, R is the ideal gas constant, and T is the temperature.We can rearrange the equation to P = (nRT)/V.
We know the values of n, R, V, and T. n is 1 mol of helium, R is 0.0821 atm∙L/mol∙K, V is 3.24 L, and T is 58.0 °C, which is equal to 331.15 K.
Plugging these values into the equation, we get:
P = \((1 mol*0.0821 atm∙L/mol∙K*331.15 K)/3.24 L = 8.66 atm\)
To learn more about helium
https://brainly.com/question/29392730
#SPJ4
vious 5 v
5
Heat and Temperature: Mastery Test
Select the correct answer.
An iron bar at 200°C is placed in thermal contact with an identical iron bar at 120°C in an isolated system. After
If the iron bars were placed in thermal contact in an open system instead of an isolated system, how would the
room temperature is 25°C.
OA. The temperatures of the iron bars after 30 minutes would be less than 160°C because heat would
OB. It would take more than 30 minutes for both iron bars to reach 160°C because heat would be trans
OC. The temperatures of both iron bars would increase as they absorb heat from the surroundings.
OD. The temperatures of both iron bars would decrease because pieces of them would be lost to the Su
If the iron bars were placed in thermal contact in an open system instead of an isolated system, it would be: C. The temperatures of both iron bars would increase as they absorb heat from the surroundings.
What is the Heat and TemperatureIn a system that is open, heat can be transferred between the system and its surroundings. In this situation, the room is at a temperature of 25°C, which is colder than the iron bars.
The room is colder than the iron bars, so heat will move from the room into the bars and make them hotter. So, both iron bars would get hotter as they take in heat from their surroundings.
Read more about isolated system here:
https://brainly.com/question/31333650
#SPJ1
if ka is 1.85 x 10^-5 for acetic acid, calculate the ph at one half the equivalnce point and at the quivalence point for a tiration of 50 ml of 0.1 m acetic acid with 0.1 m naoh
The value of Ka for acetic acid is 1.85 × 10-5.
The given solution is titrated using a 0.1 M solution of NaOH. 50 mL of 0.1 M acetic acid is titrated by 0.1 M NaOH.
We can use the Henderson-Hasselbalch equation to calculate the pH at any point in the titration of a weak acid with a strong base.
PH of acetic acid solution
= -log[H3O+]Ka = [H3O+][CH3COO-]/[CH3COOH]pKa = -logKa
At the half-equivalence point
Half equivalence point
(pKa - pH = 0.5)PH = pKa + log([A-]/[HA])pH = pKa + log(1)
because
[A-] = [HA]pH = pKa + 0.5pH = 4.74 + 0.5pH = 5.24
At the equivalence point
The number of moles of NaOH is equal to the number of moles of acetic acid
50 mL of 0.1 M acetic acid contains 0.005 moles of acetic acid.NaOH is added to the solution until the number of moles of NaOH is equal to the number of moles of acetic acid.
0.005 moles of NaOH is equal to 0.005 moles of acetic acid.
Then,
[CH3COOH] = 0.005/0.05 = 0.1 M[OH-] = 0.1 M and the pH of the solution is 14 - pOH = 13pOH = -log([OH-]) = -log(0.1) = 1pH + pOH = 14pH = 14 - pOH = 13
learn more about PH here
https://brainly.com/question/172153
#SPJ11
what does a proton and neutron have in common
Answer:Both protons and neutrons have a mass of 1
Explanation:
Answer:
Protons and neutrons are both subatomic particles, which means they are both components of atoms. Protons and neutrons are found in the nucleus of an atom. They both have mass of 1 amu.
Explanation:
the starting materials of dibenzalacetone synthesis are all colorless and turns to a clear yellow solution as it is mixed. which situation would have caused the clear yellow solution to remain as is at the end of 30 minutes?
The situation which would have caused the clear yellow solution to remain as is in dibenzalacetone synthesis at the end of 30 minutes can be due to Insufficient reactants, Inappropriate reaction conditions and Inhibition of the reaction.
The starting materials of dibenzalacetone synthesis are all colorless and turn into a clear yellow solution as they are mixed. The situation that would have caused the clear yellow solution to remain as is at the end of 30 minutes is the reaction having gone to completion. The formation of dibenzalacetone involves the aldol condensation of two moles of benzaldehyde with one mole of acetone.
The reaction is carried out in the presence of a base such as NaOH, which removes the acidic alpha-hydrogens of benzaldehyde and acetone to form the enolate ions. These ions are then condensed to form dibenzalacetone. In a successful reaction, the clear yellow solution will eventually become cloudy as dibenzalacetone forms as a solid precipitate. This can occur if not all of the starting materials were properly mixed or if the reaction did not proceed to completion due to factors such as insufficient heating or the presence of impurities.
Insufficient reactants: If there are not enough starting materials present, the reaction may not proceed to completion, and the yellow solution will not change. Inappropriate reaction conditions: Factors such as temperature, solvent, or pH could affect the reaction. If any of these factors are not optimal, the reaction may not proceed efficiently, leading to an unchanged yellow solution.
Inhibition of the reaction: The presence of any impurities or contaminants in the starting materials or the reaction mixture could potentially inhibit the reaction, causing the yellow solution to remain unchanged. To address these situations, ensure that you have the correct amounts of starting materials, follow the recommended reaction conditions, and work with clean and pure chemicals and equipment.
To know more about dibenzalacetone, refer here:
https://brainly.com/question/19340462#
#SPJ11
If the wastewater ph is raised to 10, what fraction of ammonium ion did not react to formammonia?
At a pH of 10, approximately 99% of the ammonium ion will have reacted to form ammonia, leaving 1% of the ammonium ion unreacted.
When wastewater pH is 10, ammonium ions can combine with hydroxide ions (OH-) to generate ammonia by the equilibrium reaction:
\(NH_4^+ + OH- NH_3 + H_2O\)
The equilibrium constant (K) determines the fraction of ammonium ions that did not react to generate ammonia. At pH 10, hydroxide ions outnumber ammonium ions, causing ammonia to form.
High hydroxide ion concentrations favour ammonia generation since the equilibrium constant equation for this reaction involves the concentration of products divided by the concentration of reactants. Thus, a considerable portion of ammonium ions would have formed ammonia.
Learn more about wastewater, here:
https://brainly.com/question/9637593
#SPJ4
Example #2: Ajet is traveling at 80 m/s when it starts to approach
a runway. It is able to land and park in 10 s. What is its
acceleration?
Answer:
-8 m/s^2
Explanation:
The formula for acceleration is:
a= v^2 - v^1/t
a= acceleration
v^2- final velocity which in this case would be 0 since the jet comes to a stop.
v^1= original velocity which is 80 m/s.
t=time or 10s
Substitute the letters for the numbers and you get this:
a= 0 - 80/10
0 - 80= -80
-80 divided by 10 is -8.
Hope this helps! :)
I need help with studying for my finals!!! Can somebody explain how to get the answer please :)
A sample of hydrogen gas is prepared by water displacement at a pressure of 760 torr and a temperature of 22C. If the vapor pressure of H2O at that temperature is 20 torr, what is the partial pressure of the hydrogen?
Answer:
This informative text, written in easily understood language, will allow those without a mechanical engineering background to understand air calculation and ventilation problems.
What are the two laws of conservation of energy?
Answer:
Explanation:
The law of conservation of energy states that energy can neither be created nor destroyed - only converted from one form of energy to another. This means that a system always has the same amount of energy, unless it's added from the outside. This is particularly confusing in the case of non-conservative forces, where energy is converted from mechanical energy into thermal energy, but the overall energy does remain the same. The only way to use energy is to transform energy from one form to another.
Answer:
The first law, also known as Law of Conservation of Energy, states that energy cannot be created or destroyed in an isolated system. The second law of thermodynamics states that the entropy of any isolated system always increases.
Explanation:
which of the following amines would be the most soluble in water?
(hint: consider hydrogen bonding)
a. N-ethylaniline
b. 1-propanamine
c. Propanediamine
d. N,N-dimethylpropanamine
e. N,N-diphenylaniline
Answer:
The correct answer is B. 1-propanamine.
Explanation:
Amines can form hydrogen bonds with water molecules, which makes them soluble in water. The more hydrogen bonding sites an amine has, the more soluble it will be in water.
Out of the given options, 1-propanamine has only one carbon chain, which allows it to form more hydrogen bonds with water molecules compared to amine molecules with longer carbon chains. Also, it does not have any other functional groups that could interfere with hydrogen bonding. Therefore, 1-propanamine would be the most soluble in water.
Further Explanation:A. N-ethylaniline - contains a nonpolar aromatic ring that can interfere with hydrogen bonding and reduce solubility in water.B. 1-propanamine - has only one carbon chain, allowing it to form more hydrogen bonds with water molecules.C. Propanediamine - has two amine groups that can form hydrogen bonds with water molecules, but it also has a longer carbon chain that can interfere with hydrogen bonding and reduce solubility in water.D. N,N-dimethylpropanamine - has two methyl groups that can interfere with hydrogen bonding and reduce solubility in water.E. N,N-diphenylaniline - contains two bulky aromatic rings that can interfere with hydrogen bonding and reduce solubility in water.Hope it helps!
Help me out here please???
Answer:
A
Explanation:
Answer:
B
Explanation:
In a chemical reaction, the number of each element should be equal on both the reactant and product side.
Green main bonding jumper screws that are furnished with residential type panels should be installed in ___.
Green main bonding jumper screws that are furnished with residential type panels should be installed in the service panel enclosure.
The main bonding jumper is a conductor that connects the noncurrent-carrying metal parts of the electrical system to the grounding electrode system. This connection helps to ensure that the electrical system is properly grounded and that any stray current will be safely directed to the ground.
The main bonding jumper should be installed in the service panel enclosure because this is the central point of the electrical system. All of the noncurrent-carrying metal parts of the electrical system, such as the service panel enclosure, the service entrance cable, and the branch circuit conductors, are connected to the service panel enclosure.
By connecting the main bonding jumper to the service panel enclosure, all of these noncurrent-carrying metal parts are also connected to the grounding electrode system.
The main bonding jumper should be a solid copper conductor with a minimum cross-sectional area of 6 AWG. It should be installed in a way that allows for easy access for inspection and maintenance.
To know more about service panel, refer here:
https://brainly.com/question/905462#
#SPJ11
how is bacteria on mars counted as life but a heartbeat on earth is not?
What happens when ocean water that is more dense (colder or saltier) is mixed with water that is less dense (warmer or less salty)?
please make it sound like i wrote it :(
When ocean water that is more dense (colder or saltier) is mixed with water that is less dense (warmer or less salty), the denser water will sink to the bottom and the less dense water will rise to the top. This is known as stratification, and it helps to create distinct layers in the ocean.
This stratification can create an environment that is more conducive to life, as it allows different types of organisms to inhabit different layers of the ocean.
The different layers of the ocean created by stratification play a significant role in the global climate system. Colder, denser waters are usually found at the bottom of the ocean, while warmer, less dense waters are found near the surface.
This temperature difference creates a natural convection system that drives currents throughout the ocean, which helps to regulate temperatures on a global scale. Additionally, stratification can also affect the amount of oxygen in the ocean.
Learn more about density of the ocean:
https://brainly.com/question/28819040
#SPJ4
A certain metal M forms a soluble sulfate salt M2SO4. Suppose the left half cell of a galvanic cell apparatus is filled with a 50.0mM solution of M2SO4 and the right half cell with a 5.00M solution of the same substance. Electrodes made of M are dipped into both solutions and a voltmeter is connected between them. The temperature of the apparatus is held constant at 20.0°C.
Which electrode will be positive?
Left
Right
Answer:
Right
Explanation:
The given parameters are;
The soluble sulfate formed by the metal, M = M₂SO₄
In the galvanic cell formed by the metal M, we have;
The concentration of M₂SO₄ in the left half cell = 50.0 mM = 0.05 M
The concentration of M₂SO₄ in the right half cell = 5.00 M
In the galvanic cell, the metal 'M' will be dissolved into the solution with lower concentration as M²⁺ which is the left half cell, making the cell negative and the solution more concentrated
In the right half cell, the metal 'M²⁺' in the solution will be plated unto the electrode making the solution less concentrated and the electrode in the right half cell will be the positive electrode
Therefore;
The electrode which will be positive is the electrode in the right half cell.
Convert from: 689 m =____mm*
(Metric Conversion chart)
A. 68,900 mm
B. 689,000 mm
C. 0.689 mm
D. 0.000689 mm
Answer:
b) 689,000mm
as 1m= 1000mm
Answer:
A
Explanation:
mark me brainlisted please
How many moles of NaF are contained in 258.6 mL of 0.0296 M NaF solution?
Answer:
Approximately 7.65
Explanation:
math.
skillz.
Q-3 Determine the fugacity in atm for pure ethane at 310 K and 20.4 atm and change in the chemical potential between this state and a second state od ethane where temperature is constant but pressure is 24 atm.
The fugacity in atm for pure ethane at 310 K and 20.4 atm is given by the equation: f = 20.4 exp (-Δg1/RT). The change in chemical potential between this state and a second state of ethane where the temperature is constant but the pressure is 24 atm is -0.0911RT.
Fugacity is a measure of the escaping tendency of a component in a mixture, which is defined as the pressure that the component would have if it obeyed ideal gas laws. It is used as a correction factor in the calculation of equilibrium constants and thermodynamic properties such as chemical potential. Here we need to determine the fugacity in atm for pure ethane at 310 K and 20.4 atm and the change in the chemical potential between this state and a second state of ethane where the temperature is constant but the pressure is 24 atm. So, using the formula of fugacity: f = P.exp(Δu/RT) Where P is the pressure of the system, R is the gas constant, T is the temperature of the system, Δu is the change in chemical potential of the system. Δu = RT ln (f / P)The chemical potential at the initial state can be calculated using the ideal gas equation as: PV = nRT
=> P
= nRT/V
=> 20.4 atm
= nRT/V
=> n/V
= 20.4/RT The chemical potential of the system at the initial state is:
Δu1 = RT ln (f/P)
= RT ln (f/20.4) Also, we know that for a pure substance,
Δu = Δg. So,
Δg1 = Δu1 The change in pressure is 24 atm – 20.4 atm
= 3.6 atm At the second state, the pressure is 24 atm.
Using the ideal gas equation, n/V = 24/RT The chemical potential of the system at the second state is: Δu2 = RT ln (f/24) = RT ln (f/24) The change in chemical potential is Δu2 – Δu1 The change in chemical potential is
Δu2 – Δu1 = RT ln (f/24) – RT ln (f/20.4)
= RT ln [(f/24)/(f/20.4)]
= RT ln (20.4/24)
= - 0.0911 RT Therefore, the fugacity in atm for pure ethane at 310 K and 20.4 atm is:
f = P.exp(Δu/RT)
=> f
= 20.4 exp (-Δu1/RT)
=> f
= 20.4 exp (-Δg1/RT) And, the change in the chemical potential between this state and a second state of ethane where the temperature is constant but pressure is 24 atm is -0.0911RT. Therefore, the fugacity in atm for pure ethane at 310 K and 20.4 atm is given by the equation: f = 20.4 exp (-Δg1/RT). The change in chemical potential between this state and a second state of ethane where the temperature is constant but the pressure is 24 atm is -0.0911RT.
To know more about chemical potential visit:-
https://brainly.com/question/31100203
#SPJ11
Which RNA strand would match with this DNA strand?
AGGCTAAT
What is the DNA strand? You have not named it.