what is BEFORE and AFTER when you put the baking soda in vinegar?​

Answers

Answer 1

When you mix baking soda and vinegar, a chemical reaction occurs that produces carbon dioxide gas, water, and a type of salt called sodium acetate.

What happens at the mixing of baking soda in vinegar?​

Before: Before mixing baking soda and vinegar, they are both in their separate states. Baking soda is a white powder, and vinegar is a clear liquid.

During: When you mix the baking soda and vinegar, the baking soda (sodium bicarbonate) reacts with the vinegar (acetic acid) to produce carbon dioxide gas (CO2), water (H2O), and sodium acetate (NaC2H3O2).

After: After the chemical reaction has taken place, you will see bubbles of carbon dioxide gas being released. The solution will also become cloudy as the sodium acetate precipitates out. The resulting mixture may feel warmer due to the exothermic nature of the reaction (meaning it releases heat).

Learn more about baking soda in vinegar:https://brainly.com/question/2427021

#SPJ1


Related Questions

State the career function of mechanical engineering​

Answers

Answer:

Mechanical engineers design power producing machines, like electric generators, internal combustion engines, and steam and gas turbines, also power using machines, such as refrigeration and air-conditioning systems. Mechanical engineers design other machines inside buildings, such as elevators and escalators.

Explanation:

How would the equilibrium of the reaction below be affected if the
temperature decreased?
200 kJ +2503(9)
702() +250 (9)
A. The reaction would shift to produce more SO3.
B. The reaction would shift to produce more O2 and SO2-
C. The reaction would produce less O2, SO2, and SO3.
D. The reaction would produce more O2, SO2, and SO3.

Answers

Answer:

B. The reaction would shift to produce more O2 and SO2-

Explanation:

This is because the forward reaction is exothermic.

The correct answer is option B. The reaction would shift to produce more O2 and SO2-

How would the equilibrium of the reaction below be affected if the temperature decreased?

A decrease in temperature will cause the equilibrium to shift to favour the exothermic reaction. Therefore the reverse reaction rate will decrease sharply, and then gradually increase until equilibrium is re-established.

When the temperature has increased the equilibrium will shift to the?

If the temperature is increasing, a product is being added to the equilibrium, so the equilibrium shifts to minimize the addition of extra product: it shifts back toward reactants.

Learn more about the equilibrium of the reaction here:  https://brainly.com/question/18849238

#SPJ2

. 11 gallons of gasoline for $26.29
or 6 gallons of gasoline for $14.45?

Answers

Answer:

6 gallons of gasoline for $14.45 is the best price

Explanation:

26.29/11=2.39 $ per gallon

14.45/11=1.31 $ per gallon

evaporation is a cooling process and condensation is:

Answers

Condensation is the process where water vapor becomes liquid.

Florence is only able to find 0. 015 m aqueous ki/i2 on the reagent cart, so they perform a dilution by combining 10 ml of water and 10 ml of the available reagent. They now have 0. 0075 m aqueous ki/i2 which can be used at station c. Is there a difference in the chemical composition of the solution florence made from what was available on the reagent cart?.

Answers

Florence is only able to find 0. 015 m aqueous ki/i2 on the reagent cart, so they perform a dilution by combining 10 ml of water and 10 ml of the available reagent. They now have 0. 0075 m aqueous ki/i2 which can be used at station there is no difference in the chemical composition of the solution because water was already present in the solution.

Florence is a type of flask used as an item of laboratory glassware and is named after the city Florence. here Florence flask is only able to find 0. 015 m aqueous Ki/i2 on the reagent cart they perform a dilution by combining 10 ml of water and 10 ml of the available reagent They now have 0. 0075 m aqueous Ki/i2 which can be used at station there is no difference  because water was already present in the solution water is only present on the reagent cart.

Know more about Florence

https://brainly.com/question/28499549

#SPJ4

What mass Na2CO3 will completely react with 150 mL of 0.15 M HNO3?
a) write the balanced equation
b) construct the pathway of how you would approach the problem.
c) write out the calculation
d) calculate

Answers

a) Balanced equation:

2Na2CO3 + 2HNO3 -> 2NaNO3 + H2O + CO2

b) Pathway:

To determine the mass of Na2CO3 required to react with 150 mL of 0.15 M HNO3, we need to follow these steps:

Write the balanced equation to determine the stoichiometry between Na2CO3 and HNO3.

Convert the volume of HNO3 to moles using its molarity.

Use the stoichiometry from the balanced equation to determine the moles of Na2CO3 required.

Convert the moles of Na2CO3 to grams using its molar mass.

c) Calculation:

Given:

Volume of HNO3 = 150 mL = 0.150 L

Molarity of HNO3 = 0.15 M

Step 1: Balanced equation:

2Na2CO3 + 2HNO3 -> 2NaNO3 + H2O + CO2

Step 2: Convert volume of HNO3 to moles:

Moles of HNO3 = Volume (L) × Molarity

= 0.150 L × 0.15 M

= 0.0225 moles of HNO3

Step 3: Use stoichiometry to find moles of Na2CO3:

From the balanced equation, we can see that 2 moles of Na2CO3 react with 2 moles of HNO3.

Therefore, the moles of Na2CO3 required = 0.0225 moles of HNO3

Step 4: Convert moles of Na2CO3 to grams:

Molar mass of Na2CO3 = (2 × atomic mass of Na) + atomic mass of C + (3 × atomic mass of O)

= (2 × 22.99 g/mol) + 12.01 g/mol + (3 × 16.00 g/mol)

= 105.99 g/mol

Mass of Na2CO3 = Moles × Molar mass

= 0.0225 moles × 105.99 g/mol

= 2.384 g

d) Calculation:

The mass of Na2CO3 required to completely react with 150 mL of 0.15 M HNO3 is 2.384 grams.

Learn more about balanced equation here : brainly.com/question/7181548
#SPJ11

The shape of the directly sunlit portion of the Moon as viewed from
Earth

Answers

your answer:

lunar phases

What makes a molecule organic?

Answers

Answer:

Organic molecules contain carbon; inorganic compounds do not. Carbon oxides and carbonates are exceptions; they contain carbon but are considered inorganic because they do not contain hydrogen. The atoms of an organic molecule are typically organized around chains of carbon atoms.

calculate the wavelntg in nm of the lowest energy photon capable of ionizng the hydrogen atom from its ground state\

Answers

The wavelength of photon capable of ionizing a hydrogen atom from its ground state = 91.2 nm

The energy of a hydrogen atom in its ground state = -13.6 eV.

So to ionize the atom we have to provide at least 13.6 eV of energy.

Converting eV to Joules,

Energy, E = 13.6 × 1.6 ×10⁻¹⁸ = 2.18 × 10⁻¹⁸ J

From Plank's quantum theory, E = hυ

          h is the plank's constant

          υ is the frequency.

Also  c = υλ

        λ = c/υ,    λ is the wavelength,

                         c is the velocity of light in vaccum

                        υ is the frequency.

By combining both equations, E = hc/λ

                                                   λ = hc/E

                                                     = (6.63× 10⁻³⁴ )×(3×10⁸)/(2.18×10⁻¹⁸)

                                                     = 9.12 ×10⁻⁸ m

                                                    = 91.2 nm

So the wavelength of photon required to ionize hydrogen atom is 91.2nm

For further information regarding energy and wavelength, kindly refer

https://brainly.com/question/30064724

#SPJ4

you consider starting material a. you know that a can undergo two irreversible reactions as shown in the below reaction coordinate diagram with one reaction pathway labeled in red and one reaction pathway labeled in blue. the red path leads to product b, while the blue path leads to product c. assuming both reaction pathways occur simultaneously in competition with each other, what is the major product, and why?

Answers

Product B because it has a lower energy level than Product C's transition state, which leads to Product C.

What are reaction pathways?

The series of reactions required to create a desired product are described by a reaction pathway. The distribution strategy for a product is determined by things like percentage yield. Atomic economics. reaction time. is a connected graph with chemical species as its nodes. If a reaction transfers material from one species to the other, an edge unites the two. An vector from reactant toward the product is depicted as the edge.

What role do reactions pathway ?

Energy, or ATP, is created by chemical reactions within our cells. All living things require energy to survive, and Adp would be a reactant that fuels a number of other chemical reactions inside cells. Cells generate energy through a process called cellular respiration.

To know more about Reaction pathways visit:

https://brainly.com/question/16047003

#SPJ4

8 vocabulary words related to energy sources

Answers

Answer:

Solar energy. Biofuel, Nuclear power, Hydro power, Geothermal energy, Fossil, Gasoline, sun

Spontaneous movement of molecules and ions from an area of high concentration to an area of low concentration. True or false?.

Answers

Spontaneous movement of molecules and ions from an area of high concentration to an area of low concentration is true.

There are two examples of spontaneous movement: diffusion and osmosis.

Diffusion is spontaneous movement of molecules and ions from an area of high concentration to an area of low concentration.

Osmosis is the spontaneous movement of solvent molecules (in this example water) through a selectively permeable membrane into a region of higher solute concentration (15 percent salt solution), in the direction that tends to equalize the solute concentrations on the two sides.

The direction of osmotic pressure is always from the side with the lower concentration of solute to the side with the higher concentration.

More about diffusion: brainly.com/question/7161064

#SPJ4


What is a source of mechanical energy?

A dirt
B sunlight
C wind
D No answer text provided.

Answers

Answer:

D.No answer text provide.

Explanation:

The energy that is possessed by an object due to it's motion or due to it's position is mechainical energy

CaCO3 + 2HCl→CaCl2+H2CO3 is an example of which type of reaction? Question 2 options: Single-Displacement Double-Displacement Combustion Decomposition

Answers

Answer:

Double replacement:

Explanation:

Double replacement:

It is the reaction in which two compound exchange their ions and form new compounds.

AB + CD → AD +CB

Chemical equation:

CaCO₃ + 2HCl    →      CaCl₂ + H₂CO₃

The given chemical reaction is example of double displacement reaction. In this type of reaction cation and anion of both reactant exchange with each other. We can see carbonate ion of calcium carbonate combine with hydrogen ion of HCl and form carbonic acid while chloride ions of HCl combine with calcium ion and form calcium chloride.

All other options are incorrect because,

Single replacement:

It is the reaction in which one elements replace the other element in compound.

AB + C → AC + B

Decomposition reaction:

It is the reaction in which one reactant is break down into two or more product.

AB → A + B

Combustion reaction:

In combustion reaction substances are burned in the presence of oxygen.

Answer:

double-displacement

Explanation:

I took the test :)

Bright red color (R) is dominant over grey color (r) in a type of fish , what color is the fish

Bright red color (R) is dominant over grey color (r) in a type of fish , what color is the fish

Answers

i am pretty sure its red and grey

In an electrochemical cell, electrons travel in which direction? * (a) from the anode to the cathode through the external circuit (b) from the anode to the cathode through the porous cup (c) from the cathode to the anode through the external circuit (d) from the cathode to the anode through the porous cup.

Answers

Answer:

(a) from the anode to the cathode through the external circuit

Explanation:

In an electrochemical cell, there are two half cells; the oxidation half cell and reduction half cell. Oxidation typically refers to loss of electrons and reduction refers to gain of electrons.

Electrons always flow from the anode to the cathode or from the oxidation half cell to the reduction half cell.

The electrical circuit in an electrochemical cell confirms the flow of electron. Usually a light bulb is attached. The correct option is;

(a) from the anode to the cathode through the external circuit

In an electrochemical cell, the direction which electrons travel is: (a) from the anode to the cathode through the external circuit.

Electrons can be defined as the subatomic particles of a chemical element that are negatively charged and have a magnitude of -1.

An electrochemical cell refers to a device that is capable of either generating electric current from the electrical energy released by a spontaneous redox reaction or using an electrical energy to cause chemical reactions.

Generally, an electrochemical cell is also referred to as a secondary cell and a good example is a rechargeable battery.

In Science, the direction of flow of current is usually from the anode (positive side) to the cathode (negative side) in an electrical circuit.

On a related, current is made up of electrons and as such the direction which electrons travel is usually from the anode to the cathode through the external electrical circuit.

Find more information: https://brainly.com/question/18214726

what are the factors affecting gravity?​

Answers

Gravity, as a fundamental force of nature, is influenced by several factors. The following are some of the key factors affecting gravity:

Mass: The most significant factor affecting gravity is the mass of the objects involved. According to Newton's law of universal gravitation, the gravitational force between two objects is directly proportional to the product of their masses. Greater mass leads to a stronger gravitational force.Distance: The distance between two objects also plays a crucial role in the strength of gravity. According to the inverse square law, the gravitational force decreases as the distance between objects increases. As objects move farther apart, the gravitational attraction between them weakens.Gravitational Constant: The gravitational constant, denoted by G, is a fundamental constant in physics that determines the strength of the gravitational force. It is a universal constant and does not change, affecting the overall magnitude of gravity.Shape and Distribution of Mass: The distribution of mass within an object can influence the gravitational field it generates. Objects with a more compact and concentrated mass distribution will have a stronger gravitational pull compared to those with a more spread-out mass distribution.External Influences: Gravity can be influenced by external factors such as nearby celestial bodies or the presence of other forces. For example, the gravitational interaction between the Earth and the Moon affects tides on Earth's surface.

Observe Record the appearance (colors,
textures, etc.) of the reactants in the data table.
The reactant Zn is
A. An element
B. An iconic compound
C. A molecule
D. An oxide
The reactant CuSO4 İs
A. An element
B. An iconic compound
C. A molecule
D. An oxide

Observe Record the appearance (colors,textures, etc.) of the reactants in the data table.The reactant

Answers

Answer:

1) Zn is a element

2)CuSO4 is an ionic compound

Explanation:

Answer: an element and an ionic compound

Explanation: my mom told me


Suppose a substance has a heat of fusion equal to 45 calg and a specific heat of 0.75
the liquid state. If 5.0 kcal of heat are applied to a 50-g sample of the substance at a
temperature of 24°C, what will its new temperature be? What state will the sample be in?
(melting point of the substance = 27°C; specific heat of the sold = 0.48 -
- boiling point of
the substance = 700ºC) Show your work.​

Answers

Answer:

The substance will be in liquid state at a temperature of 97.3 °C

Note: The question is incomplete. The complete question is given below :

Suppose a substance has a heat of fusion equal to 45 cal/g and a specific heat of 0.75 cal/g°C in the liquid state. If 5.0 kcal of heat are applied to a 50 g sample of the substance at a temperature of 24°C, what will its new temperate be? What state will the sample be in? (melting point of the substance = 27°C; specific heat of the solid =0.48 cal/g°C; boiling point of the substance = 700°C)

Explanation:

1.a) Heat energy required to raise the temperature of the substance to its melting point, H = mcΔT

Mass of solid sample = 50 g; specific heat of solid = 0.75 cal/g; ΔT = 27 - 24 = 3 °C

H = 50 × 0.75 × 3 = 112.5 calories

b) Heat energy required to convert the solid to liquid at its melting point at 27°C, H = m×l, where l = 45 cal/g

H = 50 × 45 = 2250 cal

c) Total energy used so far = 112.5 cal + 2250 cal = 2362.5 calories.

Amount of energy left = 5000 - 2362.5 = 2637.5 cal

The remaining energy is used to heat the liquid

H = mcΔT

Where specific heat of the liquid, c = 0.75 cal/g/°C, H = 2637.5 cal, ΔT = temperature change

2637.5 = 50 × 0.75 x ΔT

ΔT = 2637.5 / ( 50*0.75)

ΔT = 70.3 °C

Final temperature of sample = (70.3 + 27) °C = 97.3 °C

The substance will be in liquid state at a temperature of 97.3 °C

Which pairs are isomers? CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3. CH3CH(CH3)CH2CH2CH2CH2CH2CH2CH3 and CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3. CH3CH2CH2CH2CH2CH3 and CH3CH2CH(CH3)CH2CH2CH3. CH3CH(CH3)CH2CH2CH(CH3)CH3 and CH3CH2CH2CH2CH2CH2CH2CH3. CH3CH(CH3)CH2CH3 and CH3CH2CH2CH2CH3

Answers

The pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.

Isomers are the molecules which have the same molecular formula but differ in the arrangement of their atoms. The following pairs of compounds are isomers: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3.CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3.CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.In the first pair of compounds, the molecule on the left is n-butane, while the molecule on the right is 2-methylpropane or isobutane. They are isomers because both have the same molecular formula C4H10, but different structures.2. In the second pair of compounds, the molecule on the left is octane, while the molecule on the right is 2-methylheptane.

These compounds have the same molecular formula, C8H18, but different structures.3. In the third pair of compounds, the molecule on the left is 2-methylpentane, while the molecule on the right is 3-methylpentane.

They are isomers because they have the same molecular formula C6H14, but different structures.4.

In the fourth pair of compounds, the molecule on the left is 2,3-dimethylbutane, while the molecule on the right is 2,4-dimethylpentane.

They are isomers because they have the same molecular formula C8H18, but different structures.5. In the fifth pair of compounds, the molecule on the left is isopropyl group, while the molecule on the right is n-propyl group.

They are isomers because they have the same molecular formula C3H7, but different structures.

In conclusion, the pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.

To know more about isomers visit:

brainly.com/question/32508297

#SPJ11

calculate the solubility of carbon dioxide in water at an atmospheric pressure of 0.540 atm (a typical value at high altitude).

Answers

The solubility of carbon dioxide in water at an atmospheric pressure of 0.540 atm is 1.40x10⁻² M

The amount of a substance's concentration that dissolves in a solvent at a particular temperature is known as its solubility. The type of bond, mass, temperature, and pressure all affect solubility.

The solubility can be calculate with formula below:

S = KH*P  

where

S= Solubility

KH = measure of hardness of water / carbonate hardness = 3.50*10⁻² mol/L.atm

P = atmospheric pressure = 0.5400 atm

Thus, we got

S = KH*P

= (3.50x10⁻² mol/L.atm)*(0.5400 atm)

= 1.89 x 10⁻² mol/L

But 1 mol/L = 1 M,

Therefore, the answer (1.40*10⁻² mol/L ) is equivalent to  1.40x10⁻² M

learn more about solubility at https://brainly.com/question/13198024

#SPJ4

What are some reasonable safety precautions for conducting field investigations
in polar climates?

Answers

Answer:

warm clothing hiking sticks safter gear. food water. the basics

Please answer it in 1 hour Write explanation if it needed I’ll give you upvote immediately Don’t use excel to solve this question i In a bond amortization schedule, what does the book value mean?Describe in words. (ii) Consider a n-period coupon bond where the redemption amount, C may not be the same as the face amount, F. Using j and g to represent the yield rate per period and modified coupon rate per period respectively, show that,for k = 01,2,n, the book value at time k,B is B=C+Cg-jan-kj and the amortized amount at time k is ii Let K = Cu. The Makeham formula to compute the price of a bond is given by A verbal interpretation for K would be that K is the present value of the redemption value C.Provide a verbal interpretation for(C-K)

Answers

Answer:

(i) In a bond amortization schedule, the book value represents the remaining amount of the bond principal that hasn't been paid off at a given point in time. When a bond is first issued, its book value equals its face value. As payments are made over the life of the bond, a portion of these payments reduces the book value. By the end of the bond's life, its book value will be zero, as the entire principal will have been paid off.

(ii) The formula for the book value B at time k, where k is the number of periods elapsed, is B = C + Cg - jan-kj.

Here:

- C is the redemption amount,

- g is the modified coupon rate per period,

- j is the yield rate per period, and

- a_n-kj is the present value of an annuity immediate with n - k periods at the yield rate j.

This formula states that the book value at any time k is the redemption amount plus the present value of the future coupon payments (Cg), minus the present value of the annuity that represents the repayments of the bond (jan-kj).

The amortized amount at time k is the change in the book value from time k-1 to time k, plus the coupon payment at time k. It represents the portion of the bond's principal (and interest) that has been repaid up to time k.

(iii) If K is defined as the present value of the redemption value C, according to the Makeham formula, (C-K) would represent the difference between the redemption value of the bond and its present value. This difference is the amount of interest that will accumulate over the life of the bond. In other words, (C-K) can be interpreted as the total interest that the bondholder will earn from holding the bond until redemption, assuming that all coupon payments are reinvested at the yield rate j.

Explanation:

Differentiate between breathing and respiration using three differences

Answers

Answer:

breathing is inhaling and exhaling of gases between the cells in the environment.

respiration is the biochemical process that happens in the cell. this process releases energy from organic compounds that are then used for performing activities

Explanation:

Approximately how many formula units of NaCl are in 116.88g of table salt (NaCl), knowing that the molar mass of NaCl is 58.44g/mol?

Answers

Answer:

116.88g of table salt (NaCl) contains two formula units

Explanation:

Now,

We know that 1 formula unit of sodium chloride has a molar mass of 58.44g/mol

Hence;

Mass of 1 formula unit = 58.44g

Mass of x formula units = 116.88g

x = 116.88g * 1 formula unit/58.44g

x = 2 formula units

Therefore;

116.88g of table salt (NaCl) contains two formula units

Answer:

There are  1.2044 × 10²⁴ formula units of NaCl in 116.88 g of table salt (NaCl)

Explanation:

A formula unit is an empirical formula of the smallest collection or number of atoms in an ionic or covalent combination from which a compounds formula can be established and which are used to represent the compound stoichiometrically

Sodium chloride is an ionic compound and is represented by the formula unit NaCl as it composed of ions and is not therefoe represented by a molecular formula

The given mass of the table salt, NaCl = 116.88 g

The molar mass of NaCl = 58.44 g/mol = The mass of 1 mole of NaCl

1 mole of NaCl contains one Avogadro's number or 6.022 × 10²³ formula units of NaCl,

∴ 58.44 g of NaCl contains 6.022 × 10²³ formula units of NaCl

116.88 g of NaCl will have (116.88/58.44) × 6.022 × 10²³ = 1.2044 × 10²⁴ formula units of NaCl

The number of formula units of NaCl in 116.88 g of table salt (NaCl) =  1.2044 × 10²⁴ formula units of NaCl.

How many sigma (o) and pi (1) bonds are in the following molecules: Enter a whole number such as 0, 1, 2, 3, ... A. H3C(CH2)4COOH (a carboxylic acid) sigma pi B. H2CCHCOCH3 (a ketone) sigma pi

Answers

The number of sigma (σ) and pi (π) bonds in the following molecules are:
A. H₃C(CH₂)₄COOH : 19 sigma bonds and 1 pi bond
B. H₂CCHCOCH₃ : 10 sigma bonds and 1 pi bond

A. H₃C(CH₂)₄COOH (a carboxylic acid)
In this molecule, there are single bonds between carbon and hydrogen atoms, carbon and carbon atoms, and carbon and oxygen atoms. Single bonds are always sigma bonds. There is also a double bond between the carbon and oxygen atoms in the carboxyl group (COOH). Double bonds consist of one sigma bond and one pi bond.

- 13 C-H bonds
- 4 C-C bonds
- 1 C-O single bond
- 1 C=O double bond (1 σ, 1 π)

Sigma bonds: 13 + 4 + 1 + 1 = 19
Pi bonds: 1

B. H₂CCHCOCH₃ (a ketone)
In this molecule, there are single bonds between carbon and hydrogen atoms, and carbon and carbon atoms. There is a double bond between the carbon and oxygen atoms in the carbonyl group (C=O). Again, double bonds consist of one sigma bond and one pi bond.

- 6 C-H bonds
- 3 C-C bonds
- 1 C=O double bond (1 σ, 1 π)

Sigma bonds: 6 + 3 + 1 = 10
Pi bonds: 1

Learn more about sigma (σ) and pi (π) bonds here: https://brainly.com/question/10123266

#SPJ11

How is the molar mass of an element different from the atomic mass of an element?

Answers

1.Molar mass is the mass of one mole per single element while atomic mass is the mass of an atom at rest or is the number of protons and neutrons.
2.Molar mass is measured in grams per mole while atomic mass is “unitless.”
3.Atomic mass is measured via mass spectrometry while molar mass is computed via atomic weight.

Consider two bulbs seperated by a valce. Both bulbs are amintained at the same temperature. Assume that when the valve between the two bulbs is closed, the gases are sealed in their respective bulbs. When the valve is closed, the following data apply:

Bulb A Bulb B
Gas Ne CO
V 2.50L 2.00L
P 1.09 atm 0.73 atm


Assuming no temperature change, determine the final pressure inside the system after the valve connecting the two bulbs is opened. Ignore the volume of the tube connecting the two bulbs.

Answers

Answer:

The  pressure is \(P_f = 0.93 \ atm\)

Explanation:

From the question we are told that

   The  volume of  Ne  is  \(V_N = 2.50 \ L\)

    The volume  of  CO is  \(V_C = 2.00 \ L\)

    The  pressure of  \(Ne\) is  \(P_N = 1.09 \ atm\)

      The  pressure of  CO is \(P_C = 0.773 \ atm\)

The  number of  moles of  Ne present is evaluated using the ideal gas equation as

      \(n_N = \frac{P_N * V_N}{R T}\)

=>   \(n_N = \frac{1.09 * 2.50 }{R T} = \frac{2.725}{RT}\)

The  number of  moles of  CO present is evaluated using the ideal gas equation as

      \(n_N = \frac{P_C * V_C}{R T}\)

=>   \(n_N = \frac{0.73 * 2.00 }{R T} = \frac{1.46}{RT}\)

The  total number of moles of gas present is evaluated as

        \(n_T = n_N + n_C\)

        \(n_T = \frac{2.725}{RT} + \frac{1.46}{RT}\)

      \(n_T = \frac{4.185}{RT}\)

The  total volume of gas present when valve is opened is  mathematically represented as

                \(V_T = V_N + V_C\)

    =>        \(V_T = 2.50 + 2.00 = 4.50 \ L\)

So

  From the ideal gas equation the final pressure inside the system  is mathematically represented as

         \(P_f = \frac{n_T * RT }{ V_T}\)

=>      \(P_f = \frac{[\frac{4.185}{RT} ] * RT }{ 4.50}\)

=>       \(P_f = 0.93 \ atm\)

     

Which units express specific heat capacity?
J/°C, J/K, cal/°C, cal/K
J/(gi°C), J/(giK), cal/(gi°C), cal/(giK)
J, cal
°C, K

Answers

The units that express specific heat capacity are J/(g°C), J/(gK), cal/(g°C), and cal/(gK).

The specific heat capacity of a material refers to the amount of heat required to raise the temperature of one gram of the material by one degree Celsius or one Kelvin.

Specific heat capacity is typically represented by the symbol c and is expressed in units of either joules per gram per degree Celsius (J/(g°C)) or calories per gram per degree Celsius (cal/(g°C)).

The specific heat capacity of a substance is determined by the nature of the material and the temperature at which it is measured.

The specific heat capacity of water, for example, is 4.184 J/(g°C) or 1 cal/(g°C), which means that it takes 4.184 joules of energy to raise the temperature of one gram of water by one degree Celsius.

This is a relatively high value compared to other substances, which means that water has a high thermal inertia and requires a lot of energy to change its temperature.

Other substances, such as metals, have lower specific heat capacities, which means that they heat up and cool down more quickly in response to changes in temperature.

Overall, the specific heat capacity of a material is an important property that affects its thermal behavior and is used in a variety of applications, including in the design of heating and cooling systems and in the study of thermodynamics.

For more such questions on  heat capacity

https://brainly.com/question/29792498

#SPJ8

What pillar of sustainability is broken by recycling
electronics in India? Should the US make a law that electronics can
only be recycled in the US?

Answers

The pillar of sustainability broken by recycling electronics in India is environmental sustainability. Implementing a law that restricts electronics recycling to the US would not necessarily be the most effective solution, as it overlooks the complex global dynamics of electronic waste management.

Recycling electronics in India often involves improper disposal methods, such as burning or dismantling without proper safety measures. This leads to environmental pollution, including the release of hazardous substances into the air, soil, and water, thus violating the principle of environmental sustainability.

However, simply mandating that electronics can only be recycled in the US may not be the most optimal solution. Electronic waste is a global issue, and restricting recycling to a single country disregards the fact that electronic products are manufactured and consumed worldwide. A more comprehensive approach to addressing electronic waste would involve international cooperation, strict regulations, and monitoring of recycling practices to ensure they meet environmental standards.

Efforts should focus on improving recycling practices globally, including promoting responsible electronic waste management, developing sustainable recycling infrastructure in multiple countries, and encouraging the adoption of safe and environmentally friendly recycling practices. This approach would foster global sustainability and address the challenges associated with electronic waste disposal more effectively than a geographically limited restriction.

To learn more about sustainability, here

https://brainly.com/question/32771548

#SPJ4

Other Questions
Let P(A) = 0.70, P(B | A) = 0.55, and P(B | Ac) = 0.10. Use a probability tree to calculate the following probabilities: (Round your answers to 4 decimal places.) a. P(Ac) b. P(A B) P(Ac B) c. P(B) d. P(A | B) problem 1A body whose mass is 50kg is raised to a height of 2m above the ground.what is it's potential energy? if the body is allowed to fall ,find the kinetic energy (a)when half way down (b)just before impact with the floor.problem 2.A trailer is pulling a car with a force of 900N on a level road .The car is moving at 70km/h.How much work is done by the trailer on the car in 15mns.problem 3the brake of a 1600kg vehicle travelling at 15m/sec on a level road are applied long enough to do 90KJ work. Find the speed of the vehicle.what is the amount of work required to stop the vehicle.? PLEASE HELP NOW!!! What would be the experimental probability of drawing a white marble?Ryan asks 80 people to choose a marble, note the color, and replace the marble in Brianna's bag. Of all random marble selections in this experiment, 34 red, 18 white, 9 black, and 19 green marbles are selected. How does the theoretical probability compare with the experimental probability of drawing a white marble? Lesson 9-3 IN PYTHON****Forms often allow a user to enter an integer. Write a program that takes in a string representing an integer as input, and outputs yes if every character is a digit 0-9.Ex: If the input is:1995the output is:yesEx: If the input is:42,000or any string with a non-integer character, the output is:no Question 1 3 pts The style of eruption depends on the plate tectonic setting in which the volcano is situated. Compare the different eruption styles you could observe at a divergent versus a convergent plate boundary. Make sure to address the roles that composition, viscosity, and gas content play in your answer. A tetherball is on a 2.1 m string which makes an angle of 56 degree with the vertical as it moves around the pole in a horizontal plane. If the mass of the ball is 1.3 kg, what is the ball's speed? can someone help with a sentence starter?The story is The Queen Bee.And the questions are, explain how " The Queen Bee'' could be considered an allegory.Explain how the author developed the allegory through the use of the literary elements. Identify the most and the least basic compound in each of the following sets. Leave the remaining answer in each set blank.a) Sodium acetate: --B Sodium methoxide: Sodium phenoxide: b) Sodium acetate: Sodium chloroacetate: Sodium fluoroacetate: c) Lithium ethoxide: Lithium hydroxide: Lithium formate: Health care as a disci-pline discuss Aaron sampled 101 students and calculated an average of 6.5 hours of sleep each night with a standard deviation of 2.14. Using a 96% confidence level, he also found that t* = 2.081.confidence intervat = xs/n A 96% confidence interval calculates that the average number of hours of sleep for working college students is between __________. examine the figure above depicting the preparatory step and the krebs cycle, and identify statements that correctly describe these processes. An operating system uses available storage space on a startup drive for _____. Select all that apply.A. storing programsB. virtual memoryC. storing appsD. virtual reality what is the independent variable and the dependent variable in which cleans teeth better baking soda or toothpaste project. Employees adopt new behaviors and attitudes during the ___________ stage, although they will need training and practice before the new ways of doing things become automatic. is the current flowing out of a resistor smaller than the current flowing into it. if not, then do resistors not actually slow down the flow of charge. eplain and give exampes\ Electric field lines are used to represent the vector electric field around point charges and charged objects. Which of the following statements are true about electric field lines. Select ALL that apply. Select all that apply A. Electric field lines cannot cross. B. Lines of electric field only originate from positive charges. C. Field lines point in the direction of the force the electric field creates on an electron. D. The strength of the electric field is greater in regions where the field lines are closer together. E. In an electric-field-line drawing with many point charges, the number of field lines originating or terminating on each charge is proportional to the charge. That is, bigger charges have proportionally more field lines. F. The true strength of an electric field at any point can be determined from an electric field representation. by middle childhood, children who hold flexible beliefs about what boys and girls can do group of answer choices are more likely to have an androgynous gender identity. are more likely to notice instances of gender discrimination. get more encouragement from teachers to participate in gender-typed activities. show more in-group favoritism than children who hold rigid beliefs. Instead of copper (II) chloride, KCL is added to a piece of aluminum. No reaction occursBased on this information, predict and explain what would happen if KCL was added to a sample of solid copper1.copper would dissolve and solid potassium would be formed 2.nothing would occur3. Prediction cant be madeExplain why The odometer on an automobile actually counts axle turns and converts the number of turns to miles based on knowledge that the diameter of the tires is 0.62m.How many turns does the axle make when traveling 10miles? In this process, the risks that have been underwritten are pooled together into a bundle, which is then considered an asset and the underwriter then sells its shares; hence, the risk is transferred from the insurers to the capital markets. Identify this process.a. Reinsuranceb. Securitizationc. Credit swappingd. Redlininge. Gentrification