The derivative of cos(2x) is obtained as follows:
[cos(2x)]' = -2sin(2x).
How to obtain the derivative?The function in this problem is given as follows:
cos(2x).
The function is a composite function, hence the chain rule is used to obtain the derivative of the function.
The derivatives are given as follows:
Derivative of 2x: 2.Derivative of cos(x): -sin(x).Derivative of cos(x) at 2x: -sin(2x).Hence the derivative is given as follows:
[cos(2x)]' = -2sin(2x).
More can be learned about the chain rule of derivatives at https://brainly.com/question/29498741
#SPJ1
Answer:
1. Addition
2. Cosine Sum Identity
2. Simplify
Step-by-step explanation:
Dont worry abt that
Also here’s the next answers
Evaluate the expression for m = -3.
-4|5 + m|
Type the correct answer in the box. Use numerals instead of words.
Answer:
The answer is -8
-4 l5 +(-3)l
-4 (2) = -8
Answer: Correct answer is -8
Step-by-step explanation:
Substitute the given value of m into the expression:
-4|5 + (-3)|.
Then evaluate using the order of operations:
-4|5 + (-3)|
= -4|2|
= -4(2)
= -8
Edmentum Answer
Calculate the volume of a hemisphere with a diameter of 9 feet, rounded to the nearest hundredths
Answer:
190.85
Step-by-step explanation:
What’s the answer I need help pls ease?
The product of the two matrices is [2 - 3] x [1 - 4]
[ 3 2] [4 1]
option B.
What is a product of matrices?A product matrix is also known as matrix multiplication, which involves the multiplication of two matrices, to get or simply to a single matrix.
For example, if P and Q are the two matrices, then the product of the two matrices P and Q are denoted by:
Y = PQ.
For the given question; we have the first matrix as; (2 - 3i) and the second matrix as (1 - 4i).
Matrix (2 - 3i) is transformed to [2 - 3]
[ 3 2]
Matrix (1 - 4i) is transformed to [1 - 4]
[4 1]
The product of the two matrices = [2 - 3] x [1 - 4]
[ 3 2] [4 1]
Learn more about product of matrices here: https://brainly.com/question/94574
#SPJ1
100 CD’s cost $16.67. How much does one CD cost? Round to the nearest cent.
Answer:
5.99 or 6 dollars
Step-by-step explanation:
100 divided by 16.67
Find the area of the circle.
Use 3.14 for it.
A = 7r2
13 cm
Give your answer to the nearest hundredth.
A = [?] cm?
Answer:530.66cm
Step-by-step explanation:the formula for the area of the circle is pi times r times r so pi is 3.14 then 3.14 times 13 times 13 should give you the answer.
Answer:
A≈530.93
Step-by-step explanation:
A=πr^2=π·13^2≈530.92916
hope i helped
-lvr
Gavin has 16 blue marbles and 8 white ones. If he wants to place them in identical groups
without any marbles left over, what is the greatest number of groups Gavin can make?
Answer:
6
Step-by-step explanation:
Select all the trapezoids.
Answer:
A trapezoid is a quadrilateral, meaning 4 sides. It is similar to a square but with longer lines. It also has 1 pair of parallel lines, the other pair are not.
Step-by-step explanation:
hope this helps :)
In the given set of figures, figures, 2, 3, and 4 are trapezoids.
Since we know that,
A trapezoid is a four-sided polygon with two parallel sides that are usually called bases. The other two sides are called legs.
Trapezoids have a wide range of applications in mathematics, especially in geometry.
They can be used to calculate the area and perimeter of various objects.
Trapezoids can also be classified as isosceles or scalene, depending on whether or not the legs have the same length.
To determine whether a given figure is a trapezoid,
it is important to check for a few specific features.
The first step is to ensure that the figure has four sides - this is a prerequisite for it to be considered a trapezoid.
Once this is established, the next step is to look for two parallel sides.
If there are two sides that are parallel, then the figure could be a trapezoid.
The next step is to check the angles formed by the sides.
If the two non-parallel sides slant towards each other, then the figure is a trapezoid.
However, if they slant away from each other, it is not a trapezoid.
Finally, it is important to make sure that the two non-parallel sides are of different lengths, as a trapezoid must have two parallel sides of different lengths.
By following these steps, we can easily recognize whether a given figure is a trapezoid or not.
Hence figures, 2, 3, and 4 are trapezoids.
To learn more about trapezium visit:
https://brainly.com/question/16687907
#SPJ6
The complete question is attached below:
Scott sells scones and has collected sales data for the past few days. Scott wiill use a simple naive to forecast but is concerned about forcast accuracy. Determine what MAD (Mean Absolute Deviation) will be to 2 decimal places.
To determine the Mean Absolute Deviation (MAD), we need the actual sales data and the forecasted values. Since the actual sales data is not provided, it is not possible to calculate the MAD accurately.
MAD is calculated by taking the average of the absolute differences between the forecasted values and the actual values. Without the actual sales data, we cannot compute the absolute differences and find the MAD.
To calculate the MAD, you will need the actual sales data and the corresponding forecasted values for each day. Then, you can calculate the absolute differences between the actual and forecasted values, take their average, and round the result to two decimal places to obtain the MAD.
To know more about Deviation visit-
brainly.com/question/31314442
#SPJ11
pls help I'm lost on this
Answer:
Correct answer's the top one
Step-by-step explanation:
Think of powers of 10. Each power is 10 times larger or smaller than the last one. So in this instance, the bacterium has a diameter of 10^-6 which is 1 millionth. And then there's the virus, which has a diameter of 10^-7 which is 1 ten millionth. So basically, take 10^-7 and times that by 10. This gives you 10^-6, which can only mean that the bacterium is 10 times bigger than the virus, which is the answer on top.
Which expression represents the perimeter, in units, of this trapezoid?
Answer:
youll have to insert a pic of the trapezoid for us to see and answer it...
Step-by-step explanation:
For this problem, type "infinity" when relavent and omit spaces in your answers. Let y = f(x) be given by the graph below. 6 -2 3 2 2
The graph of the function y = f(x) consists of three distinct parts. For x ≤ 3, the function has a constant value of 6. From x = 3 to x = 6, the function decreases linearly with a slope of -2, starting at 6 and ending at 0. Finally, for x > 6, the function remains constant at 2.
The graph provided can be divided into three segments based on the behavior of the function y = f(x).
In the first segment, for x values less than or equal to 3, the function has a constant value of 6. This means that no matter what x-value is chosen within this range, the corresponding y-value will always be 6.
In the second segment, from x = 3 to x = 6, the function decreases linearly with a slope of -2. This means that as x increases within this range, the y-values decrease at a constant rate of 2 units for every 1 unit increase in x. The line starts at the point (3, 6) and ends at the point (6, 0).
In the third segment, for x values greater than 6, the function remains constant at a value of 2. This means that regardless of the x-value chosen within this range, the corresponding y-value will always be 2.
To summarize, the function y = f(x) has a constant value of 6 for x ≤ 3, decreases linearly from 6 to 0 with a slope of -2 for x = 3 to x = 6, and remains constant at 2 for x > 6.
Learn more about slope here: https://brainly.com/question/29184253
#SPJ11
3x (2a - b)-y(2a - b) factorise
Answer: The correct answer is (3x−y)(2a−b)
Step-by-step explanation:
Factor 3x(2a−b)−y(2a−b)
6ax−2ay−3bx+by
=(3x−y)(2a−b)
Solve 5 ln(x + 2)5 + 1 2 ln(x) − ln(x2 + 3x + 2)2
To solve this equation, we need to apply the rules of logarithms. First, we can simplify the expression by using the power rule of logarithms:
5 ln[(x+2)^5] + 1/2 ln(x) - 2 ln[(x+1)(x+2)]
= ln[x^5(x+2)^25 * x^(1/2) / (x+1)^2(x+2)^2]
Now, we can simplify the expression under the natural logarithm by combining like terms:
= ln[x^(11/2)(x+2)^23 / (x+1)^2(x+2)^2]
Finally, we can use the logarithmic property of exponentials to rewrite the expression in exponential form:
x^(11/2)(x+2)^23 / (x+1)^2(x+2)^2 = e^[ln(x^(11/2)(x+2)^23) - ln(x+1)^2(x+2)^2]
= e^[11/2 ln(x) + 23 ln(x+2) - 2 ln(x+1) - 2 ln(x+2)]
To know more about equation visit :-
https://brainly.com/question/28243079
#SPJ11
express each of the following percentages as a fraction.28% 158%
Answer:
28% = 7/25 and 158% = 79/50
Step-by-step explanation:
To convert a percent into a fraction, you have to put the value of the percent over 100.
For 28%: 28/100
28 and 100 are both divisible by 4, so the fraction reduces to 7/25.
For 158%: 158/100
158 and 100 are both divisible by 2, so the fraction reduces to 79/50. If you teacher doesn't want you do use improper fractions, then 79/50 can further be reduced and becomes \(1\frac{29}{50}\).
Hope this helped!
28 29 30 31 32 33 34 35 36 Find all solutions of the equation in the interval [0, 2n). sinx(2 cosx+2)=0 Write your answer in radians in terms of . If there is more than one solution, separate them wit
The solutions of the equation in the interval [0, 2π) are x=0, π, (2n+1)π/2 (for all integers n and n≠0).
To solve this equation, we need to find all values of x in the interval [0, 2π) that satisfy the equation sinx(2cosx+2)=0.
First, we need to find all values of x where sinx=0. These occur when x=0, π, and any integer multiple of π. We will call these values of x "sinx solutions".
Next, we need to find all values of x where 2cosx+2=0. Solving for cosx, we get cosx=-1. This occurs when x=π and any odd multiple of π/2. We will call these values of x "cosx solutions".
Now, we need to check which of these solutions also satisfy the original equation sinx(2cosx+2)=0.
For the sinx solutions, we have:
x=0: sinx(2cosx+2)=0(2cos0+2)=0(2+2)=0. This solution works.
x=π: sinx(2cosx+2)=sinπ(2cosπ+2)=0(2(-1)+2)=0. This solution works.
For the sinx solutions where x is an integer multiple of π, we have:
x=nπ: sinx(2cosx+2)=0(2cos(nπ)+2)=0(2(-1)ⁿ+2)=0. This solution works when n is odd (since (-1)ⁿ =-1), and does not work when n is even (since (-1)ⁿ=1).
For the cosx solutions, we have:
x=π: sinx(2cosx+2)=sinπ(2cosπ+2)=0(2(-1)+2)=0. This solution works.
x=(2n+1)π/2: sinx(2cosx+2)=sin((2n+1)π/2)(2cos((2n+1)π/2)+2)=0(2(0)+2)=0. This solution works for all integers n.
You can learn more about intervals at: brainly.com/question/11051767
#SPJ11
write 331600000 in standard form
Answer:
331.6 million
Step-by-step explanation:
331.6 million
3.3e+8
I used this website
https://numbersinwords.net/331-6-million-in-numbers
I hope it help
A college conducted a survey of randomly selected freshmen about their choice of major. The table shows the results of the survery. Which inference about all freshmen at this college is best supported by this information?
Answer:
I think it’s B (I’m not sure if I’m right)
Step-by-step explanation:
50 pupils in a sports centre are surveyed. the pupils can only use the swimming pool and the gym. 31 pupils use the swimming pool. 28 pupils use the gym. 7 pupils use neither the swimming pool nor the gym. find the probability to select a pupil that uses the swimming pool but not the gym.
Using it's concept, it is found that there is a 0.3 = 30% probability to select a pupil that uses the swimming pool but not the gym.
What is a probability?A probability is given by the number of desired outcomes divided by the number of total outcomes.
In this problem, we have that 50 - 7 = 43 pupils use at least one of the pool or the gym.
We use the following relation, considering the numbers of each:
Both = Pool + Gym - At least one
Hence:
Both = 31 + 28 - 43 = 16.
From this, we have that out of 50 pupils, there are 31 - 16 = 15 pupils who use the pool but not the gym, hence the probability is:
p = 15/50 = 0.3 = 30%.
More can be learned about probabilities at https://brainly.com/question/14398287
#SPJ1
Crossover trial: A crossover trial is a type of experiment used to compare two drugs. Subjects take one drug for a period of time, then switch to the other. The responses of the subjects are then compared using matched-pair methods. In an experiment to compare two pain relievers, seven subjects took one pain reliever for two weeks, then switched to the other. They rated their pain level from to , with larger numbers representing higher levels of pain. The results are listed below. Can you conclude that the mean pain level is more with drug B? Let μ1 represent the mean pain level with drug A and =μd−μ1μ2. Use the =α0.10 level and the P-value method with the TI-84 Plus calculator.
Subject 1 2 3 4 5 6 7
Drug A 5 4 6 6 5 2 1
Drug B 7 4 5 6 7 5 7
1. State the appropriate null and alternate hypotheses.
2. Compute the P-value. Round the answer to at least four decimal places.
3. Determine whether to reject H0.
4. State a conclusion.
Based on the given data from the crossover trial comparing two pain relievers (drugs A and B), we can conclude that there is evidence to suggest that the mean pain level is higher with drug B.
The appropriate null and alternate hypotheses are:
Null hypothesis (H0): μ1 = μ2 (There is no difference in the mean pain level between drug A and drug B)
Alternate hypothesis (H1): μ1 < μ2 (The mean pain level is higher with drug B)
To compute the P-value using the TI-84 Plus calculator, we need to perform a paired t-test on the data. By calculating the t-statistic for the paired differences and degrees of freedom, we can obtain the P-value associated with the observed difference. Using the P-value method, the obtained P-value is compared to the significance level (α = 0.10) to make a decision.
If the computed P-value is less than the significance level (0.10), we reject the null hypothesis. This indicates that there is sufficient evidence to support the alternative hypothesis, suggesting that the mean pain level is indeed higher with drug B.
Based on the results of the analysis, we can conclude that there is evidence to suggest that the mean pain level is more with drug B compared to drug A. However, it's important to note that this conclusion is based on the given data and the assumptions made during the analysis. Further studies with larger sample sizes and rigorous experimental designs may be needed to confirm these findings.
Learn more about hypotheses here:
https://brainly.com/question/33444525
#SPJ11
A spherical water tank holds 9000ft ^3 of water. What is the diameter of the tank? (Hint: V = 1/6d^3 3.14)
Set up? :
9000 = 1/6 d ^3 x 3.14
The diameter of the spherical tank that holds 9000ft³ of water is 25.81 ft.
What is diameter?A diameter is a line that divides a circle into two equal parts.
To calculate the diameter of the tank, we use the formula below.
Formula:
V = d³π/6............ Equation 1Making d the subject of the equation,
d = ∛(6V/π).................. Equation 2Where:
V = Volume of the spherical water tankd = Diameter of the tankFrom the question,
Given:
V = 9000 ft³π = 3.14Substitute these values into equation 2
d = ∛(6×9000/3.14)d = 25.81 ftHence, the diameter of the tank is 25.81 ft.
Learn more about diameter here: https://brainly.com/question/23220731
#SPJ1
Express the proposition r-es in an English sentence, and determine whether it is true or false, where r and s are the following propositions r: "35 +34 3 is greater than 341 s: "3.102 5. 10 +8 equals 341 Express the proposition r-es in an English sentence. A. 3 +34 33 is greater than 341 and 3.102 10+ 8 equals 341 B. 3s +34 33 is greater than 341 or 3 .102 10+ 8 equals 341 C. 3.102 +5.10+ 8 equals 341, then 35 34 +33 is greater than 341 D. If 35 +34 +33 is greater than 341, then 3.102 +5. 10+ 8 equals 341
The proposition r - s is false, because both r and s are true.
The proposition r is "35 + 34 + 3 is greater than 341" and the proposition s is "3.1025 x \(10^8\)equals 341".
To express the proposition r - s, we subtract the proposition s from the proposition r. Therefore,
r - s: "35 + 34 + 3 is greater than 341 and 3.1025 x \(10^8\)does not equal 341"
Option A is incorrect because it includes the proposition s as being equal to 341, which is not true.
Option B is incorrect because it suggests that either proposition r or proposition s is true, but that is not what the proposition r - s means.
Option C is incorrect because it reverses the order of the propositions in r - s.
Option D is correct because it correctly expresses the proposition r - s. It states that if proposition r is true (i.e. 35 + 34 + 3 is greater than 341), then proposition s must be false (i.e. 3.1025 x 1\(0^8\) does not equal 341).
As for the truth value of r and s, we can evaluate them as follows:
r: 35 + 34 + 3 = 72, which is indeed greater than 341, so r is true.
s: 3.1025 x \(10^8\)is not equal to 341, so s is true.
for such more question on proposition
https://brainly.com/question/870035
#SPJ11
Which of the following is true?
a. The mean of the sampling distribution is always equal to the population mean.
b. The standard deviation of the sampling distribution is always equal to the population standard deviation.
c. The shape of the sampling distribution is always approximately normal.
d. All of the above.
The correct answer is a. The mean of the sampling distribution is always equal to the population mean.
This is known as the central limit theorem, which states that as the sample size increases, the sampling distribution will approach a normal distribution with a mean equal to the population mean. However, the standard deviation of the sampling distribution (option b) is not always equal to the population standard deviation and the shape of the sampling distribution (option c) is not always approximately normal, as it depends on the sample size and the underlying population distribution. Therefore, option d is incorrect. The correct is (a). The mean of the sampling distribution is always equal to the population mean. This is due to the fact that a sampling distribution is created by taking multiple random samples from the population, and as the number of samples increases, their mean tends to converge to the population mean. Options (b) and (c) are not always true, as the standard deviation and shape of the sampling distribution depend on the sample size and the underlying population distribution.
To know more about limit theorem visit:
https://brainly.com/question/898534
#SPJ11
You get 10 points❄️ Plz plz plz is math
Which expression is equivalent to
200?
O 2010
O 10-12
O 10./20
100.5
Pleaseee HELPP MEE WITHH THIS QUESTION!
Answer:
1120°
Step-by-step explanation:
Use the sum of interior angles formula:
\(180(n-2)\)
Where n is the number of sides.
In a nonagon, there are 9 sides, substitute 9 for n:
\(180(9-2)\\180(7)\\1260\)
Since our nonagon is a regular nonagon, all 9 angles measure the same, so each angle measures:
\(\frac{1260}{9} =140\)
Subtract 140 from 1260:
\(1260-140=1120\)
From a table of integrals, we know that for ,≠0a,b≠0,
∫cos()=⋅cos()+sin()2+2+.∫eatcos(bt)dt=eat⋅acos(bt)+bsin(bt)a2+b2+C.
Use this antiderivative to compute the following improper integral:
∫[infinity]01cos(3)− = limT→[infinity]∫0[infinity]e1tcos(3t)e−stdt = limT→[infinity] if ≠1s≠1
or
∫[infinity]01cos(3)− = limT→[infinity]∫0[infinity]e1tcos(3t)e−stdt = limT→[infinity] if =1.s=1. help (formulas)
For which values of s do the limits above exist? In other words, what is the domain of the Laplace transform of 1cos(3)e1tcos(3t)?
help (inequalities)
Evaluate the existing limit to compute the Laplace transform of 1cos(3)e1tcos(3t) on the domain you determined in the previous part:
()=L{e^1t cos(3)}=
"From a table of integrals, we know that for \(\(a \neq 0\)\) and \(\(b \neq 0\):\)
\(\[\int \cos(at) \, dt = \frac{1}{a} \cdot \cos(at) + \frac{1}{b} \cdot \sin(bt) + C\]\)
and
\(\[\int e^a t \cos(bt) \, dt = \frac{e^{at}}{a} \cdot \cos(bt) + \frac{b}{a^2 + b^2} \cdot \sin(bt) + C\]\)
Use this antiderivative to compute the following improper integral:
\(\[\int_{-\infty}^{0} \cos(3t) \, dt = \lim_{{T \to \infty}} \int_{0}^{T} e^t \cos(3t) \, e^{-st} \, dt = \lim_{{T \to \infty}} \text{ if } s \neq 1, \, \text{ or } \lim_{{T \to \infty}} \text{ if } s = 1.\]\)
For which values of \(\(s\)\) do the limits above exist? In other words, what is the domain of the Laplace transform of \(\(\frac{1}{\cos(3)} \cdot e^t \cos(3t)\)\)?
Evaluate the existing limit to compute the Laplace transform of on the domain you determined in the previous part:
\(\[L\{e^t \cos(3t)\\).
To know more about antiderivative visit-
brainly.com/question/9700015
#SPJ11
Find the slope of the line
Given: KM bisects JKL
Prove: m MKL= 1/2m JKL
please explain
Start with out given statement:
Line KM bisects <JKL and the reason for that is because it's given.
For statement 2, we know that m<JKM = m<MKL
because of the definition of an angle bisector.
For statement 3, we can use the angle addition
postulate to get m<JKM + m<MKL = m<JKL.
For statement 4, we use substitution from
the info in statement 2 to get m<MKL + m<MKL = m<JKL.
For statement 5, we simplify to get 2(m < KML) = m<JKL.
For statement 5, we use the division property of equality.
All the reasons are underlined.
1. 3(1-3x)= 2(-4x+7)
2. 8p+4(4p-3) = 4(6p+4) -4
3. -3(t-1) + 8(t-3) = 6x +7 -5x
4. 3(1-3y) = 2(-4y+7)
Answer:
1. x=−11
2. No solution
3.x=5t−28
4.y=-11
Step-by-step explanation:
Answer:
1. x=11
2.p=8
3.5t-21-x+7
4. y=8
Step-by-step explanation:
1. 3(1-3x)=2(4x+7)
3-9x=8x+14
x=11
2.8p+4(4p-3)=4(6p+4)-4
8p+16p-12=24p+24-4
25p-12=24p-4
p=8
3. -3(t-1)+8(t-3)=6x+7-5x
-3t+3+8t-24=6x+7-5x
5t-21=x+7
4. 3(2-3y)=2(-4y+7)
6-9y=-8y+14
y=8
Use words to write 520783106. Be sure to use any needed commas and hyphens.
Answer:
[See Below]
Step-by-step explanation:
✦ Five hundred twenty million, seven hundred eighty-three thousand, one hundred six.
This is the written form of \(520783106\).
~Hope this helps Mate. If you need anything feel free to message me.