The structure of the periodic table is based on the distribution of
in each element. The elements are arranged in horizontal and vertical

From the rate law, the information that is given by the rate constant is: C. It tells how much the reaction rate is affected by activation energy.

Rate law is also referred to as rate equation and it can be defined as a chemical equation that is typically used to relate the initial (forward) chemical reaction rate with respect to the concentrations or pressures of the chemical reactants and constant parameters.

Mathematically, the rate law is given by this formula:

\(R = k[A]^x[B]^y\)

Where:

In Chemistry, the rate constant is typically used to tell the reaction rate or rate of a chemical reaction that is affected by activation energy.

Read more on rate constant here: https://brainly.com/question/24749252

1. D. Absorbing excess carbon dioxide in the atmosphere

2.C. Abnormal warming of the earth

3.D. Organisms in the converted forest areas will lose their natural habitats.

4.D. Tropical rainforests have important functions in the ecosystem

5.C. Loss of habitat of many marine creatures

6.B. Use of sodium cyanide in fishing

1. The important roles of tropical rainforests in the earth's environment: Rainforests are often called the lungs of the planet for their role in absorbing carbon dioxide, a greenhouse gas, and increasing local humidity.

2. If all trees were cut down and burned, the forest's carbon storage capacity would be lost to the atmosphere.

3. The most common pressures causing deforestation and severe forest degradation are agriculture, unsustainable forest management, mining, infrastructure projects and increased fire incidence and intensity.

4. Need to conserve and protect tropical rainforests: The most important function of forests is that it produces mass amounts of oxygen as a by-product of photosynthesis. ... Forests also prevent soil erosion and keep soil pollution in check.

5. If coral reefs are destroyed: Sea life has the most to lose. Coral reefs cover less than 1% of the ocean floor. But, they provide an essential ecosystem for a quarter of all marine life.

6. Pollution, overfishing, destructive fishing practices using dynamite or cyanide, collecting live corals for the aquarium market, mining coral for building materials, and a warming climate are some of the many ways that people damage reefs all around the world every day.

Learn more:

brainly.com/question/11361766

The conjugate base of a compound is what this compound will be after donating a H⁺.

The comopund in question is H₂BO₃⁻. After it loses 1 H⁺, it will have one less H atom and its charge decrease by one. Its charge is only with a "-" sign, which means its chargeis 1-. After decreasing by one, the charge becomes 2-.

So, the conjugate base will be HBO₃²⁻

Answer:

Drilling in the earth can provide new sources of wind

Explanation:

Answer:

the water would rise above you and spill out

Explanation:

the water would form around you, because the human body is solid, and would take up some of the volume of the tub. the water then goes up due to the added volume.

The molarity of the NaCl solution is 0.271 M (moles per liter) when 15.84 grams of NaCl is dissolved in 1.00 liter of distilled water.

Molarity is a concentration unit widely used in chemistry that measures the amount of solute dissolved in a given volume of solvent. It is defined as the number of moles of solute per liter of solution. It provides a quantitative measure of the concentration of a solute in a solution and allows for consistent comparisons between different solutions. It is a fundamental concept in many aspects of chemistry, from laboratory experiments to industrial processes, enabling precise control and understanding of solution compositions.

The molarity of the solution can be calculated by dividing the number of moles of solute (15.84 g of NaCl) by the volume of the solution (1.00 l):

Molarity = (15.84 g NaCl ÷ 58.44 g/mol NaCl) ÷ 1.00 l

Molarity = 0.27 mol/l

To learn more about molarity

https://brainly.com/question/30404105

#SPJ4

Answer:

False

Explanation:

False : It is better they are closer together

The RF ( retention factor  ) is calculated with this formula

= distance travelled / distance travelled by solvent

And the larger the RF factor of a compound the less polar the compound ( i.e. it will not stick to the stationary phase ) hence it is better the RF values of the components to be closer

Answer:

True

Explanation:

The resulting Rf factor, which has no units, is dependent upon the specific stationary and mobile phase used. Chromatogram results are considered to have better resolution if the Rf values of the components being separated are farther apart (e.g. 0.3 and 0.7) rather than closer together (e.g. 0.4 and 0.5). The distance the compound moves relative to the distance the solvent (or mobile phase or eluent) moves is a characteristic of that compound. (where Rf is equal to distance compound moved divided by solvent front distance)

A substance q had a vapor pressure of 345 mmHg at 22.0 °C. the temperature at a vapor pressure of 275 mmHg. the heat of vaporization of q is 36.0 kJ/mol is 19.6 °C.

The Clausius Clapeyron equation is given as :

ln ( P2 / P1 ) = - ΔH /R ( 1 / T2 - 1 / T1)

ln ( 275 / 345 ) = - 36 / 8.314 (1 / T2 - 1 / 295)

- 0.235 = - 4.33  ( 295 - T2 / 295 T2 )

15.98 T2 = 295 - T2

14.98 T2 = 295

T2 = 19.6 °C

The temperature at vapor pressure 275 mmHg is 19.6 °C.

To learn more about vapor pressure here

https://brainly.com/question/13126432

#SPJ4

Answer:

The distance light travels in a tiny fraction of a second

Explanation:

One meter is defined as the length of the path travelled by light in a vacuum in \(\dfrac{1}{299 792 458}\) of a second. It is also equal to the one \(\dfrac{1}{10}\) of the distance from the equator to the North Pole. It is one of the fundamental units. It is a SI unit of length. So, the standard definition of 1 mete is the distance light travels in a tiny fraction of a second.

Hence, the correct option is (d).

Non polar: A bon in which neither atom takes more than its share of electrons

Metallic : A type of bond that allows valence electrons to move freely among its ions

Polar: A bond with a negative end and a positive end

Electronegativity: Determines what type of bond will form

Diatomic: Composed of two atoms

The mass of an additional 0.5% sodium chloride is 2.93×10^23

As an electrolyte replenisher, sodium chloride is used to assist reduce heat cramps brought on by excessive sweating. This drug is also used to make a standard isotonic sodium chloride solution. The chemical formula for the ionic compound sodium chloride, often known as salt, is NaCl, which represents a 1:1 ratio of the ions sodium and chloride. 39.34 g Na and 60.66 g Cl have molar weights of 22.99 and 35.45 g/mol in 100 g of NaCl, respectively. To replace salt and water that have been lost from your body as a result of specific conditions, sodium chloride 23.4% injection is employed (eg, hyponatremia or low salt syndrome). Additionally, it is added to IV fluids that contain carbohydrates and total parenteral nutrition (TPN).

In vulnerable individuals, a high-NaCl diet can increase blood pressure and result in premature mortality. In hypertension, a high-NaCl diet can significantly increase mortality even while it does not further raise blood pressure, in part due to numerous tiny brain infarcts, according to recent research. Salt, commonly known as sodium chloride (NaCl), is a crucial substance that our body uses to transport and absorb nutrients. keep blood pressure steady. maintain the proper fluid equilibrium.

Molecular formula of NaCl is 58.5

58.5gof NaCl=6.023×10^23

28.5g of NaCl= 6.023×10^23÷58.5×28.5

= 2.93×10^23

To know more about Sodium Chloride visit:

https://brainly.com/question/9811771

#SPJ1

There are several steps to draw lewis dot structure of any chemical compound. Here, we taking RbF.  Structure is given below with the image.

1. Start by writing the chemical symbol for the element at the center of the structure. In this case, it is Rb for Rubidium.

2. Draw dots around the symbol to represent the valence electrons. Rb has one valence electron, so you would put one dot around the Rb.

3. Next, write the chemical symbol for the other element in the compound, in this case F for Fluorine.

4. Draw dots around the symbol to represent the valence electrons. Fluorine has 7 valence electrons, so you would put 7 dots around the F.

5. To create the bond between the two elements, use a pair of dots to connect the Rb and F. This represents the sharing of electrons between the two elements.

So the Lewis dot structure for RbF would be represented as:

        . .

Rb+ [:F:]

        . .

This representation shows that Rb and F share one pair of electrons, forming a bond between them, and the dots around Rb and F represent the remaining number of valence electrons that are not involved in the bond.

To know more about RbF please refer: https://brainly.com/question/13526282

#SPJ4

The number of moles of HCl can be calculated using the formula: moles = concentration x volume. Given a concentration of 1.34 M and a volume of 15.00 mL, we can calculate the number of moles of HCl.

To calculate the number of moles of HCl, we can use the formula:

moles = concentration x volume

Given:

Concentration = 1.34 M

Volume = 15.00 mL

First, we need to convert the volume from milliliters (mL) to liters (L) since the concentration is given in moles per liter (M):

Volume = 15.00 mL = 15.00 mL / 1000 mL/L = 0.015 L

Now we can calculate the number of moles:

moles = 1.34 M x 0.015 L = 0.0201 moles

Therefore, the number of moles of HCl is 0.0201 moles.

Learn more about calculating moles here: brainly.com/question/10482331

#SPJ11

To increase the amount of light that a device is converting, you can optimize the photovoltaic material and the surface area.

The choice of photovoltaic material plays a crucial role in light conversion. Research and development efforts focus on enhancing the efficiency of existing materials or discovering new materials with better light absorption and conversion properties.

When you increase the surface area of the device exposed to light, it can enhance light absorption. This can be achieved through design modifications that trap or scatter light, or by using materials with a higher surface area-to-volume ratio.

Learn more about light here:

https://brainly.com/question/104425

#SPJ1

The pH of the solution containing 2.80 M acetic acid is 2.34.

Given, The Ka value for acetic acid, CH3COOH(aq), is 1.8x10^-5.Molar concentration of acetic acid, CH3COOH(aq), is 2.80 M.

Step 1 The equation for the ionization of acetic acid is as follows.CH3COOH(aq) + H2O(l) ⇆ H3O+(aq) + CH3COO-(aq)

Step 2Expression for Ka isKa = [H3O+][CH3COO-]/[CH3COOH(aq)]1.8 x 10-5 = [H3O+][CH3COO-]/2.80[H3O+] = √(Ka [CH3COOH(aq)]) = √(1.8 x 10-5 x 2.80) = 0.00462 M

Step 3pH = -log[H3O+] = -log(0.00462) = 2.34

So, the pH of the solution containing 2.80 M acetic acid is 2.34.

Acetic acid (CH3COOH) is a weak acid with a Ka value of 1.8x10⁻.

By utilizing this Ka value and the molar concentration of acetic acid, the pH of a 2.80 M acetic acid solution can be calculated.

Using the equation Ka = [H3O+][CH3COO-]/[CH3COOH(aq)], and after simplifying,

it can be determined that [H3O+] = √(Ka [CH3COOH(aq)]).

After substituting the values for Ka and [CH3COOH(aq)], [H3O+] is found to be 0.00462 M.

Finally, pH can be calculated by the expression pH = -log[H3O+], and we obtain the answer of pH=2.34.

To know more about acetic acid visit:

brainly.com/question/15202177

#SPJ11

The volume of the balloon if five more same-sized breaths are added to the balloon is 4L.A measurement of three-dimensional space is volume. Numerous imperial or US customary units, as well as SI-derived units, are frequently used to quantify it quantitatively.

The quantity of air a balloon can contain is measured by its volume. A balloon's volume is expressed in cubic feet or meters. A balloon can contain 14.5 cubic feet of air on average. The size of the balloon, the volume of air within, and the temperature of the air all have an impact on the volume of the balloon.

The amount of space occupied by a substance or item, or the volume of space enclosed within a container.

The volume of inflated balloon is 1.5 L

\(1.5 X \frac{1 breath}{3breath} =0.5\)

The final volume after 8 breaths

\(0.5 X \frac{8 breath}{1 breath} =4 L\)

Thus, the volume of the balloon after five more breaths is 4.5 L.

to Learn more about volume, pls click here:

brainly.com/question/1578538

#SPJ4

Answer:

no it will not be.

Explanation:

as the Water will be squishy and the cotton will be wet it will not be comfortable.

Answer:

I think carbon.

Explanation:

............

Explanation:

hope it will help you Mark me as a brilliant

\(\large{\textrm{{{\color{navy}{Answer....}}}}}\)

\large{\textrm{{{\color{navy}{Answer....}}}}}

\(\Huge \mid \underline {\mathcal {{{\color{orange}{Answer...}}}}} \mid\)

\Huge \mid \underline {\mathcal {{{\color{orange}{Answer...}}}}} \mid

\(\boxed{\sf Note:-}\)

\boxed{\sf Note:-}

\(\begin{gathered} {\underline{\boxed{ \sf {\red{Answer}}}}}\end{gathered}\)

\begin{gathered} {\underline{\boxed{ \sf {\red{Answer}}}}}\end{gathered}

\(\huge\red{\boxed{\orange{\mathcal{\overbrace{\underbrace{\fcolorbox{red}{pink}{\underline{\red{❥Answer࿐}}}}}}}}}\)

\huge\red{\boxed{\orange{\mathcal{\overbrace{\underbrace{\fcolorbox{red}{pink}{\underline{\red{❥Answer࿐}}}}}}}}}

\({\boxed{ \Huge{ \blue{ \mathcal{ \underline{ Answer}}}}}}\)

{\boxed{ \Huge{ \blue{ \mathcal{ \underline{ Answer}}}}}}

\(\large\bf\purple{ \longrightarrow} \rm \:\)

\large\bf\purple{ \longrightarrow} \rm \:

\(\Huge\bf\overbrace{\underline{ \underbrace{\blue \dag \orange{Answer \blue \dag}}}}\)

\Huge\bf\overbrace{\underline{ \underbrace{\blue \dag \orange{Answer}}}} \blue\dag

\(\Huge\bf\underline{\underline{\red{Answer}}}\)

\Huge\bf\underline{\underline{\red{Answer}}}

\(\Huge\bf { \underline{\mathbb {\green{ Answer }}}} \)

\Huge\bf \underbrace{ \underline{\mathbb {\blue \dag\green{ Answer }}}} \underline\blue\dag

Answer:

The sun and the heat waves  or to be more educational the  infrared radiation that makes us feel the heat we do .

Hope I could help -

Sleepy~

Answer:

density = 5 g/ml

Explanation:

D=m/v. Mass=30g and Volume=6mL

SO solve for D when m = 30 and v = 6

D=m/v

D = 30/6

density = 5 g/ml

Answer:

uhhhh

Explanation:

if you need help ask someone who is not anyone on this app

hehe :]

Answer:

9: Chemical Energy  10:

Electrical Energy = k

Elastic Energy = p  

Sound Energy = k

Radiant Energy = k

Chemical Energy = p

Gravitational Energy = k

Explanation

There

Answer:

C. Earth's Mantle

Explanation:

Answer:

C

Explanation:

Earth's mantle is the correct answer

Answer:

It is neither a synthesis reaction nor a decomposition reaction because two reactants form two products.

Explanation:

This reaction would be considered a single replacement reaction.

The chemical reaction involves the products and the reactants. The image is neither synthesis nor decomposition as the two products are formed from two reactants. Thus, option A is correct.

A chemical reaction includes the chemical interaction between the reactants to yield the products. In a synthesis reaction, two reactants interact to produce a different molecule or compound.

In a decomposition reaction, a reactant undergoes splitting to produce products and energy. But in the image two reactants produces two products that neither of the reaction shows.

This type of reaction is seen as the single replacement reaction where the more reactive element displaces the less reactive from the compound to form the new molecule.

Therefore, option a. Maya's picture represents a single replacement reaction but not a synthesis or decomposition reaction.

Learn more about the chemical reactions here:

https://brainly.com/question/16099976

#SPJ2

The equilibrium constant expression for this reaction is:

K = [C]2[D] / [A]4[B]2

We can rearrange this expression to solve for [B]:

[B] = √([A]4[C]2[D] / K)

Plugging in the given values, we get:

[B] = √((2.60 M)4(2.70 M)2(3.10 M) / 0.0964)

= √(6.76 M)

= 0.26 M

The initial concentration of B is 2.60 M, so the change in concentration of B is 2.60 M - 0.26 M = 2.34 M.

Since the reaction takes place in a 5.00-liter container, the number of moles of B that were removed is 2.34 M * 5.00 L = 11.7 moles.

Therefore, 11.7 moles of B were removed.

On the periodic table, first ionization energy generally increases as you move left to right across a period.

The ionisation energy measures an element's ability to participate in chemical processes that call for the creation of ions or the donation of electronsIt frequently has to do with the kind of chemical bonds that exist between the constituent parts of the compounds they produce.

The smallest amount of energy necessary to free the most loosely bound electron (or the valence electron) from an isolated neutral gaseous atom in order to create a cation is known as the ionisation energy (Ei or IE). X+ + e = X+ + energy

Ionization energy can be expressed mathematically as the electron's orbital energy with the opposite sign. The energy of ionisation is 2.18 x 10-18 J/atom, or 1312.3 KJ/mole.

To learn more about ionization please click on below link

https://brainly.com/question/28385102

#SPJ4

Answer:

A. 35

B. 7

C. halogênios

Explanation:

Aqui, para responder a essa pergunta, precisaremos conhecer o elemento particular em questão.

..... 4s ^ 2 3d ^ 10 4p ^ 5 significa que está a cinco elétrons da configuração eletrônica do último elemento na primeira camada dos metais pesados.

O último elemento da 1ª série do elemento de transição é o zinco, portanto, como está a apenas 5 elementos de distância, o átomo de que estamos falando é o átomo de Bromo de Bromo.

A. O zinco tem um número atômico 30 e como o bromo está a 5 elementos de distância, seu número atômico é 35

B. Uma vez que pertence ao grupo halogênio, tem 7 elétrons de valência como o resto da família

C. Pertence à família dos halogênios

Around axons, oligodendrocytes create the myelin sheath. Astrocytes sustain the extracellular environment of neurons, supply them with nutrients, and promote their structural integrity, and transmit signals, hence option A is correct.

Scavenge infections and dead cells using microglia. The cerebrospinal fluid, which cushions the neurons, is produced by ependymal cells.

Despite the complexity of the nervous system, nerve tissue only contains two primary kinds of cells. The neuron is the real nerve cell. The structural component of the nervous system, the "conducting" cell, sends impulses. Neuroglial, often known as glial cells, is the other type of cell.

Learn more about nervous system, here:

https://brainly.com/question/8695732

#SPJ1

The given question is incomplete, so the most probable complete question is,

The nervous system includes the brain, nerves, and spinal cord. All of these parts are made up of cells.

Which of the following is true about the cells in the nervous system?

a. Transmit signals.

b. Small and unbranched.

c. Glial cells provide nutrients.

d. Astrocytes forms myelin sheath.

Answer:

Upthrust.

An upthrust is that outward protruding force that acts opposite to the weight of the object

Answer:

Surface currents in the ocean are driven by global wind systems that are fueled by energy from the sun. Patterns of surface currents are determined by wind direction, Coriolis forces from the Earth's rotation, and the position of landforms that interact with the currents