The sequences were already outlined therefore she didn't have any difficulty in choosing between math and poetry.
What is a sequence?A sequence is an orderly arrangement of events or objects. When objects or events are arranged in a sequence, decision making becomes much easier.
For the task at hand, since the sequences were already outlined, then she didn't have any difficulty in choosing between math and poetry.
Learn more about sequence: https://brainly.com/question/21961097
Answer:
to solve an equation
which element has the electrons configuration 1s22s22p63s23p64s23d104p2
What is the final temperature after 840 Joules is absorbed by 10.0g of water at 25.0
C?
The final temperature of the water is: T_final = 45.0°C
We can use the formula for the specific heat capacity of the water to solve this problem:
q = mcΔT
First, we can calculate the initial energy of the water:
q = mcΔT
q = (10.0 g) (4.184 J/g°C) (25.0°C)
q = 1,046 J
Next, we can calculate the final temperature after absorbing 840 J:
q = mcΔT
840 J = (10.0 g) (4.184 J/g°C) (ΔT)
ΔT = 20.0°C
Therefore, the final temperature of the water is:
T_final = T_initial + ΔT
T_final = 25.0°C + 20.0°C
T_final = 45.0°C
To know more about final temperature, here
brainly.com/question/11244611
#SPJ1
Determine the volume in mL of 0.242 M NaOH(aq) needed to reach the equivalence (stoichiometric) point in the titration of 46.79 mL of 0.204 M propanoic acid(aq). The Ka of propanoic acid is 1.3 x 10-5.
The volume (in mL) of 0.242 M NaOH solution needed for the titration reaction is 39.44 mL
Balanced equationCH₃CH₂COOH + NaOH —> CH₃CH₂COONa + H₂O
From the balanced equation above,
The mole ratio of the acid, CH₃CH₂COOH (nA) = 1The mole ratio of the base, NaOH (nB) = 1How to determine the volume of NaOHVolume of acid, CH₃CH₂COOH (Va) = 46.79 mL Molarity of acid, CH₃CH₂COOH (Ma) = 0.204 MMolarity of base, NaOH (Mb) = 0.242 MVolume of base, KOH (Vb) =?MaVa / MbVb = nA / nB
(0.204 × 46.79) / (0.242 × Vb) = 1
Cross multiply
0.242 × Vb = 0.204 × 46.79
Divide both side by 0.242
Vb = (0.204 × 46.79) / 0.242
Vb = 39.44 mL
Thus, the volume of NaOH needed for the reaction is 39.44 mL
Learn more about titration:
https://brainly.com/question/14356286
Suppose the concentration of Al3+ is 1.90 M and the concentration of Sn2+ is 0.25 M in a galvanic cell that operates at 25°C with the same electrodes as the One above. Would the cell potential, Ecell, under these conditions be greater than, less than, or equal to the standard cell potential, E° cell from part b?
Justify your answer.
Under these conditions, the cell potential, Ecell, would be somewhat lower than the usual cell potential, E°cell.
How to determine cell potential?To determine whether the cell potential, Ecell, would be greater than, less than, or equal to the standard cell potential, E°cell, use the Nernst equation:
Ecell = E°cell - (RT/nF)ln(Q)
where:
Ecell = cell potential under the given conditions
E°cell = standard cell potential
R = gas constant (8.314 J/(mol·K))
T = temperature in Kelvin (25°C = 298 K)
n = number of electrons transferred in the overall cell reaction
F = Faraday constant (96,485 C/mol)
Q = reaction quotient
The balanced equation for the cell reaction is:
2Al(s) + 3Sn₂⁺(aq) → 2Al₃⁺(aq) + 3Sn(s)
The cell reaction involves the transfer of 3 electrons, so n = 3.
At standard conditions (1 M concentration for all species and 25°C), the cell potential, E°cell, can be calculated using the standard reduction potentials for the half-reactions:
Al₃⁺(aq) + 3e- → Al(s) E° = -1.66 V
Sn₂⁺(aq) + 2e- → Sn(s) E° = -0.14 V
E°cell = E°(cathode) - E°(anode) = (-0.14 V) - (-1.66 V) = 1.52 V
To calculate Q, use the given concentrations of Al3+ and Sn2+:
Q = ([Al₃⁺]²/[Sn⁺]³) = (1.90 M)² / (0.25 M)³ = 231.2
Now use the Nernst equation to calculate Ecell under the given conditions:
Ecell = E°cell - (RT/nF)ln(Q)
Ecell = 1.52 V - [(8.314 J/(mol·K))(298 K)/(3 mol)(96,485 C/mol)ln(231.2)]
Ecell = 1.52 V - (0.012 V) = 1.508 V
Therefore, the cell potential, Ecell, under these conditions would be slightly less than the standard cell potential, E°cell. This is because the concentration of Al₃⁺ is higher and the concentration of Sn₂⁺is lower than the standard conditions, which shifts the reaction towards the side with lower concentration of Al₃⁺ and higher concentration of Sn₂⁺. This means that the reaction is not occurring under standard conditions and the Nernst equation must be used to account for the non-standard conditions.
Find out more on concentration here: https://brainly.com/question/17206790
#SPJ1
some1 please help me with this problem
for reference: it’s speaking about 3H2 + N2 -> 2NH3 (ammonia)
Theoretically, if 20 grams of hydrogen reacts then 112.5 grams of ammonia is produced.
The balanced chemical equation can be given as:
N₂+3H₂→ 2NH₃
From stoichiometry, 2 mol of NH₃is produced from 3 mol of H₂
5 mol of NH₃ will be produced from = 3/2×5 = 7.5 mol of H₂
∴mass of H₂=7.5×2= 15gm of H₂.
Excess reagents are those reactants in a chemical reaction that are not exhausted at the end of the reaction. A completely exhausted or reacted reagent is called a limiting reagent because its amount limits the number of products formed. In this reaction, the excess reagent is Nitrogen as 35 grams of nitrogen and 15 grams of hydrogen react to produce 34 grams of ammonia.
To learn more about ammonia, refer to the link:
https://brainly.com/question/29519032
#SPJ1
Kindly help me with the number 2 answer
The number of moles of nitrogen, N in 65 moles of Pb(NO₃)₄ is 260 moles
How do I determine the number of mole of N?We'll begin by obtaining the number of mole of N in one mole of Pb(NO₃)₄. Details below:
From the formula of Pb(NO₃)₄, we can see that there are 4 moles of N in 1 mole of Pb(NO₃)₄
With the above information, we can determine the number of mole of N in 65 moles of Pb(NO₃)₄. This is illustrated below:
1 mole of Pb(NO₃)₄ contains 4 moles of N
Therefore,
65 mole of Pb(NO₃)₄ will contain = (65 moles × 4 moles) / 1 mole = 260 moles of N
Thus, we can conclude from the above calculation that the number of mole of N is 260 moles
Learn more about mole:
https://brainly.com/question/13314627
#SPJ1
In a 74.0-g aqueous solution of methanol, CH4O, the mole fraction of methanol is 0.140. What is the mass of each component?
Answer:
The correct answer is 16.61 grams methanol and 57.38 grams water.
Explanation:
The mole fraction (X) of methanol can be determined by using the formula,
X₁ = mole number of methanol (n₁) / Total mole number (n₁ + n₂)
X₁ = n₁/n₁ + n₂ = 0.14
n₁ / n₁ + n₂ = 0.14 ---------(i)
n₁ mole CH₃OH = n₁ mol × 32.042 gram/mol (The molecular mass of CH₃OH is 32.042 grams per mole)
n₁ mole CH₃OH = 32.042 n₁ g
n₂ mole H2O = n₂ mole × 18.015 g/mol
n₂ mole H2O = 18.015 n₂ g
Thus, total mole number is,
32.042 n₁ + 18.015 n₂ = 74 ------------(ii)
From equation (i)
n₁/n₁ + n₂ = 0.14
n₁ = 0.14 n₁ + 0.14 n₂
n₁ - 0.14 n₁ = 0.14 n₂
n₁ = 0.14 n₂ / 1-0.14
n₁ = 0.14 n₂/0.86 ----------(iii)
From eq (ii) and (iii) we get,
32.042 × 0.14/0.86 n₂ + 18.015 n₂ = 74
n₂ (32.042 × 0.14/0.86 + 18.015) = 74
n₂ = 74 / (32.042 × 0.14/0.86 + 18.0.15)
n₂ = 3.1854 mol
From equation (iii),
n₁ = 0.14/0.86 n₂
n₁ = 0.14/0.86 × 3.1854
n₁ = 0.5185 mol
Now, presence of water in the mixture is,
= 3.1854 mole × 18.015 gram per mole
= 57.38 grams
Methanol present in the mixture is,
= 0.5185 mol × 32.042 gram per mole
= 16.61 grams
A student made a graph plotting the progress of a reaction over time. The student forgot to label the y-axis of the graph.
A graph is shown with two graph lines. One graph line starts at a higher position on the y axis and slopes downwards towards the right. The other graph line starts at a lower position on the y axis and slopes upwards towards the right. The two graph lines stop short of intersecting each other and continue as separate lines which gradually become straight and parallel to the x axis. A vertical line is shown at a point where the two graph lines finally became parallel to the x axis. This vertical line is labeled equilibrium. The title on the x axis is Time and an arrow pointing towards the right is shown above Time. The title on the y axis is left blank.
What best explains the label that the student should use on the y-axis? (5 points)
Group of answer choices
Amount, because as the amount of product decreases, the amount of reactant increases over time.
Reaction rate, because forward and backward reaction become equal at equilibrium.
Amount, because the amounts of reactants and products become constant after equilibrium is reached.
Reaction rate, as the rate of forward reaction increases and rate of backward reaction decreases over time.
Answer:
C
Explanation:
Recall that, at equilibrium, the concentration of the reactants and products stop changing because both the forward and reverse reaction rates are equal.
Therefore, Choice C is correct.
Choice A is incorrect because there is no indication that the upper line describes the products and the lower line describes the reactants.
Choice B is incorrect because the statement, while true, is not reflected by the graph. (The two lines after equilibrium are not at the same y-value.)
Choice D is incorrect because the forward reaction rate generally decreases as time increases due to the decrease in reactant concentration(s).
In using the Haber process in the formation of ammonia, what mass of hydrogen is needed to produce 51.0 grams of ammonia? 3 H₂(g) + N2 (g) → 2 NH3(g).
The mass of hydrogen needed to produce 51.0 grams of ammonia is ≈ 9.07 grams.
To determine the mass of hydrogen required to produce 51.0 grams of ammonia (NH3) using the Haber process, we need to calculate the stoichiometric ratio between hydrogen and ammonia.
From the balanced chemical equation:
3 H₂(g) + N₂(g) → 2 NH₃(g)
We can see that for every 3 moles of hydrogen (H₂), we obtain 2 moles of ammonia (NH₃).
First, we need to convert the given mass of ammonia (51.0 grams) to moles. The molar mass of NH₃ is 17.03 g/mol.
Number of moles of NH₃ = Mass / Molar mass
= 51.0 g / 17.03 g/mol
≈ 2.995 moles
Next, using the stoichiometric ratio, we can calculate the moles of hydrogen required.
Moles of H₂ = (Moles of NH₃ × Coefficient of H₂) / Coefficient of NH₃
= (2.995 moles × 3) / 2
≈ 4.493 moles
Finally, we can convert the moles of hydrogen to mass using the molar mass of hydrogen (2.02 g/mol).
Mass of H₂ = Moles × Molar mass
= 4.493 moles × 2.02 g/mol
≈ 9.07 grams
Therefore, approximately 9.07 grams of hydrogen is needed to produce 51.0 grams of ammonia in the Haber process.
Know more about the mass of hydrogen here:
https://brainly.com/question/14083730
#SPJ8
Choose the equation below that is balanced correctly.
S8 +24 028 SO3
S8+ 12 0₂8 SO3
6 S8+8 026 SO3
2 S8 +3 022 SO3
The balanced equation for the reaction between sulfur (S₈) and oxygen (O₂) to form sulfur trioxide (SO₃) is 2S₈ + 16O₂ → 16SO₃.
What is the balanced chemical equation?Balancing chemical equations involves the addition of stoichiometric coefficients to the reactants and products.
The balanced equation for the reaction between sulfur (S₈) and oxygen (O₂) to form sulfur trioxide (SO₃) is determined as;
2S₈ + 16O₂ → 16SO₃
From the reactants side we can see that sulfur is 16 and also 16 in the product side. The number of oxygen in the reactant side is 32 and also 32 in the product side.
Thus, the balanced equation for the reaction between sulfur (S₈) and oxygen (O₂) to form sulfur trioxide (SO₃) is 2S₈ + 16O₂ → 16SO₃.
Learn more about balanced chemical equation here: https://brainly.com/question/26694427
#SPJ1
In the laboratory hydrogen gas is usually made by the following reaction:Zn(s)+2HCl(aq)=H2(g)+ZnCl2(aq)How many liters of H2 gas , collected over water at an atmospheric pressure of 752 mmHg and a temperture of 21 Co, can made from 3.566 g of Zn and excess HCl?the partial pressure of water vapor is 18.65mmHg at 21C0.A) 0.68LB) 2.72LC) 1.36LD) 1.33LE) 0.0975L
Answer:
The correct answer is option C, that is, 1.36 L.
Explanation:
The reaction mentioned in the question is:
Zn (s) + 2HCl (aq) ⇒ H2 (g) + ZnCl2 (aq)
It is clear that one mole of zinc is generating one mole of hydrogen gas as seen in the reaction. The mass of zinc mentioned in the question is 3.566 grams, the no of moles can be determined by using the formula,
n = mass / molecular mass
The molecular mass of zinc is 65.39 g/mol, now putting the values in the formula we get,
n = 3.566 g/ 65.39 g/mol
= 0.0545 mol
Based on the question, the partial pressure of water vapor is 18.65 mmHg and the atmospheric pressure is 752 mmHg. Therefore, the pressure of hydrogen gas will be,
Pressure of hydrogen gas (H2) = 752 mmHg - 18.65 mmHg
= 733.35 mmHg
The liters of hydrogen gas produced can be calculated by using the equation, PV =nRT
R is the gas constant, having the value 62.36 L mmHg/K/mol and T is the temperature (273 + 21 = 294 K).
Now putting the values in the equation we get,
733.35 mmHg * V = 0.0545 mol * 62.36 mmHg/K/mol * 294 K
= 999.19 L / 733.35
= 1.36 L
Hence, the volume of hydrogen gas is 1.36 L.
What does water vapor do to the density of the air
Answer:
The amount of water vapor in air influence density. Water vapor is relatively light compared to diatomic Oxygen and diatomic Nitrogen - the dominant components in air. When vapor content increases in moist air the amount of Oxygen and Nitrogen are decreased per unit volume and the density of the mix decreases since the mass is decreasing.
Explanation:
Most types of heather grow better in acidic soil.
In which TWO of the soil samples should heather grow well?
Answer:
A and C would be best for the Heather's
1 Which one of these atoms will have electrons in its outermost shell (highest energy level) that experience the greatest attractive force between themselves and the nucleus?
helium lithium fluorine potassium argon
Explain your answer. [4 marks]
2 Explain why potassium is more reactive than lithium. (I) [4 marks]
3 Explain why fluorine is more reactive than bromine. (4) [4 marks]
4 Predict the difference in reactivity, giving reasons, seen in:
a Group 2, between magnesium and calcium
[5 marks]
b Group 6, between oxygen and sulfur.
[5 marks]
In the reduction of 10.04g of the iron (III) oxide with hdrogen (with the formation of H20(g), ΔH^0 of H20(g) = -241.84 kJ/mol), 6.09 kJ of heat is absorbed. Find ΔH(f) (in kJ/mol) Fe2O3.
a) -822
b) 907
c) 94
d) 536
e) 1550
After solving the equation the correct answer is a) -822 kJ/mol.
What is equation?An equation is a mathematical statement that expresses two expressions as being equal. It contains an equal sign, and typically involves variables, numbers, and/or operations such as addition, subtraction, multiplication, and division. Equations can be used to solve for unknown values and to describe relationships between things. They are a powerful tool in mathematics, science, engineering, economics, and other fields.
The given equation is Fe2O3 + 3H2 → 2Fe + 3H2O. Since the enthalpy of formation of water, ΔHf^0 (H2O) is known, the enthalpy of formation of iron (III) oxide can be calculated as follows:
ΔHf^0 (Fe2O3) = -6.09 kJ - 3(-241.84 kJ/mol)
ΔHf^0 (Fe2O3) = -822 kJ/mol
Therefore, the correct answer is a) -822 kJ/mol.
To learn more about equation
https://brainly.com/question/28818351
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
¿What is a sulphurous gas?
¿What is a sulphurous gas?
Sulfur dioxide (SO) is a colorless gas with a pungent odor particular. Also called sulfite, it was used from centuries ago and its purpose is to preserve the aromas of the wine and the elimination of bacteria. It is also used in preservatives and antioxidants, and the food industries
They use it in dried fruit juices, jams and juices.
in terms of volume, how do ml and cm³ relate to one another?
Answer: 1 mL = 1 cm^3
Explanation:
This is a common conversion, 1 mL equals 1 cm^3. They are the same volume.
Please someone answer this asap
Answer:
b or c but I would just pick c
Answer:
C
Explanation:
Sun is an energy source not a matter.
A4 g sugar cube (Sucrose : C 12 H 22 O 11 ) is dissolved in a 350 ml teacup of 80 C water. What is the percent composition by mass of the sugar solution ? Density of water at 80 degrees * C = 0.975g / m * l Select one :- 1.96\% . 1.63% 1.36 % d% e 1.16 \%
Answer:
%Sgr = 1% (1 sig.fig.)
Explanation:
mass water = 350ml x 0.975g/ml = 341.25g
mass sugar added = 4g
solution mass = 341.25g + 4g = 345.25g
%sugar = (4g/345.25g)·100% = 1.1586% ≅ 1% (1 sig.fig)
The percent composition by the mass of the sugar solution is:
e. 1.16 %
This can be calculated by using mass of sugar.
Calculation of percent composition:Mass of water = 350ml x 0.975g/ml = 341.25g
Mass of sugar added = 4g
Total solution's mass = 341.25g + 4g = 345.25g
%sugar = (4g/345.25g)·100%
%sugar= 1.1586% ≅ 1.16 %
Thus, the percent composition of sugar is 1.16%. Hence, option E is correct.
Find more information about percent composition here:
brainly.com/question/17021926
In a reaction A+B--->C, reactant A has 5g of product C has 9g of product. How many grams should reactant B contain?
According to the law of conservation of Mass:
In a chemical reaction mass can neither be created nor be destroyed
So, we can say that: Mass of A + Mass of B = Mass of C
In the given reaction,
One of the reactants weigh 5 grams and another one weighs x grams
The mass of the product of this reaction is 9 grams
Mass of reactant B:
Mass of A + Mass of B = Mass of C
5 + x = 9
x = 4 grams
a crystal with symmetry of a=b≠c and α=β=γ≠90° and γ=60°
Structure does not refer to how the crystal appears on the outside, but rather to how the particles are arranged within. Therefore, a crystal with symmetry of a=b≠c and α=β=γ≠90° and γ=60° is rhombohedral.
What are crystal structure?A crystal's internal repeating pattern of atoms (or molecules or ions) is known as its crystal structure. These, however, are not fully independent because a crystal's exterior appearance is frequently tied to its interior organization.
For instance, the cubic sea salt (NaCl) crystals have a cubic look on a physical level. a crystal with symmetry of a=b≠c and α=β=γ≠90° and γ=60° is rhombohedral.
Therefore, a crystal with symmetry of a=b≠c and α=β=γ≠90° and γ=60° is rhombohedral.
To know more about crystal structure, here:
https://brainly.com/question/29392874
#SPJ1
Choose all the answers that apply.
What does the cardiovascular system do?
transports oxygen and carbon dioxide for the respiratory system
carries nutrients for the digestive system
works with the immune system to fight infection
carries hormones for the endocrine system
sends nerve impulses to the brain and spinal cord
Answer:
All of the above. The CV system transports blood and plasma the do all 4.
1. List 3 things that make it difficult for Mark to survive on Mars
2. Why did Nasa not want the crew to know that Mark was still alive?
3. How do you think Marks sense of humor helped him survive? Use 2 example from the movie
4. Explain how Mark is rescued.
Answer;
need more info.........
Explanation:
TUTOR Determining Molecular Weight
What is the molecular weight of Cr3(ASO4)2? amu
The molecular weight of Cr3(AsO4)2 is 433.827.
Is molecular weight the same As molar mass?Furthermore, the primary distinction between each is that molar mass gives the mass of a mole of a selected substance. While molecular weight is the mass of a molecule of a particular substance. At an equal time as the definition and devices are splendid for molar mass and molecular weight, the value is the same.
The sum of the atomic hundreds of all atoms in a molecule is based totally on a scale wherein the atomic loads of hydrogen, carbon, nitrogen, and oxygen are 1, 12, 14, and 16, respectively.
Learn more about molecular weight here https://brainly.com/question/26388921
#SPJ10
Cumulative Exam Active
41 42 43 144
The electron configuration of nitrogen (N) is
O 1s²2s²2p³
O 1s²2s²2p4
O 1s²2s²2p5
O 1s²2s²2p6
The answer is: The electronic configuration of Nitrogen is \(1s^22s^22p^3\).
Electronic configuration: The electronic configuration is defined as the distribution of electrons of an atom in the atomic or molecular orbitals and is written using the labels for the subshell.
How to decide which orbital is filled first?
The order in which electrons are filled in atomic orbitals as:(Shown in image)
Just follow the arrows to select the orbitals, s orbital can have 2 electrons, p can have 6 electrons, d can have 10 electrons and f can 14 electrons.The electronic configuration in which the outer shell is completely filled is known as noble-gas configuration as they are similar to electronic configurations of noble gases.Now, the given element is nitrogen (\(N\)). The atomic number of Nitrogen is 7. Thus, these 7 electrons are filled as-\(1s^22s^22p^3\)
Therefore, the electronic configuration of Nitrogen is \(1s^22s^22p^3\).To learn more about the electronic configuration, visit:
https://brainly.com/question/21977349
#SPJ4
Nitrogen's complete electron configuration is 12s2s22p3.
The shorthand electron configuration for noble gases is [He] 2s22p3. Nitrogen has an atomic number of 7. The nitrogen atoms' nucleus contain this many protons. An atom that is neutral has an equal number of protons and electrons. Thus, the ground state electron configuration will consist of 7 electrons in the suitable s and p orbitals (state of lowest energy). For nitrogen, the entire electron configuration is 1s22s22p. Scientists may easily express and explain how the electrons are organized around the nitrogen atom's nucleus by using the configuration notation for nitrogen (N). As a result, it is simpler to comprehend and forecast how atoms will cooperate to form chemical bonds.
Learn more about electronic configuration here-
https://brainly.com/question/11309892
#SPJ9
Roger has a car that accelerates at 5 m/s2. If the car has a mass 0f 1000 kg, how much force does the car produce?
Answer:
The answer is 5000 NExplanation:
The force acting on an object given it's mass and acceleration can be found by using the formula
force = mass × acceleration
From the question we have
force = 1000 × 5
We have the final answer as
5000 NHope this helps you
Answer:
5OOON
Explanation:
IM SMARTTT
An atom has 11 protons, 12 neutrons, and 10 electrons. What is the charge?
Answer:
The atom is Na, sodium with a net charge of +1 because it lost an electron. it usually has 11 electrons.
Explanation:
sodium has a 11 protons with an atomic mass of 23-11=12 neutrons.
To see the number of atoms of an element in a given molecule we need to multiply stoichiometry to the number that is written on the foot of the element that is stoichiometry. Therefore, the charge on atom is +1.
What is atom?Atom is the smallest particle of any element, molecule or compound. Atom can not be further divided. Atoms contains nucleus in its center and electron that revolve around the atom in fixed orbit.
In the nucleus, proton and neutron are present. Electron has -1 charge while proton has +1 charge. Neutron is neutral that is it has no charge. So overall the charge of nucleus is due to only proton, not by neutron.
Since the number of electrons is 10. The number of protons is 11. So, there is loss of one electron, so the charge on atom is +1.
Therefore, the charge on atom is +1.
To know more about atom, here:
https://brainly.com/question/13518322
#SPJ2
Given the following equilibrium constants:
Na2O(s) ⇌ 2 Na(l) + 1/2 O2(g) K1= 2 x 10^–25
NaO(g) ⇌ Na(l) + 1/2 O2(g) K2= 2 x 10^–5
Na2O2(s) ⇌ 2 Na(l) + O2(g) K3= 5 x 10^–29
NaO2(s) ⇌ Na(l) + O2(g) K4= 3 x 10^–14
Determine the value for the equilibrium constants for the following reaction:
2 NaO(g) ⇌ Na2O2(s)
Answer:
K = 8x10¹⁸
Explanation:
When you sum a reaction, the result of this sum has a K equal to the multiplication of the K's of the reactions involved in the sum
The sum of two times the reaction:
NaO(g) ⇌ Na(l) + 1/2 O₂(g) K₂ = 2x10⁻⁵
2 NaO(g) ⇌ 2 Na(l) + O₂(g) K = K₂ₓK₂ = (2x10⁻⁵)² = 4x10⁻¹⁰
The result of the inverse reaction:
Na₂O₂(s) ⇌ 2 Na(l) + O₂(g) K₃= 5x10⁻²⁹
2 Na(l) + O₂(g) ⇌ Na₂O₂(s) K = 1/K₃ = 2x10²⁸
And the sum of the two bolded reactions:
2 NaO(g) + 2 Na(l) + O₂(g) ⇌ 2 Na(l) + O₂(g) + Na₂O₂(s)
2 NaO(g) ⇌ Na₂O₂(s) K = 4x10⁻¹⁰× 2x10²⁸
K = 8x10¹⁸
what is the name of the the bending effect convex lenses do?
Convex lenses refract light inward toward a focal point. Light rays progress through the edges of a convex lens and are bent most.
What is it called when a convex lens bends light rays together?convex lenses are across in the middle. Rays of light that pass through the lens are conducted closer together (they converge). A convex lens is a meet lens. When parallel rays of light pass through a convex lens the refracted rays cross at one point called the principal focus.
. A convex lens is a connecting lens. When parallel rays of light pass through a convex lens the refracted rays merge at one point called the principal focus.
So we can conclude that Convex Lens. Concave Lens; It is known as a converging lens as light rays, when passed through this lens, tends to bend towards each other. It is known as a Convex Lens
Learn more about Convex Lens here: https://brainly.com/question/28039799
#SPJ1