The probability of rain in Nevada is 0.3. If it rains, the probability of the school bus being late is 0.4. If it does not rain, the probability of the school bus being late is 0.15. What is the probability that it will not rain? If it does not rain, the probability of the school bus bring on time is? What is the probability that it will rain and the school bus will be on time?

Answer:84.5

Step-by-step explanation:

Answer:

84.5

Step-by-step explanation:

1. Put the numbers in numerical order.

2. Cross out the numbers on the far left and right until you get to 84 and 85.

3. Add the two numbers and divide by 2.

Answer:

512 ft and 1,232 ft

Step-by-step explanation:

area is length x width

the pool's area can be calculated doing 32ft x 16ft

the area of the pool is 512 ft

the deck's area can be calculated doing 28ft x 44ft

the area of the deck is 1,232 ft

you're welcome<3

Answer:

A: 6 (-7 + 4)

B: (4 - 7) 6

C: 6 (7 - 4

The given expression (2x − 1)(4x + 3) − (9x + 1)(2x − 1) is equivalent to -10x^2 + 9x - 2, that is, option b.

If terms of the form (a + b) and (a + c) are to be multiplied, then each number or variable in the 1st term is multiplied by every variable in the 2nd term. Thus, (a + b)(a + c) = a^2 + ac + ab + bc.

Here, we are given an expression (2x − 1)(4x + 3) − (9x + 1)(2x − 1)

let us simplify the given expression-

[2x(4x) + 3(2x) -4x - 3] - [9x(2x) -9x + 2x -1)]

8x^2 + 6x - 4x - 3 - (18x^2 -9x + 2x -1)

8x^2 + 2x - 3 - 18x^2 +7x +1

8x^2 -18x^2  + 2x +7x -3 +1

-10x^2 + 9x - 2

Thus, option b is the correct answer.

Learn more about equations here-

https://brainly.com/question/2972832

#SPJ9

Your answer was incomplete. Check for the complete content below-

Which expression is equivalent to (2x − 1)(4x + 3) − (9x + 1)(2x − 1)?

a. 10x^2 + 9x - 2

b. -10x^2 + 9x - 2

c. 10x^2 - 9x + 2

d. -10x^2 + 9x - 8

Answer: sin(A+B)+sin(A-B)=2sinAcosB​

Step-by-step explanation:

sin(a+b) = sin(a)cos(b)+cos(a)sin(b)

sin(a-b) = sin(a)cos(b)-cos(a)sin(b)

sin(a)cos(b)+cos(a)sin(b)+sin(a)cos(b)-cos(a)sin(b) = 2sin(a)cos(b)

Answer:

True

Step-by-step explanation:

sin(A+B) + sin(A-B) = 2sin(A)cos(B)​

\(sin(t)+sin(s) = 2sin(\frac{t+s}{2} )cos(\frac{t-s}{2} )\)

\(sin(a+b) + sin(a-b) = 2sin(\frac{(a+b)+(a-b)}{2})cos(\frac{(a+b)-(a-b)}{2} )\)

\(2sin(\frac{(a+b)+(a-b)}{2})cos(\frac{(a+b)-(a-b)}{2} )\)

\(2sin(\frac{(a+a)+(b-b)}{2})cos(\frac{(a-a)+(b+b)}{2} )\)

\(2sin(\frac{2a}{2})cos(\frac{2b}{2} )\)

\(2sin(a)cos(b)\)

For the function f( x) = 3x- 2 and g( x) = x2, the workout fg( x) is 3x2- 2.

What is function?

A function in mathematics from a set X to a set Y allocates exactly one element of Y to each element of X. The sets X and Y are inclusively appertained to as the function's sphere and codomain, independently. originally, functions represented the idealized relationship between two changing amounts.

A formula, rule, or legislation that specifies how one variable( the independent variable) and another variable are related( the dependent variable).

Four orders of functions live functions with return values and arguments.

This function accepts arguments and gives back a result.

functions that take arguments but have no return values.

functions with return values and no arguments.

functions that have no arguments or return values.

we are given two function f( x) and g( x);

f( x) = 3x- 2 and

g( x) = x2

So, for fg( x), we've to put value of g( x) into f( x);

Hence, the equation will be;

fg( x) = 3x2- 2.

thus, for the function f( x) = 3x- 2 and g( x) = x2, the fg( x) is 3x2- 2.

Learn more about function click here:

brainly.com/question/11624077

#SPJ1

Answer:

  left to right, we have t/u < r/s < p/q.

Step-by-step explanation:

The properties of ordering tell you ...

 if a > b and b > c, then a > c

Here, we have a = p/q, b = r/s, c = t/u. The same property still applies:

  if p/q > r/s and r/s > t/u, then p/q > t/u

__

On a number line, the largest value is on the right:

  p/q is right of r/s

  r/s is right of t/u

therefore, ...

 p/q is right of t/u

Answer:

A. 0.4

Step-by-step explanation:

Write 12 of 30 as a fraction:

12/30

Convert this to be a fraction over 100 by setting up an equation:

Variable x = proportional answer to 12/30

12/30 = x/100

Cross multiply:

12 × 100 = 30 × x

1200 = 30x

40 = x

40/100

Convert this number into a decimal by adding a zero and decimal point before the "4" in 40:

0.40

Simplify:

0.40 = 0.4

I converted it into a decimal through the use of fractions, but you can also find the answer by doing long division: 12 ÷ 30. However, showing work for long division over a message is too complex so I solved the problem this way instead.

Answer:

16818165

Step-by-step explanation:

12 guests equal 555 liters

total guests 363636

divide 363636 by 12

result is 30303

multiply 30303 times 555

total is 16818165

\(▪▪▪▪▪▪▪▪▪▪▪▪▪  {\huge\mathfrak{Answer}}▪▪▪▪▪▪▪▪▪▪▪▪▪▪\)

Here's the solution ~

Area of a Trapezoid is :

\(\qquad \sf  \dashrightarrow \: \dfrac{1}{2} \times (sum \: of \: parallel \: sides) \times height = 133 \: c {m}^{2} \)

so ~

\(\qquad \sf  \dashrightarrow \: \dfrac{1}{2} \times ((x + 5) + (3x - 2)) \times (2x - 3) = 133 \: \)

\(\qquad \sf  \dashrightarrow \: \dfrac{1}{2} \times (x + 5+ 3x - 2) \times (2x - 3) = 133 \: \)

\(\qquad \sf  \dashrightarrow \: \dfrac{1}{2} \times (4x + 3) \times (2x - 3) = 133 \: \)

\(\qquad \sf  \dashrightarrow \: \dfrac{1}{2} \times(8 {x}^{2} - 12x + 6x - 9) = 133 \: \)

\(\qquad \sf  \dashrightarrow \: \dfrac{1}{2} \times(8 {x}^{2} - 6x - 9) = 133 \: \)

\(\qquad \sf  \dashrightarrow \: (8 {x}^{2} - 6x - 9) =( 133 \times 2)\: \)

\(\qquad \sf  \dashrightarrow \: 8 {x}^{2} - 6x - 9 =266\: \)

\(\qquad \sf  \dashrightarrow \: 8 {x}^{2} - 6x - 9 - 266 = 0\)

\(\qquad \sf  \dashrightarrow \: 8 {x}^{2} - 6x - 275 = 0\)

hence, we got the required equation ~

\(\\ \rm\hookrightarrow \dfrac{1}{2}(Sum\:of\: parallel\:sides)(Height)=133\)

\(\\ \rm\hookrightarrow \dfrac{1}{2}(x+5+3x-2)(2x-3)=133\)

\(\\ \rm\hookrightarrow 4x+3(2x-3)=266\)

\(\\ \rm\hookrightarrow 4x(2x-3)+3(2x-3)=266\)

\(\\ \rm\hookrightarrow 8x^2-12x+6x-9=266\)

\(\\ \rm\hookrightarrow 8x^2-6x=266+9\)

\(\\ \rm\hookrightarrow 8x^2-6x=275\)

\(\\ \rm\hookrightarrow 8x^2-6x-275=0\)

Answer:

The answer is

\(A = 4.53 \times {10}^{17} \: {m}^{2} \)

Step-by-step explanation:

Since the Earth's moon is a sphere

Surface area of a sphere from the question is given by

A = 4πr²

where r is the radius

To find the radius using the diameter we use the formula

radius = diameter / 2

\(radius \: = \frac{3.8 \times {10}^{8} }{2} \)

\(radius = 1.9 \times {10}^{8} \: m\)

π = 3.14

Substitute these values into the above formula

That's

\(A = 4 \times 3.14 \times ({1.9 \times {10}^{8} })^{2} \)

We have the final answer as

\(A = 4.53 \times {10}^{17} \: {m}^{2} \)

Hope this helps you

Let w be the weight on point s. Since the sum of the weights is 1, the weight on point t is 0.625, we can write:

w + 0.625 = 1

Subtracting 0.625 from both sides, we get:

w = 1 - 0.625 = 0.375

Therefore, the weight on point s is 0.375.

The equivalent expression to  4√3 is  √48 or 6.928.

An equivalent expression is an expression that has equal value to the original given expression.

From the given expression, we can determine its equivalent expression as follows;

The given expression = 4√3

We can square 4 and multiply it by 3 and enclose all with the square root.

4√3 = √(4² x 3 )

= √ ( 16 x 3 )

= √ ( 48 )

= 6.928

Learn more about equivalent expression here: https://brainly.com/question/22365614

#SPJ1

a) He needs 500 g of sugar to make apple crumble for 16 people.

b) She needs 45 g of flour to make apple crumble for 2 people.

c) 500g of apples is enough to make apple crumble for 6 people.

The amounts for this problem are obtained according to the proportions given in the problem.

For 8 people, the amount of sugar needed is of 250 g. For 16 people, the  number of people doubles, hence the amount of sugar needed will also double, as follows:

2 x 250 = 500 g.

For 2 people, the amount of each item is divided by 4, hence the amount of flour needed is given as follows:

180/4 = 45 g.

The amount of apple needed per people is of:

700/8 = 87.5 grams.

For 6 people, the amount is given as follows:

6 x 87.5 = 525 grams.

Hence 500g of apples is enough to make apple crumble for 6 people.

More can be learned about proportions at https://brainly.com/question/24372153

#SPJ1

Answer:

2+2=4 and 3+1=4

Step-by-step explanation:

Hope this Helps! :)

Answer:

2+2=4 and 3+1=4 hope thsi helps!

Step-by-step explanation:

Answer:

Answer:

Step-by-step explanation:

1st- rewrite the subtraction expression as the first number

2nd- + the opposite of second number

Answer:

0.75 g ≤ 35

Step-by-step explanation:

if each games costs $0.75, then the answer of g will be given by 35/0.75.

he can go up to exactly $35 but not over

so, the inequality is given by 0.75 g ≤ 35

It should be noted that Ted is not saving any money, therefore he may be missing a budget. This is evident from the fact that his total cash outflow for the month is equivalent to his total cash inflow.

It should be noted that a budget is an estimation of revenue and expenses over a period of time and is usually compiled on a periodic basis.

It should be noted that budgets can be made for a person, a business, a government.

Based on the information, Ted is not saving any money, therefore he may be missing a budget. This is evident from the fact that his total cash outflow for the month is equivalent to his total cash inflow.

Learn more about budget on:

https://brainly.com/question/6663636

#SPJ1

a) Angle of line of sightFrom a point O in the school compound, Adeolu is 100 m away on a bearing N 35° E and Ibrahim is 80 m away on a bearing S 55° E. (a) How far apart are both boys? (b) (c) What is the bearing of Adeolu from point O, in three-figure bearings? What is the bearing of Ibrahim from point O, in three-figure bearings?The angle of the line of sight of Adeolu from the point O is given by:α = 90 - 35α = 55°.The angle of the line of sight of Ibrahim from the point O is given by:β = 90 - 55β = 35°.a) By using the Sine Rule, we can determine the distance between Adeolu and Ibrahim as follows:$

\frac{100}{sin55^{\circ}} = \frac{80}{sin35^{\circ}

100 sin 35° = 80 sin 55°=57.73 mT

herefore, both boys are 57.73 m apart. b) The bearing of Adeolu from the point O can be determined as follows:OAN is a right-angled triangle with α = 55° and OA = 100. Therefore, the sine function is used to determine the side opposite the angle in order to determine AN.

Thus:$$sin55^{\circ} = \frac{AN}{100}$$AN = 80.71 m.

To find the bearing, OAD is used as a reference angle. Since α = 55°, the bearing is 055°.

Therefore, the bearing of Adeolu from the point O is N55°E. c) Similarly, the bearing of Ibrahim from the point O can be determined as follows:OBS is a right-angled triangle with β = 35° and OB = 80. Therefore, the sine function is used to determine the side opposite the angle in order to determine BS.

Thus:$$sin35^{\circ} = \frac{BS}{80}$$BS = 46.40 m.

To find the bearing, OCD is used as a reference angle. Since β = 35°, the bearing is 035°.Therefore, the bearing of Ibrahim from the point O is S35°E. A boy walks 5 km due North and then 4 km due East. (a) Find the bearing of his current posi- tion from the starting point.

(b) How far is the boy now from the start- ing point?The boy's position is 5 km North and 4 km East from his starting position. The Pythagorean Theorem is used to determine the distance between the two points, which are joined to form a right-angled triangle. Thus

:$$c^2 = a^2 + b^2$$

where c is the hypotenuse, and a and b are the other two sides of the triangle. Therefore, the distance between the starting position and the boy's current position is:$$

c^2 = 5^2 + 4^2$$$$c^2 = 25 + 16$$$$c^2 = 41$$$$c = \sqrt{41} = 6.4 km$$

Therefore, the boy is 6.4 km from his starting point. (a) The bearing of the boy's current position from the starting point is given by the tangent function.

Thus:$$\tan{\theta} = \frac{opposite}{adjacent}$$$$\tan{\theta} = \frac{5}{4}$$$$\theta = \tan^{-1}{\left(\frac{5}{4}\right)}$$$$\theta = 51.34^{\circ}$$

Therefore, the bearing of the boy's current position from the starting point is N51°E.

For such more question on triangle

https://brainly.com/question/1058720

#SPJ8

Two quantities are in the golden ratio if their ratio is the same as the ratio of their sum to the larger of the two quantities.

It should be noted that the Golden ratio is also called the golden mean or divine proportion.

The Golden ratio is refered to as the. most beautiful number in the universe.

It is extraordinary because it can be visualized everywhere from geometry to the human body.

In this case, quantities are in the golden ratio if their ratio is the same as the ratio of their sum to the larger of the two quantities.

Learn more about ratio on:

brainly.com/question/2328454

#SPJ1

Step-by-step explanation:

Using the dividend discount model and the information given:

D1 = $2.00

beta = 0.9

risk-free rate = 4.2%

market risk premium = 4.5%

current stock price = $28.00

First, we need to find the required rate of return for the stock using the capital asset pricing model (CAPM):

r = r_rf + beta * (r_m - r_rf)

r = 0.042 + 0.9 * 0.045

r = 0.0831 or 8.31%

Next, we can use the dividend discount model to find the expected stock price at the end of 3 years:

D1 = D0 * (1 + g)

D0 = D1 / (1 + g)

P0 = D1 / (r - g)

P3 = D3 / (r - g)

P0 = current stock price = $28.00

D0 = D1 / (1 + g) = $2.00 / (1 + g)

D3 = D0 * (1 + g)^3

Substituting these values and solving for P3:

$28.00 = $2.00 / (1 + g) / (0.0831 - g)

$28.00 * (0.0831 - g) = $2.00 / (1 + g)

0.002343 - 0.028g + 0.0831g - 0.0831g^2 = 0.002343 + 0.002g

0.0831g^2 - 0.026g - 0.002343 = 0

g = 0.069 or 6.9%

Now we can use the dividend discount model again to find the expected stock price at the end of 3 years:

P3 = $2.00 * (1 + 0.069) ^ 3 / (0.0831 - 0.069)

P3 = $38.81

Therefore, the market believes the stock price at the end of 3 years will be $38.81

Answer:

The answer is B) the span of the roof is 4

Step-by-step explanation:

The span is 30 meters if the pitched roof is built with a 1:3 ratio of rise to span.

It is described as the comparison of two quantities to determine how many times one obtains the other. The proportion can be expressed as a fraction or as a sign: between two integers.

We have:

A pitched roof is built with a 1:3 ratio of rise to span

rise/span = 1/3

rise = 10 meters

10/span = 1/3

span = 3×10 = 30 meters

Thus, the span is 30 meters if the pitched roof is built with a 1:3 ratio of rise to span.

Learn more about the ratio here:

brainly.com/question/13419413

#SPJ2

When the figure passed through the transformations the image formed is similar to the image at B as attached

The figure is in the second quadrant

clockwise rotation 90degrees about the origin will being the figure to the first quadrant

Translation 9 units down will bring an image to the -6 of the y direction in the fourth quadrant

reflection over the y axis will create a mirror image of the figure and make the image at the third quadrant

The option B correctly shows the final image

Learn more about transformation here:

https://brainly.com/question/29321312

#SPJ1

The inverse function of f(x) = 3x + 5 is given as follows:

C. p(x) = 1/3x - 5/3.

The function in the context of this problem is defined as follows:

f(x) = 3x + 5.

To obtain the inverse function, first we must exchange the variables x and y, hence:

y = 3x + 5

x = 3y + 5.

Now we must isolate the variable y, hence:

3y = x - 5

y = (x - 5)/3.

p(x) = 1/3x - 5/3.

More can be learned about inverse functions at https://brainly.com/question/3831584

#SPJ1

Using the normal distribution, it is found that the correct option is:

In a normal distribution with mean and standard deviation , the z-score of a measure X is given by:

\(Z = \frac{X - \mu}{\sigma}\)

In this problem:

P(Y < 16) is the p-value of Z when X = 16, hence:

\(Z = \frac{X - \mu}{\sigma}\)

\(Z = \frac{16 - 20}{2.3}\)

\(Z = -1.74\)

\(Z = -1.74\) has a p-value of 0.041.

This is valid for the entire population, hence, the correct interpretation is:

A similar problem is given at https://brainly.com/question/24663213

Answer:

440 in ^2 in the surface area

Step-by-step explanation:

Hope this helps

Answer: -7

Step-by-step explanation:

-22 -(-7)

-22 + 7

-15

Since the temperature got colder, your answer is going to be a negative number.

The missing statement in the proof specified is given by: Option B: ∠BCA≅∠DCB

What is the reflexive property of congruence?

According to the reflexive feature of congruence, the geometric quantity under consideration—be it an angle, a line segment, a form, etc.—is congruent to itself.

The third step's key concept in this instance is the "Reflexive Property of Congruence."

The fourth phase comes to the conclusion that the ΔABC~ΔBDC criteria for similarity are met.

Since it was established in the second stage that ∠ABC≅∠BDC

Therefore, in order for the fourth step to apply angle-angle similarity, which requires the angles of two considered triangles to be congruent, we must demonstrate another angle pair of triangles ΔABC and ΔBDC being congruent in the third step.

Internal angle C is the common angle in the triangles ABC and BDC.

As a result, it is consistent with itself due to its reflexive characteristic.

We obtain the following notation for internal angle C from triangle ABC:

Angle ACB and BCA(both will work)

Triangle BDC gives us the following notation for internal angle C:

Angle DCB and BCD(Both will function.)

They fit together. The second choice takes angle C into account, so:

∠BCA≅∠DCB (second option) is the missing statement.

Learn more about the reflexive property of congruency here:

brainly.com/question/862440

#SPJ4

it's d dkdkdkdkdkdkdkdkj

Answer:

The answer is D. If the bread is the same, it's still $4.25. If the soup is less than $1.50 for Mrs. Lee, it couldn't be A, B, or C.