The pattern for an inclusion is a magnetic particle buildup forming is not a well-defined statement. It is unclear what is meant by "pattern for an inclusion" and how it relates to the formation of a magnetic particle buildup.
Inclusions in materials can refer to impurities, foreign particles, or defects present within the material structure. The formation of a magnetic particle buildup typically occurs in the presence of a magnetic field, where magnetic particles align and adhere to a surface, creating a visible buildup or pattern.
However, without more context or specific information, it is challenging to provide a precise explanation or further interpretation of the statement. Clarifying the context or providing additional details would be helpful in addressing the topic more accurately.
to learn more about magnetic particle click here:brainly.com/question/29833158
#SPJ11
Which equation is derived from the combined gas law?
StartFraction V subscript 1 over T subscript 1 EndFraction equals StartFraction V subscript 2 over T subscript 2 EndFraction.
StartFraction V subscript 1 over T subscript 2 EndFraction equals StartFraction V subscript 2 over T subscript 1 EndFraction.
V subscript 1 T subscript 1 equals P subscript 2 T subscript 2.
P subscript 1 V subscript 1 T subscript 1 equals P subscript 2 V subscript 2 T subscript 2.
The equation derived from the combined gas law is option D: P₁V₁T₁ = P₂V₂T₂. Option D
The combined gas law combines Boyle's law, Charles's law, and Gay-Lussac's law into a single equation that relates the pressure, volume, and temperature of a gas sample. It allows us to analyze changes in these variables while keeping the amount of gas constant.
Boyle's law states that at a constant temperature, the pressure and volume of a gas are inversely proportional. In other words, if the volume of a gas decreases, its pressure increases, and vice versa. This is expressed as P₁V₁ = P₂V₂.
Charles's law states that at a constant pressure, the volume and temperature of a gas are directly proportional. If the temperature of a gas increases, its volume increases, and vice versa. This is expressed as V₁/T₁ = V₂/T₂.
Gay-Lussac's law states that at a constant volume, the pressure and temperature of a gas are directly proportional. If the temperature of a gas increases, its pressure increases, and vice versa. This is expressed as P₁/T₁ = P₂/T₂.
By combining these three laws, we obtain the combined gas law equation: (P₁V₁)/T₁ = (P₂V₂)/T₂. To eliminate the division, we can cross-multiply to get P₁V₁T₂ = P₂V₂T₁, which can be rearranged as P₁V₁T₁ = P₂V₂T₂.
This equation allows us to calculate the final values of pressure, volume, or temperature when any two of these variables change while the amount of gas remains constant. It is particularly useful in analyzing the behavior of gases under different conditions or when studying gas systems.
Option D
For more such question on gas law visit:
https://brainly.com/question/27870704
#SPJ8
Answer:
it was A for me.. don't know if this will help
Explanation:
why are earthquakes different in New Madrid than in California.
based on the reconstructed temperatures you saw and changes in solar irradiance and co2 concentrations over the past millennium, what century do you expect to have the largest simulated temperatures from the gcms?
20th century was expected to have the largest simulated temperature from the gas chromatography mass spectrometry.
What is temperature and gcms and what century had largest temperatures from gcms?Temperature is the measure of degree of hotness and coldness wither of a substance or a region.Gcms is gas chromatography-mass spectrometry is a complex analysis phenomena in which first gas samples are analyzed first.The sample of solid, liquid and gas are taken and in case of liquid the sample is vapourized to detect the presence of substance.Here the question is asking which century had most temperature from gas chromatography and mass spectrometry.Hence 20th century was supposed to have maximum temperature from gas chromatography and mass spectrometry.To know more about temperature visit:
https://brainly.com/question/11464844
#SPJ4
Given that sodium bicarbonate dissociates to form Na+
and HCO3- when mixed with water, which of
these would be part of the explanation for taking bicarbonate
(NaHCO3) for excess stomach acid?
When bic
Bicarbonate (HCO3-) would be part of the explanation for taking bicarbonate (NaHCO3) for excess stomach acid.
When mixed with water, sodium bicarbonate dissociates into Na+ and HCO3-. Bicarbonate acts as a base that reacts with the acid in the stomach to neutralize it, causing carbon dioxide gas and water to be produced as by-products. This makes sodium bicarbonate an effective antacid for treating heartburn and other forms of acid reflux.The neutralization reaction can be written as follows:NaHCO3 + HCl → NaCl + CO2 + H2O
Where NaHCO3 is sodium bicarbonate, HCl is hydrochloric acid, NaCl is sodium chloride, CO2 is carbon dioxide, and H2O is water. Bicarbonate neutralizes the acid in the stomach, reducing symptoms of heartburn and other types of acid reflux.
To know more about Bicarbonate visit:-
https://brainly.com/question/32692550
#SPJ11
Given the standard enthalpy changes for the following two reactions
Given the standard enthalpy changes for the following two reactions:
(1) 2C(s) + 2H2(g)C2H4(g)...... ΔH° = 52.3 kJ
(2) 2C(s) + 3H2(g)C2H6(g)......ΔH° = -84.7 kJ
what is the standard enthalpy change for the reaction:
(3) C2H4(g) + H2(g)C2H6(g)......ΔH° = ?
The standard enthalpy change for reaction (3) is 117.1 kJ.
The standard enthalpy change for reaction (3) can be calculated by using the enthalpy changes of reactions (1) and (2) and applying Hess's Law.
To do this, we need to manipulate the given equations so that the desired reaction (3) can be obtained.
First, we reverse reaction (1) to get the formation of C2H4(g) from C2H6(g):
C2H4(g)C2H6(g) ΔH° = -52.3 kJ
Next, we multiply reaction (2) by 2 and reverse it to obtain 2 moles of C2H6(g) reacting to form 3 moles of H2(g):
2C2H6(g)2C(s) + 3H2(g) ΔH° = 169.4 kJ
Now, we add the two modified equations together:
C2H4(g)C2H6(g) ΔH° = -52.3 kJ
2C2H6(g)2C(s) + 3H2(g) ΔH° = 169.4 kJ
When adding these equations, the C2H6(g) on the left side cancels out with the C2H6(g) on the right side, leaving us with the desired reaction (3):
C2H4(g) + H2(g)C2H6(g) ΔH° = -52.3 kJ + 169.4 kJ = 117.1 kJ
Learn more about standard enthalpy here :-
https://brainly.com/question/28303513
#SPJ11
what planet has a 16 hour day
Answer:
Neptune
Explanation:
how many moles of iron are in 4.8 x 10^24 atoms of iron
Answer:
7.97 moles
Explanation:
The number of moles (n) of iron (Fe) in this question can be calculated by dividing its number of atoms by Avogadro's number (6.02 × 10²³ atoms).
That is;
n = number of molecule ÷ Avogadro's number
According to this question, the number of atoms of Fe is given as 4.8 x 10²⁴ atoms.
Hence,
n = 4.8 x 10²⁴ ÷ 6.02 × 10²³
n = 4.8/6.02 × 10^(24-23)
n = 0.797 × 10¹
n = 7.97 moles
Mg (s) + 2HCl (aq) → MgCl2 (aq) + H2 (g)
If you start with 4.50 grams of Magnesium (Mg), how many grams of Hydrogen gas (H2) will you theoretically...
Answer:
Explanation:
So you should obtain 0.1875 moles of H2 The theoretical yield of H2, in grams, can be found by multiplying the 0.1875 moles by the molar mass of H2 (2 grams/mole). We would expect, and love to find, 0.37g in our possession.
what gas (name and formula) is produced in the chemical reaction of iron metal and hydrochloric acid
Additional Practice Questions
6. If you dissolve 2.31 g of barium hydroxide into 250 mL of water and the barium hydroxide is fully ionized, what will
your resulting pH be?
pH of solution = 13.033
Further explanationGiven
2.31 g Ba(OH)₂
250 ml water
Required
pH of solution
Solution
Barium hydroxide is fully ionized, means that Ba(OH)₂ is a strong base
So we use a strong base formula to find the pH
[OH ⁻] = b. Mb where
b = number of OH⁻ /base valence
Mb = strong base concentration
Molarity of Ba(OH)₂(MW=171.34 g/mol) :
\(\tt M=\dfrac{mol}{L}=\dfrac{2.31~g\div 171.34~g/mol}{0.25~L}\\\\M=0.054\)
Ba(OH)₂ ⇒ Ba²⁺ + 2OH⁻(b=valence=2)
[OH⁻]= 2 . 0.054
[OH⁻] = 0.108
pOH= - log 0.108
pOH=0.967
pOH+pH=14
pH=14-0.967
pH=13.033
According to a recent pol, 25% of adults in a certain area have high levels of cholesterol. They ceport that such elevated fevels "could be financialy devastating to the regions heathcare instem" and are a major concern to health insurance providers. Assume the standard deviation from the recent studies is accurate and known. According to recent studies, cholesterol levels in healthy adults from the area average about 205 mg/dL, with a standard deviation of about 35 mg/dL, and are roughly Normally distributed. If the cholesterol levels of a sample of 46 healthy adults from the region is taken, answer parts (a) through (d)
(a) What is the probability that the mean cholesterol level of the sample will be no more than 205?
Plys 205) 0.5 (Round to three decimal places as needed.)
(b) What is the probability that the mean cholesterol level of the sample will be between 200 and 2107
P(200
(c) What is the probability that the mean cholesterol level of the sample will be less than 1957
Ply<195) (Round to three decimal places as needed)
(d) What is the probability that the mean cholesterol level of the sample will be greater than 2179
Py>217) (Round to three decimal places as needed)
Hence, the probability that the mean cholesterol level of the sample will be greater than 217 is 0.034. Answer: 0.034.According to the given statement, we have the following data.
mean (μ) = 205 mg/dLstandard deviation
(σ) = 35 mg/dLsample size
(n) = 46(a) Probability that the mean cholesterol level of the sample will be no more than 205.To find this, we will use the z-score formula.z
= (x - μ) / (σ/√n)Here,
x = 205
μ = 205
σ =
35n
= 46Plugging in these values, we get,
z = (205 - 205) / (35/√46)
z = 0Hence, the probability that the mean cholesterol level of the sample will be no more than 205 is 0.5. Answer: 0.5
(b) Probability that the mean cholesterol level of the sample will be between 200 and 210:
To find this, we need to standardize the values and use the z-table.P(z < (210 - 205) / (35/√46)) - P(z < (200 - 205) / (35/√46))P(z < 1.65) - P(z < -1.65) = 0.4495 - 0.0505
= 0.3990Hence, the probability that the mean cholesterol level of the sample will be between 200 and 210 is 0.3990. Answer: 0.3990
(c) Probability that the mean cholesterol level of the sample will be less than 195: To find this, we need to standardize the values and use the z-table.P(z < (195 - 205) / (35/√46))P(z < -2.91) = 0.002Hence, the probability that the mean cholesterol level of the sample will be less than 195 is 0.002. Answer: 0.002
(d) Probability that the mean cholesterol level of the sample will be greater than 217: To find this, we need to standardize the values and use the z-table.P(z > (217 - 205) / (35/√46))P(z > 1.82) = 0.034 Answer: 0.034.
To know more about data visit:
https://brainly.com/question/29117029
#SPJ11
which of these is true about the angle of incidence and angle of reflection
The synthesis of nylon requires solutions of 5% hexamethylenediamine and 5% adipoyl chloride. This polymer will form Choose... To remove the nylon, Choose... Choose... in the 5% hexamethylenediamine in the 5% adipoyl chloride in between layers of the solutions
The synthesis of nylon requires solutions of 5% hexamethylenediamine and 5% adipoyl chloride. This polymer will form between layers of the solutions. To remove the nylon, one can choose to dissolve it in the 5% hexamethylenediamine or in the 5% adipoyl chloride.
Nylon, a synthetic polymer, is produced from the combination of adipoyl chloride and hexamethylenediamine. This process is called the synthesis of nylon. Nylon is a highly flexible material that is resistant to wear and tear, as well as chemical and heat degradation. The synthesis of nylon requires solutions of 5% hexamethylenediamine and 5% adipoyl chloride, respectively, for the two reactants to be mixed together.
The reaction between these two chemicals is exothermic, which means that it releases heat. The heat generated in the reaction drives the reaction forward, resulting in the formation of nylon. The chemical formula for nylon is (-CO-NH-)n, where n is a large number that reflects the degree of polymerization. To remove the nylon, it is soaked in an acid solution. The acid dissolves the nylon, separating it into its constituent components, which can then be purified and reused.
The most commonly used acid for this process is hydrochloric acid. The process of removing nylon from its solvent is called the "acid-catalyzed hydrolysis of nylon." Nylon is used in a variety of applications, including textiles, packaging materials, and electrical components, among others. Its properties make it ideal for use in applications that require durability, strength, and flexibility. Nylon's physical properties, including its resistance to heat and chemical degradation, make it ideal for use in applications such as electrical insulation, packaging materials, and textiles.
Know more about nylon here:
https://brainly.com/question/25835424
#SPJ8
Using dimensional analysis, convert 523.7 cm into feet. (1 in= 2.54 cm; 12 in=1 ft)
-15962
-2471
-17.18
-43.64
Answer:
17.18
Explanation:
(1 in = 2.54 cm; 12 in = 1 ft)
Formula:- Divide the length value by 30.48
523.7 ÷ 30.48 = 17.181
Thus, The answer is 17.181
-TheUnknownScientist
Answer:
17.18
Explanation:
I hope its helpful......
The resistance of a thermometer is 5 ohm at 25 degree Celsius and 6 2 at 50 degree Celsius. Using linear approximation, calculate the value of resistance temperature coefficient at 45 degree Celsius.
The approximate resistance value at 45 degrees Celsius is around 5.8 ohms.
To calculate the value of the resistance temperature coefficient at 45 degrees Celsius using linear approximation, we can use the formula:
R(T) = R0 + α(T - T0),
where R(T) is the resistance at temperature T, R0 is the resistance at a reference temperature T0, α is the resistance temperature coefficient, and (T - T0) is the temperature difference.
Given that the resistance at 25 degrees Celsius is 5 ohms (R0 = 5) and the resistance at 50 degrees Celsius is 6 ohms (R(T) = 6), we can calculate the value of α.
6 = 5 + α(50 - 25),
Simplifying the equation:
1 = 25α,
Therefore, α = 1/25 = 0.04 ohm/degree Celsius.
Using the linear approximation, we can approximate the value of the resistance at 45 degrees Celsius:
R(45) = 5 + 0.04(45 - 25) = 5 + 0.04(20) = 5 + 0.8 = 5.8 ohms.
Therefore, the value of the resistance at 45 degrees Celsius is approximately 5.8 ohms.
You can learn more about resistance at
https://brainly.com/question/17563681
#SPJ11
Draw (1R, 2S, 4R)-1,2,4-trimethylcyclohexane. Show stereochemistry using wedges and dashes.
Here is the drawing of (1R, 2S, 4R)-1,2,4-trimethylcyclohexane with stereochemistry shown using wedges and dashes
H
|
H--C---C---C--H
| | | | |
H--C---C---C--H
| | |
CH3 CH3
In this drawing, the solid wedge represents a bond that is coming out of the plane of the paper towards the viewer, and the dashed wedge represents a bond that is going into the plane of the paper away from the viewer. The stereochemistry of the molecule is indicated by the labels (1R, 2S, 4R), which refer to the configurations of the chiral centers at carbons 1, 2, and 4, respectively.
Know more about stereochemistry here: https://brainly.com/question/13266152
#SPJ4
3. Which of the following is an example of a polyatomic ion?
a. NO
b. OP-
C. CI
d. Ca²+
Answer:D
Explanation:polyatomic means more then one and it have more then 1 positive ion
2. How many milliliters of 0.95M sodium hydroxide must be added to 35.0 mL of 0.85M acetic acid to reach the equivalence point? Given: K, for acetic acid is 1.8 x 10-5 A) What is the pH before any bas
The balanced equation for the reaction between sodium hydroxide and acetic acid is;
CH3COOH(aq) + NaOH(aq) → CH3COONa(aq) + H2O(l)
Hence,
sodium acetate and water are formed when sodium hydroxide is added to acetic acid.
This is a neutralization reaction where the number of moles of acid is equivalent to the number of moles of base. The volume and molarity of the solutions are used to calculate the number of moles of acid and base respectively.
Moles of acetic acid = 0.85M × 0.035L = 0.02975 moles
Moles of sodium hydroxide = (0.95M)(x mL/1000 mL)
Sodium hydroxide and acetic acid are strong base and weak acid respectively. The weak acid dissociates partially in water to form acetate ions (CH3COO-) and hydrogen ions (H+). The hydrogen ion concentration can be determined using the acid dissociation constant (Ka) for acetic acid
Ka = [H+][CH3COO-]/[CH3COOH]1.8 × 10-5 = [H+]2/[0.02975 - H+][H+]2 = 5.4 × 10-10[H+] = 7.35 × 10-6 pH = -log[H+] = 5.13
Before adding any base, the pH of the acetic acid solution is 5.13.
The equivalence point is reached when the number of moles of base is equivalent to the number of moles of acid.
Hence,
0.02975 moles of sodium hydroxide are required.
The volume can be calculated as follows:0.02975 moles = (0.95M)(x mL/1000 mL)x = 31.32,
31.32 mL of 0.95M sodium hydroxide must be added to 35.0 mL of 0.85M acetic acid to reach the equivalence point.
To know more about sodium hydroxide visit:
https://brainly.com/question/10073865
#SPJ11
1. How many atoms are in 3.5 moles of nickel?
The number is 6.022 x 10^23 atoms/mol.
The photograph shows one way individuals work together in groups. What
kind of work is shown in the photograph?
If a beach ball has a volume of 261 L at a temperature of 502 K, what will be the new
temperature of the balloon if the volume decreases to 176 L? Formula: V/T, -V2/T2
The new temperature of the balloon if the volume is decreased to the given amount is 338.5K.
Charles's law
Charles's law states that the volume occupied by a definite quantity of gas is directly proportional to its absolute temperature.
It is expressed as;
\(\frac{V_1}{T_1} = \frac{V_2}{T_2}\)
Given the data in the question;
Initial volume; \(V_1 = 261L\)Initial temperature; \(T_1 = 502K\)Final volume; \(V_2 = 176L\)Final Temperature; \(T_2 = \ ?\)
To determine the new temperature as the volume is decrease, we substitute our given values into the expression above.
\(\frac{V_1}{T_1} = \frac{V_2}{T_2}\\\\V_1T_2 = V_2T_1\\\\261L * T_2 = 176L * 502K\\\\261L * T_2 = 88352L.K\\\\T_2 = \frac{88352L.K}{261L}\\ \\T_2 = 338.5K\)
Therefore, the new temperature of the balloon if the volume is decreased to the given amount is 338.5K.
Learn more about Charles's law: https://brainly.com/question/12835309
what mass of water should be added to 22.0 g of kcl to make a 5.50y mass solution? practice show your work.
To make a 5.50% mass solution of KCl, you should add 94.50 grams of water to 22.0 grams of KCl.
To determine the mass of water needed to make a 5.50% mass solution of KCl, we need to consider the following:
Mass percent = (mass of solute / mass of solution) x 100%
Given:
Mass percent = 5.50%
Mass of KCl = 22.0 g
Mass of solution = ?
Mass of water = ?
Let's assume the mass of the solution is 100 grams. Since the mass percent is given as 5.50%, we can calculate the mass of KCl in the solution:
Mass of KCl = (5.50 / 100) x 100 g = 5.50 g
The mass of water can be obtained by subtracting the mass of KCl from the total mass of the solution:
Mass of water = Mass of solution - Mass of KCl
Mass of water = 100 g - 5.50 g
Mass of water = 94.50 g
Therefore, to make a 5.50% mass solution of KCl, you should add 94.50 grams of water to 22.0 grams of KCl.
Learn more about Mass percent here:
https://brainly.com/question/5840377
#SPJ11
U
Question 4
1 pts
(05.02 MC)
What is the molar mass of magnesium carbonate, MgCO3?
ton
52314 g/mol
O 84.313 g/mol
o 96.771 g/mol
102.588 g/mol
N
Answer:
84.313 g/mol
Explanation:
Magnesium Carbonate molecular weight. Molar mass of MgCO3 = 84.313 g/mol.
What is the protons role in the atom?
yes correct answer......
same answer by me .....
follow me and make me as brilliest.....the study of how quickly chemical reactions occur, in a measure of the change in reactant (or product) concentration per unit of time. the factors that affect this speed.
The study of how quickly chemical reactions occur is known as reaction kinetics.
About reaction kineticsIt is a measure of the change in reactant (or product) concentration per unit of time. There are several factors that affect the speed of a reaction, including:
1. Temperature: Increasing the temperature of a reaction increases the speed of the reaction. This is because the molecules have more energy and move faster, causing more collisions between the reactants.
2. Concentration: Increasing the concentration of the reactants also increases the speed of the reaction. This is because there are more molecules available to collide with each other.
3. Surface area: Increasing the surface area of the reactants can increase the speed of the reaction. This is because there are more places for the molecules to collide with each other.
4. Catalysts: Adding a catalyst to a reaction can increase the speed of the reaction. A catalyst is a substance that speeds up a reaction without being consumed by the reaction.
5. Pressure: Increasing the pressure of a reaction can also increase the speed of the reaction. This is because the molecules are closer together, which increases the frequency of collisions between the reactants.
Learn more about reaction kinetics at
https://brainly.com/question/29136970
#SPJ11
Convert 87.68 kg to g
87680 grams
nssjsjsnbsjs
Answer:
87.68 times 1000 so that equals 87680 grams.
Explanation:
Consider this reaction:
At a certain temperature it obeys this rate law.
rate
Suppose a vessel containsat a concentration of. Calculate the concentration ofin the vesselseconds later. You may assume no other reaction is important
The concentration of A after 30 seconds when the given reaction obeys the rate law rate = k[A]²[B].
We use the initial concentration of A and B and the rate constant of the reaction to find the rates at these concentrations. Using the integrated rate law for a second-order reaction, we find the concentration of A after 30 seconds to be 0.0934 M.
Given reaction obeys the rate law, rate=k[A]²[B].
Here, the initial concentration of A= 0.10 M,
initial concentration of B = 0.05 M, and
rate constant, k = 2.0 × 10⁻⁴ M⁻¹s⁻¹
We have to find the concentration of A, after 30 seconds.
To find the concentration of A, we need to know the rate at 0.10 M and 0.05 M. Therefore, we have to calculate the rates at these concentrations.
rate1 = k[A]²[B]
= (2.0 × 10⁻⁴ M⁻¹s⁻¹)(0.10 M)²(0.05 M)
= 1.0 × 10⁻⁷ M/srate2
= k[A]²[B] = (2.0 × 10⁻⁴ M⁻¹s⁻¹)(0.09 M)²(0.04 M)
= 6.48 × 10⁻⁸ M/s
Using the integrated rate law for a second-order reaction: [A] = [A]₀ - kt where [A]₀ = initial concentration of A, k = rate constant, and t = time in seconds.
We know [A]₀ = 0.10 M and k = 2.0 × 10⁻⁴ M⁻¹s⁻¹.
Substituting the values in the above equation, we get: [A] = [A]₀ - kt= 0.10 M - (2.0 × 10⁻⁴ M⁻¹s⁻¹)(30 s)≈ 0.0934 M
Therefore, the concentration of A in the vessel after 30 seconds is 0.0934 M.
This question requires us to calculate the concentration of A after 30 seconds when the given reaction obeys the rate law rate = k[A]²[B].
We are given the initial concentration of A and B and the rate constant of the reaction. To find the concentration of A after 30 seconds, we need to calculate the rates at the initial concentrations of A and B.
Using the integrated rate law for a second-order reaction, we can find the concentration of A at any given time. We substitute the given values in the formula and solve for [A]. We get the concentration of A as 0.0934 M after 30 seconds. This calculation is based on the assumption that no other reaction is important.
The concentration of A after 30 seconds when the given reaction obeys the rate law rate = k[A]²[B]. We use the initial concentration of A and B and the rate constant of the reaction to find the rates at these concentrations. Using the integrated rate law for a second-order reaction, we find the concentration of A after 30 seconds to be 0.0934 M. This calculation assumes that no other reaction is important.
To know more about concentration visit:
brainly.com/question/13872928
#SPJ11
The lowest parts of a transverse wave are called
1.Transversals
2.summits
3.troughs
4.crest
ecosystems do not have similar climates and every plant is different True or false
The combustion of glucose, c6 h12 o6 (s), produces carbon dioxide, co2 (g), and water, h2 o(g), according to the equation below. upper c subscript 6 upper h subscript 12 upper o subscript 6 (s) plus 6 upper o subscript 2 (g) right arrow 6 upper c upper o subscript 2 (g) plus 6 upper h subscript 2 upper o (l). the enthalpy of the reaction is –2,840 kj. what is the heat of combustion, per mole, of glucose?
The heat of combustion per mol of the glucose is 2840 kJ.
A reaction that involves the burning of a compound in the presence of air or oxygen is called combustion. In the absence of oxygen combustion of a compound cannot take place.
It is given that the combustion of glucose produces carbon dioxide and water. The balanced chemical reaction for the given process is expressed as:
C6H12O6 (s) + 6O2 (g) ------> 6CO2 (g) + 6H2O (l)
The energy released from this reaction is -2840 kJ. The above equation clearly shows that 1 mol of glucose is used during the reaction and the energy produced is -2840 kJ.
Therefore, the heat of combustion per mol of the glucose is 2840 kJ.
Learn more about combustion here:
https://brainly.com/question/13096727
#SPJ4