Answer:
CHCL3= 11.73 mL
CHBr3= 8.268 mL
Explanation:
Let x be the mL of CHCl3 and y be the mL of CHBr3, then we have:
y+x = 20 mL
1.492x+2.89y=2.07* 20.0 mL
Volume of CHCl₃ [V(CHCl₃)] = 7.68 ml and Volume of CHBr₃ [V(CHBr₃)] = 12.32 ml
How to find the volume of mixture ?D × V = M
where,
D is density
V is volume
M is mass
Density of CHCl₃ = 1.492 g/ml
Density of CHBr₃ = 2.890 g/ml
Total volume of mixture = 20.0 ml
Let X ml be the volume of CHCl₃
And Y ml be the volume of CHBr₃
So, the sum of volumes is equal to the total volume of mixture required.
X ml + Y ml = 20 ml .....(i)
Now,
Density × Volume = Mass
Density of CHCl₃ × Volume of CHCl₃ + Density of CHBr₃ × Volume of CHBr₃ = Density of mixture × Volume of mixture
(1.492 g/ml) × (X ml) + (2.890 g/ml) × (Y ml) = (2.33 g/ml) × (20.0 ml) ...... (ii)
By solving equation (i) and (ii)
(1.492 g/ml) × (X ml) + (2.890 g/ml) × (Y ml) = (2.33 g/ml) × (20.0 ml) .....(ii)
X ml + Y ml = 20 ml .....(i)
Multiply equation (i) by 1.492, we get
(1.492 g/ml) × (X ml) + (2.890 g/ml) × (Y ml) = (2.33 g/ml) × (20.0 ml)
(1.492 g/ml) × (X ml) + (1.492 g/ml) × (Y ml) = (1.492 g/ml) × (20.0 ml)
Now, subtract the equation
(1.492 g/ml) × (X ml) + (2.890 g/ml) × (Y ml) = (2.33 g/ml) × (20.0 ml)
(1.492 g/ml) × (X ml) + (1.492 g/ml) × (Y ml) = (1.492 g/ml) × (20.0 ml)
- - -
______________________________________________________
(1.398 g/ml) × (Y ml) = 17.226
Y = 12.32 ml
Now put the value of Y in equation (i)
X ml + Y ml = 20 ml
X + 12.32 ml = 20 ml
X = 20 ml - 12.32 ml
X = 7.68 ml
Thus, from above conclusion we can say that Volume of CHCl₃ [V(CHCl₃)] = 7.68 ml and Volume of CHBr₃ [V(CHBr₃)] = 12.32 ml
Learn more about the Density here: https://brainly.com/question/1354972
#SPJ2
A student makes a solution that is 3.4 m. If she used 123.4 g of water, how many moles of solute did she use?
Describe how crystals change if they form in large amounts of space vs limited space.
Crystals form when magma cools because the solution is super-saturated with certain minerals. Because the crystals do not have much time to form if the magma cools quickly, they are very small. The crystals have enough time to grow and become large if the magma cools slowly.
What causes big crystals to form?When the solution becomes supersaturated, which means there is too much salt dissolved in the water, crystals form. Crystals form from the extra salt (or other material). To obtain a supersaturated solution, either cool the solution or allow some of the water to evaporate.
The size of the crystals is affected by the solubility of the compound in the solvent used for recrystallization, the number of nucleation sites, mechanical agitation of the system, and time during crystal growth.
Thus, the crystals do not have much time to form if the magma cools quickly, they are very small.
To learn more about the crystals, follow the link;
https://brainly.com/question/13008800
#SPJ9
Which of the following statements are true concerning the results of the Human Genome Project? Check all that apply.
Researchers now have maps of every human’s genome.
The Human Genome Project has raised many complicated ethical issues.
All medical conditions can be attributed to a specific gene.
Researchers now have a map of an “average” human genome.
The following statement is true concerning the results of the Human Genome Project:
The Human Genome Project has raised many complicated ethical issues.
What is Human Genome?
The human genome refers to the complete set of genetic information (DNA) present in human cells. It includes both the protein-coding and non-coding regions of DNA. The human genome is made up of about 3 billion base pairs and is organized into 23 pairs of chromosomes. The study of the human genome is an important field of genetics and has many implications for understanding human biology, evolution, and disease.
The Human Genome Project was a scientific research project that aimed to identify and map all the genes in the human genome, which contains all the genetic information needed for human development and function. The project was completed in 2003 and provided a wealth of information about the structure and function of the human genome, including the location and sequence of all human genes.
Learn more about Human Genome from the given https://brainly.com/question/29479722
#SPJ1
How is the rate of a reflection affected when the temperature increases
The rate of a reflection decreases when the temperature increases
This goes to say that the rate of reflection will go down more whenever there is an increase in temperature
What is reflection?Reflection can simply be defined as the the throwing back by a body of light without absorbing it.
reflection of
In conclusion, the rate of a reflection decreases when the temperature increases
Learn more about reflection:
https://brainly.com/question/1908648
#SPJ1
In the following unbalanced combustion reaction how many grams of C8H18 will react with 24.78g of O2.
7.10 grams of C₈H₁₈ will react with 24.78 g of O₂ in this unbalanced combustion reaction.
What is meant by combustion reaction?Type of chemical reaction that occurs when substance reacts with oxygen gas to produce energy in the form of heat and light is called combustion reaction .
To balance the combustion reaction: C₈H₁₈ + 12.5 O₂ -> 8 CO₂ + 9 H₂O
The coefficients show that 12.5 moles of O₂ are needed to react with 1 mole of C₈H₁₈.
1 mole of O₂ has a mass of 32 g, so 24.78 g of O₂ is:
24.78 g / 32 g/mol = 0.774 mol of O₂
0.774 mol of O₂ / 12.5 mol of O₂/mol of C₈H₁₈ = 0.06192 moles of C₈H₁₈
0.06192 moles of C8H18 x 114.23 g/mol of C₈H₁₈ = 7.10 g of C₈H₁₈
Therefore, 7.10 grams of C₈H₁₈ will react with 24.78 g of O₂ in this unbalanced combustion reaction.
To know more about combustion reaction, refer
https://brainly.com/question/13251946
#SPJ1
How is the A Hf related to the AH of a reaction?
A. The AHreaction is the sum of the A Hf, products and the A Hf,
reactants
B. The AHreaction is the same thing as the AHf, reactants
C. The AHreaction is the same thing as the AHf, products
OD. The A Hreaction is the difference between A Hf, products and A
reactants
[hm
The A Hreaction is the difference between A Hf, products and A
reactants. option D
What is the enthalpy of formation?Enthalpy of formation (also known as heat of formation) is the amount of heat released or absorbed when one mole of a compound is formed from its constituent elements in their standard states at a given temperature and pressure. The standard state for an element is its most stable form at a given temperature and pressure, typically 25°C and 1 atm.
Enthalpy of formation is an important parameter in thermochemistry and is used to determine the energy requirements for chemical reactions, such as combustion reactions or the synthesis of new compounds.
Learn more about enthalpy:https://brainly.com/question/13996238
#SPJ1
Account for the low reactivity of chlorobenzene toward Ag+
The resonance structures that result form the reaction of chlorobenzene toward Ag^+ are unstable hence the low reactivity.
Why is there low reactivity?Let us recall that the kind of reaction that is going to occur here is the nucleophilic reaction. The implication of that is that the center that is going to be attacked is a center that is positive.
We now have to look at the structure of the chlorobenzene as we can see from the structures of the resonance of the compound that have been shown in the image attached.
The resonance structures that are formed by the compound are not stable and such the attacked does not lead to the production of chemical species that are stable and this is why the reactivity of the chlorobenzene towards the sliver ion is low.
Learn more about reactivity:https://brainly.com/question/1598581
#SPJ1
Predict the formula for a compound made from X3+ and Y− .
Answer:
XY₃
Explanation:
We have cations of the X³⁺ type and anions of the Y⁻ type. For a compound to be formed, it has to be electrically neutral, that is, it must have the same number of positive charges and negative charges so that the final charge of the compound is zero. In this case, the compound would be neutral if it had 1 atom of X³⁺ and 3 atoms of Y⁻. The resulting chemical formula would be XY₃.
Seamus is conducting an experiment on electric force. He wants to get an approximate idea of how much force the charges will generate. Drag and drop the tiles to show the force of each situation in increasing order from lowest to highest (with repulsive forces being positive and attractive forces being negative).
=
One object with a charge of -4 × 10-5 C and another with a charge of 3 × 10-5 C placed 0.5
meters apart
One object with a charge of 3 x 10- C and another with a charge of -3 × 10-5 C placed 1
E
meter apart
= Two objects with a charge of 4 × 10-5 C placed 1 meter apart
= Two objects both with a charge of 3 × 10-5 C placed 0.5 meters apart
One object with a charge of 3 x 10- C and another with a charge of 4 x 10 C placed 1
E
meter apart
The highest electric force exerted by charges -4 ×10⁻⁵ C and 3 ×10⁻⁵ C placed 0.5 m apart is equal to 43.15 N.
The lowest electric force exerted by charges 3 ×10⁻⁵ C and 3 ×10⁻⁵ C placed 1 m apart is equal to 8.10 N.
What is coulomb's law?According to Coulomb’s law, the force of attraction between two charges is equal to the product of their charges and is inversely proportional to the square of the distance. This electric force applies along the line joining the two charges.
The magnitude of the electric force can be written as follows:
\(\displaystyle F = k\frac{q_1q_2}{r^2}\)
where k is constant proportionality = 8.99 × 10⁹ N.m²/C².
Given the charge on one point charge, q₁ = 4 ×10⁻⁵ C
The charge on the other point charge, q₂ = - 3 × 10⁻⁵C
The distance between these two charges, r = 0.5 m
The magnitude of electric force between the charges will be:
\(\displaystyle F = 8.99\times 10^{9}\times \frac{4\times 10^{-5}\times 3\times 10^{-5}}{(0.5)^2}\)
F = 43.15 N
Given the charge on one point charge, q₁ = 3 ×10⁻⁵ C
The charge on the other point charge, q₂ = 3 × 10⁻⁵C
The distance between these two charges, r = 1 m
The magnitude of force between the charges will be:
\(\displaystyle F = 8.99\times 10^{9}\times \frac{3\times 10^{-5}\times 3\times 10^{-5}}{(1)^2}\)
F = 8.1 N
Learn more about Coulomb's law, here:
brainly.com/question/506926
#SPJ1
What is the Name of molecule and smiles strings ?
Explanation:
Aromatic nitrogen bonded to hydrogen, as found in pyrrole must be represented as [nH] ; thus imidazole is written in SMILES notation as n1c[nH]cc1 . When aromatic atoms are singly bonded to each other, such as in biphenyl, a single bond must be shown explicitly: c1ccccc1-c2ccccc2 .
The Croatian seismologist, Andrija Mohorovicic, discovered a boundary change in the Earth's layers. Please explain how he discovered this using two to three sentences using your best grammar.
The Croatian seismologist, Andrija Mohorovicic, discovered a boundary change in the Earth's layers because he noticed that P-waves were refracted at the boundary.
Who is a seismologist?Seismologists are described as Earth scientists, specialized in geophysics, who study the genesis and the propagation of seismic waves in geological materials.
Andrija Mohorovicic realized that as one crosses the boundary the predominant mineral composition of the rock changes, and the minerals on the mantle side enable seismic waves to travel faster.
Learn more about Seismologists at: https://brainly.com/question/676287
#SPJ1
Which compounds, on heating with an excess of concentrated sulfuric acid, produce only one product with molecular formula C7H10? [choices on the picture]
Answer:
1 and 2
Explanation:
When Concentrated H2SO4 reacted with the alcohols, they produce cycloalkenes. This is a mechanism known as dehydration of alcohols with an acid catalyst. This is because concentrated H2SO4 acts as a great oxidizing agent. In the process, the alcohols are heated to a high temperature with an excess of pure sulfuric acid. By passing the gases through a sodium hydroxide solution, the carbon dioxide and sulfur dioxide produced by reactive species are eliminated. The reaction mechanism shown in the image below indicates that only compounds 1 and 2 produce only one product.
if 650J heat is absorbed by a system and 450J work is done on the system, then find the change in internal energy of the system
Answer: 380 J. Please mark
Explanation:
A 1.555-g sample of baking soda decomposes with heat to produce 0.991 g Na2CO3. Refer to Example Exercise 14.l and show the calculation for the theoretical yield of Na2CO3.
What is the percent yield of sodium carbonate, Na2CO3?
6. A 1473-g unknown mixture with baking soda is heated and has a mass loss of 0.325 g. Refer to Example Exercise 14.2 and show the calculation for the percentage NaHCOs in the mixture.
Answer:
a) 101%
b)59.7%
Explanation:
The equation for the thermal decomposition of baking soda is shown;
2NaHCO3 → Na2CO3 + H2O + CO2
Number of moles of baking soda= mass/molar mass= 1.555g/84.007 g/mol = 0.0185 moles
From the reaction equation;
2 moles of baking soda yields 1 mole of sodium carbonate
0.0185 moles of baking soda will yield = 0.0185 moles ×1 /2 = 9.25 ×10^-3 moles of sodium carbonate.
Therefore, mass of sodium carbonate= 9.25 ×10^-3 moles × 106gmol-1= 0.9805 g of sodium carbonate. This is the theoretical yield of sodium carbonate.
%yield = actual yield/theoretical yield ×100
% yield = 0.991/0.9805 ×100
%yield = 101%
Since ;
2NaHCO3 → Na2CO3 + H2O + CO2
And H2O + CO2 ---> H2CO3
Hence I can write, 2NaHCO3 → Na2CO3 + H2CO3
Molar mass of H2CO3= 62.03 gmol-1
Molar mass of baking soda= 84 gmol-1
Therefore, mass of baking soda=
0.325/62.03 × 2 × 84 = 0.88 g of NaHCO3
% of NaHCO3= 0.88/1.473 × 100 = 59.7%
The decomposition reaction of baking soda is a reaction in which water and carbon dioxide ae given off as gaseous products.
5. The theoretical yield of Na₂CO₃ is approximately 0.9809 gramsThe percentage yield of sodium carbonate is approximately 101.02%.6. Percentage of NaHCO₃ in the mixture is approximately 59.76%.Reasons:
Mass of baking soda = 1.555 g
Mass of Na₂CO₃ produced = 0.991 g
Required:
Calculation for the theoretical yield
Solution:
Theoretical yield (mass) of Na₂CO₃ produced is found as follows;
Molar mass of Na₂CO₃ = 105.9888 g/mol
Molar mass of NaHCO₃ = 84.007 g/mol
\(\displaystyle 1.555 \, g \, NaHCO_3 \times \frac{1 \, mol \, NaHCO_3}{84.007 \, g \, NaHCO_3} \times \frac{1 \, mol \, Na_2CO_3}{2 \, mol \, NaHCO_3} \times 105.9888 \ g \approx 0.9809 \, g \, Na_2CO_3\)
The theoretical yield of Na₂CO₃ ≈ 0.9809 grams.
The percentage yield is given as follows;
\(\displaystyle Percentage \ yield = \mathbf{\frac{Actual \, Yield}{Theorectical \, Yield} \times 100 \%}\)
The percentage yield of Na₂CO₃ is therefore;
\(\displaystyle Percentage \ yield \ of \ Na_2CO_3= \frac{0.991}{0.9809} \times 100 \% \approx \underline{ 101.02 \%}\)
(Some baking soda may remain if the reaction is not completed)
6. Mass of the unknown mixture of baking soda = 1473 g
Mass loss from the mixture = 0.325 g
Required:
The percentage of NaHCO₃ in the mixture.
Solution:
The chemical in the mass loss from heating the NaHCO₃ = H₂CO₃
Molar mass of H₂CO₃ = 62.03 g/mol
\(\displaystyle \mathrm{Number \ of \ moles \ of \ H_2CO_3 \ produced} = \frac{0.325 \, g}{62.03 \, g/mol} \approx 5.2394 \times 10^{-3} \ moles\)
The chemical reaction is presented as follows;
2NaHCO₃(s) \(\underrightarrow {\Delta \ Heated}\) Na₂CO₃(s) + H₂CO₃(g)2 moles of NaHCO₃ produces 1 mole of H₂CO₃The number of moles of NaHCO₃ in the mixture is therefore;
2 × 5.2394 × 10⁻³ moles ≈ 1.04788 × 10⁻² molesMass of NaHCO₃ in the mixture is therefore
Mass of NaHCO₃ = 1.04788 × 10⁻² moles × 84.007 g/mol = 0.88029 g\(\displaystyle Percentage \ of \ NaHCO_3 \ in \ the \ mixture \ = \mathbf{ \frac{Mass \ of \ NaHCO_3}{Mass \ of \ mixture} \times 100}\)
Which gives;
\(\displaystyle Percentage \ of \ NaHCO_3 \ in \ the \ mixture \ = \ \frac{0.88029 \, g}{1.473 \, g} \times 100 \approx \underline{ 59.76 \%}\)Learn more here:
https://brainly.com/question/21091465
What theoretical mass of NaCl would result from reacting 3.0
moles of NaHCO3 with excess HCI (aqueous)
The theoretical mass of NaCl would result from reacting 3.0 moles of NaHCO3 with excess HCI is 175.32 g.
This problem is solved by using the concept of moles:
What is mole?Mole is a term which is defined as a ratio of theoretical mass of compound to the molar mass of compound.
Mathematically,
Moles = given mass/molar mass
Molar mass of NaCl = 58.44 g/Mol
Now we have to calculate the moles of NaCl
\(NaHCO_{3} + HCl = > NaCl + H_{2}O + CO_{2}\)
From the chemical equation, we noticed that moles of NaHCO3 is equal to moles of NaCl.
Since moles of NaHCO3 = 3
Therefore, moles of NaCl = 3
Now, by substituting all the values, we get
Theoretical mass of NaCl = 3 x 58.44 = 175.32 g
Thus we concluded that the theoretical mass of NaCl would result from reacting 3.0 moles of NaHCO3 with excess HCI is 175.32 g
Learn more about Moles:
https://brainly.com/question/15209553
#SPJ1
show is a pedigree chart. the chart shows that sally is carrier for red-green color blindness
Answer:
you cant post pictures on brainly answers.... can you?
Explanation:
The average birth weight of domestic cats is about 3 ounces. Assume that the distribution of birth weights is Normal with a standard deviation of 0 4 ounce.
a. Find the birtn weight of cats at the 90th percentile.
b. Find the birth weight of cats at the 10th percentile
The birth weight of cats at the 90th percentile would be approximately 3.7 ounces. b. The birth weight of cats at the 10th percentile would be approximately 2.3 ounces.
What are the methods of calculating weight?There are three main methods of calculating weight:
1. Balance Beam Scale: A balance beam scale is an example of a mechanical weighing system. It uses a set of calibrated weights to measure the weight of an object.
2. Digital Scale: A digital scale uses an electronic or digital readout to display the weight of an object.
3. Calipers: Calipers are devices used to measure the distance between two points, such as thickness or diameter. They come in various sizes and shapes, depending on the type of measurement the user wants to take.
What is birth weight?Birth weight is the weight of a baby at the time of birth. It is usually measured soon after delivery, with a special baby scale, though sometimes the baby's weight is estimated. The normal range of birth weight is anywhere between 5 lbs 8 oz and 10 lbs, though preterm or premature babies may be significantly lighter. A baby's birth weight is important because it can provide a clue to the baby's overall health. High birth weights may indicate an underlying medical condition, and low birth weights can be a sign of premature or difficult delivery and health risks associated with such a delivery.
To know more about birth weight, visit:
https://brainly.com/question/19262426
#SPJ1
how to calculate molar extinction coefficient with wavelength and absorbance
The molar extinction coefficient is specific to the substance being measured and the wavelength of light used. Accurate and precise values for absorbance, concentration, and path length are necessary for an accurate calculation.
How to calculate molar extinction coefficient with wavelength and absorbanceTo calculate the molar extinction coefficient (ε) using wavelength (λ) and absorbance (A):
Apply the Beer-Lambert Law: A = εclA is the absorbance, ε is the molar extinction coefficient (in M^-1 cm^-1), c is the concentration of the substance (in M), and l is the path length of the sample (in cm).Rearrange the equation: ε = A / (cl)Ensure that concentration is in molar units (M) and path length is in centimeters (cm).Divide the absorbance by the product of the concentration and path length to obtain the molar extinction coefficient (ε).Learn more on molar extinction coefficient here https://brainly.com/question/31088826
#SPJ1
A person plugs a power cord into an electrical outlet in the wall. The power cord is covered in black rubber .Which statement is an accurate description of the materials?
Electrons would easily move through the person if there was no rubber around the wire
Electrons would not move through the wire if there was no rubber around the wire
Electrons easily move through the rubber around the wire
Electrons move through air when the cord is a few inches from the outlet
Answer:
A
Explanation: The rubber around the wire is an insulator, and the wire i would imagine would be made out of something like copper. Electricity runs through everything and without the insulator there, you'd be touching metal that electricity is running through.
13. Classify the following as pure substances or as mixtures:
air
gasoline
grain alcohol
gold
salt water
water
Simery
mercury
sugar
oxygen
Pure substances - gasoline, grain alcohol, gold, water, mercury, sugar, and oxygen.
Mixtures - air, salt water.
Pure substances vs Mixtures
Pure substances are made up of only one type of molecule. On the other hand, mixtures are substances that are a mix of two or more different molecules.
Mixtures can be heterogenous when the different molecules are not evenly distributed or homogenous when the molecules are uniformly distributed within the substance.
Gasoline, grain alcohol, gold, water, mercury, sugar, and oxygen all consist of a single type of molecule. They are thus, pure substances.
Air is a mixture of different gases such as oxygen, carbon dioxide, nitrogen, etc. Salt water is a mixture of water and salt.
More on mixtures can be found here: https://brainly.com/question/24898889
#SPJ1
Why don't solids, liquids, and gases leave Earth's atmosphere? A) Only gases can leave the atmosphere. B) Matter on Earth is destroyed and recycled. C) Gravity keeps all matter on Earth.
Answer:
The answer is C) Gravity keeps all matter on Earth.
Explanation:
I took the test and this was correct!
(Not a fake answer like some, I promise!)
A 10.0 cm3 sample of copper has a mass of 89.6 g. What is the density of copper
Answer:
Density = 8.96 g/cm³Explanation:
The density of a substance can be found by using the formula
\(Density = \frac{mass}{volume} \)
From the question
mass of copper = 89.6 g
volume = 10 cm³
Substitute the values into the above formula and solve
That's
\(Density = \frac{89.6}{10} \)
We have the final answer as
Density = 8.96 g/cm³Hope this helps you
If you had 0.08841 mol of sucrose present in a 625 mL aqueous solution, what would be the molarity of the solution? (Remember that molarity is defined in terms of liters of the solution!)
The molarity of the solution with 0.08841 moles of sucrose in 625 mL of aqueous solution is 0.1414 M.
Given the number of moles of sucrose (n) = 0.08841mol
The volume of aqueous sucrose solution (V) = 625mL = 0.625L
Let the molarity of solution = M
Molarity (M) is the number of moles of solute per liter of solution. To find the molarity of a solution, we need to divide the number of moles of solute by the number of liters of solution.
Therefore, the molarity of the solution with 0.08841 moles of sucrose in 625 mL of aqueous solution can be calculated as follows:
Molarity (M) = (moles of solute(n)) / (Volume of solution(V))
M = (0.08841 mol sucrose) / (0.625 L solution)
M = 0.1414M sucrose
To learn more about molarity click here https://brainly.com/question/8732513
#SPJ1
I WILL MARK YOU THE BRANLIEST!!!
Which property shows that electrons are quantized?
A. Electrons are attached to protons.
B. Each electron has its own "address."
C. Each electron carries a charge.
D. Electrons have very little mass.
Answer:
B. Each electron has its own "address."
Explanation:
This is the correct answer.
Good luck with the rest, and have a good day : )
Each electron has its own "address." Therefore, the correct option is option B among all the given options.
What is quantization?The elementary electric charge of the electron is a negative one, making it a subatomic particle. Due to their lack of components or substructure, electrons, which are part of the lepton particles family's first generation, are typically regarded to be elementary particles. The mass of an electron is roughly 1/1836 that of a proton.
The electron has a half-integer intrinsic rotational momentum that is represented in terms of the decreased Planck constant,, among its quantum mechanical features. The rule of exclusion developed by Pauli states that because electrons are fermions, no two of them may be in the same quantum state. Since they're capable of collide against other particles as well as can be bent like light, electrons, like all primary particles, display both wave and particle characteristics. Each electron has its own "address."
Therefore, the correct option is option B.
To know more about quantization, here:
https://brainly.com/question/24256516
#SPJ2
It took Lily 7 seconds to ride her bike 35 m to the end of the block what was her speed
Answer:
5
35 divided by 7 = 5
Explanation:
Hope this helps!!
Liyah
An electron in the ground state absorbs a single photon of light and then relaxes back to the ground state by emitting an infrared photon (1200 nm) followed by an orange photon (600 nm). What is the wavelength of the absorbed photon?
A. 400 nm
B. 600 nm
C. 1800 nm
A powder contains feso47h2o
The mass of FeSO4*7H2O in the sample is 1.21 grams.
Calculate moles of Fe2O3
moles of Fe2O3 = mass of Fe2O3 / Molar mass of Fe2O3
moles of Fe2O3 = 0.348 grams / 159.69 g/mole = 0.00218 moles
Calculate moles of Fe
4 Fe + 3O2 → 2Fe2O3
For 4 moles of Fe consumed there is 2 moles of Fe2O3 produced
This means it has a ratio 2:1
So 0.00218 moles of Fe2O3 produced , there is 2*0.00218 = 0.00436 moles of Fe consumed
Calculate moles of FeSO4*7H2O
Fe + H2SO4 + 7H2O → FeSO4*7H20 + H2
For 1 mole of Fe consumed there is 1 mole of FeSO4*7H2O produced
This means for 0.00436 moles there is 0.00436 moles of Fe2SO4*H2O produced
Calculate the mass of FeSO4*7H2O in the sample
mass of FeSO4*7H2O = 0.00436 moles * 278.01 g/mole = 1.212 g
The mass of FeSO4*7H2O in the sample is 1.21 grams.
Complete question: A powder contains FeSO4⋅7H2O (molar mass=278.01 g/mol), among other components. A 3.930 g sample of the powder was dissolved in HNO3 and heated to convert all iron to Fe3+. The addition of NH3 precipitated Fe2O3⋅xH2O, which was subsequently ignited to produce 0.348 g Fe2O3. What was the mass of FeSO4⋅7H2O in the 3.930 g sample?
To learn more about Molar mass visit:https://brainly.com/question/12127540
#SPJ9
calculate the relative formula mass of copper oxide if O=16 and Cu=64
Copper oxide, CuO has a relative formula mass of 80.
What is the Relative Formula mass?
This refers to the total of the relative atomic masses of the atoms in the numbers seen in the formula.
What is Relative Atomic mass?This refers to the relative mass of atoms when compared with the carbon-12 atoms Ar. Relative formula mass is a measure of relative mass, thus it has no unit.
Calculating Relative Formular mass?Solve for the number of atoms each element presents in the chemical formula. Sum the Relative atomic values for all the atoms present. From the question:O=16 and Cu=64
copper oxide, CuO= (1 * 64) + (1 * 16)
= 64 + 16
=80
Where,
1 = The subscript value of the element present.
Learn more about Relative Formular mass on
https://brainly.com/question/10632827
#SPJ1
Hypothesis II: Write the equation with Iron (III) Chloride and balance it: Iron + Copper (II) chloride --> Iron (III) chloride + Copper
Answer:
Fe + CuCl2 = FeCl2 + Cu
Explanation:
This is already balanced.
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.