Select all answer choices that would result in units of moles.

a) RT/PV
b) PV/RT
c) mass ÷ molar mass
d) molar mass ÷ mass
e) molar mass × mass
f) molarity ÷ volume
g) volume ÷ molarity
h) molarity × volume

The given question is an incomplete question, the complete question is given below.

Use this equation to answer the questions that follow.

\(3O_2(g)+N_2(g)\rightarrow 2NO_3(g)\)

5 moles of oxygen gas are present. How many moles of \(NO_3\) will be produced with this amount of oxygen gas?

Answer : The moles of \(NO_3\) produced will be 3.33 moles.

Explanation : Given,

Moles of oxygen gas = 5 moles

Now we have to calculate the moles of \(NO_3\).

The given balanced chemical equation is:

\(3O_2(g)+N_2(g)\rightarrow 2NO_3(g)\)

From the balanced chemical equation we conclude that,

As, 3 moles of \(O_2\) gas react to produces 2 moles of \(NO_3\) gas

So, 5 moles of \(O_2\) gas react to produces \(\frac{2}{3}\times 5=3.33\) moles of \(NO_3\) gas

Therefore, the moles of \(NO_3\) produced will be 3.33 moles.

Explanation:

Rate = 84mL/s

A minute has 60 seconds;

Rate = 84mL/s * 60s = 5040 mL/minute

Volume of blood in a minute = Rate * Number of beeats per minute

Volume = 5040 * 72 = 362880 mL

How long to circulate 3500ml?

1 minute = 362880mL

x = 3500 mL

x = 3500mL min / 362880mL

Math Expression:

Time to circulate 3500ml of blood (min) = 3500ml * 1 minute / Volume of blood at a rate of 84ml/s and 72 beats per minute (ml)

The best description of cis-trans isomers is that they differ in their spatial arrangement around inflexible double bonds. Option E is correct.

Specifically, cis-trans isomers are a type of stereoisomers that have the same molecular formula and the same covalent bonds but differ in the spatial arrangement of their atoms due to the inflexibility of a double bond. In cis isomers, the two substituents on each carbon atom are on the same side of the double bond, while in trans isomers, the two substituents on each carbon atom are on opposite sides of the double bond.

This results in different physical and chemical properties for the two isomers. For example, cis and trans isomers of some compounds may have different boiling points, melting points, and reactivities.  Cis-trans isomerism is an important concept in organic chemistry as it affects the properties and behavior of molecules and can have significant implications for their biological activity, environmental fate, and industrial applications. Option E is correct.

To know more about the Covalent bonds, here

https://brainly.com/question/13130950

#SPJ1

The observation that compound A releases H2 gas while compound B does not when treated with Na metal can be explained by considering the structural differences between the two compounds and their ability to undergo specific reactions.

Compound A and compound B both have the molecular formula C₂H₆O, which indicates that they both contain two carbon atoms, six hydrogen atoms, and one oxygen atom. However, the difference lies in the arrangement of these atoms within the molecules. One possible explanation for the observed difference is that compound A is an alcohol, specifically ethanol (CH₃CH₂OH), while compound B is an ether, such as dimethyl ether (CH₃OCH₃). The presence of the hydroxyl group (-OH) in ethanol enables it to undergo a reaction with sodium metal, known as the metal-acid reaction. In this reaction, the metal displaces the hydrogen from the hydroxyl group, forming sodium ethoxide (CH₃CH₂ONa) and releasing hydrogen gas (H₂). On the other hand, ethers like dimethyl ether lack the hydroxyl group and therefore cannot undergo the metal-acid reaction. Consequently, when compound B is treated with sodium metal, no hydrogen gas is released. The ability of compound A to release hydrogen gas while compound B does not when treated with sodium metal can be attributed to the presence of a hydroxyl group in compound A (ethanol), enabling it to undergo a metal-acid reaction, whereas compound B (dimethyl ether) lacks the necessary functional group and thus does not undergo this reaction.

For such more questions on structural

https://brainly.com/question/29117530

#SPJ11

Answer:

C.) protons and neutrons

Explanation:

Most atoms contain proton(s), neutron(s), and electron(s). Within the nucleus of an atom, there are protons and neutrons. Electrons are located outside of the nucleus.

Answer:

B

Explanation:

uncontrolled energy damage the body

Answer: causes destruction

Explanation:

From here we can see the addition of unbound electrons and their formal charge, making the resonance structure a full resonance structure.

other two resonance structures, which can be derived from overall structure, are also shown in the picture. Of these three structures, the structure that contributes most to hybridization is the structure with a negative oxygen charge.

The complete resonance Structure with its nonbonding electrons and formal charge.

Unbound electrons are the electrons that are not bound to an atom or molecule. They can move freely and also interact with other atoms or molecules. Unbound electrons can be found as ions, plasmas and conductors.

The missing incomplete resonance structure is attached in the image below.

To know more about  unbound electrons:

brainly.com/question/14697681

#SPJ4

Answer:

through transfer of electrons during boiling

The carbohydrate molecule would have more atoms than the glucose molecule.

We need to know what is a monomer and what is a polymer. It is important to note that the polymer is made from the agglomeration of the small units of the compound that combine together.

We ought to know that glucose is a monomer and that carbohydrate is the polymer. The monomer is composed of a few atoms but there are many more atoms in the polymer as the atoms join together. This is because the carbohydrate is made up of many atoms much more than glucose.

Learn more about polymer:https://brainly.com/question/17354715

#SPJ1

The equilibrium constant Keq is the ratio of product of concentration of products in a reaction to that reactants. In the given reaction the equilibrium constant is 1.05 × 10²⁴.

The equilibrium constant in a reaction is the ratio of product of molar concentrations of products to the product of molar concentration of the reactants in the reaction.

In the given reaction, the product is PCl₅ and reactants are Cl₂ and PCl₃. Thus the expression for Keq is written as:

\(Keq = \frac{[PCl_{5}]}{[PCl_{3}][Cl_{2}]}\)

Apply the number of moles and volume of all the reactants and products in this expression.

Keq = (2.01 × 10²¹molecules /1 L ) [(0.12/1L) (0.15/ 1L)]

      = 1.05 × 10²⁴

Hence, the equilibrium constant Keq is 1.05 × 10²⁴.

To find more on equilibrium constant, refer here:

http://brainly.com/question/10038290

#SPJ1

Answer:

8.5 g is the mass of something like the ammonia (in g) 3.01 x 1023 sodium atoms.

The most common alkali metal & sixth most abundant element on the world, sodium compensates 2.8 percent of a crust of the Earth. As opposed to sodium alone, sodium salts are much more beneficial. The most often used sodium component in common salt is sodium chloride. In the winter, it is used to de-ice roads and flavour food.

Ammonia produced from industry is used as fertiliser in agriculture to the tune of 80%.Ammonia is also used to create polymers, explosives, textiles, pesticides, dyes, and other compounds in addition to its various applications. Moreover, it is utilised to clean water sources.

No. of molecules of the Ammonia =3.01×10

23

Molar Mass of the Ammonia =17g/mole.

Using the Formula,

No. of Molecules =Mass/Molar Mass×Avogadro

s Number.

⇒3.01×10

23

=Mass/17×6.022×10

23

Mass=

2

17

∴Mass=8.5 g.

Hence, the Mass of the Ammonia is 8.5 g.

To know more about sodium visit :

brainly.com/question/29327783

#SPJ4

The question is incomplete, the complete question is;

The rate of reaction was measured during a chemical reaction. After the first 3 seconds, the rate of reaction was 1.8 x10−6 M/s. Which of the following would you expect after another 3 seconds? a

The rate would be higher, and the concentration of reactants would be lower.

b

The rate would be higher, and the concentration of reactants would be higher.

c

The rate would be lower, and the concentration of reactants would be lower.

d

The rate would be lower, and the concentration of reactants would be higher.

Answer:

The rate would be lower, and the concentration of reactants would be lower.

Explanation:

The rate of reaction refers to how quickly or slowly the reactants disappear or the products appear in a given reaction. The rate of reaction depends on the concentration of the reactants. Thus, as concentration decreases with time, the rate of reaction decreases accordingly.

Therefore, reaction rates tend to decrease with time since the concentration of  the reactants decrease with time as the reactants are being converted into products. Thus after three seconds, the rate would be lower, and the concentration of reactants would be lower. Hence the answer above.

Answer:

The rate would be lower, and the concentration of reactants would be higher.

Explanation:

I took the test and i think i got it right

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:D

Explanation:

The majority of explosives that forensic scientists deal with in investigations are homemade bombs. Therefore, option D is correct.

In general, forensic scientists do the following kinds of work: They examine tangible materials gathered from crime sites. They offer forensic expert testimony both before and during court proceedings. Blood, hair, and other trace evidence are gathered by investigators and sent to crime labs for analysis.

Criminalists or crime scene investigators are generalist forensic science technicians that gather evidence at the scene of a crime and conduct scientific and technical examination in labs or offices.

A forensic scientist's key responsibilities include gathering evidence at the crime scene, documenting the findings in reports, processing the evidence at the lab, and giving testimony in court.

Thus, option D is correct.

To learn more about forensic scientist, follow the link;

https://brainly.com/question/29293791

#SPJ2

Based on the heat of reaction, if 123 kJ of heat is evolved when the reaction described below is carried out, the mass of HCl gas (36.46 g/mol) produced is 23.6 g.

The heat of a reaction is the amount of heat energy given off or absorbed in the reaction.

During a reaction, energy changes occur as a result of the breaking of bonds in the reactants as well as the formation of bonds in the products.

The sum of the overall energy change that accompanies the formation of products from the reactants gives the heat change of a reaction.

Considering the heat change of the given reaction below:

3 Cl₂ (g) + PH₃ (g) → PCl₃ (g) + 3 HCl (g)     ∆H = - 570.4 kJ

The formation of 3 moles of HCl results in the evolution of 570.4 kJ of heat.

If 123 kJ of heat are evolved, then the moles of HCl produced will be:

Moles of HCl produced = 123 kJ * 3 moles / 570.4 kJ

Moles of HCl produced =  0.647 moles

Mass of HCl produced = 0.647 * 36.46

Mass of HCl produced = 23.6 g

Learn more about heat of reaction at: https://brainly.com/question/11631046

#SPJ1

The equation C2H4(g) + H2(g) + C2H6(g) → Caco3(s) + Cao(s) + CO2(g) shows an increase in entropy due to the formation of a gas as a product. Option A

In this equation, the reactants on the left-hand side consist of gases (C2H4 and H2), while the products on the right-hand side include a solid (Caco3) and a gas (CO2).

When a reaction involves a change from gaseous to solid or liquid states, there is typically a decrease in entropy because the particles become more ordered and constrained in the solid or liquid phase.

Conversely, when a reaction involves the formation of gases, there is generally an increase in entropy because gases have higher degrees of molecular motion and greater freedom of movement compared to solids or liquids.

In the given equation, the reactants include three gaseous compounds (C2H4, H2, and C2H6), and one of the products is a gas (CO2). Therefore, the overall entropy of the system increases during this reaction.

The equation Fe(s) + S(s) → FeS(s) does not show an increase in entropy. Both the reactants (Fe and S) and the product (FeS) are solids. Since solids have lower entropy compared to gases or liquids, the entropy of the system does not increase in this reaction. Option A

For more such questions on entropy visit:

https://brainly.com/question/30481619

#SPJ8

Answer:

It works by separating the fuel from the oxygen. The oxygen comes from the air. It is the same oxygen we breathe. Since the oxygen has to be in contact with the fuel, if you can coat the fuel with something that keeps the oxygen away, the fire will go out which is what the fire extinguisher does.

For strong electrolytes, molar conductivity decreases as the solution is diluted because the concentration of ions decreases.

For weak electrolytes, molar conductivity increases as the solution is diluted because as the solution is diluted, the concentration of ions increases.

The expression for the dilution law is A = εcb

The conductivity of a solution containing one mole of an electrolyte when placed between two electrodes spaced one centimeter apart is known as the molar conductivity of the electrolyte. The strength of the electrolyte affects how molar conductivity changes with dilution.

At infinite dilution, the molar conductivity of an electrolyte reaches its maximum value because the electrolyte's ions are so far apart that they no longer interact with one another.

The dilution law or Beer-Lambert law states that the absorbance of a solution is directly proportional to the concentration of the solution and the path length of the light through the solution.

A ∝ cb

Adding a proportionality constant gives:

A = εcb

where;

Learn more about molar conductivity at: https://brainly.com/question/26097545

#SPJ1

Based on the potential energy diagram and the potential energies of reactant and product the synthesis and double replacement reactions are endothermic. The single replacement reaction is exothermic and the ΔH is negative.

Chemical processes referred to as endothermic reactions occur when the reactants take in heat energy from their environment to create products. The reaction absorbs energy from its surroundings. The energy that manifests as heat. Examples include cooking, evaporation, gas molecules, melting of ice, and photosynthesis.

An exothermic reaction is one in which energy is given off as heat or light. The mechanism releases energy into its surroundings. Energy can be emitted as sound, light, heat, or electricity. Examples include rusting iron, settling, chemical bonds, explosions, and nuclear fission.

A potential energy diagram, also known as a reaction progress curve, is a visual representation of the energy changes that take place during a chemical reaction. A diagram of potential energy illustrates how a system's potential energy changes as reactants are changed into products. Note that an exothermic reaction results in a negative enthalpy change while an endothermic reaction exhibits a positive enthalpy change. The diagrams of potential energy show this. When the system absorbs energy from its environment, its overall potential energy rises for the endothermic reaction. As the system undergoes the exothermic process, the system's overall potential energy declines.

To know more about Enthalpy Change, visit:

https://brainly.com/question/29556033

#SPJ1

The maximum mass of water that could be produced by the chemical reaction is 162 g.

The given chemical equation is: 2 C8H18(l) + 25 O2(g) → 16 CO2(g) + 18 H2O(l)In the chemical reaction of liquid octane with gaseous oxygen, the products are gaseous carbon dioxide and gaseous water.According to the balanced chemical equation, 2 moles of C8H18 react with 25 moles of O2 to form 18 moles of H2O.So, 1 mole of C8H18 react with 25/2 = 12.5 moles of O2 to form 9 moles of H2O.The molar mass of C8H18 is 114 g/mol. So, the number of moles in 17 g of C8H18 is:17 g / 114 g/mol = 0.149 molThe molar mass of O2 is 32 g/mol. So, the number of moles in 112 g of O2 is:112 g / 32 g/mol = 3.5 molFrom the balanced chemical equation, 1 mole of C8H18 react with 12.5 moles of O2 to form 9 moles of H2O.So, the number of moles of O2 required to react with 0.149 mol of C8H18 to form H2O is:(12.5 mol / 1 mol) × (0.149 mol / 2 mol) = 0.935 molThe maximum number of moles of H2O that can be produced from 0.149 mol of C8H18 and 0.935 mol of O2 is 9 mol.So, the mass of water produced from 17 g of C8H18 and 112 g of O2 is:9 mol × 18 g/mol = 162 g

for more questions on chemical reaction

https://brainly.com/question/25769000

#SPJ8

total amount of energy required is= 132.6 + 717.9 + 45.42 = 896 kJ to convert 450g of liquid water from 38°C to water vapor at 125 C. The molar heat of vaporization (Hvap) of water is 40.79 kJ/mol. The specific heat for water is 4.184 J/g C, and for steam is 1.99 J/g C.

cslculation-heat energy required to raise the temp of liquid water to 100 C = 317 * 4.184 * 100 = 132632 J =132.6 kJ,mole of water = 317 / 18 = 17.6 mol,heat required for vaporization = 17.6 * 40.79 = 717.9 kJ,Heat required to raise the temp of water vapor to 172 C = 317 * 1.99 * 72 = 45420 J = 45.42 kJ, total heat required  = 132.6 + 717.9 + 45.42 = 896 kJ. The quantity of heat necessary to increase the temperature of one unit mass of a substance by one degree Celsius. The specific heat capacity of a substance is specified as the amount of heat (J) soaked up per unit mass (kg) when its temperature rises 1 K (or 1 °C). The specific heat capacity of a substance is typically calculated by monitoring the heat capacity of a specimen of the material, generally with a calorimeter, and trying to divide by the sample's mass. The average kinetic energy of each molecule increases as the substance heats up.

Learn more about specific heat here:

https://brainly.com/question/11297584

#SPJ4

Answer:

No and Yes

Explanation:

This is both possible and impossible. When you put your mind to what you believe, you can achieve it through patience and minded values. Your mind can either be your Greatest enemy or your Best Ally.

Answer:

bernacles on a while.

Explanation:

These crustaceans stick to the bodies of baleen whales during their larval stage, when they are still able to swim, and establish a commensal relationship with the mysticetes, since they neither harm nor benefit the host that hosts them, whom they will accompany throughout their lives. .

Answer:

➜ Properties of liquids and gases. Liquids have a fixed volume but no fixed shape. Gases have no fixed volume and no fixed shape. Gases expand to fill the space available. They can also be compressed into a very small space.

Explanation:

12.044 × 10 ²³molecules of sulphur dioxide are 0.2 mole.

Answer:

The play will be more  appealing to a younger audience.

Explanation:

A younger audience will more likely appreciate current pop hits rather than classical score.

Answer:

B. The play will be more appealing to a younger audience.

Explanation:

If the audience is younger, then this would be more appealing to them because pop has always been one of the fan-favorties of younger generations

Answer:

Acanthite. MFCD00003406

Explanation:

Answer:it’s isomers

Explanation:The line are in two different places but they still have the same molecules