Answer:
FALSE.
Explanation:
The right answer is false. There are three different groups of phylum for worms.
Hope this helped!
Answer:
FALSE
there are like 3 different phylum
Explanation:
Hope this helps!
if so
please mark Brainlist!!
thx
Q1. Consider the gravitational interactions among Earth, the Sun, and the Moon. Does this constitute a system? If so, what are its boundaries? Is it open or closed? What forms of energy are involved?
When two objects descend towards one another, the potential energy related to the gravitational field is released (transformed into kinetic energy).
The potential energy that a huge item has in relation to a different massive object due to gravity is known as gravitational energy and gravitational potential energy. When two objects descend towards one another, the potential energy related to the gravitational field is released (transformed into kinetic energy). Bringing two things farther apart increases the gravitational potential energy.
To know more about gravitational, here:
https://brainly.com/question/3009841
#SPJ1
Which of the following could not be responsible for the acceleration of an object?
wind
gravity
density
friction
Answer:
i believe its friction
Explanation:
friction slows down objects
How many grams of HBr would there be in 355 mL of a 7.5% m/v HBr solution?
26.62 grams of HBr would be present in 355 mL of a 7.5% m/v HBr solution.
Concentration refers to the amount of a substance in a defined space. Another definition is that concentration is the ratio of solute in a solution to either solvent or total solution.
There are various methods of expressing the concentration of a solution.
Concentrations are usually expressed in terms of molarity, defined as the number of moles of solute in 1 L of solution.
Solutions of known concentration can be prepared either by dissolving a known mass of solute in a solvent and diluting to a desired final volume or by diluting the appropriate volume of a more concentrated solution (a stock solution) to the desired final volume.
Given,
HBr = 7.5% m/ v
This means 7.5g of HBr in 100 ml of the solution.
1 ml of the solution has 0.075g
355 ml of the solution will have = 0.075 × 355 = 26.62g of HBr
Learn more about Concentration, here:
https://brainly.com/question/3045247
#SPJ1
Why must the pH values of the mouth, stomach, and small intestine be different?
Answer:
so you don't digest your tounge
If the dosage for a medication is 225mg/lb, how many grams should a 25-lb child be given?
SHOW ALL WORK
Answer:
5.625 grams
Explanation:
Start your equation with what you have been given. Place the units you need in your answer on the right side of the equal sign.
225mg
----------- X ----------- X ------------- = ? g
lb
Now start to fill in your equation and use a conversions to get rid of the units you don't want. Convert mg into grams first. The child's weight (25 lb) is placed over 1 just to get the equation lined up properly so you can see how the units cancel out.
225 mg 1 g 25 lb 5.625 g
--------------- X --------------- X ------------- = ---------------
lb 1000 mg 1 1
The lb on the top and bottom cancel each other out and you are left with just grams. Even though it is over one, that is the same at just 5.625 grams.
The correct answer is 5.625 grams.
How to calculate drug doses and infusion rates accurately?
Miscalculating doses is a common source of drug errors. This article explains how to calculate drug doses and highlights common errors. After reading it, you can undertake the Nursing Times learning unit Drug Calculations in Practice, which includes clinical scenarios to test your knowledge
Learn more about How to calculate drug doses and infusion rates accurately? here: https://brainly.com/question/26254731
#SPJ2
Help HELP pls pls plsssssss
Answer:
hurricane
Explanation:
back a few years ago it had hurricane Jackson or whatever
Answer:
Typhoon or Hurricane
Explanation:
explain the shapes of simple molecules
Answer:
Simple molecules, also known as covalent molecules, are made up of two or more non-metal atoms that share electrons to form a covalent bond. The shape of a simple molecule is determined by the arrangement of its atoms in space, which is influenced by the number of electron pairs surrounding the central atom and the repulsion between them.
In general, there are two types of electron pairs: bonding pairs and non-bonding pairs (also known as lone pairs). Bonding pairs are shared between two atoms and create a strong bond that holds the molecule together. Non-bonding pairs are not shared and exert a repulsive force on the other electron pairs in the molecule.
The repulsion between electron pairs determines the shape of the molecule. For example, if a molecule has two electron pairs (a bonding pair and a non-bonding pair), they will arrange themselves as far apart as possible, which results in a linear shape. If a molecule has three electron pairs (two bonding pairs and one non-bonding pair), they will arrange themselves in a trigonal planar shape. If a molecule has four electron pairs (three bonding pairs and one non-bonding pair), they will arrange themselves in a tetrahedral shape.
Overall, the shape of a simple molecule is determined by the number of electron pairs and the repulsion between them.
draw the structure(s) of the branched ether(s) with the chemical formula c4h10o?
The structure of the branched ether of chemical formula c4h10o, is \(CH_3 - CH_2 - CH_2 - O - CH_2 - CH_2 - CH_3.\)
\(C_4H_{10} O\) is a branched ether, also known as an alkoxyalkane or a glycol ether. It is an organic compound composed of four carbon atoms, ten hydrogen atoms, and one oxygen atom. Its molecular formula is \(C_4H_{10} O\)and its molecular weight is 86.13 g/mol.
Its structure is linear, with a carbon backbone and an oxygen atom attached to two of the carbons in the chain. The oxygen atom is then connected to two methyl (\(CH_3\)) groups, one on each side of the central carbon atom.
Learn more about structure of the ether:
https://brainly.com/question/20772030
#SPJ4
What is the direct function of the energy released from the nuclear chain reaction in a nuclear power plant? turning the blades of the turbine heating water to produce steam powering the condenser carrying electricity from the plant to consumers
Answer:
the energy released is to make steam to create electricity. yes you are right i just didnt feel like being super technical
In a nuclear reaction, the direct function of the energy released from the nuclear chain reaction in a nuclear power plant is turning the blades of the turbine heating water to produce steam .
What are nuclear reactions?There are two types of nuclear reactions which are nuclear fusion and nuclear fission .They involve the combination and disintegration of the element's nucleus respectively.
In nuclear fission, the nucleus of the atom is bombarded with electrons of low energy which splits the nucleus in to two parts .Large amount of energy is released in the process.It is used in nuclear power reactors as it produces large amount of energy.
In nuclear fusion,on the other hand, is a reaction which occurs when two or more atoms combine to form a heavy nucleus.Large amount of energy is released in the process which is greater than that of the energy which is released in nuclear fission process.
Learn more about nuclear reactions,here:
https://brainly.com/question/12786977
#SPJ7
Susie believes that putting wax on her shoes will increase how fast she runs. She buys two of the exact pair of shoes and covers pair A with wax and leaves pair B alone. She will determine if the wax makes her faster by timing how long it takes her to run 50 yards. Susie runs exactly 50 yards once with pair A and after a 30 minute break again with pair B. She determined that she ran 50 yards in 6.2 seconds with pair A, and she ran 50 yards in 5.6 seconds with pair B
Susie's belief that putting wax on her shoes will increase how fast she runs is false because with wax she covered 50 yards in 6.2 seconds and without was she covered 50 yards in 5.6 seconds.
What is wax?Wax is a type of organic compound that is lipophilic and greasy substance. They are alkanes and lipids. They are used in many creams and cosmetics.
Susie put wax in a pair of shoes A with wax and leaves pair B alone. She covered 50 yards in 5.6 seconds, and with wax she covered 50 yards in 6.2 seconds, which means, without waxy shoes, runs fast.
Thus, Susie's belief is incorrect.
To learn more about wax, refer to the link:
https://brainly.com/question/3125385
#SPJ1
What is the density at STP of NOz gas (molar
mass = 46.01 g/mol) in grams per liter?
Answer:
We can use the ideal gas law, PV = nRT, to solve for the density at STP (standard temperature and pressure). At STP, the temperature is 273.15 K and the pressure is 1 atm. We know the molar mass of NO2 is 46.01 g/mol. We also know that 1 mole of any gas at STP occupies a volume of 22.4 L.
First, we can calculate the number of moles of NO2 at STP:
n = PV/RT = (1 atm)(22.4 L)/(0.08206 L·atm/mol·K)(273.15 K) = 1.00 mol
Next, we can calculate the mass of 1 mole of NO2:
46.01 g/mol
Finally, we can calculate the density of NO2 at STP:
density = mass/volume = (46.01 g/mol)/(22.4 L) = 2.054 g/L
Therefore, the density at STP of NO2 gas (molar mass = 46.01 g/mol) in grams per liter is 2.054 g/L.
Explanation:
A gas sample with a volume of 5.3 L has a pressure of 745 mm Hg at 33°C. What is the pressure of the sample if the volume remains at 5.3 L but the temperature rises to 85°C?
According to the Gay-Lussac which establishes that the pressure of a fixed volume of a gas is directly proportional to its temperature.
It is represented by the following formula:
\(\frac{P_1}{T_1}=\frac{P_2}{T_2},\)The pressure must be in atm units and temperature in kelvin. We calculate the conversion of each one:
\(745\text{ mmHg}\cdot\frac{1\text{ atm}}{760\text{ mmHg}}=0.98\text{ atm,}\)\(T_1=33C+273=306K,T_2=85C+273=358K\text{.}\)The final step is clear the final pressure which is P2 and replace the values there:
\(P_2=\frac{P_1\cdot T_2}{T_1}=\frac{0.98\text{ atm}\cdot358\text{ K}}{306\text{ K}}=1.146\text{ atm.}\)Then, we do the conversion from atm to mmHg:
\(1.146\text{ atm}\cdot\frac{760\text{ mmHg}}{1\text{ atm}}=870.96\text{ mmHg.}\)The final pressure is 870.96 mmHg.
reen plants absorb sunlight to power photosynthesis, the chemical synthesis of food from water and carbon dioxide. The compound responsible for light absorption and the color of plants, chlorophyll, strongly absorbs light with a wavelength of 453.nm. Calculate the frequency of this light. Round your answer to 3 significant digits.
Answer:
The frequency of the light is 6.62 * 10¹⁴ Hz
Explanation:
The frequency of a wave is defined as the number of complete oscillations made by the wave per second. Its unit is Hertz. The frequency of light as well as the velocity of the light and wavelength of the light are all related.
The velocity of light is the distance the light wave travels per second.
Wavelength is defined as the distance between successive crests and troughs of the wave. It is inversely related to the frequency of the wave.
The velocity of light, c is related to frequency, f, and wavelength, λ, by the formula, c = λf
where the velocity of light, c is a constant = 3 * 10⁸ m/s
λ is wavelength of light = 453 nm = 4.53 * 10⁻⁷ m
Frequency, f = ?
Making f subject of formula in the equation above, f = c/λ
f = 3 * 10⁸ m/s / 4.53 * 10⁻⁷ m
f = 6.62 * 10¹⁴ Hz
Therefore, the frequency of the light is 6.62 * 10¹⁴ Hz
There are only two naturally-occuring stable isotopes of lithium, the masses of which are listed in the table below. Use whatever data you need from the ALEKS Periodic Table to calculate the natural abundance of each isotope and complete the table.
The natural abundance of each isotope of lithium:
For \(^{6} Li\) = 7.5%
For \(^{7} Li\) = 92.5%
Due to the fact that lithium only has two stable isotopes, it follows that only two isotopes contribute to its average atomic mass.
Then, if we take x the proportional abundance of \(^{6} Li\) it is possible to state that the decimal abundance of \(^{7} Li\) need to be equivalent to 1−x.
Lithium's typical atomic mass will now be equal to =
avg. Atomic weight Li = Atomic weight of \(^{6} Li\)× quantile abundance of \(^{6} Li\)+ Atomic weight of \(^{7} Li\)× quantile abundance of \(^{7} Li\)
Since you are aware that the average atomic mass of lithium is
6.941 you can construct the equation as follows.
6.941 = 6.015 × x + 7.016 × (1-x)
x = 0.075
This is the decimal abundance of \(^{6} Li\). The decimal abundance of \(^{7} Li\) is 1 - 0.075 = 0.925.
Percent abundances :
For \(^{6} Li\) = 7.5%
For \(^{7} Li\) = 92.5%
Learn more about isotope of lithium here;
https://brainly.com/question/11919522
#SPJ4
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
pOH of the 0.001M NaOH solution is
The pOH of the 0.001 M NaOH solution is approximately 3.
To determine the pOH of a solution, we need to know the concentration of hydroxide ions (OH-) in the solution.
In the case of a 0.001 M NaOH solution, we can assume that all of the NaOH dissociates completely in water to form Na+ and OH- ions. Therefore, the concentration of hydroxide ions in the solution is also 0.001 M.
The pOH is calculated using the equation:
pOH = -log[OH-]
Substituting the concentration of hydroxide ions, we have:
pOH = -log(0.001)
Using a calculator, we can evaluate the logarithm:
pOH ≈ 3
Therefore, the pOH of the 0.001 M NaOH solution is approximately 3.
Know more about hydroxide ions here:
https://brainly.com/question/28464162
#SPJ8
A student places one piece of chalk into a bowl with vinegar and another into a bowl with water. The next day she observes that the chalk in the water is mostly unchanged but the chalk in vinegar has pieces missing.
Which option describes a process in nature similar to the experiment? A.
heavy rainfall causing a landslide
B.
rocks at the bottom of a waterfall
C.
acid rain falling on a limestone sculpture
D.
salt water waves rolling over a rocky shoreline
E.
moving water of a river bumping rocks against each other
Heavy rainfall causes a landslide. Hence, option A is correct.
What is a landslide?A landslide is defined as the movement of a mass of rock, debris, or earth down a slope.
Water can trigger landslides and mudslides because it alters the pressure within the slope, which leads to slope instability.
Consequently, the heavy water-laden slope materials (soil, rock, etc.) will succumb to the forces of gravity.
Hence, option A is correct.
Learn more about the landslide here:
https://brainly.com/question/16151931
#SPJ1
2) A student performs this reaction in the laboratory, and collects the hydrogen gas over water. The student collects 215.8 mL of gas. The total pressure is 755.2 mmHg and the temperature is 22.0 oC. c) Use the ideal gas law to calculate how many moles of hydrogen were produced in the reaction
Answer: 0.0086 moles of hydrogen are produced.
Explanation:
According to ideal gas equation:
\(PV=nRT\)
total pressure = 755.2 mm Hg
pressure of water at \(22^0C\) = 19.8 mm Hg
P = pressure of hydrogen = (755.2-19.8) mm Hg = 735.4 mm Hg = 0.97 atm
(760 mm Hg = 1atm)
V = Volume of gas = 215.8 ml = 0.2158 L
n = number of moles
R = gas constant =\(0.0821Latm/Kmol\)
T =temperature =\(22.0^0C=(22.0+273)K=295K\)
\(n=\frac{PV}{RT}\)
\(n=\frac{0.97atm\times 0.2158L}{0.0821 L atm/K mol\times 295K}=0.0086moles\)
Thus 0.0086 moles of hydrogen are produced.
Plzz tell me the answer u need help im kinda confused
All of the following are examples of an external stimulus except -
Group of answer choices
Ⓐ hunger.
Ⓑ sunlight.
Ⓒ a loud sound.
Stimuli are the senses that cause an organism to react. Internal sensations include things like hunger and thirst that are produced inside the body, hence option A is correct.
What is stimulus?A stimulus is a perceptible alteration in the internal or external surroundings of an organism's physical or chemical composition.
Sensitivity is the capacity of an organism or organ to recognize external stimuli and to respond appropriately to them.
A stimulation that comes from outside the organism is known as an external stimulus. Light is one example of an outside stimulation. Although it comes from outside the body, it has an impact there as well.
Therefore, sunlight and a loud sound are the examples of external stimuli, while hunger is an internal stimulus.
Learn more about stimulus, here:
https://brainly.com/question/1747649
#SPJ5
How many grams are there in 1.18 x 1024 molecules of boron trihydride, BH3?
A cylinder of Krypton has contains 17 L of Ar at 22.8 atm and 112 degrees celsisus. How many moles are in the cylinder?
Given :
A cylinder of Krypton has contains 17 L of Ar at 22.8 atm and 112 degrees Celsius.
To Find :
How many moles are in the cylinder.
Solution :
We know, by ideal gas equation :
\(PV = nRT\\\\n = \dfrac{PV}{RT}\)
Here, R is gas constant and \(R = 8.205 \times 10^{-5} \ m^3\ atm\ K^{-1} mol^{-1}\)
Converting all given in required units and putting in above equation, we get :
\(n = \dfrac{P\times V}{ R \times T}\\\\n = \dfrac{22.8 \times 0.017}{8.205\times (112+273)}\ moles\\\\n = 1.22 \times 10^{-4} \ moles\)
Hence, this is the required solution.
2.
Which mixture could be a useful buffer in a solution?
acetic acid (CH3CO2H) and hydrochloric acid (HCl)
sodium hydroxide (NaOH) and elemental sodium (Na)
ammonia (NH3) and ammonium chloride (NH4Cl)
acetic acid (CH3CO2H) and ammonia (NH3)
Pls answer quickly
Ammonia (\(NH_3\)) and ammonium chloride (\(NH_4Cl\)) mixture could be a useful buffer in a solution. Option C
A buffer is a solution that can resist changes in pH when small amounts of acid or base are added. It consists of a weak acid and its conjugate base or a weak base and its conjugate acid. The buffer system works by the principle of Le Chatelier's principle, where the equilibrium is shifted to counteract the changes caused by the addition of an acid or a base.
In option A, acetic acid (\(CH_3CO_2H\)) is a weak acid, but hydrochloric acid (HCl) is a strong acid. This combination does not form a buffer because HCl is completely dissociated in water and cannot provide a significant concentration of its conjugate base.
Option B consists of sodium hydroxide (NaOH), which is a strong base, and elemental sodium (Na), which is a metal. This combination does not form a buffer as there is no weak acid-base pair involved.
Option D contains acetic acid (\(CH_3CO_2H\)), a weak acid, and ammonia (\(NH_3\)), a weak base. Although they are weak acid and base, they do not form a buffer system together as they are both weak acids or bases and lack the required conjugate acid-base pair.
Option C, ammonia (\(NH_3\)), is a weak base, and ammonium chloride (\(NH_4Cl\)) is its conjugate acid. This combination can form a buffer system. When ammonia reacts with water, it forms ammonium ions (NH4+) and hydroxide ions (OH-).
The ammonium ions act as the weak acid, while the ammonia acts as the weak base. The addition of a small amount of acid will be counteracted by the ammonium ions, and the addition of a small amount of base will be counteracted by the ammonia, thus maintaining the pH of the solution relatively stable.
Therefore, option C, consisting of ammonia (\(NH_3\)) and ammonium chloride (\(NH_4Cl\)), is the suitable mixture that could be a useful buffer in a solution.
For more such question on buffer visit:
https://brainly.com/question/13076037
#SPJ8
i need help ;]
Thank you!!
I learned this already its the thermosphere
What the name of this compound be: Na2CO3•4H2O?
The name "sodium carbonate" refers to the chemical formula Na2CO3, which consists of two sodium ions (Na+)
The compound Na2CO3•4H2O is called sodium carbonate decahydrate. It is a hydrate compound, indicating that it contains water molecules within its crystal structure. In this case, there are four water molecules associated with each molecule of sodium carbonate.
The name "sodium carbonate" refers to the chemical formula Na2CO3, which consists of two sodium ions (Na+) and one carbonate ion (CO3^2-). The "decahydrate" part of the name indicates the presence of ten water molecules (H2O) in the compound.
When sodium carbonate decahydrate is formed, each sodium carbonate molecule associates with four water molecules, resulting in the formula Na2CO3•4H2O. The water molecules are not chemically bonded to the sodium carbonate but rather held within the crystal lattice through weak intermolecular forces.
Sodium carbonate decahydrate is commonly known as soda ash or washing soda. It is used in various applications such as water treatment, glass manufacturing, detergent production, and pH regulation in swimming pools.
for more such question on sodium carbonate visit
https://brainly.com/question/18458464
#SPJ8
The image "Sodium Chloride, Water, Carbon Dioxide, and Hydrogen Peroxide" illustrates the chemical
structure of water, which is a(n):
H
Water, H₂O
Sodium chloride, NaCl
H
Carbon dioxide, CO₂ Hydrogen peroxide, H₂O₂
Oelemental molecule.
O compound molecule.
atom.
state of matter.
The image features a molecular diagram of each of these substances, with the molecules displayed in a 3D structure. The diagram shows the chemical bonds that link the atoms of the molecules together.
Relative reactivity of moleculeThe reactivity of each molecule depends on the type of reaction being carried out and the functional groups present on each molecule. Generally, molecules with more electronegative or polar functional groups are more reactive than those without.
For example, molecules with carbonyl, amine, or hydroxyl groups tend to be more reactive than those without. Additionally, molecules with strained bonds, such as cyclic compounds, tend to be more reactive than linear molecules.
Additionally, molecules of higher molecular weight tend to be less reactive than those of lower molecular weight. Finally, the presence of electron-withdrawing groups, such as nitro or halogens, can increase the reactivity of a molecule.
In summary, the reactivity of a molecule is determined by a variety of factors, including the type of reaction, the functional groups present, the strain of the molecule, the molecular weight, and the presence of electron-withdrawing groups.
To learn more about reactivity of molecule refer to:
https://brainly.com/question/28383861
#SPJ1
A balloon originally had a volume of 4.39 L at 44C and a pressure of 729 torr  to what temperature must the balloon be cooled to reduce its volume to 3.78 L of the new pressure is at 1.0 atm
The new temperature : 11.56 °C
Further explanationBoyle's law and Gay Lussac's law
\(\tt \dfrac{P_1.V_1}{T_1}=\dfrac{P_2.V_2}{T_2}\)
P1 = initial gas pressure (N/m² or Pa)
V1 = initial gas volume (m³)
P2 = final gas pressure
V2 = final gas volume
T1 = initial gas temperature (K)
T2 = final gas temperature
V₁=4.39 L
T₁=44+273=317 K
P₁ = 729 torr = 0,959211 atm
V₂=3.78 L
P₂= 1 atm
\(\tt \dfrac{0.959211\times 4.39}{317}=\dfrac{1\times 3.78}{T_2}\\\\T_2=\dfrac{1\times 3.78\times 317}{0.959211\times 4.39}\\\\T_2=284.559~K=11.56~C\)
Solar and wind energy are both intermittent resources that cannot be relied upon for a constant stream of energy production. Explain why developing better ways to store energy is an important part of making these energy sources more practical to use.
By removing the need to build additional transmission lines and equipment, energy storage may reduce costs for utilities and their customers.
By removing the need to build additional transmission lines and equipment, energy storage may reduce costs for utilities and their customers. Energy storage's inherent ability to offer backup power in the event of grid failure is a feature that both residential consumers and commercial owners find highly desirable.
To know more about energy, here:
https://brainly.com/question/1932868
#SPJ1
Solve the problem.
A menu in a restaurant allows you to pick some items from Column A and some from
Column B. Column A has 24 items. Column B has 16 items. If you and 3 friends want
to order everything from both columns, but not order any item more than once, how
many items from each column would you each choose (assuming each person orders
the same number of items from each column)?
Select the correct answer.
4 from A, 4 from B
6 from A, 4 from B
6 from A, 6 from B
4 from A, 6 from B
Each person should choose 6 items from Column A and 4 items from Column B, ensuring that everyone orders the same number of items from each column. Option B
To divide the items evenly among four people while ensuring that each person orders the same number of items from each column, we need to find the common divisor of the number of items in each column.
Column A has 24 items, and Column B has 16 items. The common divisor of 24 and 16 is 8. Therefore, each person should choose 8 items.
Since there are 24 items in Column A, and each person needs to choose 8 items, the answer is 24 divided by 8, which equals 3. Each person should choose 3 items from Column A.
Similarly, since there are 16 items in Column B, and each person needs to choose 8 items, the answer is 16 divided by 8, which equals 2. Each person should choose 2 items from Column B.
Therefore, the correct answer is:
B) 6 from A, 4 from B
Each person should choose 6 items from Column A and 4 items from Column B, ensuring that everyone orders the same number of items from each column.
For more such questions on Column visit:
https://brainly.com/question/17532859
#SPJ8
How many grams of NO are obtained from 16.1 g NO2 ?
Question: How many grams of NO are obtained from 16.1 g NO2 ?
Explanation: Goodmorning: ) i'm gonna say 2ɴᴏ2 --> 2ɴᴏ + ᴏ2
ᴍᴏʟᴇᴄᴜʟᴀʀ ᴡᴇɪɢʜᴛ ᴏꜰ ɴᴏ2 = 46.0ɢ
ᴍᴏʟᴇᴄᴜʟᴀʀ ᴡᴇɪɢʜᴛ ᴏꜰ ɴᴏ = 30.0ɢ
16ɢ ɴᴏ2 / 46ɢ (ᴍᴡ ᴏꜰ ɴᴏ2)=.3478 ᴍᴏʟ ᴏꜰ 2ɴᴏ2
= .3478 ᴍᴏʟ ᴏꜰ 2ɴᴏ✨
Can someone please help me with this question. I got half of the question and I am stuck on the rest.
The mean of the data set is approximately 4.0626, and the 90% confidence interval is [4.060925, 4.064275].
What is the mean and 90% confidence interval of the given data?The sample mean (x) is calculated as follows:
x = (4.0620 + 4.0550 + 4.0650 + 4.0740 + 4.0550 + 4.0660) / 6
x ≈ 4.0626 (rounded to four decimal places)
The 90% confidence interval is calculated as follows;
Standard deviation (s):
(4.0620 - 4.0626)² = 0.00000036
(4.0550 - 4.0626)² = 0.00000576
(4.0650 - 4.0626)² = 0.00000006
(4.0740 - 4.0626)² = 0.00001328
(4.0550 - 4.0626)² = 0.00000576
(4.0660 - 4.0626)² = 0.00000012
average of the squared differences:
(0.00000036 + 0.00000576 + 0.00000006 + 0.00001328 + 0.00000576 + 0.00000012) / 6 ≈ 0.00000624
s = √(0.00000624)
s ≈ 0.002496
the standard error of the mean (SEM):
SEM = 0.002496 / √6
SEM ≈ 0.001018
For a 90% confidence interval, the z value is approximately 1.645.
ME = 1.645 * 0.001018 ≈ 0.001675
CI = x ± ME
CI = 4.0626 ± 0.001675
CI ≈ [4.060925, 4.064275]
Learn more about mean and confidence intervals at: https://brainly.com/question/20309162
#SPJ1