Ordena los siguientes números decimales en una tabla en la que integres en la zona azul: UM, C, D, U, Punto decimal (.), Décimos, Centésimos, Milésimos, Diezmilésimos.

a) 4567.3456

b) 78.6549

c) 7.0909

Answers

Answer 1

Answer:

que?

Step-by-step explanation:


Related Questions

A scientist uses a submarine to study ocean life.
She begins at sea level, which is an elevation of o feet.
She travels straight down for 50 seconds at a speed of 4-5 feet per seco
She then travels directly up for 92 seconds at a speed of 0.5 feet per
second.
At this point, what is her elevation, in feet?

A scientist uses a submarine to study ocean life.She begins at sea level, which is an elevation of o

Answers

Answer:

51.9 to get back to sea level hope this helps you out

Translate the shape by the vector
Y₁
9
8
7
6
5
4
3
2
1
O
1
2 3 4 5 6 7
5
89
X

Answers

Answer: Your welcome!

Step-by-step explanation:

14

13

12

11

10

9

8

7

6

O

6

7 8 9 10 11 12 13

10

1415

The answer is 14, 13, 12, 11, 10, 9, 8, 7, 6, O, 6, 7, 8, 9, 10, 11, 12, 13, 10, 14, 15. This is the result of translating the shape by the vector (5, 4). The original shape was shifted 5 units to the right and 4 units down, resulting in the new shape.

8 divided by 618 ..............

Answers

Answer:

0.0129449838188

0.01294498

that’s your answer

(x – 4)2 = -9 has no real solution

Answers

Answer:

x = -1/2

Step-by-step explanation:

(x - 4) * 2 = -9

Divide both sides by 2:

x - 4 = - 9 / 2

Add 4 to both sides:

x = - 1 / 2.

Answer:

Actually, it does have a solution

Step-by-step explanation:

(x 4)2 = -9 has no real solution

Write a rule for the nth term of the geometric sequence for which a_2=-72 and a_6=-1/18

Answers

The rule for the nth term of the sequence is f(n) = -432(1/6)ⁿ ⁻ ¹

Finding the explicit rule for the sequence

From the question, we have the following parameters that can be used in our computation:

a(2) = -72

a(6) = -1/18

The common ratio is calculated as

r⁴ = a(6)/a(2)

So, we have

r⁴ = (-1/18)/(-72)

Evaluate

r⁴ = 1/(18 * 72)

Take the fourth root of both sides

r = 1/6

So, we have

a = -72/(1/6)

Evaluate

a = -432

The nth term is then represented as

f(n) = arⁿ ⁻ ¹

Substitute the known values in the above equation, so, we have the following representation

f(n) = -432(1/6)ⁿ ⁻ ¹

Hence, the explicit rule is f(n) = -432(1/6)ⁿ ⁻ ¹

Read more about sequence at

brainly.com/question/30499691

#SPJ1

Three of five baseketball players scored more than 10 points. What percent of the players scored more than 10 points?

Answers

60 percent of the players scored more than 10 points if three of the five basketball players scored more than 10 points.

What is the percentage?

It's the ratio of two integers stated as a fraction of a hundred parts. It is a metric for comparing two sets of data, and it is expressed as a percentage using the percent symbol.

It is given that:

Three of the five basketball players scored more than 10 points.

Total number of basketball players = 5

The number of players who scored more than 10 points = 3

In fraction:

= 3/5

= 0.6

To convert the above fraction into the percentage multiply it by 100:

= 0.6x100

The percent of the players scored more than 10 points = 60%

Thus, 60 percent of the players scored more than 10 points if three of the five basketball players scored more than 10 points.

To Learn more about the percentage form the link:

brainly.com/question/8011401

#SPJ1

*HELP I WILL MARK BRAINLIST*

*HELP I WILL MARK BRAINLIST*

Answers

The volume of plaster Darla needs for the miniature stairs is 418³.

What is the volume?

The volume is the space occupied by a three-dimensional object.

Volume is the product of the multiplication of length, width, and height.

We first calculate the total volume for this situation, assuming that the stairs have not cut portions.

Secondly, calculate the volume of the cut portions and subtract the result from the total volume to get the volume of the stairs, which represents the quantity of plaster required by Darla.

Length of the miniature stairs = 12 cm

Width of the miniature stairs = 11 cm

Height of the miniature stairs = 4 cm

The volume of the stairs with the cut portion = 528 cm³ (12 x 11 x 4)

The length of the cut portion of the stairs = 12 cm

The width of the cut portion of the stairs = 11 cm

The height of the cut portion of the stairs = 2 cm (4 - 2)

The volume of the cut portion of the stairs = 110 cm³ (11 x 5 x 2)

The volume of the stairs without the cut portion = 418 cm³ (528 - 120)

The total volume of plaster can also be computed separately as the volume of the larger object plus the volume of the smaller object.

418 cm³= (7 cm x 4 cm x 11 cm) + (5 cm x 2 cm x 11 cm)

= (308 cm³ + 110 cm³)

Thus, the quantity (volume) of plaster Darla needs is 418 cm³.

Learn more about volume at https://brainly.com/question/463363

#SPJ1

Plane A has just 1 ton of fuel left and has requested plane B to refuel it. Plane B has 21 tons of fuel. Fuel transfer happens at the rate of 1 ton per minute. Use this information as you work through the activity and find how long it will take to refuel plane A until both planes have the same amount of fuel.

Answers

Answer:

10 minutes

Step-by-step explanation:

Plane A = 1 ton of fuel left

Plane B = 21 tons of fuel Left

Fuel transfer = 1 ton per minute

In order for them to have the same amount of fuel,

We add up the fuel left in Plane A and Plane B

= 21 + 1 = 22 tons

This means each plane will equally have 11 tons

How long it will take to refuel plane A until both planes have the same amount of fuel is calculated as:

Plane B will transfer 10 tons of fuel to Plane A which would give plan A a total of 11 tons.

Since transfer rate = 1 ton per minute

= 1 ton = 1 minute

10 tons = 10 minutes.

Therefore, it will take 10 minutes to refuel plane A until both planes have the same amount of fuel.

Answer:

y = x + 1  y = -x + 21

(0, 1) (0, 21)

(1, 2)         (1, 20)

(2, 3) (2, 19)

(3, 4) (3, 18)

PLATO

Step-by-step explanation:

At great axial distances x from a current-carrying loop the magnetic field varies as
a. x^2
b. x^-3
c. x^3
d. x^-2
e. x^-1

Answers

At great axial distances x from a current-carrying loop, the magnetic field varies as:

b. x^-3



Here's the step-by-step explanation:

1. The magnetic field B at a point on the axis of a current-carrying loop can be given by the formula: B = (μ₀Ia²) / (2(a² + x²)^(3/2))

2. In this formula, μ₀ is the permeability of free space, I is current, a is the radius of the loop, and x is the axial distance from the loop.

3. When the axial distance x is much greater than the radius a (i.e., x >> a), the term a² in the denominator becomes negligible compared to x².

4. Therefore, the formula simplifies to: B ≈ (μ₀I) / (2x³)

As you can see, the magnetic field B varies as x^-3 at great axial distances from the current-carrying loop.

Visit here to learn more about magnetic field:

brainly.com/question/14848188

#SPJ11

Solve the following equation: (number only) 8x-4=12x+6+x

Answers

Answer:

X=2/5

Step-by-step explanation:

8x-4=12x+6+x

8x-4=13x+6

8x-13x=+6-4

-5x=-2

x=-2/-5

x=2/5

(64-42
wich model showes

(64-42wich model showes

Answers

Answer:

3√64 is 4

The answer is in the bottom left under the biggest one

Step-by-step explanation:

To find the volume you need to multiply the height, width, and length which represents the 3 to square it to 4 means 4 unit length on each side to have a total of 64 volume.

Hope this helps!

Antra calculated the product 2222 × 2223 × 22 × 24 and got a number. What will be the remainder when the product is divided by 10?

Answers

Answer:

the remainder is 8

Step-by-step explanation:

2222 x 2223 x 22 x 24 = 2,608,059,168

2,608,059,168 ÷ 10 = 260,805,916.8

so the remainder is 8

awnsers this and you'll get alot of points;)​

awnsers this and you'll get alot of points;)

Answers

Answer:

-11,-5,-2, 8%, 5/2

Step-by-step explanation:

Least to greatest would mean starting off with negatives. So we have -11, -5, -2. Then we known 8% as a number is 8/100 or 0.08. Which is less than 5/2 because 5/2 is equal to 2 1/2. Which is the greatest number out of the 5.

The paired values of the Consumer Price Index (CPI) and the cost of a slice of pizza are listed ( point) in the table. Assume a 0.01 significance level. Determine the correlation coefficient and find the critical values. CPI Cost of Pizza 30.2 48.3 112.3 162.2 191.9 197.8 0.15 0.35 1.00 1.25 1.75 2.00 Or 0.872; critical values- +0.811 Or 0.985; critical values +0.917 Or 0.985; critical values-0.811 r- 0.872; critical values +0.917

Answers

Since the correlation coefficient of 0.872 is greater than the critical value of +0.811, we can conclude that there is a significant positive correlation between CPI and the cost of pizza at a 0.01 significance level.

In statistics, the correlation coefficient measures the strength and direction of the linear relationship between two variables. The correlation coefficient ranges from -1 to 1, where -1 indicates a perfect negative correlation, 0 indicates no correlation, and 1 indicates a perfect positive correlation.

In this case, the correlation coefficient between CPI and the cost of pizza is 0.872, which is close to 1. This indicates a strong positive correlation between the two variables. The critical value for a 0.01 significance level and 4 degrees of freedom is +0.811, which means that if the correlation coefficient is greater than this critical value, we can reject the null hypothesis that there is no correlation between the two variables, and conclude that there is a significant positive correlation.

Since the correlation coefficient of 0.872 is greater than the critical value of +0.811, we can conclude that there is a significant positive correlation between CPI and the cost of pizza at a 0.01 significance level. In other words, as the CPI increases, so does the cost of pizza, and this relationship is not due to chance.

To know more about correlation coefficient,

https://brainly.com/question/27226153

#SPJ11

If 0 Degrees Celsius is 32 Degrees in Fahrenheit, is 0 Degrees Celsius + 0 Degrees Celsius = 64 Degrees Fahrenheit or 32 Degrees Fahrenheit???? Please Help ASAP!!

Answers

0 degrees Celsius + 0 degrees Celsius = 0 degrees Celsius = 32 degrees Fahrenheit.

How to determine the solution

To convert Celsius to Fahrenheit, we use the formula:

°F = (°C × 9/5) + 32

Let's calculate the conversion for 0 degrees Celsius:

°F = (0 × 9/5) + 32

°F = 0 + 32

°F = 32

Therefore, 0 degrees Celsius is equal to 32 degrees Fahrenheit.

Now, let's consider the addition of 0 degrees Celsius and 0 degrees Celsius:

0 degrees Celsius + 0 degrees Celsius = 0 + 0 = 0

Since 0 degrees Celsius is equivalent to 32 degrees Fahrenheit, the sum of 0 degrees Celsius and 0 degrees Celsius is 0, not 64 degrees Fahrenheit.

So, 0 degrees Celsius + 0 degrees Celsius = 0 degrees Celsius = 32 degrees Fahrenheit.

Learn more about Celsius at https://brainly.com/question/30775517

#SPJ1

On a piece of paper, use a protractor to construct right triangle ABC with AB=8 cm, m∠B=30°, and m∠C=90°.

Which statement is true about this triangle?

AC=16 cm
BC=16 cm
AC=4 cm
BC=4 cm
due in 15 minutes pls help!

Answers

The statement which is true about the right triangle as described is; AC=4 cm

Right Triangles

From the given description;

It follows that the triangle is a right triangle with a right angle at corner C.

Additionally, the angle measure, m∠B=30°

Hence, upon construction of the right triangle as described; the measure of line AC is 4cm.

The image is as attached

Read more on right Triangles;

https://brainly.com/question/2437195

On a piece of paper, use a protractor to construct right triangle ABC with AB=8 cm, mB=30, and mC=90.Which

Answer:

ac = 4cm

Step-by-step explanation:

k12

How do you calculate seed number?

Answers

To calculate seed number, divide the total number of inches available for crop by the in-row crop spacing. For example, 120 inches divided by one inch per pea seed equals 120 pea seeds.

What is seed?

In botany, a seed is an undeveloped plant embryo and food reserve encased in a protective outer covering. In a broader sense, "seed" refers to anything that can be sown, such as seed and husk or tuber.

Seeds are formed when a ripened ovule is fertilised by pollen-derived sperm, resulting in a zygote. The embryo develops from the zygote within a seed, forming a seed coat around the ovule and growing to a certain size within the mother plant before growth stops.

The formation of seeds is a stage in the reproduction of seed plants (spermatophytes). Other plants, such as ferns, mosses, and liverworts, lack seeds and must reproduce exclusively through water.

Learn more about seeds

https://brainly.com/question/29045399

#SPJ4

What is the formula for solving for X?

Answers

The formula for solving for X is known as the quadratic equation. This equation is used to solve for the unknown variable X, which is usually a second-degree polynomial equation of the form ax2 + bx + c = 0.

The formula for solving for X is: X = \(\frac{-b ± √(b2 - 4ac) }{2a}\). This formula can be broken down into three parts. The first part is the negative sign in front of the b, which is used to reverse the sign of b. The second part is the square root portion, which takes the difference of b2 and 4ac and finds the square root of that number. Lastly, the denominator of 2a is the coefficient of x2, which is used to divide the answer. The quadratic equation is a useful tool in mathematics as it can be used to solve a variety of equations, such as solving for the roots of a parabola, finding the vertex of a parabola, and finding the area of a triangle. It is also useful in solving problems in physics, such as calculating the trajectory of a projectile, the velocity of a moving object, and finding the time it takes to reach a certain height. Accidently, the quadratic equation can be used to calculate the maximums and minimums of functions, as well as to solve for the solutions of linear equations with two unknowns.

Learn more about polynomial here:

https://brainly.com/question/11536910

#SPJ4

Use an Addition or Subtraction Formula to write the expression as a trigonometric function of one number. cos 13π 15 cos − π 5 − sin 13π 15 sin − π 5 Find its exact value.

Answers

Use an additive or reduction formula to determine an expression as a fractional derivative of one number, which is provided as -1/2.

Now, According to the question:

What do trigonometry's fundamentals entail?

The three basic trigonometric operations are sine, cosine, and tangent. Cotangent, radial basis, and cotangent functions are all built on these three fundamental functions. All trigonometry concepts are built on top of these functions. The learning of trigonometry is not really easy until pupils are familiarized with all the terms and formulae. As a result, it is suggested that students learn each of these and practice responding to test questions from prior years.

The expression is given as:

cos(13/15)cos(-/5)-sin(13/15)sin(-/5)

This has the format of a trigonometry identity -

Cos (A+B) = Cos A Cos B - Sin A Sin B

Then = Cos ( 13π/15 + (-π/5) )

= Cos( 10π/15)

= Cos( 2π/3)

= Cos(120°)

= cos (90° + 30°)

=  -sin 30°

= -1/2

Hence, Cos(13/15)Cos(-/5)-Sin(13/15)Sin(-/5) = -1/2

Learn more about Trigonometry function at:

https://brainly.com/question/29286780

#SPJ4

You just obtained a credit card. You immediately purchase a stereo system for $200. your credit limit is $1000. Let's assume that you make no payments and purchase nothing more and there are no other fees. The monthly interest rate is 1.42%.
What is the growth rate of your credit card balance?
A. 0.42
B. 0.0142
C. 14.2
D. 142

Answers

Answer:

its b

Step-by-step explanation:

have a great day <3

The growth rate of your credit card balance is approximately 0.0142.

Therefore, the correct option is B.

Given that you got a credit card, you purchased a stereo system for $200. your credit limit is $1000.

The monthly interest rate is 1.42%.

We need to determine the growth rate of your credit card balance,

To calculate the growth rate of your credit card balance, we need to consider the monthly interest rate and the initial purchase amount.

The monthly interest rate is 1.42%, which can be expressed as a decimal by dividing it by 100: 0.0142.

The initial purchase amount is $200.

Assuming no payments are made and no additional purchases are made, the credit card balance will increase each month due to the accrued interest.

To calculate the growth rate, we can divide the accrued interest by the initial purchase amount.

Accrued interest = Monthly interest rate x Initial purchase amount

= 0.0142 x $200

= $2.84

Growth rate = Accrued interest / Initial purchase amount

= $2.84 / $200

≈ 0.0142

Therefore, the growth rate of your credit card balance is approximately 0.0142, which corresponds to option B.

Learn more about Credit cards click;

https://brainly.com/question/30940802

#SPJ2

Priya asked each of five friends to attempt to throw a ball in a trash can until they succeeded. She recorded the number of unsuccessful attempts made by each friend as: 1, 8, 6, 2, 4. Priya made a mistake: The 8 in the data set should have been 18. How would changing the 8 to 18 affect the mean and median of the data set

Answers

Answer: The mean will increase and the median would not change

Step-by-step explanation:

Recorded data by Priya :

Data: 1,8,6,2,4

Mean of data = (1+8+6+2+4)/5

=21/5 = 4.2

Median of data = 1,2,4,6,8

Median = 4

Correct data: 1,18,6,2,4

Mean of data = (1+18+6+2+4)/5

=31/5 = 6.2

Median of data = 1,2,4,6,18

Median = 4

Therefore ; according to the evaluation above, the median will remain unchanged, but the mean increased from 4.20 to 6.20.

for how many integer values of does the equation have integer solutions for ?

Answers

The equation has integer solutions for an infinite number of values of k.

(3k + 5)(k - 7) = m^2

Step 1: Expand the equation and rearrange it:

3k^2 - 16k - 35 = m^2

Step 2: Notice that the left-hand side of the equation is a quadratic expression in terms of k. To determine the values of k that yield integer solutions, we need to find the discriminant, which must be a perfect square:

Δ = (-16)^2 - 4 * 3 * (-35) = 256 + 420 = 676 = 26^2

Step 3: Since the discriminant is a perfect square, there exists at least one value of k that yields an integer solution. However, we need to determine if there are additional values. To find them, we solve for k using the quadratic formula:

k = (16 ± √(26^2)) / (2 * 3) = (16 ± 26) / 6

Step 4: Simplify the expression:

k = (8 ± 13) / 3

This gives us two potential values for k: k₁ = 7 and k₂ = -5/3.

Step 5: Substitute these values of k back into the original equation to check if they yield integer solutions:

For k = 7: (3(7) + 5)(7 - 7) = (26)(0) = 0, which is a perfect square.

For k = -5/3: (3(-5/3) + 5)(-5/3 - 7) = (0)(-26/3) = 0, which is also a perfect square.

Step 6: Therefore, the equation has integer solutions for the two values of k found in Step 4, k = 7 and k = -5/3. Thus, there are two integer values of k for which the equation has integer solutions.

Learn more about integer  : brainly.com/question/490943

#SPJ11

I really need help on this question, because I forgot of how to find the angle of each variable.​

I really need help on this question, because I forgot of how to find the angle of each variable.

Answers

Answer:

a = 38 degree

b = 54 degree

c = 54 degree

Step-by-step explanation:

a = 180 - 142 = 38 ( angle on a straight line is equal to 180)

To determine the value of b, we have to find the other missing angle in the triangle.

the value of the missing angle is 38

Alternate angles are equal. the missing angle is alternate to angle b which has a value of 38

b = 180 - (38 + 88) = 54

c = 54

After watching Donald Duck in Mathmagic Land, please type out three things that you learned from the video. Did you like the video? Why or why not? Please answer all parts to the question

Answers

Answer:

Hope this helps

Step-by-step explanation:

Mathmagic Land had taught me more about math that I never knew before. I learned that everything can be involved with math. It all starts at the Pythagoreans which were the Greek. An example of how math is used today, is by playing billiards.

In billiards, you have to have a good technique of how your going to hit the ball, (good angles,) and you have to have a precise calculation of the angle your going to hit it at.I also learned when you cut shapes like a sphere, it just makes more and more shapes.

This is what I learned watching the Mathmagic Land Video.

Yes,  Donald Duck in Mathmagic Land taught me alot of things I did not know before.

   

How long will take a swordfish at top speed to swim an olympic pool?

Answers

Answer:

Maybe 10 to 20 seconds or half a minute depending on where it is and how you will get the swordfish

the correct answer (reported to the proper number of significant figures) to the following is ________. (2115 - 2101) × (5.11 × 7.72) = ________

Answers

Reported to the proper number of significant figures, is 551.56 which has five significant figures.

The given expression is:(2115 - 2101) × (5.11 × 7.72)

Now let's evaluate the given expression to solve for the unknown. For that, we have to perform the mathematical operations in the following order according to the proper order of operations or the PEMDAS rule:

Parentheses or Brackets Exponents or Powers Multiplication or Division (from left to right) Addition or Subtraction (from left to right). So, let's solve the given expression by using the above rule.

(2115 - 2101) × (5.11 × 7.72)= 14 × (5.11 × 7.72)= 14 × 39.3972= 551.5608 ≈ 551.56

The answer, reported to the proper number of significant figures, is 551.56 which has five significant figures.

The first significant figure is 5 (it comes before decimal point), and the next four significant figures are 5, 1, 5, and 6 (they come after decimal point). The final answer should have no more than five significant figures because the least precise number given in the expression (2101) has four significant figures.

To know more about proper numbers visit:

https://brainly.com/question/32601205

#SPJ11

Camila went shopping for a new pair of pants. The listed price of the pair of pants was $38, but the price with tax came to $39.14. Find the percent sales tax.

Answers

Answer:

3%

Step-by-step explanation:

#brainliestisthekey

what is 0.4111111… as a fraction

Answers

So there is a method to do this problem
Take 0.41111... as x
Thus 10x = 4.11111... and 100x= 41.1111...

=> 100x - 10x = 41.1111... - 4.111111
=> 90x=37
=> x= 37/90
=> 0.4111... = 37/90

Find the missing side of the right triangle. 7 ܠ x x= [?] /[ Enter the number that belongs in the green box.​

Find the missing side of the right triangle. 7 x x= [?] /[ Enter the number that belongs in the green

Answers

Answer:

Step-by-step explanation:

Find the missing side of the right triangle. 7 x x= [?] /[ Enter the number that belongs in the green

Alexis sells stuffed animals. She sells a stuffed elephant for $14.95, and the sales tax is 5% of the sale price. About how much is the sales tax on the elephant? Must show work please hurry.

Answers

Answer:

$0.75

Step-by-step explanation:

Given:

Selling price is $14.95Sales tax is 5%

Find the amount of the tax:

14.95*5/100 = 0.7475 ≈ 0.75 (rounded)
Other Questions
How did the Great Awakening and the Enlightenment affect the colonies? if a salesperson was attempting to develop a feeling of ownership in a prospect shopping for a diamond ring, the salesperson should most likely: group of answer choices explain the concept of the four c's in terms of diamonds explain the store's installment payment plan for jewelry lay the ring on black velvet to enhance its brilliance inform the customer of the gem's clarity encourage the customer to try on the ring if the intensity of a sound wave increases by 2%, what is the change in the sound level of the wave? db _____ is an example of a sugar alcohol that has a lower glycemic effect than sucrose How does the molecular weight of the pigment relate to the Rf value? Which molecular weight would move farthest, the lowest molecular weight or the highest molecular weight? What does a small Rf number tell you about the characteristics of the moving molecules vs a large Rf number? Why would having your fingerprints on your chromatograph strip matter? HINT: What macromolecule would be left behind? EARTH SCIENCE igneous rock is dense and has a dark color.a. basalticb. intrusiveC. graniticd. extrusive Max works at a local car wash. he can wash 9 cars every 2 hours. at this rate, how many cars will he be able to wash in 6 hours? Can someone plz help me out i rlly need to pass thisIn the diagram, z and y are the measures of two complementary angles.Also, the measure of one of the angles is 29.6What is the correct value for x?Enter your answer as a decimal, if necessary, like this: 42.5 Solve for X50 POINTS IN IT FOR YOU, ILL GIVE THANK, BRIANLIEST AND 5 STARS 4.) How did governmentofficials get Indiansto leave their lands? How did Suharto create strong ties with the United States? Solve the following boundary value problem. if there is no solution, write none for your answer. y3y=0; y(0)=22e3; y(1)=0 Nearly ______ percent of school-age children have received a medical diagnosis of adhd. in lecture the argument was make that trade lead to colonization. which of the following was not mentioned as one of the types of colonies that developed as a result of increasing trade across the oceans? group of answer choices plantation colonies occupation colonies penal colonies trade colonies settler colonies If there are over 1,000 websites about a certain topic, the information is reliable. A. True B. False 7/89 + 4/79 write your answer as a mixed number in simplest form What was Freedmana Bureau? how many different alkenes result when 2-bromooctane is treated with a strong base? select answer from the options below why was the black death so significant to Medieval Europe? I will mark brainly. a client is scheduled to have breast augmentation surgery in the outpatient surgical unit. which discharge instructions would the nurse provide? select all that apply. one, some, or all responses may be correct.