Suppose the CO gas evolved by a certain chemical reaction taking place at 30.0 °C is collected over water, and the final volume of gas in the collection tube is measured to be 128 mL.
Calculate the mass of CO that is in the collection tube.
To solve the problem we have to find the number of moles of CO that are in the sample. But, since the sample is collected over water, the CO is not alone. The sample also contains water vapor.
To solve problems like this one we usually use Dalton's Law to find the partial pressure of the gas of interest. And then the Ideal Gas Law to find the number of moles of CO.
According to Dalton's Law the total pressure exerted is equal to the sum of the partial pressures of the individual gases that form the mixture. So:
Ptotal = Pco + Pwater
We are not given the total pressure so we will assume that it is 1 atm (atmoshperical pressure). And if we look for the Vapor Pressure of water at 30 °C we will find that it is 31.82 mmHg (we have to convert it to atm also). So:
Ptotal = 1 atm
Pwater = 31.82 mmHg * 1 atm / 760 mmHg
Pwater = 0.0419 atm
Now we can find the partial pressure of CO:
Ptotal = Pco + Pwater
Pco = Ptotal - Pwater
Pco = 1 atm - 0.0419 atm
Pco = 0.9581 atm
So we found that the partial pressure of CO in our sample is 0.9581 atm. What does that mean? That if the molecules of CO were alone in the sample (occupying the 128 ml) they would have a pressure of 0.9581 atm.
Now we can use the Ideal gas Law to find the number of moles of CO:
Pco * V = n * R * T
Pco = 0.9581 atm
V = 128 mL = 128 mL * 1 L /(1000 mL) = 0.128 L
n= number of moles of CO
R = ideal gas constant = 0.082 atm*L/(mol*K)
T = 30.0 °C = (273.15 + 30.0) K = 303.15 K
Pco * V = n * R * T
n = Pco * V / (R * T)
n= 0.9581 atm * 0.128 L / (0.082 atm*L/(mol*K) *303.15 K)
n = 0.00493 moles of CO
So there are 0.00493 moles of CO in the sample. To finisht the problem we have to find the mass of CO using its molar mass.
molar mass of CO = 12 + 16 = 28 g/mol
mass of CO = number of moles of CO * molar mass of CO
mass of CO = 0.00493 moles of CO * 28 g/mol
mass of CO = 0.138 g = 0.14 g
So the answer to our problem using 2 SF is 0.14 g of CO.
characteristics. of. rusting
Answer: metal turn orange and weaker as it gets oxidised
Explanation:
During a UV-Visible spectroscopy experiment, a student notes a wavelength peak measurement at 280 nm. What region of the electromagnetic spectrum was this peak observed?
If during a spectroscopy experiment a student notes a wavelength peak measurement at 280 nm, then the region of the electromagnetic spectrum observed is the UV region.
What is the electromagnetic spectrum?The electromagnetic spectrum refers to all types of wavelengths that radiation can emit as light, which involves both visible light and also ultraviolet (UV) radiation.
In conclusion, if during a spectroscopy experiment a student notes a wavelength peak measurement at 280 nm, the region of the electromagnetic spectrum observed is the UV region.
Learn more about the electromagnetic spectrum here:
https://brainly.com/question/23423065
#SPJ1
Three biologically important diatomic species, either because they promote or inhibit life, are
(a) CO,
(b) NO3 and
(c) CN-.
The first binds to hemoglobin, the second is a chemical messenger, and the third interrupts the respiratory electron transfer chain. Their biochemical action is a reflection of their orbital structure. Deduce their ground state electron configurations.
Answer:
See Explanation
Explanation:
We can write the molecular orbital configuration of molecules in the same way as we write the orbital electron configuration of atoms. The valence electrons in the molecule are filled into molecular orbitals of appropriate energy in accordance to the Aufbau principle.
For CO;
σ2s2, σ*2s2, Π2py2, Π2pz2, σ2px2
For NO;
σ2s2, σ*2s2, Π2px2, Π2py2, σ2pz2, Π*2px1
For CN-;
σ2s2, σ*2s2, Π2px2, Π2py2, σ2pz2
These are the ground state electron configurations of these molecules.
how many moles of CaCo3 are there in an antacid tablet containing 0.512g CaCo3
The number of mole of CaCO₃ in antacid tablet containing 0.512 g of CaCO₃ is 5.12×10⁻³ mole
Description of moleThe mole of a substance is related to it's mass and molar mass according to the following equation:
Mole = mass / molar mass
How to determine the mole of CaCO₃From the question given above, the following data were obtained:
Mass of CaCO₃ = 0.512 gMolar mass of CaCO₃ = 40 + 12 + (3 × 16) = 40 + 12 + 48 = 100 g/mol Mole of CaCO₃ =?The number of mole in 0.512 g of CaCO₃ can be obtained as follow:
Mole = mass / molar mass
Mole of CaCO₃ = 0.512 / 100
Mole of CaCO₃ = 5.12×10⁻³ mole
Thus, 5.12×10⁻³ mole of CaCO₃ is present in the antacid tablet
Learn more about mole:
https://brainly.com/question/13314627
#SPJ1
Is it possible to predict whether a precipitate will likely be white or a color other than white based on the position of the cation's element in the periodic table? Refer to a periodic table and the compiled data of the different teams with regard to the precipitate color of the cations that reacted to support your conclusion.
Is it possible to predict whether a precipitate will likely be white or a color other than white based on the position of the cation's element in the periodic table then the precipitate is determined by qualitative analysis
Precipitation is the formation of a solid in a solution or inside another solid during a chemical reaction or by diffusion in a solid
Here the composition of relatively complex mixture of metal ion can be determined by using qualitative analysis then in group 1 there are insoluble chlorides in that most metal chloride salt are soluble in water and if no precipitate is form then this cation are not present in significant amount and when white precipitate is formed by the solution of AgNO₃ is added to an acidified unknown solution then white precipitate indicate that presence of Cl⁻ ions whereas all chromates are usually yellow orange or red precipitate
Know more about precipitate
https://brainly.com/question/14397615
#SPJ1
Lithium hydrogen phosphate formula
The formula for lithium hydrogen phosphate is Li2HPO4.
What is lithium hydrogen phosphate (Li2HPO4)?
Lithium hydrogen phosphate (Li2HPO4) is a chemical compound that contains the elements lithium, hydrogen, phosphorus, and oxygen. It is an ionic compound and a salt of phosphoric acid.
Lithium hydrogen phosphate is commonly used in the production of lithium-ion batteries and as a source of lithium ions in chemical reactions. It is also used in the synthesis of various other lithium compounds. In addition, lithium hydrogen phosphate has potential applications in the field of biomedical engineering as a material for bone tissue engineering and drug delivery.
What is an ionic compound?
An ionic compound is a type of chemical compound formed by the combination of positively charged ions (called cations) and negatively charged ions (called anions) through electrostatic attraction. The cations and anions are held together by ionic bonds, which are formed by the transfer of electrons from the cation to the anion. Ionic compounds are typically solids at room temperature and have high melting and boiling points. Examples of ionic compounds include sodium chloride (NaCl), magnesium oxide (MgO), and calcium carbonate (CaCO3).
To know more about ionic compound, visit:
https://brainly.com/question/29005103
#SPJ1
A sample of gas has a density of 0.53 g/L at 225 K and under a pressure of 108.8 kPa. Find the density of the gas at 345 K under a pressure of 68.3 kPa. Assuming the mass is equal to 1 gram.
Answer:
\(\rho _2=0.22g/L\)
Explanation:
Hello!
In this case, since we are considering an gas, which can be considered as idea, we can write the ideal gas equation in order to write it in terms of density rather than moles and volume:
\(PV=nRT\\\\PV=\frac{m}{MM} RT\\\\P*MM=\frac{m}{V} RT\\\\P*MM=\rho RT\)
Whereas MM is the molar mass of the gas. Now, since we can identify the initial and final states, we can cancel out R and MM since they remain the same:
\(\frac{P_1*MM}{P_2*MM} =\frac{\rho _1RT_1}{\rho _2RT_2} \\\\\frac{P_1}{P_2} =\frac{\rho _1T_1}{\rho _2T_2}\)
It means we can compute the final density as shown below:
\(\rho _2=\frac{\rho _1T_1P_2}{P_1T_2}\)
Now, we plug in to obtain:
\(\rho _2=\frac{0.53g/L*225K*68.3kPa}{345K*108.8kPa}\\\\\rho _2=0.22g/L\)
Regards!
Zn(s) =PbCI2(aq) ZnCI2(aq)+Pb(s) reaction type
Answer:
Redox reaction
Explanation:
HELP FAST PLZ!!!!!!!!!!!!!_____ energy from the outlet transfers energy to the light bulband
the bulb lights up,
heat
electrical
kinetic
potential
Answer:
electrical
Explanation:
It wouldnt be kinetic or potential since both of those have to do with motion, and it would not be heat because heat does not power a light bulb. Therefore, the answer is electrical.
HELP
____________ sweat by water from the leaf cells __________________ into the air, which pulls _______________________ from the leaf into the air.
Answer:
Water sweated by water from the leaf cells evaporating into the air, which pulls water and nutrients from the leaf into the air.
describe what xeriscaping is and what is involved in a successful xeriscaping project
Xeriscaping is a landscaping approach that focuses on conserving water by using drought-tolerant plants and efficient irrigation techniques. The goal is to create a visually appealing and sustainable garden while minimizing water usage.
Successful xeriscaping projects involve several key elements. Firstly, careful plant selection is crucial, opting for species that can thrive in arid conditions without excessive watering. Mulching is used to reduce evaporation and retain soil moisture.
Proper soil preparation, such as improving drainage and adding organic matter, promotes healthier plant growth. Efficient irrigation systems, like drip irrigation or soaker hoses, deliver water directly to plant roots, minimizing wastage.
Additionally, controlling erosion through the use of retaining walls or terracing is important. Lastly, regular maintenance, including appropriate pruning and weed control, ensures the longevity and vitality of the xeriscape garden. Overall, a successful xeriscaping project harmonizes sustainable practices with a beautiful outdoor environment.
For more such questions on Xeriscaping
https://brainly.com/question/12960529
#SPJ11
0.156000 in standard notation
Hi!
0.156000 is written as 1.56000 × 10-1 in scientific notation.
Hope this helps!~~PicklePoppers~~Alkali metals react violently with water. How much Hydrogen gas (in g) is produced when 10.0 g of sodium reacts with excess water according to the following equation?
2Na + 2H2O ----> 2NaOH + H2
The mass of Hydrogen gas produced when 10.0 g of sodium reacts with excess water is 0.44 g.
From the question,
We are to determine the mass of Hydrogen gas produced when 10.0g of sodium reacts with excess water.
From the balanced chemical equation for the reaction
2Na + 2H₂O → 2NaOH + H₂
This means
2 moles of sodium reacts with 2 moles of water to produce 2 moles of sodium hydroxide (NaOH) and 1 mole of Hydrogen gas.
Now, we will determine the number of moles of sodium present
Mass of sodium = 10.0 g
Atomic mass of sodium = 22.99 g/mol
From the formula
\(Number\ of\ moles\ = \frac{Mass}{Molar\ mass}\)
∴ Number of moles of sodium present = \(\frac{10.0}{22.99}\)
Number of moles of sodium present = 0.43497 mole
From the balanced chemical equation
2 moles of sodium reacts with 2 moles of water to produce 1 mole of Hydrogen gas.
Then,
0.43497 mole of sodium will react with 0.43497 mole of water to produce \(\frac{0.43497}{2}\) mole of Hydrogen gas
\(\frac{0.43497}{2} = 0.217485\)
∴ 0.217485 mole of Hydrogen gas was produced during the reaction
Now, for the mass of Hydrogen gas produced
Using the formula
Mass = Number of moles × Molar mass
Molar mass of H₂ = 2.016 g/mol
∴ Mass of Hydrogen gas produced = 0.217485 × 2.016
Mass of Hydrogen gas produced = 0.43845 g
Mass of Hydrogen gas produced ≅ 0.44 g
Hence, the mass of Hydrogen gas produced when 10.0 g of sodium reacts with excess water is 0.44 g.
Learn more here: https://brainly.com/question/15110469
Which step is this ?prophase I, Anaphase I, prophase II, Anaphase II
Answer:
Prophase 1
Explanation:
Answer:
The correct answer will be prophase I
Explanation:
During this stage, the genetic code is together and hasn't split yet therefore, the answer is prophase I hopefully this helps!
which of the following is a fission reaction?
carbon-12 and hydrogen-1 combining to form a nitrogen-13 atom
Answer:The reactions are as follows: a carbon-12 (12C) nucleus captures a hydrogen nucleus (1H, a proton) to form a nucleus of nitrogen-13 (13N); a gamma ray (γ) is emitted in the process. The nitrogen-13 nucleus emits a positive electron (positron, e+) and becomes carbon-13 (13C).
Ca(NO3)2(aq) + KCl(aq) →
Express your answer as a chemical equation.
The chemical equation is
\(\rm Ca(NO_ 3)_2 (aq) + 2KCl (aq) \rightarrow CaCl_2 + 2KNO_3\)
What are chemical equation?Chemical equation is defined as a symbolic representation of a chemical reaction in the form of symbols, in which the reactants and products are expressed in terms of their respective chemical formulas. It can also be called as chemical reactions.
There are basically six types of chemical reactions.
Combination reactionDecomposition reactionPrecipitation reactionNeutralization reactionCombustion reactionDisplacement reactionThus, the chemical equation is
\(\rm Ca(NO_ 3)_2 (aq) + 2KCl (aq) \rightarrow CaCl_2 + 2KNO_3\)
To learn more about chemical equations, refer to the link below:
https://brainly.com/question/28294176
#SPJ2
gWhat is the concentration of a solution made by diluting 5.0 mL of a 3.2 M glucose solution by adding enough water to make a 40.0 mL solution
Answer:
0.4 M
Explanation:
To solve this problem first we calculate the number of glucose moles, using the first volume and concentration:
3.2 M * 5.0 mL = 16 mmol glucoseThis number of moles remains the same throughout the dilution process. So we can now calculate the concentration of the second solution, dividing the number of moles by the second volume:
16 mmol / 40.0 mL = 0.4 MHow many moles of water contain each of the following number of molecules?
4.38 × 10^21 molecules
Report your answer using appropriate number of significant figures.
In 4.38 × 10^21 molecules of water, there are approximately 0.073 moles.
To calculate the number of moles, we can use Avogadro's number, which states that 1 mole of a substance contains 6.022 × 10^23 molecules. So, by dividing the given number of molecules (4.38 × 10^21) by Avogadro's number, we can find the number of moles.
Now, let's explain the process in detail. Avogadro's number is a constant that represents the number of particles (atoms, molecules, etc.) in one mole of a substance. It is approximately 6.022 × 10^23. Therefore, if we divide the given number of molecules by Avogadro's number, we can determine the number of moles.
In this case, we divide 4.38 × 10^21 molecules by 6.022 × 10^23 molecules/mole, resulting in approximately 0.073 moles.
Significant figures play an important role in reporting the answer. The given number of molecules has three significant figures (4, 3, and 8), so our answer should be reported with three significant figures as well. Therefore, the number of moles is approximately 0.073.
for such more questions on molecules
https://brainly.com/question/475709
#SPJ8
59. Which one has 0 dipole moment?
a. H2O2 b. Co2 c. HF
d. HBr
Answer:
the answer to this question is A H202
Is the following chemical equation balanced? Please make a claim, provide evidence, and then explain your reasoning.
2Li + 2H2O H2 + 2LiOH
Answer:
first the right answer is
Li + H2O = LiOH + H2O
then to balance it...
2 Li + 2 H2O = 2 LiOH + H2
so that we can have both side of the equation to be equal....
HOPE ITS HELPS....
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
6. How many moles are in 8.30 x 1023 molecules of CO₂?
a.
b.
C.
d.
1.37
2.8
55.5
100
- Preparation of NaPO4 solution (So): A solution (So) of sodium phosphate is to be prepared of molar concentration 0.1 mol/L. mL. 100 Given M(Na3PO)=164 g/mol. and a volume 1.1- Calculate the mass of sodium phosphate needed to prepare this solution. Deduce its mass concentration (Cm). 1.2 - Write the materials and glassware needed. 1.3- Write the equation of dissolution of sodium phosphate. 1.4- Determine the molar concentration of Na ions in this solution
Answer:
Explanation:
1.1 we have to find mass of Na3PO4;
for that we have to Calculate the moles of Na3PO4 needed:
volume is 100mL = 0.1L
Molar concentration = Moles of solute / Volume of solution in L
0.1 mol/L = Moles of Na3PO4 / 0.1 L
Moles of Na3PO4 = 0.1 mol/L * 0.1 L
Moles of Na3PO4 = 0.01 mol
Now, Calculate the mass of Na3PO4 needed:
so, Mass = Moles of Na3PO4 * Molar mass of Na3PO4
Mass = 0.01 mol * 164 g/mol
Mass = 1.64 g of Na3PO4.
1.2 materials and glassware needed:
1.64 g Sodium phosphate (Na3PO4)
100 mL volumetric flask
weighing balance
Distilled water
Glass rod
Pipette and burette
homogenous and heterogenous catalyst1- state the definition of each one. 2- describe in detail the mechanism of each one. 3- give example of 2 industrial uses per catalyst type with balanced equations for the reactions each catalyzes and the catalyst name.
1) Homogeneous catalysts are those that occupy the same phase as the reaction mixture (generally liquid or gas), while heterogeneous catalysts occupy a different phase. Normally, heterogeneous catalysts are solid compounds that are added to liquid or gas reaction mixtures.
A 25 ml solution of 0.5 M NaOH is titrated until neutralized into a 50 ml sample of HCl?
The concentration of the acid is \(0.25 M\).
Titration is a laboratory technique used to determine the concentration of a substance in a solution by reacting it with a standardized solution of known concentration.
The titration formula can be given by,
(Volume of the Base) \(\times\) (Normality of the Base) = (Volume of the Acid) \(\times\) (Normality of the Acid)
\(\Rightarrow V_1N_1=V_2N_2\)
Given, the volume of the base (\(NaOH\)), \(V_1 =25 ml\).
The concentration of the base (\(NaOH\)), \(M_1=0.5 M\).
The equivalence of the base (\(NaOH\)) is \(1\).
Hence, the normality of the base (\(NaOH\)), \(N_1=\frac{0.5}{1}N=0.5N\).
Given, the volume of the acid (\(HCl\)), \(V_2 =50 ml\).
Let us assume that the normality of the acid (\(HCl\)) \(N_2\).
Substitute the values in the given formula of titration.
\((25\times0.5)=(50 \times N_2)\\\Rightarrow 12.5=50N_2\\\Rightarrow N_2=\frac{12.5}{50} N\\\Rightarrow N_2=0.25 N\)
Hence, the normality of the acid (\(HCl\)), \(N_2=0.25 N\).
The equivalence of the acid (\(HCl\)) is \(1\).
Therefore, the concentration of the acid, \(M_1=\frac{0.25}{1}=0.25 M\).
Learn more about titration here: brainly.com/question/186765
Which of the following a true statement about igneous rocks?
A: Igneous rocks are only formed under a lot of heat and pressure. Some igneous rocks are formed below the surface others in oceans.
B: The properties of igneous rocks depend on the location in which they are formed.
C: Wind and water erosion can create igneous rocks.
Answer:
i think the answer is A....
Explanation:
Igneous rocks (from the Latin word for fire) form when hot, molten rock crystallizes and solidifies. The melt originates deep within the Earth near active plate boundaries or hot spots, then rises toward the surface.
plz help ill give u brainiest
Answer:
Supercalifragilisticexpialidocious...
Explanation: beacause...so...yeah...
Workers on a movie set are stacking fake glass to use in a scene. The diagram above shows the pieces of fake glass before they touch each other. Use the information in the diagram to answer the question.
Compare the temperatures of the four pieces of fake glass before they touch. Which pieces are warmer, which pieces are cooler, and are any pieces the same temperature as each other? After the top pieces and bottom pieces have been touching for a while, will the two bottom pieces be the same temperature or different temperatures? Explain how their temperatures will compare, and why.
Answer:
I did the same thing I hope this helps you and sorry if its incorrect :)
When observing the photo above, I see that in both scenes, the bottom glass has 8 as their molecule energy and the top has 16 as their molecule energy. Since the bottom glass has more molecules in scene 2, that means they have more total energy. However, in scene 1, the top glass has more total energy. In scene one, the top is warmer and the bottom is cooler. In scene 2, the bottom glass is warmer than the top. No pieces are at the same temperature. When they have been touching for a while, the pieces will be at the same temperature since they will eventually reach equilibrium. The temperature will compare because at the start, they were different temperatures. However, after they will have the same temperature.
What mass of CaCl2 would you need to have 0.43 moles of CaCl2?
To determine the mass of CaCl2 we need, we must first calculate what the molar mass of the molecule is. To find the molar mass of a molecule, we add the atomic weights of the elements multiplied by the number of atoms of each element. To see it a little clearer we can make the following table:
The molar mass of the CaCl2 molecule is 110.984 g/mol. They give us the number of moles and ask us to find the mass, we apply the following equation to find the mass of CaCl2:
\(\begin{gathered} gC_{}aC_{}l_2=GivenmolCaCl_2\times\frac{MolarMass,gCaCl_2}{1molCaCl_2} \\ gC_{}aC_{}l_2=0.43molCaCl_2\times\frac{110.984gCaCl_2}{1molCaCl_2}=48gCaCl_2 \end{gathered}\)To have 0.43 moles of CaCl2 would need 48gCaCl2
see image attached please and thank you
hope it helps:)
\(a. \: Ca + Cl _{2} → CaCl _{2} \\
\\ b. \: Cl _{2}+H _{2} O+ NaOH → \\ NaCl+ H _{2}O \\ \\
c. \: \: \: H _{2} SO _{4} +CaCO _{3} → \\ CaSO _{4} +H _{2}O+CO _{2} \\ \\
d. \: \: Fe+Cu(NO _{3}) _{2} → \\ Fe(NO _{3} ) _{2}+Cu\)
brainliest pls 。◕‿◕。