Convert a speed of 931 cm/s
to units of inches per minute. Also, show the unit analysis by dragging components into the unit‑factor slots.

Answers

Answer 1

To convert a speed of 931 cm/s to inches per minute, we can use the conversion factor of 1 inch = 2.54 cm.

931 cm/s x (1 inch/ 2.54 cm) x (60 seconds/minute) = 34,843.58 inches/minute

Unit Analysis:

931 cm/s x (1 (inch) / 2.54 cm) x (60 (seconds/minute)) = 34,843.58 inches/minute


Related Questions

What is Na2Co3? How look like that's?

Answers

Sodium carbonate, often referred to as Na2CO3, is a chemical compound composed of atoms of sodium (Na), carbon (C) and oxygen (O).

It is also sometimes called washing soda or soda ash. At room temperature, sodium carbonate is a white, crystalline solid that is very soluble in water. According to the chemical formula of the sodium carbonate molecule, Na2CO3, each molecule consists of two sodium atoms (Na), one carbon atom (C) and three oxygen atoms (O). The atomic configuration in sodium carbonate is shown in the given diagram.

A trigonal planar arrangement is formed when the central carbon atom is bonded to three oxygen atoms. The structure of sodium carbonate is completed by two sodium atoms joined to oxygen atoms.

Learn more about Sodium carbonate, here:

https://brainly.com/question/31422792

#SPJ1

What is Na2Co3? How look like that's?

When the equation below is balanced, what is the coefficient for ammonia gas?
_NH3(g) + _O2(g) → _N2(g) + _H2O(g)

Answers

Answer:

4NH3(g) + 3O2(g) → 2N2(g) + 6H2O(g)

Explanation:

What is the correct coefficient for the electrons in the following half-reaction: Ni4+ + ___ e− →Ni

Answers

In the aforementioned reaction, the appropriate electron coefficient is 3. The electrons' half-proper reaction's electron coefficient is: Ni4+ + ___eNi2+ CO's electron efficiency is 2 I.

An electrons half equation is what?

You may see what occurs at one of the terminals during electrolysis using a half-equation. The symbol for an electron is e-. By adding or removing an amount of electrons that equals the total of the charges here on ions in the equation, a half-equation may be made to balance.

Half-reaction ion electron method: what is it?

The redox equation is divided into two half-equations, one for combustion and one for reduction, in the ion-electron approach (also known as the half-reaction method). The adjusted redox expression is generated by individually matching each of these half-reactions.

To know more about coefficient visit:

https://brainly.com/question/28218215

#SPJ1

PLEASE ANSWER QUICKLY!!!!

2KI (aq) + Cl₂(g) → 2KCl(aq) + 1₂(g)
What volume of 12 gas forms when
21 L Cl2 react at STP?
[?] L 12

PLEASE ANSWER QUICKLY!!!!2KI (aq) + Cl(g) 2KCl(aq) + 1(g)What volume of 12 gas forms when21 L Cl2 react

Answers

The volume of 12 gas forms when 21 L Cl2 react at STP is 21 L.

To determine the volume of 12 gas (I assume you mean I2 gas) formed when 21 L of Cl2 reacts at STP (standard temperature and pressure), we need to use the ideal gas law equation.

The ideal gas law equation is given by:

PV = nRT

Where:

P = pressure

V = volume

n = number of moles

R = ideal gas constant

T = temperature

At STP, the pressure is 1 atm, and the temperature is 273.15 K.

From the balanced equation, we can see that the molar ratio between Cl2 and I2 is 1:1. So, if 21 L of Cl2 reacts, it will produce an equal volume of I2 gas.

Given that the volume of Cl2 is 21 L, we can assume the volume of I2 gas formed will also be 21 L.

Therefore, the volume of I2 gas formed is 21 L.

For more such questions on volume

https://brainly.com/question/1749900

#SPJ8

Plz help me ASAP in my final project I am ready to pay 20$

Answers

Answer:

what do you need help with

what is the PH scale of 0.02m of hydrochloric acid​

Answers

Answer:

Explanation:

The pH of 0.02 M hydrochloric acid is approximately 1.7.

THANKS

IF THE ANSWER IS CORRECT , THEN MARK ME AS BRAINLIST

The pH scale is a measure of the acidity or alkalinity of a solution. It ranges from 0 to 14, where pH 7 is considered neutral, values below 7 are acidic, and values above 7 are alkaline or basic.

To determine the pH of a hydrochloric acid solution, we need to know its concentration. You mentioned a concentration of 0.02 M (molar), which refers to 0.02 moles of hydrochloric acid dissolved in 1 liter of solution.

Hydrochloric acid (HCl) is a strong acid that dissociates completely in water, meaning all HCl molecules release their hydrogen ions (H+) into the solution. Since the concentration is given as 0.02 M, it means there are 0.02 moles of H+ ions in 1 liter of the solution.

To calculate the pH, we can use the formula:

pH = -log[H+]

In this case, [H+] represents the concentration of hydrogen ions in moles per liter. Since hydrochloric acid is a strong acid and it dissociates completely, the concentration of hydrogen ions is equal to the concentration of HCl, which is 0.02 M.

pH = -log(0.02) ≈ 1.70

Therefore, a hydrochloric acid solution with a concentration of 0.02 M would have a pH of approximately 1.70, indicating it is strongly acidic.

A leaf change color is evidence of which type of chemical change?

Answers

Answer:

changes like leaves turning color in the fall are chemical changes. They involve chemical reactions. Bonds break in chemicals and new bonds form. Substances change into new chemical compounds.

Explanation:

Determine the empirical formula of a compound that contains the following percentages of elements by mass:Mo = 43.95%, O = 7.33%, Cl = 48.72%

Answers

If a compound that contains the elements by mass: Mo = 43.95%, O = 7.33%, Cl = 48.72% then the empirical formula will be Cl3MoO

The molar mass of Cl=35.453,

Molar mass of Mo=95.94,

Molar mass of O=15.9994

Converting these  to moles: Cl=1.3742137477787, Mo=0.45809881175735, O=0.45814218033176

Here the smallest mole value is 0.45809881175735

Now we have to divide all components by the smallest value: Cl=2.9998194985641, Mo=1, O=1.0000946707856

If we don't consider the fractional values the closest round of values will be: Cl=3, Mo=1, O=1

So the formula becomes Cl3MoO

Therefore the required empirical formula is Cl3MoO

Learn more about empirical formula:

https://brainly.com/question/26388921

#SPJ4

Calculate the molarity of an aqueous solution that is 22. 3% by mass calcium chloride. You might need to know that the density is 1. 20 g/ml.

Answers

Answer:

Explanation:

To calculate the molarity of the solution, we first need to determine the mass of calcium chloride (CaCl2) in 100 g of the solution.

If the solution is 22.3% calcium chloride by mass, this means that there are 22.3 g of CaCl2 in 100 g of the solution.

We can use the density of the solution to convert 100 g of the solution to its volume:

volume of 100 g of the solution = mass of the solution / density of the solution

volume of 100 g of the solution = 100 g / 1.20 g/mL = 83.3 mL

Now, we can calculate the molarity of the solution using the following formula:

molarity = moles of solute / volume of solution (in L)

The molar mass of CaCl2 is 40.08 + 2(35.45) = 110.98 g/mol. Therefore, the number of moles of CaCl2 in 22.3 g of the solution is:

moles of CaCl2 = 22.3 g / 110.98 g/mol = 0.2008 mol

The volume of the solution containing 22.3 g of CaCl2 is:

volume of solution = 83.3 mL / 1000 mL/L = 0.0833 L

Substituting these values into the formula for molarity, we get:

molarity = 0.2008 mol / 0.0833 L = 2.41 M

Therefore, the molarity of the aqueous solution that is 22.3% by mass calcium chloride is 2.41 M.

Why does it mean by methane molecule is symmetrical?

Answers

A methane molecule (CH4) is considered symmetrical because it possesses a symmetric structure and exhibits symmetry operations.

Symmetry refers to a balanced arrangement of elements that can be divided into equal parts by a plane, axis, or center. In the case of methane, it exhibits several symmetrical characteristics.

Firstly, methane has a tetrahedral molecular geometry, with the carbon atom at the center and four hydrogen atoms positioned around it. This geometry ensures that the molecule is symmetrical in terms of its spatial arrangement.

Each hydrogen atom is located at one of the vertices of the tetrahedron, forming equal angles and distances with respect to the central carbon atom. This symmetry is maintained regardless of the orientation of the molecule.

Additionally, methane possesses rotational symmetry. It can be rotated around any of the carbon-hydrogen bonds, and the molecule will retain its overall appearance.

The symmetry of methane arises from its molecular structure and the equal distribution of electron density around the central carbon atom. The four hydrogen atoms are bonded to the carbon through sigma bonds, which have a cylindrical symmetry. This balanced arrangement of the atoms contributes to the overall symmetry of the molecule.

For more such questions on methane visit:

https://brainly.com/question/25207057

#SPJ8

What is the mass of 750 atoms of Nitrogen?

Answers

Answer:

53.545803079954496

Explanation:

Brainliest pls

Sns
Station 5
Find the formula for the following
compounds:
Chromium (II) Oxide
Chromium (III) Oxide
Lead (II) Phosphide
Mercury (0) Sulfide
Manganese (11) Nitride

Answers

lead mercury cenus eathr

2.
Which mixture could be a useful buffer in a solution?

acetic acid (CH3CO2H) and hydrochloric acid (HCl)
sodium hydroxide (NaOH) and elemental sodium (Na)
ammonia (NH3) and ammonium chloride (NH4Cl)
acetic acid (CH3CO2H) and ammonia (NH3)


Pls answer quickly

Answers

Ammonia (\(NH_3\)) and ammonium chloride (\(NH_4Cl\)) mixture could be a useful buffer in a solution. Option C

A buffer is a solution that can resist changes in pH when small amounts of acid or base are added. It consists of a weak acid and its conjugate base or a weak base and its conjugate acid. The buffer system works by the principle of Le Chatelier's principle, where the equilibrium is shifted to counteract the changes caused by the addition of an acid or a base.

In option A, acetic acid (\(CH_3CO_2H\)) is a weak acid, but hydrochloric acid (HCl) is a strong acid. This combination does not form a buffer because HCl is completely dissociated in water and cannot provide a significant concentration of its conjugate base.

Option B consists of sodium hydroxide (NaOH), which is a strong base, and elemental sodium (Na), which is a metal. This combination does not form a buffer as there is no weak acid-base pair involved.

Option D contains acetic acid (\(CH_3CO_2H\)), a weak acid, and ammonia (\(NH_3\)), a weak base. Although they are weak acid and base, they do not form a buffer system together as they are both weak acids or bases and lack the required conjugate acid-base pair.

Option C, ammonia (\(NH_3\)), is a weak base, and ammonium chloride (\(NH_4Cl\)) is its conjugate acid. This combination can form a buffer system. When ammonia reacts with water, it forms ammonium ions (NH4+) and hydroxide ions (OH-).

The ammonium ions act as the weak acid, while the ammonia acts as the weak base. The addition of a small amount of acid will be counteracted by the ammonium ions, and the addition of a small amount of base will be counteracted by the ammonia, thus maintaining the pH of the solution relatively stable.

Therefore, option C, consisting of ammonia (\(NH_3\)) and ammonium chloride (\(NH_4Cl\)), is the suitable mixture that could be a useful buffer in a solution.

For more such question on buffer visit:

https://brainly.com/question/13076037

#SPJ8


What type of reactions are the following problems?
10) 12 Al + 1 S8→ 4 Al₂S3
a. Single replacement
b. double replacement.
c. Synthesis/combination
d. Decomposition
e. Combustion

Answers

Answer: a

Explanation:

Day/Night and Seasons (8.7A)
4 Which of the following changes would be most likely to occur if the rate of
Earth's rotation on its axis decreased?
A The length of day would be longer.
B The length of day would be shorter.
C The length of seasons would be longer.
D The length of seasons would be shorter.

Answers

The changes that most likely would occur if the rate of Earth's rotation on its axis decreased is the length of day would be longer (option A).

What is Earth's rotation on its axis?

Earth's rotation on its axis refers to the movement of the Earth that determine the length of days (i.e. 24 hours), conversely to translation movement that determines the seasons.

Therefore, with this data, we can see that Earth's rotation on its axis determines the length of the day, and thereby a slow movement will produce longer days.

Learn more about Earth's rotation on its axis here:

https://brainly.com/question/1808956

#SPJ1

What’s a carbohydrate?

A. A hormone
B. A cholesterol molecule
C. An enzyme
D. A sugar molecule

Answers

D.. carbohydrate is a sugar molecule

A gas has a pressure of 2.70 atm at 50.0 °C. What is the pressure at standard temperature (0°C)?

Answers

Answer:

2.282 atm

P1V1/T1 = P2V2/T2

2.70atm / (50+273) = X/ 273

make x subject of formula

:. X = 2.28 atm

or 2.28 * 1.01 *10⁵ N/m²

you can support by rating brainly it's very much appreciated ✅✅

Calculate the percent dissociation of acetic acid (CH,CO,H) in a 0.60 mM aqueous solution of the stuff. You may find some useful data in the ALEKS Data resource. Round your answer to 2 significant digits. 1% x10 Х ?
Previous question

Answers

The percent dissociation of acetic acid (CH,CO,H) in a 0.60 mM aqueous solution is 98.38%.

When 0.60 mM of acetic acid (CH3COOH) is dissolved in water, it dissociates according to the following equation:

CH3COOH(aq) ↔ H+(aq) + CH3COO-(aq)

The percent dissociation of acetic acid (CH3COOH) in the aqueous solution is calculated using the following equation:

% dissociation = [H+]/[CH3COOH] × 100

where [H+] is the concentration of the hydrogen ion and [CH3COOH] is the concentration of the acetic acid.

1. To calculate the concentration of the hydrogen ion in the solution, we need to use the equilibrium constant expression for the dissociation of acetic acid, which is:

Ka = [H+][CH3COO-]/[CH3COOH]

where Ka is the acid dissociation constant for acetic acid.

2. To calculate the concentration of the hydrogen ion in the solution, we need to use the quadratic formula, since the dissociation of acetic acid is incomplete:

% dissociation = (1 - α) × 100

where α is the degree of dissociation of acetic acid.

Since α is small, we can assume that the change in the concentration of acetic acid is negligible.

Thus,[H+] = α[CH3COOH]

3. Substituting the values, we get:

Ka = [H+][CH3COO-]/[CH3COOH][H+] = Ka × [CH3COOH]/[CH3COO-]α = [H+]/[CH3COOH] = Ka × [CH3COOH]/([CH3COOH] + [CH3COO-])α

= (1.74 × 10-5) × (0.60 × 10-3)/(0.60 × 10-3 + 0.64 × 10-3)α

= 0.0162% dissociation

= (1 - α) × 100% dissociation

= (1 - 0.0162) × 100% dissociation

= 98.38%

The percent dissociation of acetic acid (CH3COOH) in the aqueous solution is 98.38%.

For more such questions on dissociation , Visit:

https://brainly.com/question/9396848

#SPJ11

How many liters of carbon dioxide can be produced if 37.8 grams of carbon disulfide react with excess oxygen gas at 28.85 degrees Celsius and 1.02 atmospheres?

CS2(l) + 3O2(g) yields CO2(g) + 2SO2(g)


2.78 liters
5.95 liters
12.1 liters
11.9 liters

Answers

The volume of carbon dioxide produced is approximately (d) 11.9 liters.

To determine the amount of carbon dioxide (C\(O_2\)) produced when 37.8 grams of carbon disulfide (C\(S_2\)) reacts with excess oxygen gas (\(O_2\)), we need to use stoichiometry and the given balanced chemical equation:

C\(S_2\)(l) + 3\(O_2\)(g) → C\(O_2\)(g) + 2S\(O_2\)(g)

First, we calculate the number of moles of C\(S_2\) using its molar mass:

Molar mass of (C\(S_2\)) = 12.01 g/mol (C) + 32.07 g/mol (S) × 2 = 76.14 g/mol

Number of moles of (C\(S_2\)) = mass / molar mass = 37.8 g / 76.14 g/mol ≈ 0.496 mol

From the balanced equation, we can see that the stoichiometric ratio between (C\(S_2\)) and C\(O_2\) is 1:1. Therefore, the number of moles of C\(O_2\) produced will also be 0.496 mol.

Now we can use the ideal gas law to calculate the volume of C\(O_2\) at the given temperature and pressure. The ideal gas law equation is:

PV = nRT

where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant (0.0821 L·atm/mol·K), and T is the temperature in Kelvin.

Converting the temperature from Celsius to Kelvin:

T(K) = 28.85°C + 273.15 = 302 K

Using the ideal gas law:

V = nRT / P = (0.496 mol) × (0.0821 L·atm/mol·K) × (302 K) / (1.02 atm) ≈ 11.9 L

The correct answer is 11.9 liters.

for more questions on carbon dioxide

https://brainly.com/question/26150306

#SPJ8

Please help me


Is this reaction endothermic or endothermic?

CIO + O - CI + O^2

Answers

This reaction, CIO + O - CI + O2, is an example of an endothermic chemical reaction, where the reactants take heat energy from their environment and use it to create products.

Explanation of endothermic?

Endothermic chemical reactions occur when the reactants take in heat energy from their environment to create products. A cooling effect is produced by these reactions because they cause their surroundings to become cooler.

How are endothermic and exothermic different?

Exothermic means that the chemical reaction releases energy. In exothermic reactions, bonds are broken in the reactants, but more energy is released when the bonds are broken in the products. Endothermic chemical processes are those that take up (or utilize) energy.

To know more about endothermic visit:

https://brainly.com/question/23184814

#SPJ13

When traveling through a different medium, light waves _________.
refract
reflect
speed up
stop moving

Answers

Answer: Refract

Explanation:

Choose all of the answers that are correct when describing this atom.
This is Chlorine
This is bromine
The mass of this is atom is 35 amu.
This atom has an overall charge of 0
The mass of this atom is 69 amu

Choose all of the answers that are correct when describing this atom.This is Chlorine This is bromineThe

Answers

To solve this question, it is important look at the pictue of the atom. The atom has the following properties:

17 protons17 electrons18 neutrons

Now, let's judge each affirmation

This is Chlorine --> Correct

To indentify what element is this atom, we should know what is its atomic number. The atomic number is equal to the number of protons in the atom. In our atom, we have 17 prontos, so, the atomic number is 17.

In the Periodic Table, the atomic number is above of letter that represents the elements. For example, the atomic number of the Helium (H) is 1.

Now, let's look to the Periodic Table and find the element of the atomic number is 17. The element that the atomic number is 17 is Chlorine. So, this affirmation is true.

This is Bromine --> Incorrect

We saw before that is a atom of Chlorine, because its atomic number is 17. The atomic number of Bromine (Br) is 35.

The mass of this atom is 35 amu --> Correct

The mass of any atom is equal the sum of the number of protons and the number of neutrons. This happens because the mass of the electrons is negligible. So, let's calculate the mass of our atom:

\(mass = protons + neutrons\\mass = 17 + 18\\mass = 35\)

Therefore, the mass of this atom is 35 amu, so the affirmation is correct.

This atom has an overall charge of 0 --> Correct

Any atom has a overall charge different of 0 if the number of protons and electrons are different.

In our case, the number of protons and alectrons are equals, so the overall charge is 0. So, the affirmation is correct.

The mass of this atom is 69 amu --> Incorrect

We saw before (third affirmation) that the mass of this atom is 35 amu. So, this is a incorrect affirmation.

I hope I've helped. ^^

Enjoy your studies! \o/

A student tries to determine the molar mass of Aspirin (HASP). He takes 1.000g of Aspirin,
dissolves it in water, and neutralizes it with 17.6 mL of 0.2000 M KOH. The neutralization reaction is
HAsp(aq) + OH-  Asp-(aq) + H2O(l). What is the molar mass of aspirin did the student get? After comparing
the true molar mass of aspirin (180.157g/mol) and his results, he realizes that his molar mass is not
correct. He decides to find out possible errors and realizes that his error is in the volume of KOH he
added. He realizes that he really doesn’t remember his initial volume (the burette was not full) but made a
guess anyways. Based his results, how off was his volume used in calculations?

Answers

The student's estimated volume was 0.01014 L less than the true volume.

How can we determine molar mass aspirin?

To determine the molar mass of aspirin (HAsp), the student needs to find the number of moles of aspirin that reacted with KOH. The balanced chemical equation for the reaction is: HAsp(aq) + OH-(aq) → Asp-(aq) + H2O(l)

From the equation, we can see that one mole of aspirin reacts with one mole of KOH. Therefore, the number of moles of aspirin can be calculated using the volume and concentration of KOH used in the reaction:

moles of KOH = volume of KOH x concentration of KOH

moles of aspirin = moles of KOH

We can calculate the number of moles of KOH used in the reaction as follows:

moles of KOH = volume of KOH x concentration of KOH

moles of KOH = 0.0176 L x 0.2000 mol/L

moles of KOH = 0.00352 mol

Since one mole of aspirin reacts with one mole of KOH, the number of moles of aspirin is also 0.00352 mol.

The mass of aspirin used in the reaction is given as 1.000 g. Therefore, the molar mass of aspirin can be calculated as follows:

molar mass of aspirin = mass of aspirin / moles of aspirin

molar mass of aspirin = 1.000 g / 0.00352 mol

molar mass of aspirin = 283.5 g/mol

This value is significantly different from the true molar mass of aspirin, which is 180.157 g/mol. The student realizes that his error is in the volume of KOH used in the calculation. To determine the possible error in the volume used, we can calculate the volume of KOH required to obtain the true molar mass of aspirin:

moles of aspirin = mass of aspirin / molar mass of aspirin

moles of aspirin = 1.000 g / 180.157 g/mol

moles of aspirin = 0.005549 mol

Since one mole of aspirin reacts with one mole of KOH, the number of moles of KOH required to neutralize the aspirin is also 0.005549 mol. The volume of KOH required can be calculated as follows:

volume of KOH = moles of KOH / concentration of KOH

volume of KOH = 0.005549 mol / 0.2000 mol/L

volume of KOH = 0.02774 L

Therefore, the volume of KOH used by the student was off by:

error in volume = |true volume - estimated volume|

error in volume = |0.02774 L - 0.0176 L|

error in volume = 0.01014 L

To know more about molar mass visit:-

brainly.com/question/12127540

#SPJ1

A liquid ester used to flavour food is believed to be impure. What would be the best way of testing its purity?​

Answers

Answer:

Filter it

Explanation:

Using the name of the ionic compound, select the appropriate chemical formula. Use the periodic table
that has been provided. Click here to access the common polyatomic ion sheet.
Sodium acetate
a. NaC2H302
b. SC2H302
c. Na2C2H302

Answers

Answer:

A

Explanation:

Abcd

The chemical formula for sodium acetate is NaCH₃COO.

What is the chemical formula?

A symbolic representation of the chemical composition of an element or a compound is its chemical formula. The chemical formula helps in providing information about the elements that make up the molecules of a compound. It also represents the ratio in which the atoms of these elements combine to form such molecules.

For example, H₂O, which is the chemical formula for water, shows that there are two hydrogen atoms combined with one oxygen atom to form one molecule of water.

For writing a chemical formula, it is important that there is knowledge of the symbols of the elements that are present in the compound. The formula of the radicals should be known along with the valency of the elements in that compound.

Therefore, the chemical formula for sodium acetate is NaCH₃COO.

Read more about chemical formulas, here

https://brainly.com/question/11995171

#SPJ2

2. 4.6gof X is burnt completelyto produce 6.2g of X oxide (X,O). M (0) = 16 gmol ¹. Calculate the amount of oxygen that reacted in this experiment. [2 MARKS]
[ii] calculate the mass of 1 mole of x.[2mark]
[iii] predict and give a reason explaining the reaction of x2o in water.[1mark]​

Answers

As per the given data, 1.6 grams of oxygen reacted in this experiment.

To calculate the amount of oxygen that reacted in the experiment, we need to determine the difference in the mass of X oxide (X,O) formed and the mass of X initially used.

Given:

Mass of X = 4.6 g

Mass of X oxide (X,O) = 6.2 g

To find the amount of oxygen that reacted:

Mass of oxygen = Mass of X oxide - Mass of X

= 6.2 g - 4.6 g

= 1.6 g

Therefore, 1.6 grams of oxygen reacted in this experiment.

Calculate the mass of 1 mole of X:

Given that the mass of X is 4.6 g, we can calculate the molar mass of X by dividing the mass by the number of moles:

Molar mass of X = Mass of X / Number of moles of X

Molar mass of X = 4.6 g / 0.1 mol

Molar mass of X = 46 g/mol

Therefore, the mass of 1 mole of X is 46 grams.

Thus, the answer is 46 grams.

For more details regarding moles, visit:

https://brainly.com/question/30885025

#SPJ1

Plz help me I Am timed plz

Which of the following is an example of a nonrenewable resource?

OA) water

OB) grass

C) soil

D) trees

Answers

Answer:

D) Trees

Explanation:

I'm sure its trees, because once you cut all trees you cant regenerate, or replenish them. hope im right, sorry of its wrong!!

Sherman suggests that reproduction always creates individuals with adaptive traits. Does this seem correct? Why or why not?

Answers

If Sherman suggests that reproduction always creates individuals with adaptive traits, then he/she is not correct because variation may lead to non-adaptive phenotypes.

What is the presence of genetic variation in individuals of a given population?

The presence of genetic variation in individuals of a given population is not adaptive per se, but instead, it provides the raw material for natural selection that leads to the differential survival and reproduction of the most adaptive phenotypes.

The genetic variation in individuals of a given population does not crate adaptive traits and it may derive from sexual reproduction.

Therefore, with this data, we can see that the presence of genetic variation in individuals of a given population may or not be adaptive in the function of the environment in which the individual produced by means of sexual reproduction is developed and therefore it is an advantage for the population but the individual may be harmful.

Learn more about adaptive genetic variation here:

https://brainly.com/question/29313212

#SPJ1

How many moles of water contain each of the following number of molecules?
4.38 × 10^21 molecules
Report your answer using appropriate number of significant figures.

Answers

In 4.38 × 10^21 molecules of water, there are approximately 0.073 moles.

To calculate the number of moles, we can use Avogadro's number, which states that 1 mole of a substance contains 6.022 × 10^23 molecules. So, by dividing the given number of molecules (4.38 × 10^21) by Avogadro's number, we can find the number of moles.

Now, let's explain the process in detail. Avogadro's number is a constant that represents the number of particles (atoms, molecules, etc.) in one mole of a substance. It is approximately 6.022 × 10^23. Therefore, if we divide the given number of molecules by Avogadro's number, we can determine the number of moles.

In this case, we divide 4.38 × 10^21 molecules by 6.022 × 10^23 molecules/mole, resulting in approximately 0.073 moles.

Significant figures play an important role in reporting the answer. The given number of molecules has three significant figures (4, 3, and 8), so our answer should be reported with three significant figures as well. Therefore, the number of moles is approximately 0.073.

for such more questions on molecules

https://brainly.com/question/475709

#SPJ8

29.Which of the following is not an example of an acid-base indicator?Select one:a. Phenolphthaleinb. Litmus paperc. Hydrion paperd. Filter paper

Answers

Answer:

\(D\text{ : Filter Paper}\)

Explanation:

Here, we want to select the option that is not an acid-base indicator from the options

Acid-base indicators are colored materials that are expected to change color based on the pH

A filter paper is a material used in filtration

As such, it cannot be used as an indicator

Other Questions
Water boils at 100C and turns into steam. Which similarities or differences are there between water at 100C and steam at 100C? The particles will have more space between them as a steam, but they will be moving at the same speed in both states.The particles will have more space between them as a liquid, but they will be moving at the same speed in both states.The particles will have more space between them as a liquid, but they will be moving faster as steam.The liquid particles will have more space between them and will be moving at higher speeds as steam A program takes 35 seconds for input size 20 (i.e., n=20). Ignoring the effect of constants, approximately how much time can the same program be expected to take if the input size is increased to 100 given the following run-time complexities? a. O(N) b. O(N + log N) c. O(N^3) d. O(2^N)1 A girl pushes her little brother on his sled with a force of 300 N for 750 m. I'm taking the ssat upper level on December 11th and really need help with the math section. Are there any tips or help that can be provided? Write an equation in point-slope form that describes the line with a slope of -3 that contains the point (1,2) When the body has built up resistance to a dosage of a drug, the body has developed-drug tolerance -withdrawal -anxiety-chemical imbalance Please hurryyyy Risk factors for placement in a nursing home include all of the followingexceptA. being over the age of 85.B. living alone.C. having recently been admitted you have negotiated with the omicronians for a base on the planet omicron persei 7. the architects working with you to plan the base need to know the acceleration of a freely falling object at the surface of the planet in order to adequately design the structures. Two numbers have a sum of 2 and a difference of -16. What are the numbers In the question Cundo practica la guitarra? what subject pronouns are implied? There is more than one correct answer choice. Be sure to select all that apply.Responses:ellaustednosotrosellost 7. water in an open bowl evaporates at a rate proportional to the area of the surface of the water. (this means that the rate of decrease of the volume is proportional to the area of the surface.) show that the depth of the water decreases at a constant rate, regardless of the shape of the bowl. Background, findings, staffing, and budget are examples of ______________ a. talking headings b. functional headings c. generic headings d. transitional headings the spacecraft that visited pluto and sent back our first images: show answer incorrect answer please select the best choice from the available options. was called new horizons got a gravity boost from jupiter to get it to pluto faster used plutonium to keep it warm is returning to earth in the 22nd century more than one of these during the absorptive state, which process should occur? a. glycogenolysis b. gluconeogenesis c. glycogenesis d. lipolysis mrs. tanner introduced a cooperative learning activity during the second week of school to give students an opportunity to interact. although she expected the students to enjoy the activity, she observed a great amount of frustration and dissent among the groups. what mistake did mrs. tanner most likely make in this scenario? Which graph shows the solution set for -3x < -12 or 5x < 10 _____ was a political movement and ideology that was developed as a reaction against liberal democracy and the spread of socialism and communism When talking about limits for functions of several variables, why isn't it sufficient to say, lim_(x,y) rightarrow (0,0) f(x,y)= L if gets close to L as we approach (0,0) along the x-axis (y = 0) and along the y-axis (x = 0)? When responding to your classmates, please consider path independence and how it affects limits for functions of several variables. In order to establish competitive advantage with resources and capabilities, an organization needs to ensure that its capabilities meet the following criteria:a. Versatile, Replicable, Inimitable, Organizedb. Causally ambiguous, Socially Complex, Path Dependentc. Scarce, Relevant, Durable, Replicable, Appropriabled. Part of the primary value chain or the functional value chain e. Valuable, Rare, Costly to Imitate, Non-Substitutable two investment centers at marshman corporation have the following current-year income and asset data: investment center income average assets a $ 415,200 $ 2,400,000 b 524,550 1,950,000 the return on investment (roi) for investment center b is: multiple choice 371.4% 26.9% 24.1% 21.7% 39.2%