Explain the reaction between iodine solution and polysaccharides by giving the structures of related Compounds.

Answer:

what does that supposed to mean?

Answer:

6

Explanation:

Glucose has a chemical formula of: C6H12O6 That means glucose is made of 6 carbon atoms, 12 hydrogen atoms and 6 oxygen atoms.

Answer:

convection

Explanation:

i believe

The popcorn in the pot pops up because of the conduction process when heated. The solid particles transfers heat energy by conduction mode.

There are three mode of heat transfer namely, conduction, convection and radiation. Conduction is taking place in solids whereas, convection is taking place in liquids and gases. Radiation is the way of heat transfer through vacuum.

In conduction, the heat energy transfers from one molecule to the other which are closely packed in the solids as in a chain. Thus, heat easily moves through the chain.

In gases and liquids, the hot molecules moves to the surface to make other molecules hot and this flow of molecules make the entire substance hot.

Popcorn is a solid substance thus, able to conduct heat energy. This heat energy leads them to thermal vibration and they pop up from the hot pot. Therefore, it is an example of conduction.

To find more on conduction, refer here:

https://brainly.com/question/15085692

#SPJ2

Answer:    World 5,306,425,000 6,895,889,000 7,503,828,180

1 China 1,139,060,000 1,341,335,000 1,384,688,986

2 India 873,785,000 1,224,614,000 1,296,834,042

3 United States 253,339,000 310,384,000 329,256,465

Explanation:

Answer: 4.88 g/mol. and helium

Explanation:

To find the molar mass of the gas, we can use the ideal gas law equation which is PV=nRT where:

P = pressure = 2.000 atm

V = volume = 50.00 L

n = number of moles

R = gas constant = 0.08206 L·atm/K·mol

T = temperature = 273.15 K

First, we need to find the number of moles of the gas:

PV = nRT

n = PV/RT

n = (2.000 atm)(50.00 L)/(0.08206 L·atm/K·mol)(273.15 K)

n = 1.844 mol

Now, we can find the molar mass of the gas by dividing its mass by the number of moles:

molar mass = mass/number of moles

mass = 9.00 g

molar mass = 9.00 g/1.844 mol

molar mass = 4.88 g/mol

Therefore, the molar mass of the gas is 4.88 g/mol.

To determine what gas this is, we can compare the molar mass of the gas to the molar masses of known gases. The molar mass of 4.88 g/mol is closest to that of helium (4.00 g/mol). Therefore, this gas is most likely helium.

The gravimetric factor for Br- using silver bromide is 0.425.

The gravimetric factor is an expression that is used to convert grams of a compound into grams of a single element.

It is expressed as a ratio of the formula weight (FW) of the substance that is being determined to that of a second substance that is weighed.

For example formula of silver bromide is AgBr and the formula mass of silver bromide is 188 g/mol

Formula mass of bromide ion = 80 g/mol

Gravimetric factor = 80/1188

Gravimetric factor = 0.425

Learn more about gravimetric factor at: https://brainly.com/question/2094735

#SPJ1

Significant digits give information about:

a. The results of an experiment.

b. The accuracy of data from an experiment.

An experiment can be defined as a scientific investigation which typically involves the process of manipulating an independent variable (the cause), so as to determine or measure the dependent variable (the effect).

In Science, a significant figure can be defined as the number of digits in a numerical data (value), typically a measurement from an experiment, which enhances its degree of accuracy.

In this context, we can infer and logically deduce that significant digits give information about:

Read more on significant figures here: https://brainly.com/question/13467103

#SPJ1

Answer:

NaCl: 184g

MgCl₂: 6.60g

Na₂SO₄: 9.26g

CaCl₂: 1.28g

KCl: 0.70g

NaHCO₃: 0.13g

Explanation:

To convert these concentrations to masses we need to convert molarity to moles and moles to grams using molar mass of each salt:

[CaCl₂] = [Ca²⁺] = 0.0115M

[HCO₃⁻] = [NaHCO₃] = 0.0015M

[SO₄²⁻] = [Na₂SO₄] = 0.0652M

[Mg²⁺] = [MgCl₂] = 0.0693M

[K⁺] = [KCl] = 0.0094M

And using the concentration of Cl⁻:

[Cl⁻] = [NaCl] + 2[MgCl₂] + 2[CaCl₂] + [KCl]

[3.32] = [NaCl] + 2[0.0693] + 2[0.0115] + [0.0094]

[NaCl] = 3.149M

The masses you need are:

NaCl (Molar mass: 58.44g/mol):

3.149mol/L * 1L *  (58.44g/mol) =

MgCl₂ (Molar mass: 95.211g/mol):

0.0693mol/L * 1L *  (95.211g/mol) =

Na₂SO₄ (Molar mass: 142.04g/mol):

0.0652mol/L * 1L *  (142.04g/mol) =

CaCl₂ (Molar mass: 110.98g/mol):

0.0115mol/L * 1L *  (110.98g/mol) =

KCl (Molar mass: 74.55g/mol):

0.0094mol/L * 1L *  (74.55g/mol) =

NaHCO₃ (Molar mass: 84g/mol):

0.0015mol/L * 1L *  (84g/mol) =

Answer:

Explanation:

Let the protein contained in pizza be m gram .

calories contained by 17 g of fat = 17 x 9  kcals = 153  kcals .

calories contained by 25 g of carbohydrate = 25 x 4  kcals = 100 kcals .

calories contained by m  g of protein  = m  x 4  kcals = 4 m  kcals .

Total calories of slice of pizza = 153 + 100 + 4m kcals

= 253 + 4m kcals

Given ,

253 + 4m = 750

4m = 497

m = 124.25 g .

120 g ( rounded to two significant  figures )

Answer:

D

Explanation:

Because if I said its 35 degrees outside that has nothing to do with climate maybe if I said its usually 35 degrees in the month of December but just saying what temperature it doesn't tell you anything about climate

Well, the definition of climate is the weather conditions prevailing in an area in general or over a long period so I don't really know

So maybe it is d

Answer:

B

Explanation:

Weather refers to the short-term conditions of the lower atmosphere, such as precipitation, temperature, humidity, wind direction, wind speed, and atmospheric pressure. It could be sunny, cloudy, rainy, foggy, cold, hot, windy, stormy, snowing … the list goes on.

Answer:Matter is defined as anything that has mass and takes up space (it has volume). ... Volume is the amount of space something occupies. Words such as big, little, long, or short are used to describe volumes.

Explanation:

Answer:

protons-50

Neutrons-75

protons are 50, neutrons are 75

Answer:

(B.) and (C.)

b. So that clean NMR spectra can be obtained that do not contain solvent peaks.

c. So that the yield can be determined.

Explanation:

The solvent used in Nuclear Magnetic Resonance (NMR) spectrometer is Trimethyl silane (TMS), a neutral solvent which doesn't give off any signals. Other solvents could have interactions with the radiation, and disrupt the spectra.

Furthermore, for accurate determination of the actual yield and overall percentage yield, solid must be separated from the solvent, dried and weighed.

I hope this was explanatory enough.

Explanation:

45.8 grams of Fe2O3*(1 mole/159.69 g)= moles of Fe2O3

moles of Fe2O3 *(3 moles of O2/2 moles of Fe2O3)=moles of O2

moles of O2*(32.0g of O2/1mole)= mass of O2

Answer:

??????

Explanation:

The amount of \(HClO_3\) that will be produced from 10 liters of \(ClO_2\) would be 8.33 liters.

  \(HClO_3\) is produced from the reaction of  \(ClO_2\) and \(H_2O\) according to the following equation:

\(6 ClO_2 + 3 H_2O --- > 5 HClO_3 + HCl\)

From the balanced equation of the reaction, 6 moles of \(ClO_2\) reacts to produce 5 moles of \(HClO_3\). Thus the mole ratio is 6:5.

Now, assuming the mole ratio also transcribes to the volume ratio and 10 liters of \(ClO_2\) is available for reaction. The amount of \(HClO_3\) that will be produced can be calculated from the volume ratio as follows:

6 moles  \(ClO_2\) = 5 moles  \(HClO_3\)

10 liters  \(ClO_2\) = 5 x 10/6

                       = 8.33 liters

In other words, with 10 liters of \(ClO_2\), the volume of \(HClO_3\) that will be produced would be 8.33 liters.

More on stoichiometric problems can be found here: https://brainly.com/question/15047541

#SPJ1

The electronic configuration [Ar]4s13d5 corresponds to the element Manganese (Mn) in its ground state.

To determine the number of unpaired electrons, we need to first fill the 4s and 3d orbitals according to the Aufbau principle and Hund's rule. The 4s orbital can hold up to 2 electrons, and the 3d orbital can hold up to 10 electrons. In the case of Mn, the [Ar] noble gas configuration represents the completely filled inner shells, so we start by adding 4s1 electron and then 5 more electrons to the 3d orbital. We have:

1s2 2s2 2p6 3s2 3p6 4s1 3d5

We can see that there are five unpaired electrons in the 3d orbital (in the d-subshell, there are five unpaired electrons in the five available d-orbitals), which makes manganese a transition metal. Therefore, the number of unpaired electrons in the ground state of manganese is 5.

So, the answer is: Mn, 5.

To learn more about electronic configuration here:

https://brainly.com/question/29757010

#SPJ4

Answer:

will be 9.7 Liters

Explanation:

306.178 liters is the volume of O2 at STP, required for the complete combustion of 125g octane (\(C_{8}H_{18}\)) to \(CO_{2}\) and H20

To calculate the volume of \(O_{2}\) required for the complete combustion of octane (\(C_{8}H_{18}\)) to \(CO_{2}\) and \(H_{2}O\) at STP (Standard Temperature and Pressure), we need to consider the stoichiometry of the balanced chemical equation.

The balanced equation for the combustion of octane is:

\(C_{8}H_{18}\) + 12.5\(O_{2}\) -> 8\(CO_{2}\) + 9\(H_{2}O\)

From the equation, we can see that 1 mole of octane requires 12.5 moles of \(O_{2}\) to completely combust. The molar mass of octane (\(C_{3}H_{18}\)) is approximately 114.22 g/mol.

To calculate the moles of octane, we divide the given mass by the molar mass:

Moles of octane = 125 g / 114.22 g/mol ≈ 1.093 mol

Since the molar ratio between octane and \(O_{2}\) is 1:12.5, the moles of \(O_{2}\)required can be calculated as:

Moles of \(O_{2}\) = 1.093 mol * 12.5 ≈ 13.663 mol

Now, we can use the ideal gas law, PV = nRT, to calculate the volume of \(O_{2}\) at STP. At STP, the temperature is 273 K, and the pressure is 1 atm.

Using the molar volume of an ideal gas at STP (22.4 L/mol), the volume of \(O_{2}\) required is:

Volume of \(O_{2}\) = Moles of \(O_{2}\) * Molar volume = 13.663 mol * 22.4 L/mol ≈ 306.178 L

Therefore, approximately 306.178 liters of \(O_{2}\) at STP would be required for the complete combustion of 125 grams of octane (\(C_{8}H_{18}\)) to \(CO_{2}\) and \(H_{2}O\)

Know more about combustion here:

https://brainly.com/question/10458605

#SPJ8

Considering the definition of neutral atom, mass number and net charge, the element is a neutral atom, with a net charge equal to zero and a mass number of 4.

All atoms are made up of subatomic particles: protons and neutrons, which are part of their nucleus, and electrons, which revolve around them. Protons are positively charged, neutrons are neutrally charged, and electrons are negatively charged.

A neutral atom is one that has no electrical charge because it has the same number of protons and electrons.

In contrast, ions are atoms or groups of atoms that have an electrical charge and are formed by the gain or loss of electrons from the atom.

The mass number tells us the total number of particles in the nucleus. That is, the mass number is the sum of the number of protons and the number of neutrons in the atomic nucleus:

Mass number = (number of protons) + (number of neutrons)

It is represented by the letter A.

The net charge corresponds to the algebraic sum of all the charges that a atom possesses.

In this case, an element has:

Then, the net charge is calculated as:

net charge= 2× 0 [charge of neutron] + 2× (+1) [charge of proton] + 2× (-1) [charge of electron]

net charge= 0

This element has no electrical charge, or net charge is zero. Then, the element is a neutral atom.

On the other hand, the mass number is the sum of the number of protons and the number of neutrons. So, in this case:

mass number= 2 protons + 2 neutrons

mass number= 4

Finally, the element is a neutral atom, with a net charge equal to zero and a mass number of 4.

Learn more about

neutral atom:

brainly.com/question/24652228

brainly.com/question/18242008

brainly.com/question/18330612

mass number:

brainly.com/question/1758023

brainly.com/question/5527493

net charge:

brainly.com/question/24752359

#SPJ1

Answer: The answers are kinda blury but use this info to help u out or read over the passage

Explanation:A battery is a device that stores chemical energy and converts it to electrical energy. The chemical reactions in a battery involve the flow of electrons from one material (electrode) to another, through an external circuit. The flow of electrons provides an electric current that can be used to do work.

Answer: metal bending

Explanation: is the metal

By 2100, CO2 levels rise to about 420 ppm, almost 20 ppm over current levels, which, when additional forcings are taken into account, equals 475 ppm (in CO2e). Global temperatures are predicted to increase by 1.3–1.9C over pre-industrial levels by 2100.

According to climate models that simulate a high emissions scenario (RCP8.5), the world's average temperature will rise by at least 4 °C by 2100. Model simulations based on scenarios that would reduce emissions significantly and continuously through the end of the century (RCP2). According to climate models that simulate a high emissions scenario (RCP8.5), the world's average temperature will rise by at least 4 °C by 2100. Model simulations based on scenarios that would reduce emissions significantly and continuously through the end of the century (RCP2).

For more details regarding models   visit:

https://brainly.com/question/20031421

#SPJ4

Chemistry => Solutions => Solubility

It presents us with a solubility graph. This type of graph allows us to know how many grams of solute can be dissolved in 100 g of water depending on the temperature of the solution.

The lines on the graph represent the saturation points, that is when the solution is saturated. Below the line the solution is unsaturated and above the line, the solution is supersaturated and a precipitate will appear in the solution.

Now, to find the substance that reaches saturation with the given conditions, we are going to mark the points mentioned on the graph, we will have:

Marking 20°C on the temperature axis and 145 grams of solute on the y axis, we have that it intersects with the line of substances KI.

It means that KI reaches saturation at 145 grams of solute per 100 grams of water at 20°C.

Answer: KI

Answer:

negative

Explanation:

18 negative

19 neutral

10 positive

there are are more negative

One mole of radiant energy will supply 6.02 x 10^23 photons.

The number of photons is calculated by dividing the overall energy of a pulse by the energy of one photon included inside the pulse.

As a result, an electromagnetic energy particle is known as a photon. Photons have no mass, thus they move at the same rate as light.

we need to first calculate the total energy in one mole of photons,

By combining the energy per photon with Avogadro's number (6.022 x 1023), one may determine the energy of a mole of photons:

Energy per mole of photons = Energy per photon x Avogadro's number

we can calculate the energy per mole of photons:

Energy per mole of photons = 3.37 × 10−19 J x 6.022 x 10^23

Energy per mole of photons = 2.03 x 10^5 J/mol

Number of photons in one mole = Energy per mole of photons / Energy per photon

Number of photons in one mole = 2.03 x 10^5 J/mol / 3.37 × 10−19 J

Number of photons in one mole = 6.02 x 10^23 photons/mol

To know more about the photon visit:

https://brainly.com/question/12015967

#SPJ1

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

produces bubbles and hydrogen gas

The  proof of a chemical reaction of Zinc + Hydrogen Chloride is that after reaction it produces the hydrogen gas as white fumes.

When two reactants react in a reaction to form any product which can also be two or three and have some bi-product in the form of fumes or precipitate or any change in color so that we can conclude the results about the reaction.

In chemical reaction of Zinc + Hydrogen Chloride the producta are the zinc chloride and produces the white fumes of hydrogen gas which is a bi-product.

Therefore, it produces the hydrogen gas as white fumes is  proof of a chemical reaction of Zinc + Hydrogen Chloride is that after reaction.

Learn more about chemical reaction, here:

https://brainly.com/question/3174781

#SPJ2

The action that would most likely reduce water pollution is A) initiating efforts to remove trash from the ocean.

Trash and plastic waste in the ocean pose a significant threat to marine life and ecosystems. Initiating efforts to remove trash from the ocean can help mitigate this problem and reduce water pollution. When plastic waste accumulates in oceans, it can break down into microplastics, which are ingested by marine organisms and can enter the food chain, causing harm to both marine life and humans.

By actively removing trash from the ocean, we can prevent it from further degrading and releasing pollutants. This can help protect marine habitats, reduce the risk of entanglement or ingestion by marine animals, and preserve the overall health of ocean ecosystems.

On the other hand, options B, C, and D would likely contribute to increased water pollution:

B) Eliminating laws and regulations on industrial waste would remove important safeguards and oversight, potentially allowing industries to discharge pollutants directly into water bodies, leading to increased water pollution.

C) Promoting the use of oil and gas can lead to oil spills, leakage, and contamination of water sources. This can have severe consequences for aquatic ecosystems and human health.

D) Removing the ban on chlorofluorocarbons (CFCs) would result in the release of these harmful substances, which deplete the ozone layer and can contaminate water sources when disposed of improperly.

In conclusion, initiating efforts to remove trash from the ocean is the most effective action to reduce water pollution, while the other options would likely exacerbate the problem. Therefore, Option A is correct.

Know more about water pollution here:

https://brainly.com/question/20380251

#SPJ11

Answer:

[NH3] = 0.270M

[NH4Cl] = 0.327M

Explanation:

The HNO3 will react with the weak base, NH3, as follows:

HNO₃ + NH₃ → NH₄⁺ + NO₃⁻

Initial moles of each specie of the buffer:

NH3 = NH4⁺ 0.210L * (0.300mol/L) = 0.063moles

The moles added of HNO3 = Additional moles of NH4Cl and the moles substracted of NH3:

0.001L * (6mol / L) = 0.006 moles.

After the addition:

Moles NH3 = 0.063mol - 0.006mol = 0.057moles

Moles NH4Cl = 0.063mol + 0.006mol = 0.0069moles

And their concentrations are:

[NH3] = 0.057moles / 0.211L = 0.270M

[NH4Cl] = 0.069moles / 0.211L = 0.327M

The question is missing information. Here is the complete question.

A gas at a pressure of 2.0 atm is in a closed container. Indicate the changes (if any) in its volume when the pressure undergoes the following changes at constant temperature and constant amount of gas. Match the words in the left with the column to the appropriate blanks in the sentences on the right. Make certain each sentence is complete before submitting your answer.

1. The pressure increases to 6.0 atm. The volume ________

2. The pressure drops to 0.40 atm. The volume _________

3. The pressure remains at 2.0 atm. The volume _________

Answer: 1. Decreases

2. Increases

3. Does not change

Explanation: According to the Ideal Gas Law, Pressure, Volume and Temperature of an ideal gas is related, as the following: PV = nRT.

In this case, since temperature (T) and amount of gas (n) are constant, the Boyle's Law can be used.

The law states that the volume of a given gas, under the conditios of temperature and amount of it are constant, is inversely proportional to the applied pressure: P₁.V₁ = P₂.V₂

Initial P (P₁) = 2

Initial V (V₁) = V

Final P (P₂) = 6

P₁.V₁ = P₂.V₂

2.V = 6.V₂

V₂ = 1/3V

When the pressure increases to 6 atm, volume decreases by 1/3.

P₁ = 2

V₁ = V

P₂ = 0.4

2.V = 0.4V₂

V₂ = 5V

When pressure drops to 0.4 atm, volume increases by 5.

Since there are no change in the pressure, the volume is the same from the beginning, so does not change.