a particular graduated cylinder contains 24.0 mL Br2(liquid). The density of bromine at 25 degrees C is 3.12g/cm^3. Note that in nature, elemental bromine exists in diatomic form(that is, as Br2)
How many representative particles(molecules of Br2) are in the cylinder?

Answers

Answer 1

Answer:

\(2.82x10^{23}molecules\)

Explanation:

Hello.

In this case, given the volume (1cm³=1mL) and density of the bromine we are to firstly compute the mass since it will allow us to compute the representative particles:

\(\rho =\frac{m}{V}\)

\(m=\rho *V=3.12g/cm^3*24.0cm^3\\\\m=74.88gBr_2\)

Next, since the mass of one mole of diatomic bromine is 159.82 g (one bromine weights 78.91), we can next compute the moles in that sample:

\(n=74.88g*\frac{1mol}{159.82g} =0.469molBr_2\)

Finally, via the Avogadro's number we can compute the representative particles of bromine as follows:

\(particles=0.469mol*\frac{6.022x10^{23}molecules}{1mol}\\ \\2.82x10^{23}molecules\)

Best regards.


Related Questions

what is role ping
and what is Human sitting motion​

Answers

Answer:

role ping =Roles also allow you to selectively send alerts to players by role. Sending these alerts, which populate a little red “1” is colloquially known as a 'ping' because it's a privileged alert built to draw special attention to a Discord users. ... Finally, Roles allow users to categorically identify one another.

human sitting moon= Sitting Moon” refers to the crucial first month after giving birth when a mother should be nurtured and replenished with nutritious foods and herbs in order to regain their vitality and prevent post-labor illness. ..

Which change of state involves a release of energy?
boiling
condensation
melting
sublimation

Answers

Answer:Condensation

Explanation:I just took it:/

The phase changes occur when the substances undergoes transition between different states of matter. All phase changes involve either gain or release of energy. Here condensation involves a release of energy. The correct option is B.

What is condensation?

The process through which the physical state of matter changes from the gaseous phase into the liquid phase is defined as the condensation. The condensation occurs when water vapor in the air changes into liquid water when it comes in contact with a cooler surface.

During condensation molecules in the gaseous state release energy to change state to a liquid. The opposite of the condensation is the evaporation. At high pressure and low temperature any gas can condense.

Condensation is also important to the water cycle as it is responsible for the formation of clouds and maintains water balance.

Thus the correct option is B.

To know more about Condensation, visit;

https://brainly.com/question/20309509

#SPJ7

GIVING BRAINLIEST!!!!!!!!!!!!!


What is an atom's mass number?

○ Number of neutrons
○ Number of electrons
○ Number of protons
○ Number of protons plus number of neutrons​

Answers

option 4: number of protons plus number of neutrons
Number 4: number of protons plus the number of neutrons

PLEASE HELP QUICK 25 POINTS

The function of DNA is to:

1.Store hereditary information that is used to make proteins

2. Hang out in the nucleus and run the chloroplasts

3.take care of how are you mitochondria do their jobs

4.all of these

Answers

The answer would be 1

PLEASE HELP, WILL MARK BRAINLIEST. The two boron atoms listed in the table are isotopes of boron. The two carbon atoms and the two oxygen atoms are also called isotopes. Based on the patterns in the particle compositions of these atoms, write a definition for “isotope.”

PLEASE HELP, WILL MARK BRAINLIEST. The two boron atoms listed in the table are isotopes of boron. The

Answers

Don’t really know ‘bout this one, but here’s something I found.

Answer:

Isotopes are various forms of an element that have the same number of protons but a different number of neutrons. Some elements, such as carbon, potassium, and uranium, have multiple naturally-occurring isotopes. Isotopes are defined first by their element and then by the sum of the protons and neutrons present.

Carbon-12 (or 12C) contains six protons, six neutrons, and six electrons; therefore, it has a mass number of 12 amu (six protons and six neutrons).

Carbon-14 (or 14C) contains six protons, eight neutrons, and six electrons; its atomic mass is 14 amu (six protons and eight neutrons).

While the mass of individual isotopes is different, their physical and chemical properties remain mostly unchanged.

Necesito resolver esto

Necesito resolver esto

Answers

The velocity of the water with an earlier velocity of 8 m/s will be 24 m/s in the small tube with an area of 4 cm², option C.

How to calculate velocity?

This is a problem involving the conservation of mass and the principle of continuity in fluid mechanics. According to the principle of continuity, the mass of a fluid flowing through any given section of a pipe must remain constant.

Using the given equation A₁v₁ = A₂v₂

A₁v₁ = A₂v₂

(12 cm²) (8 m/s) = (4 cm²) (v₂)

v₂ = (12 cm²) (8 m/s) / (4 cm²)

v₂ = 24 m/s.

Learn more on velocity here: https://brainly.com/question/25905661

#SPJ1

To measure the reaction heat more accurately at isobaric condition, what modification (s) would you suggest making on the coffee cup calorimeter ?

Answers

To measure the reaction heat more accurately at isobaric condition, we can add a lid to the calorimeter to prevent heat loss due to evaporation.

Thus, to measure the reaction heat more accurately at isobaric condition, some certain modifications can be made to the coffee cup calorimeter which includes adding a lid to the calorimeter to prevent heat loss due to evaporation to keep the pressure inside the calorimeter constant.

Using a magnetic stir bar to ensure even mixing of the reactants to ensure the accurate temperature readings, use of thermometer with a smaller stem to reduce the amount of heat transferred from the solution to the thermometer, etc. are some other modifications that can be made on the coffee cup calorimeter to measure the reaction heat more accurately at isobaric condition.

Learn more about the isobaric condition here:

https://brainly.com/question/13089696

#SPJ1

Write the balanced molecular chemical equation for the reaction
in aqueous solution for cesium carbonate and magnesium
nitrate. If no reaction occurs, write NR.

Answers

Answer:

Cs2CO3 + Mg(NO3)2 -> 2CsNO3 + MgCO3

Explanation:

This is a typical double displacement equation, and balancing this equation by adding the 2 in front of the cesium would solve this problem.

The answer in words would be :

Cesium Carbonate + Magnesium Nitrate = Cesium Nitrate + Magnesite.

The balanced molecular chemical equation for the reaction will be expressed as Cs₂CO₃ + Mg(NO₃)₂ -> 2CsNO₃ + MgCO₃

For any chemical equation to be balanced, the number of moles of elements in the reactants must be equal to that of the product.

According to the question, we are to write a balanced equation for the reaction  in aqueous solution for cesium carbonate and magnesium  nitrateThe chemical formula for Cesium carbonate is Cs₂CO₃The chemical formula for magnesium  nitrate is Mg(NO₃)₂

Hence the balanced molecular chemical equation for the reaction will be expressed as Cs₂CO₃ + Mg(NO₃)₂ -> 2CsNO₃ + MgCO₃

Learn more here: https://brainly.com/question/11904811

Question 2 of 10
You read a primary source and a secondary source that discuss the same
experiment. There is a difference in the conclusions made by these two
sources. Which should you trust more, and why?
OA. The primary source, because it was written by the researcher
OB. The primary source, because it contains more charts
OC. The secondary source, because it was printed on paper
OD. The secondary source, because it is easier to understand
SUBMIT

Answers

It is the primary source which helps the students to relate in a personal way to events of the past and promote a deeper understanding of history as a series of human events. The primary source is better, because it contains more charts. The correct option is B.

The sources which are closest to the origin of the information and contain raw information which must be interpreted by the researches are called the primary sources. The secondary sources are closely related to the primary sources and often interpret them.

A direct access to the subject of our research is given by the primary source whereas the secondary source provides only second hand information and comments of other researches.

Thus the correct option is B.

To know more about primary source, visit;

https://brainly.com/question/24172115

#SPJ1

For the reaction

2NH3(g)↽−−⇀ 3H2(g)+N2(g)

the equilibrium concentrations were found to be [NH3]=0.250 M, [H2]=0.470 M, and [N2]=0.800 M. What is the equilibrium constant for this reaction?

eq=

Answers

Rounding to the appropriate number of significant figures, the equilibrium constant (Kc) for the reaction is approximately 1.66.

To calculate the equilibrium constant (Kc) for the given reaction, we can use the formula:

Kc = ([H2]^3 * [N2]) / [NH3]^2

Plugging in the given equilibrium concentrations, we have:

Kc = (0.470^3 * 0.800) / (0.250^2)

Calculating the numerator:

(0.470^3 * 0.800) = 0.1037032

Calculating the denominator:

(0.250^2) = 0.0625

Now, dividing the numerator by the denominator:

Kc = 0.1037032 / 0.0625 = 1.6592512

The equilibrium constant represents the ratio of the concentrations of products to reactants at equilibrium. In this case, the equilibrium constant is greater than 1, indicating that the products (H2 and N2) are favored at equilibrium. This means that the forward reaction is favored, leading to the formation of more products compared to reactants.The equilibrium constant value of 1.66 suggests that the forward reaction is moderately favored at equilibrium, but without additional context, it is difficult to determine the extent of the reaction or the relative concentrations of reactants and products at the beginning of the reaction.

for such more questions on reaction

https://brainly.com/question/24795637

#SPJ8

Rank the following atoms in order of decreasing electronegativity.
a. Na, Li, K
b. K, Sc, Ca
c. As, Sn, S

Answers

In the first option , the order of decrease in electronegativity is Li, Na and K.  In second option, the order is  Ca, K, Sc The order in the third group is S, As, Sn.

What is electronegativity ?

Electronegativity of an atom is the ability of its nucleus to attracts the share pair of electrons towards it. Elements like, fluorine, oxygen, nitrogen etc .are  highly electronegative.

In periodic table, along a period electronegativity increases. Whereas down  group, electronegativity decreases. The first groups elements are Li, Na , K and Cs and Fr. Hence, electronegativity decreases from Li to K.

Among, K, Sc and Ca, Ca is comparatively electronegative than K. Sc is a transition metal and not electronegative. In the last group the S is mot electronegative than As more than Sn.

Find more on electronegativity:

https://brainly.com/question/29203628

#SPJ1

What changes sodium pellets to liquid​

Answers

Answer:

when placed in water, a sodium pellet catches on fire as hydrogen gas is liberated and sodium hydroxide forms. chemical change = fire is a sign of chemical reaction.

Explanation:

When placed in water the sodium pellets catch the fire and liberate the hydrogen gas. On mixing with water solid sodium forms a colorless basic solution.

What are the properties of sodium?

Sodium is a soft metal. It is a very reactive element with a low melting point. Sodium reacts very quickly with water, snow, and ice to produce sodium hydroxide and hydrogen. It is an alkali metal and the sixth most abundant metal on earth. It has a silvery white color.

It has a strong metallic luster. On reacting with oxygen it produces sodium oxide which on reacting with the water produces sodium hydroxide.

It is used to improve the structure of certain alloys and soaps. It is also used in the purification of metals. Sodium is also present in sodium chloride, an important compound found in the environment.

To learn more about sodium, refer to the link:

https://brainly.com/question/29327783

#SPJ2

Potassium superoxide, KO2, reacts with carbon dioxide to form potassium carbonate and oxygen:

This reaction makes potassium superoxide useful in a self-contained breathing apparatus. How much O2 could be produced from 2.61 g of KO2 and 4.46 g of CO2?

Answers

First, we need to write out the balanced chemical equation for the reaction: 4 KO2 + 2 CO2 → 2 K2CO3 + 3 O2

From the equation, we can see that 4 moles of KO2 react with 2 moles of CO2 to produce 3 moles of O2. Therefore, we need to convert the given masses of KO2 and CO2 into moles:

moles of KO2 = 2.61 g / molar mass of KO2 = 2.61 g / 71.10 g/mol = 0.0367 mol
moles of CO2 = 4.46 g / molar mass of CO2 = 4.46 g / 44.01 g/mol = 0.1013 mol

Next, we need to determine the limiting reagent (the reactant that will be completely consumed in the reaction) by comparing the mole ratios of KO2 and CO2 in the balanced equation. The ratio of moles of KO2 to moles of CO2 is:
0.0367 mol KO2 / 4 mol KO2 per 2 mol CO2 = 0.0184 mol CO2

Since this ratio is less than the actual number of moles of CO2 we have (0.1013 mol), CO2 is in excess and KO2 is the limiting reagent.

Using the mole ratio from the balanced equation, we can calculate the number of moles of O2 produced:

moles of O2 = 3 mol O2 per 4 mol KO2 × 0.0367 mol KO2 = 0.0275 mol O2

Finally, we can convert the moles of O2 to grams:

mass of O2 = moles of O2 × molar mass of O2 = 0.0275 mol × 32.00 g/mol = 0.88 g
Therefore, 2.61 g of KO2 and 4.46 g of CO2 would produce 0.88 g of O2.

For more questions on: chemical

https://brainly.com/question/29886197

#SPJ11

How many moles are in 32.8 L of CO gas at STP?

Answers

At STP, 1 mole of any gas occupies 22.4 L of space. Since we are given STP conditions here, we can use this ratio to determine the number of moles of CO gas: (32.8 L CO)/(22.4 mol CO/L CO) = 1.51 mol CO.

So, there are 1.51 moles of CO gas.

Solid Snake is being chased up the communications tower. Solid Snake is 75 kg and is carrying 18 kg of equipment. If Solid Snake climbs 27 flights of stairs, each 5.5 m in height, how much work was done against gravity?

a.
4.04 kJ

b.
109.15 kJ

c.
135.34 kJ

d.
5.01 kJ

Answers

Solid Snake (75 kg) carries 18 kg of equipment. If Solid Snake climbs 27 flights of stairs, each 5.5 m in height, the work done against gravity is 135.34 kJ (c).

What is work?

In physics, work is the energy transferred to or from an object via the application of force along a displacement.

In this problem, the force that does the work is the one that opposes the weight.

Step 1: Calculate the total weight of the system.

Solid Snake is 75 kg and is carrying 18 kg of equipment. The total mass is:

m = 75 kg + 18 kg = 93 kg

We can calculate the weight using Newton's second law of motion.

F = m . g = 93 kg . 9.8 m/s² = 911.4 N

Step 2: Calculate the total displacement.

Solid Snake climbs 27 flights of stairs, each 5.5 m in height.

27 . 5.5 m = 148.5 m

Step 3: Calculate the work done.

We will use the definition of work.

w = F . s = (911.4 N) . (148.5 m) . (1 kJ/1000 J) = 135.34 kJ

Solid Snake (75 kg) carries 18 kg of equipment. If Solid Snake climbs 27 flights of stairs, each 5.5 m in height, the work done against gravity is 135.34 kJ (c).

Learn more about work here: https://brainly.com/question/62183

water can be made using the reversible reaction shown, which change would kee
p this reaction from shifting to form more of the product?

Answers

We can produce more products by;

A. Increasing the concentration of H₂ gas in the reaction vessel

B. Decreasing the temperature in the reaction vessel

C. Removing the H₂O from the reaction vessel as it forms

Is formation of water an exothermic reaction?

Water is created through an exothermic process. Heat energy is released when hydrogen gas (H2) and oxygen gas (O2) mix to make water (H2O). An exothermic reaction is characterized by this energy release.

The reaction's overall energy change is negative, which shows that energy is released. The reaction is exothermic because the extra energy is released as heat into the environment.

Learn more about exothermic reaction:https://brainly.com/question/28546817

#SPJ1

Missing parts;

Water can be made using the reversible reaction shown. Which change would

keep this reaction from shifting to form more of the product?

2H₂+022H₂O + energy

A. Increasing the concentration of H₂ gas in the reaction vessel

B. Decreasing the temperature in the reaction vessel

C. Removing the H₂O from the reaction vessel as it forms

D. Increasing the temperature in the reaction vessel

Which of the following are the weakest among the intermolecular forces? (5 points)

Ion-dipole forces
Hydrogen bonding
Dipole-dipole forces
London dispersion forces

Answers

London dispersion forces are known to be the weakest among the intermolecular forces. Therefore, option (D) is correct.

What are London dispersion forces?

London dispersion forces can be described as a type of intermolecular force acting between atoms and molecules that are generally electrically symmetric. The electrons are generally symmetrically distributed with respect to the nucleus and are part of the van der Waals forces.

The electron distribution around an atom undergoes varies in time which creates electric fields felt by other nearby atoms and molecules.

The net effect is in electron positions in an atom produce a corresponding redistribution of electrons in other atoms. These are the weakest among the other intermolecular forces.

Learn more about London dispersion forces, here:

https://brainly.com/question/20514601

#SPJ1

Calculate the number of miles of magnesium,chlorine, and oxygen atoms in 5.00 moles of magnesium perchlorate

Answers

Answer:

5.00 mol Mg

10.0 mol Cl

40.0 mol O

Explanation:

Step 1: Given data

Moles of Mg(ClO₄)₂: 5.00 mol

Step 2: Calculate the number of moles of Mg

The molar ratio of Mg(ClO₄)₂ to Mg is 1:1.

5.00 mol Mg(ClO₄)₂ × 1 mol Mg/1 mol Mg(ClO₄)₂ = 5.00 mol Mg

Step 3: Calculate the number of moles of Cl

The molar ratio of Mg(ClO₄)₂ to Cl is 1:2.

5.00 mol Mg(ClO₄)₂ × 2 mol Cl/1 mol Mg(ClO₄)₂ = 10.0 mol Cl

Step 4: Calculate the number of moles of O

The molar ratio of Mg(ClO₄)₂ to Cl is 1:8.

5.00 mol Mg(ClO₄)₂ × 8 mol O/1 mol Mg(ClO₄)₂ = 40.0 mol O

Which of the following has a fixed volume and shape?
milk feather carbon dioxide oxygen​

Answers

Answer:

the feather

Explanation:

solids do not change shape

NEED THIS ASAP PLEASE
Homework
Harnessing Human Energy Chapter 3 Lesson 3.3
Writing an Argument for the School Principal

Answers

The argument for Harnessing Human Energy  for the School Principal is written below

Dear Principal Tom,

Why we need to Harness Human Energy

Human power as we have been taught is the effort or energy created by a human being. It is one that can be said to be pace of work per time. The Muscles act as the main source of power, and body heat can also be used for tasks like warming food, shelters, or other people.

There are lot of reasons why we need to make use of these energy and this is coming form the fact that energy from the environment is transformed by humans into forms that are very beneficial for their activities.

An example to buttress this point is from the first person to understand that running a magnet via a copper wire could create an electric current was an English physicist named Michael Faraday. It was a truly remarkable finding. Magnets and copper wire coils are used in enormous power plants to create almost all of the electricity we use today. Therefore, harnessing human energy can do us more good than harm.

From

John Joe.

Learn more about Human Energy from

https://brainly.com/question/781388
#SPJ1

How are radiation levels kept in balance?

Outgoing

Earth emits


Back toward the sun in the form of



How are radiation levels kept in balance? OutgoingEarth emits Back toward the sun in the form of

Answers

Answer:

Explanation:We known that Earths energy machine is driven by sunlight which acts as fuel for this machine and to strike a balance between outgoing long wave radiation and short wave radiation there are many factors which are involved in this process.Sun emits this energy in the form of short wave radiation because of the huge energy it has and short wave radiation are higher in energy.Hence, they reach the earth surface mostly as visible and UV rays.After reaching the earths surface what happens with these rays is that they get absorbed by the clouds and other constituents of Earth.

Now, this energy needs to be emitted back in to space in order to balance out the energy budget of earth and that is why this energy is emitted back as long wave radiation which have less energy and also earth has less energy unlike the sun.Loss of this energy is essential as Earth looses most of its energy through this and results in cooling.But when this OLR decreases it should be a cause of concern for us.

This imbalance is caused by a wide range of different human induced activities which has a cumulative effect on the temperature of earth.These activities gives rise to a huge gain in the CO2 concentration which is why this word has gain so much popularity and a cause of widespread concern for us.At community level we contribute to this heating by increasing usage of personal automobiles rather than going for public transport , advancement in technology has greatly changed our lifestyles making it more simpler and easier but this demands more energy consumption.Landscape changes are one of the most important because its taking place at a faster rate.Most of the land being cleared off to built new houses which means clearing off the existing vegetation which leads to temperature rise.Setting up of Industry depending on its type can reduce the amount of OLR escaping the surface by introducing more amount of GHGs in to the atmosphere.

Its these small communities which add up to become the entire human population causing a massive damage and hence at community level if people realize and take necessary steps things will start to change.

Which of the following choices describe the steps required to determine the empirical formula of a compound from the mass %? Select all that apply. Check all that apply. The mass percentage of each element is converted to moles using the mass mass formula molar mass If a compound contains 52% of mass of C, it can be assumed that there are 52 g of C in 100 g of the compound. Therato of atoms of each element must bo a rato of ntege nmbers If the sample contains 52 g of carbon, it is assumed that this compound has 52 mass percent of carbon. The mass percentages are divided among the smallest number to calculate the ratio of atoms of each element present.

Answers

The steps required to determine the empirical formula of a compound from the mass % are:

1. Convert the mass percentages of each element to moles using the molar mass formula.

2. Divide the mass percentages among the smallest number to calculate the ratio of atoms of each element present.

3. Ensure that the ratio of atoms of each element is a ratio of integer numbers.

What is empirical formula ?

The empirical formula of a compound is the simplest whole number ratio of the elements present in the compound. It is often represented using the symbols of the elements involved and can be calculated from the relative masses of the elements. It is helpful in identifying the composition of a compound. For example, the empirical formula for glucose is CH2O, indicating that there is one carbon atom, two hydrogen atoms, and one oxygen atom present in the compound.

To learn more about empirical formula
https://brainly.com/question/1603500
#SPJ1

what kinda of water movement helps the fishing industry

Answers

Answer:

Upwelling is the natural process which brings cold, nutrient-rich water to the surface. A huge upwelling regularly occurs off the coast of Peru, which enjoys a large fishing industry as a result. Upwelling is a process in which currents bring deep, cold water to the surface of the ocean.

Explanation:

good luck

How many particles are in 67 grams of Oxygen?

Answers

There are so many particles in 67 grams of oxygen

Insoluble sulfide compounds are generally black in color. Which of the following combinations could yield a black precipitate? a) Na2S(aq) + KCl(aq) b) Li2S(aq) + Pb(N03)2(aq) c) Pb(C103)2(aq) + NaNO3(aq) d) AgNo3(aq) + KCl(aq) e) K2S(aq) + Sn(N03)4(aq)

Answers

Answer:

b) Li2S(aq)+Pb(NO3)2(aq)

e) K2S(aq)+Sn(NO3)4(aq)

Explanation:

they are the only two of the options that contain a sulfide ion (S) therefore they are the only ones that could be considered in the question.

b) Li2S(aq)+Pb(NO3)2(aq)

e) K2S(aq)+Sn(NO3)4(aq)

What is the difference between
the physical properties and the chemical
properties of a substance?

Answers

Answer:

A physical property is a characteristic of a substance that can be observed or measured without changing the identity of the substance. Physical properties can be color, density, hardness, melting or boiling points, while a chemical property describes the ability of a substance to undergo a specific chemical change.

When 6.0 mol Al react with 13 mol HCl what is the limiting reactant and how many moles can be formed

2Al + 6HCl - 2AlCl3 3H2

Answers

The limiting reactant in the reaction is HCl

The amount of products that can be formed in the reaction is:

4.33 moles of AlCl₃

6.5 moles of H₂

What is a limiting reactant?

A limiting reactant is a reactant that is used up in a reaction.

The limiting reactant when once used up, and the reaction stops. Thus, the limiting reactant produces the least amount of product from the reactants that are present.

Considering the given reaction:

2 Al + 6 HCl ---> 2 AlCl₃ + 3H₂

The mole ratio of the reactants aluminum and hydrochloric acid is 2 : 6

Hence, 13 moles of HCl will require 13 * 2/6 moles of Al = 4.33 moles of Al

Hence, HCl is the limiting reactant.

The amount of products that can be formed is:

AlCl₃ = 13 * 2/6

AlCl₃ = 4.33 moles

H₂ = 13 * 3/6

H₂= 6.5 moles

Learn more about limiting reactants at: https://brainly.com/question/19033878

#SPJ1

What mass of NaCl is needed to produce a 26.4 mol/L with a 1.7 L volume?

Answers

we would need 2625.13 grams (or 2.62513 kilograms) of NaCl.

To calculate the mass of NaCl required to produce a 26.4 mol/L solution with a 1.7 L volume, we need to use the formula that relates the mass of solute, moles of solute, and molarity:Molarity (M) = moles of solute / liters of solution Rearranging this formula, we get:moles of solute = Molarity (M) x liters of solutionWe can use this formula to find the moles of NaCl needed:moles of NaCl = 26.4 mol/L x 1.7 L = 44.88 molNow, we can use the molar mass of NaCl to convert from moles to grams. The molar mass of NaCl is 58.44 g/mol:mass of NaCl = moles of NaCl x molar mass of NaClmass of NaCl = 44.88 mol x 58.44 g/mol = 2625.13 gTo produce a 26.4 mol/L solution with a 1.7 L volume.

for more question on NaCl

https://brainly.com/question/23269908

#SPJ8

An atom has nine protons and ten electrons. This makes it:
An alpha particle
Neutrally charged
An ion
A cathode ray
Nonstoichiometric

Answers

Answer:

C: Ion

Explanation:

We are told that the atom has;

9 protons

10 electrons.

Now, in chemistry, when number of electrons(negative) is more than number of protons(positive), we say that the atom is negatively charged.

Now, looking at the options;

- alpha particles have 2 protons and 2 neutrons and so it is not correct

- for an atom to be neutrally charged, number of protons must be equal to number of electrons. Thus it is not correct.

- For an atom to be an ion, it means that there is an unequal amount of electrons and protons. If the atom has more electrons than protons, it is called anion(negative ion) but if it has less electrons than protons, it is called cation(positive ion).

Thus, option C is the correct answer.

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Other Questions
A mechanical oscillator comprises a mass that is a steel cube with a length of side 4 cm attached to a spring of stiffness 3000 N/m. The mass is initially displaced from its equilibrium position by a force of 10 N. When the force is removed, the system exhibits simple harmonic motion with no damping. If the density of steel is taken as 8.1 g/cm, calculate: (i) The resonant frequency of the system. [4] what was the prevailing reason for the push for reform in college football in the late 1800s and early 1900s? Sarah is a 15 y/o female that presents to your office c/o erythema, xeroderma and pruritus of the epidermal layer of her elbows and knees. Sarah also c/o the patches cracking and bleeding occasionally. Her mother states that she has been having this issue for several months. She remembers Sarah began having issues after she was sick. Sarah has a hx of strep throat this past winter. The patches seem to stay for a few weeks then they get better, but they always come back. Sarahs mom also states that she has been using antifungal cream on the patches, but nothing seems to make them better. Sarah has NKA and she has not been to see a Dermatologist. Determine the number of molecules of Cr2O3 that are formed when 1.34x10^3 grams of oxygen completely reacts according to the following equation 4Cr(s) + 3O(g) 2CrO(s)Answer as equation in certain species of horses, a roan coat color (mixed red and white hairs) occurs in the heterozygous (rr) offspring of red (rr) and white (rr) homozygous. which type type of inheritance does this example represent? Please help me on my math homework also please note that the answer in red is wrong. (This is serious) 6th grade science pls help me btw PLEASE NOTICE !!!!!!!IT SAYS SELECT TWO!!!!!!!!!!!!!! Ava's math certificate is 18 centimeters tall and 26 centimeters wide. Ava wants to put the certificate in a fancy frame that costs $1.53 per centimeter. How much will it cost to frame Ava's math certificate? What are the 7 types of shock? A race car starts from rest on a circular track. The car increases its speed at a constant rate at as it goes once around the track in the counterclockwise direction. Find the angle that the total acceleration of the car makes with the radius of the circle, at the moment when the car completes first half of the circle. A) 9.04o B) 4.55o C) 3.14o D) ) 0.08o E) none of the above Descube what scientist know about exoplanets, planet-like object outside the solar system. attendance at a baseball game went from 458 one week to 605 the next. What was the precnt increase in attendance What impact did the outcome of the Peloponnesian War have on Greece? Students and adults purchased tickets for a recent Math Fun Night fundraiser. 350 tickets were sold and $2,950 was collected. Each student ticket sold for $5 and adult tickets were sold for $10 each. How many adult and student tickets were sold? Let x=_______ Let y=______. I have no idea how to solve this, maybe you can help? If so, start off with the let statements and can you send the steps along with it too? 35% of those falled will find an excuse to avoid jury duty. if 10 people are called for jury duty, then what is the probability that 2 will find an excuse Question of the week. Whoever gives correct answer will be awarded Brainliest. Calculate the work done by a water pump in raising 500kg of water from 12m deep well on to a reservor 5.0m above the ground. when an employee who receives cash receipts from customers conspires with another employee who records those receipts in the customers' records to steal cash from the entity, this is known as the graph below represents the total number of plants and the number of seed packets used what is the constant of proportionally Which of the following earlier developments contributed most directly to the importance of the Asian market during the early modern period? a) the commercialization of the Chinese economy under the Song and Ming dynastiesb) the conquest of India by Muslim Turks and Afghansc) the increased trade along the Silk Roads encouraged by the mongol conquests of Eurasiad) the spread of Confucian ideas to areas of East and Southwest Asia outside China