A hiking trail is 6 1/4 miles long. roger averages 2 1/2 miles per hour. how many hours will it take him to hike the trail

Answers

Answer 1

To determine how many hours, it will take Roger to hike a 6 1/4-mile-long trail, we can divide the total distance of the trail by his average speed of 2 1/2 miles per hour. The resulting quotient will give us the number of hours required for Roger to complete the hike.

Roger's average speed is given as 2 1/2 miles per hour. To convert this mixed number to an improper fraction, we have 2 1/2 = 5/2 miles per hour.

To calculate the time, it will take Roger to hike the trail, we divide the total distance of the trail, which is 6 1/4 miles, by his average speed:

Time = Distance / Speed

Distance = 6 1/4 miles = 25/4 miles

Speed = 5/2 miles per hour

Time = (25/4) / (5/2)

To divide fractions, we multiply the first fraction by the reciprocal of the second fraction:

Time = (25/4) * (2/5)

Simplifying the multiplication, we get:

Time = (25 * 2) / (4 * 5) = 50/20 = 5/2 = 2 1/2 hours.

Therefore, it will take Roger approximately 2 1/2 hours to hike the 6 1/4-mile-long trail.

To learn more about average speed: -brainly.com/question/10449029#SPJ11


Related Questions

FIRST TO ANSWER WILL BE MARKED AS BRAINLIEST

FIRST TO ANSWER WILL BE MARKED AS BRAINLIEST

Answers

Answer:

m = 55

p=45

n = 135

Step-by-step explanation:

180 - 55 - 80 = 45

p = 45

55 = m

because ED and BC are parallel lines

80 + 55 = n

n = 135

The answer to the measure include the following:

m = 55p=45n = 135

What is a Triangle?

This is referred to a polygon which consists of three edges and three vertices.

m=55 (alternate angle)

The sum of angles in a triangle is 180

Therefore 180 - 55 - 80 = 45

p = 45

Since 55 = m

ED and BC are parallel lines therefore:

80 + 55 = n

n = 135

Read more about Triangle here https://brainly.com/question/1058720

#SPJ1

can someone help? i have a quiz tomorrow and i'm lowkey lost.

can someone help? i have a quiz tomorrow and i'm lowkey lost.

Answers

10 and 13 are the measure of the values of x and y respectively

Solving angles in a parallelogram

The given diagram is a parallelogram with unknown values x an y.

Since the measure of sum of angles in a triangle is 180 degrees, hence we will take the measure of the angles in the triangle EFY to have:

70 + 7x - 5 + 45 = 180

110 + 7x = 180

7x = 180 - 110

7x = 70

x = 10

Similarly for the triangle EDY;

45 + 70 + 5y = 180

115 + 5y = 180

5y = 180 - 115

5y = 65

y = 13

Hence the measure of the values of x and y are 10 and 13 respectively

Learn more on parallelograms here: https://brainly.com/question/970600

#SPJ1

Gale sells 16 bags of cherries at the farmers market. Each bag weighs 1.8 pounds. How many pounds of cherries does Gale sell in all?

Answers

Number of bags= 16

Bag weight= 1.8 pounds

Then, number of pounds is

= 16x 1.8 = 28.8 pounds of cherries

All you gotta do is multiply
So 16x8.1= 28.8

Type the correct answer in the box. Use numerals instead of words. If necessary, use / for the fraction bar.


Use digits to write the value of the 6 in this number.


672,180

Answers

Six hundred thousand

Hope it helps :)

Use properties of operations to complete the equivalent expression. 5(y+9)=​___y+​___ 5(y+9)=nothingy+nothing

Answers

Answer:

5y+45

Step-by-step explanation:

Danny charges $30 for 3 hours of swimming lessons, Martin charges $44 for 4 hours of swimming lessons. Who offers a better deal?

Answers

Answer:

Danny

Step-by-step explanation:

danny has a better offer

The sum of two consecutive numbers is 25. What is the largest of the consecutive numbers? Type a numerical answer in the space provided.

Answers

In a case whereby the sum of two consecutive numbers is 25 the largest of the consecutive numbers is 13.

How can the the largest of the consecutive numbers be calculated?

Given that sum of two consecutive numbers is 25 , ans we were required to locatye the  largest of the consecutive numbers. The we can represent the consecutive numbers as x and x+1. According to the problem, the sum of these two consecutive numbers is 25:

x + (x+1) = 25

Simplifying the left side of the equation:

2x + 1 = 25

2x = 24

Dividing both sides by 2:

x = 12

So the first consecutive number is 12. The second consecutive number is 12 + 1 = 13. Therefore, the largest of the consecutive numbers is 13.

Learn more about consecutive numbers at:

https://brainly.com/question/26352026

#SPJ1

Line segment ON is perpendicular to line segment ML.
What is the length of chord ML?

A) 20 units
B) 24 units
C) 26 units
D) 30 units

Line segment ON is perpendicular to line segment ML.What is the length of chord ML?A) 20 unitsB) 24 unitsC)

Answers

Answer:

24 units

Step-by-step explanation:

OM = ON, so

OP= 13-8

That means OP is 5.

Using the Pythagorean Theorom to find MP:

5^2+b^2=13^2

25+b^2=169

b^2=169-25

b^2=144

B=12

This means MP =12.  ML is twice as long as MP. 12x2=24

The answer is B. 24 units

QUESTION 8
In the figure to the right, AB is parallel to CD.
What is the value of m?
A. 7°
B. 44°
C. 46°
D. 49°

QUESTION 8In the figure to the right, AB is parallel to CD.What is the value of m?A. 7B. 44C. 46D. 49

Answers

Answer: B. 44°

if i'm wrong then its C

square $aime$ has sides of length 10 units. isosceles triangle $gem$ has base $\overline{em}$, and the area common to triangle $gem$ and square $aime$ is 80 square units. find the length of the altitude to $\overline{em}$ in triangle $gem$.

Answers

The length of the altitude to line segment $\overline{em}$ in triangle $gem$ is 16 units.

Let's denote the length of the altitude to line segment $\overline{em}$ in triangle $gem$ as $h$.

The area of a triangle is given by the formula:

Area = (base * height) / 2

The area common to triangle $gem$ and square $aime$ is 80 square units. Since the base of triangle $gem$ is $\overline{em}$, we have:

80 = (10 * h) / 2

160 = 10h

Solving for $h$, we have:

h = 160 / 10

h = 16

Therefore, the length of the altitude to line segment $\overline{em}$ in triangle $gem$ is 16 units.

Learn more about  length from

https://brainly.com/question/2217700

#SPJ11

Conchita starts a savings account. She deposits $100 from her parents. After that, she
deposits $10 each month. Write an algebraic expression to give the amount of money she
has saved after m months.

Answers

Answer:

$100 + $10m

Step-by-step explanation:

A = Account Balance = 100

After M months

A = $100 + $10m

consider a distribution with parameter that has density let be independent random variables drawn from this distribution. does this distribution belong to the canonical exponential family?

Answers

In order to determine whether a distribution belongs to the exponential family, we need to know its probability density function (PDF) or probability mass function (PMF). The exponential family is a class of probability distributions that can be expressed in the form:

f(x|θ) = h(x) exp{θT T(x) - A(θ)}

where x is the random variable, θ is the vector of parameters, T(x) is a sufficient statistic, h(x) is a known function, and A(θ) is the log normalizer.

If the distribution you are considering can be expressed in this form, then it belongs to the exponential family. If it cannot be expressed in this form, then it does not belong to the exponential family.

It is also worth noting that the exponential family includes many commonly used distributions, such as the normal, gamma, Poisson, and Bernoulli distributions.

What expressions are variables and examples?

A variable is a characteristic that may be measured and have a range of values. There are numerous factors, including height, age, money, birthplace province, academic rank, and type of housing. Variables can be grouped using categorical and numeric categories, respectively.

To know more about variables visit:

https://brainly.com/question/17344045

#SPJ4

in the following pseudocode which uses recursion to find the factorial of a number, which is the base case?factor(n - 1)n * factor(n - 1)n

Answers

The base case in the given pseudocode is factor(0).

The pseudocode is using recursion to find the factorial of a number. In each recursive call, the function is subtracting 1 from the given number (n - 1) and then multiplies it with the result of the recursive call for n - 1. The base case is the condition that stops the recursion and provides a result.

In this case, the base case is a factor(0). When the input number reaches 0, the recursion stops, and the function returns 1. This is because the factorial of 0 is defined as 1.

So, when the base case is reached, the recursion unwinds, and the factorial value is calculated by multiplying the current number (n) with the result of the previous recursive call (factor(n - 1)).

For more questions like Pseudocode click the link below:

https://brainly.com/question/17102236

#SPJ11

4.- Lucrecia tiene S/.4,50 más que María; y María, S/.15,25 menos que César. Si César tiene S/.34,15;¿cuánto tienen entre Lucrecia y María juntas

Answers

Queremos encontrar y resolver un sistema de ecuaciones que nos permita saber cuanto dinero tienen Lucrecia y María juntas.

Veremos que la solución es: $42.30

Ahora veamos como resolverlo, primero definimos las variables:

L = Dinero que tiene Lucrecia.M = Dinero que tiene María.C = Dinero que tiene César.

Sabemos que:

Lucrecia tiene $4.50 más que María, esto se puede escribir como:

L  = M + $4.50

María tiene $15.25 menos que César, esto se escribe como:

M = C - $15.25

Y finalmente sabemos que C = $34.15

Entonces nuestro sistema es:

L  = M + $4.50M = C - $15.25C = $34.15

Para resolver esto comenzamos por reemplazar la ultima igualdad en la segunda ecuación, así obtendremos:

M = $34.15 - $15.25 = $18.90

Ahora que conocemos el valor de M, lo podemos reemplazar en la primer ecuación:

L = $18.90 + $4.50 = $23.40

Ahora que sabemos cuanto dinero tiene cada una, el dinero total que tienen juntas es:

L + M = $23.40 + $18.90 = $42.30

Si quieres aprender más, puedes leer:

https://brainly.com/question/17174746

The candle maker makes a total of 45 orange candles. This is
30% of all the candles she made this week.
How many candles did the candle maker make this week?
candles

Answers

Answer:

150

Step-by-step explanation:

45........0.3

x ..........1 (same as 100%)

\( \frac{45}{x} = \frac{0.3}{1} \)

\(x = \frac{45}{0.3} \)

x = 450/3 = 150

:)

If Roger ran 5 miles in 150 minutes, Ryan ran 10 miles in 300 miles, and Rick ran 5 miles in 2 and ½ hours, who had the best rate of running(fastest time)?

Answers

Answer:

All three have same rate of running.

Step-by-step explanation:

Given that:

Distance covered by Roger = 150 minutes

Time taken by Roger = 5 miles

Distance covered by Ryan = 300 minutes

Time taken by Ryan = 10 miles

Distance covered by Rick = 2\(\frac{1}{2}\) hours

Time taken by Rick = 2 miles

To find:

Who has the fastest rate of running?

Solution:

First of all, we need to convert the time in hours and then we need to apply the formula for relation between Speed, time and distance.

Then we can compare the Speed.

60 minutes = 1 hour

150 minutes = \(\frac{1}{60} \times 150 = 2.5\ hours\)

300 minutes = 5 hours

Formula for Speed:

\(Speed = \dfrac{Distance}{Time}\)

Rate of running (speed) of Roger = \(\frac{5}{2.5}\) = 2 miles/hr

Rate of running (speed) of Ryan = \(\frac{10}{5}\) = 2 miles/hr

Rate of running (speed) of Rick = \(\frac{5}{2.5}\) = 2 miles/hr

Therefore, All three have same rate of running.

In Δ A B C, ∠C is a right angle. Find the remaining sides and angles. Round your answers to the nearest tenth. b=4.3, c=9.1

Answers

In a right triangle ΔABC, with ∠C as the right angle, you are given the lengths of side b and side c. Side b is 4.3 units long and side c is 9.1 units long. To find the remaining sides and angles,

we can use the Pythagorean theorem and trigonometric ratios. First, let's find side a using the Pythagorean theorem. According to the theorem,

a² = c² - b².

Substituting the given values, we have

a² = (9.1) ² - (4.3) ².

Calculating this, we get

a² = 82.81 - 18.49,

which simplifies to

a² = 64.32.

Next, we can find the remaining angles using trigonometric ratios. The sine ratio (sin) is defined as the ratio of the opposite side to the hypotenuse. In this case, sin(A) = a/c. Substituting the values, we have sin(A) = 8.0/9.1. Using a calculator, we find that sin(A) ≈ 0.879. Taking the inverse sine (sin⁻¹), we find that A ≈ 62.7 degrees.
we find that a ≈ 8.0 units.

To know more about right angle visit:

https://brainly.com/question/3770177

#SPJ11

The remaining angles are approximately 49.2° and 61.5°.

In a right triangle, the side opposite the right angle is called the hypotenuse, and the other two sides are called the legs. We are given that ∠C is a right angle, and we need to find the remaining sides and angles.

To find the missing side lengths, we can use the Pythagorean theorem, which states that in a right triangle, the square of the hypotenuse is equal to the sum of the squares of the legs.

Let's call the length of side a, the side opposite angle A. Using the Pythagorean theorem, we can write:

a^2 = b^2 + c^2

Substituting the given values, we get:

a^2 = (4.3)^2 + (9.1)^2

a^2 = 18.49 + 82.81

a^2 = 101.3

Taking the square root of both sides, we find:

a ≈ 10.1

So, the length of side a is approximately 10.1.

To find the remaining angles, we can use the trigonometric functions. Since we know two sides, we can use the sine and cosine ratios.

sin(A) = a / c

cos(A) = b / c

Substituting the given values, we get:

sin(A) = 10.1 / 9.1 ≈ 1.109

A ≈ arcsin(1.109) ≈ 49.2°

cos(A) = 4.3 / 9.1 ≈ 0.473

A ≈ arccos(0.473) ≈ 61.5°

Learn more about hypotenuse:

https://brainly.com/question/16893462

#SPJ11

whoever answers it i will mark brainlist (:

whoever answers it i will mark brainlist (:

Answers

Answer:

Step-by-step explanation:

You want this to be anything? It can be in any discipline?

1. There is a novel of 20000 pages that has been published. That's unlikely, but it is possible.

2. The temperature could be +30 degrees celcius in Northern Canada (today: Nov. 1).

3. The earth could stop and begin to rotate clockwise.

4. I could time travel to save John F. Kennedy.

5. Sherlock Holmes could fail to solve a mystery.

3, 12 , 48 Whats the 11th term ??

Answers

Given:-

\(3,12,48,\ldots\)

To find:-

The 11th term.

So observing the pattern its clear that the term is increasing by multiplying with 4. so we get the fourth term as,

\(48\times4=192\)

So the fifth term is,

\(192\times4=768\)

So the sixth term is,

\(768\times4=3072\)

So the seventh term is,

\(3072\times4=12288\)

So the eigthth term is,

\(12288\times4=49152\)

So the ninth term is,

\(49152\times4=196608\)

So the tenth term is,

\(196608\times4=786432\)

So the eleventh term is,

\(786432\times4=3145728\)

So the required 11th term is 3145728.

a square has side length of 7.3 in . if the area is multiplied by 19 , what happens to the perimeter?

Answers

The new perimeter is 127.2 inches if it is multiplied by 19.

What do you mean by the are and perimeter of the square ?

The area of a square is calculated by squaring the length of one of its sides. If the area of a square is multiplied by a factor, the length of the sides will be multiplied by the square root of that factor. One way to express the concept of perimeter for a square is to state that it is the total distance around the outer boundary of the shape, which is equal to the sum of the lengths of all four sides.

Determining the the value of perimeter :

The area of the square is \(7.3 \times 7.3 = 53.29\) square inches.

If this area is multiplied by 19, the new area will be 1012.51 square inches.

To find the new side length of the square, we take the square root of the new area:

\(\sqrt{1012.51} = 31.8\) (rounded to one decimal place)

Therefore, the new side length of the square is 31.8 inches.

To find the new perimeter, we multiply the new side length by 4:

\(31.8 \times 4 = 127.2\)inches

So the new perimeter is 127.2 inches.

To summarize, when the area of the square with side length 7.3 inches is multiplied by 19, the perimeter is multiplied by the square root of 19, which is approximately 4.36. The new perimeter is 127.2 inches.

To know more about perimeter visit :

brainly.com/question/6465134

#SPJ1

find f ( a ) , f ( a h ) , and the difference quotient for the function given below, where h ≠ 0 . f ( x ) = 8 x − 9

Answers

The difference quotient for the function is 8.

The function is given by:

f ( x ) = 8 x − 9, where h ≠ 0

To find f(a), substitute a for x in the function. So we have:

f ( a ) = 8 a − 9

To find f(a + h), substitute a + h for x in the function. So we have:

f ( a + h ) = 8 ( a + h ) − 9

The difference quotient can be found using the formula:

(f(a + h) - f(a))/h

Substituting the values found above, we have:

(8 ( a + h ) − 9 - (8 a − 9))/h

Expanding the brackets and simplifying, we have:

((8a + 8h) - 9 - 8a + 9)/h

= 8h/h

= 8

Therefore, the difference quotient for the function is 8.

To know more about difference quotient visit:

https://brainly.com/question/28421241

#SPJ11

Match each value of r to its scatterplot: Data 100 09 09 GRAPHA OP 8 3 40 8 0 100 Det 001 OH 0 GRAPH B OP 30 100 Duta 00 GRAPH C 爱 arch Data 100 80 60 OOO GRAPHD 20 0 0 20 40 80 100 Data 100 80 09 OOOOOOOOOOOOOOOO GRAPHE ON OZ 0 0 20 40 50 09 100 A [Choose B [ Choose -1 0.373 -0.908 0.881 -0.732 [ Choose C > D [ Choose E [Choose ]

Answers

Graphs and the correlation coefficients are mentioned below-

Graph{A} : 0.373Graph{B} : - 0.908Graph{C} : - 0.732Graph{D} : 0.881Graph{E} : - 1

What is Scatter plot?

A scatter plot uses dots to represent values for two different numeric variables. There are three types of scatter plots or charts -

U-shapedlinear exponential.

There are the three most important correlations as -

positive correlationnegative correlationno correlation

Given are the scatter plots and the associated correlation coefficient.

Correlation coefficient : it is a measure of linear correlation between two sets of data. Mathematically, we can write -

        \($r =\frac{\sum\left(x_{i}-\bar{x}\right)\left(y_{i}-\bar{y}\right)}{\sqrt{\sum\left(x_{i}-\bar{x}\right)^{2} \sum\left(y_{i}-\bar{y}\right)^{2}}}\)

        r = correlation coefficient

        \($x_{i}\) = values of the x-variable in a sample

        \($\bar x\) = mean of the values of the x-variable

        \($y_{i}\) = values of the y-variable in a sample

 \(\bar y\) = mean of the values of the y-variable

The graph and their corresponding values of [r] are mentioned below -

Graph{A} : 0.373Graph{B} : - 0.908Graph{C} : - 0.732Graph{D} : 0.881Graph{E} : - 1

Therefore, graphs and the correlation coefficients are mentioned below-

Graph{A} : 0.373Graph{B} : - 0.908Graph{C} : - 0.732Graph{D} : 0.881Graph{E} : - 1

To solve more questions on scatter plots, visit the link below-

https://brainly.com/question/29231735

#SPJ12

Match each value of r to its scatterplot: Data 100 09 09 GRAPHA OP 8 3 40 8 0 100 Det 001 OH 0 GRAPH
Match each value of r to its scatterplot: Data 100 09 09 GRAPHA OP 8 3 40 8 0 100 Det 001 OH 0 GRAPH
Match each value of r to its scatterplot: Data 100 09 09 GRAPHA OP 8 3 40 8 0 100 Det 001 OH 0 GRAPH

if a pack of 50 pencils cost $5.45 how much does a single pencil cost

Answers

Approximately 11 cents

If a pack of 50 pencils cost $5.45 then a single pencil costs $0.109.  

What is ratio?

Ratio basically compares quantities, that means it shows the value of one quantity with respect to the other quantity.

If a and b are two values, their ratio will be a:b,

Given that,

Cost of a pack of 50 pencils = $5.45.

To find the cost of one pencil,

Use ratio property,

50 pencil costs = $5.45

1 pencil costs = 5.45 / 50 =  $0.109

Cost of one pencil is $0.109.  

To learn more about Ratio on :

https://brainly.com/question/13419413

#SPJ5

pls help i will give brainliest and 5 stars

pls help i will give brainliest and 5 stars
pls help i will give brainliest and 5 stars
pls help i will give brainliest and 5 stars
pls help i will give brainliest and 5 stars
pls help i will give brainliest and 5 stars

Answers

Answer:

Answer is the fee at bank L will be the same as P when the checking fee is 600.

List the term(s) in the following expression:
2x² - 5xy +8p*
A.
B. 2,4
C. x, xy, y
D. 2x².-5xy, 8y
2, -5,8

Answers

Answer: D.

Step-by-step explanation:

The table represents an exponential function. What is the multiplicative rate of change of the function? X, 1,2,3,4 Y, 6,4,8/3,16/9

Answers

18392293649174656173619112

WILL GIVE BRAINIEST What is the solution set to log(x+4) < log6 x

WILL GIVE BRAINIEST What is the solution set to log(x+4) &lt; log6 x

Answers

It is B.

the question is so tough

Which ordered pair is a solution and f the equation? y-3=5(x-2)

Answers

Answer:

135=

3=5−10

Step-by-step explanation:

im not good at this but my mom said to try so i its not right

Carlos drove 1,064 miles on his vacation. He drove a total of 20 hours. What is the average number of miles Carlos drove each hour? Group of answer choices

Answers

53 rounded from 53.2

What is the area of a triangle with a base of 9 in and a height of 15 in

Answers

Answer:

The answer is 67.5

Step-by-step explanation:

First you would find the product of  and 15 which is 135 then divide by two and you get 67.5 hope this helped!

Other Questions
youve recently learned that the company where you work is being sold for $350,000. the companys income statement indicates current profits of $12,000, which have yet to be paid out as dividends. assuming the company will remain a "going concern" indefinitely and that the interest rate will remain constant at 7 percent, at what constant rate does the owner believe that profits will grow? marah's organization consists of an in-house project management staff and an online network of industry professionals. based on this, she is able to conduct business in the united states, europe, and the entire asia-pacific region. marah is an example of . a.a virtual organization b.a matrix design c.an m-form design d.a u-form design Michael opens a savings account with an initial deposit of $4,400. he earns 4.75% compound interest each quarter. how much would the final balance of the savings account be after 25 years if michael makes quarterly deposits of $100? round answer to nearest whole number. ?? how do you solve this _______ and ________ are two processes that facilitate cognitive development in infancy and later stages of development. A farming community collected data on the amounts of fertilizer, x, in 100kg/ha on the yield of carrots, y, in tonnes. the resulting quadratic regression model is y=-0.5x^2+1.4x+0.1 determine the amount of fertilizer needed to produce the maximum yield. go from standard form to factored to vertex form what would the correlation between between the ages of husbands and wives if men always married women who were 3 years younger than themselves select the incorrect statement. b. the peptide c-n bond is a bit shorter than the c-n bond of a simple amine due to the resonance protein a. true b. false a. the peptide bond is planar due to resonance (sharing of 2 pairs of e-) between the carbonyl oxygen and the amide nitrogen c. rotation is permitted about the n--ca and the ca--c bonds. d. the omega bond is the located between the carbonyl carbon and the amide nitrogen e. none of the above a+company+produces+a+product+with+a+contribution+margin+per+unit+of+$36.+if+the+company+incurs+$62,000+in+total+fixed+costs,+expects+to+sell+2,500+units,+and+has+a+tax+rate+of+35%,+the+pre-tax+income+ By law, all apartment buildings in New Jersey must have smoke alarms in the ceilings. Mary suffers smoke inhalation because the smoke alarm in her apartment building was not yet installed. To win a negligence action against the building owner, Mary would have to prove: Group of answer choices injury and causation. a breach of that duty. that the law exists. a duty existed toward her. according to davis and moore a system of unequal rewards increases productivity by factor 6x^2 +28x + 16 If you deposit $800 into a bank account today, what annually compounded interest rate would you need to earn in order to have $2,100 in 17 years? Enter your answer as a percentage rounded 2 decimal places. Do not enter the % sign. If sin(A+B)=sinAcosB+cosAsinB and cos(AB)=cosAcosB+sinAsinB, find the values of (i) sin75 and (ii) cos15 Kira is a vegetarian and takes great care to eat a well-rounded diet that offers her enough protein. she eats a lot of lentils, soybeans, black-eyed peas, and peanuts to help with her protein intake. these are examples of what types of seeds? legumes grasses cereal grains foundational Suppose that the Turkish economy in long-run equilibrium has an inflation rate, , of 12% per year and a natural unemployment rate, u, of 8%. The expectations-augmented Phillips curve is = -2(uu). Assume that Okun's law holds so that a 1 percentage point increase in the cyclical unemployment rate maintained for one year reduces GDP by 2% of full- employment output. a. Consider a two-year disinflation. In the first year = 0.06 and = 0.1. In the second year = 0.06 and = 0.06. in the first year, what is the unemployment rate? By what percentage does output fall short of full- employment output? In the second year, what is the unemployment rate? By what percentage does output fall short of full-employment output? What is the sacrifice ratio for this disinflation? An 85 foot wire is tied from the top of a pole to the top of a building. find distance from pole to the building A ______ defines or constrains some aspect of the business. A) business constraint. B) business structure. C) business control. D) business rule. Determine the convergence or divergence of the sequence with the given nth term. If the sequence converges, find its limit. (If the quantity diverges, enter DIVERGES.) an = sin(n)/n An electric company has to track on-time payments and late payments for each customer monthly. It is impossible for a customer to pay on-time and late each month. If the probability that a customer pays on-time each month is 0.55, and the probability that a customer pays late or on-time each month is 0.82, what is the probability that a customer pays late each month FactorsDescribe how factoring a quadratic expression ax2 + bx + c, where a 1, is different from factoring x2 + bx + c.