The direction of the child's average velocity between locations A and D on the merry-go-round will be in the direction of the displacement of the child, which is the change in position from location A to location D.
If the child is traveling at a constant speed, the average velocity will be in the same direction as the actual velocity at any given moment. The actual velocity of the child is always tangent to the circular path of the merry-go-round, and so the average velocity will also be tangent to the circular path. This means that the direction of the average velocity will be perpendicular to the line connecting the origin (center of the merry-go-round) to the position of the child.
The direction of the average velocity depends on the direction of the child's movement along the circular path of the merry-go-round.
Read more about Average velocity:
https://brainly.com/question/29483294
#SPJ4
A hanging wire made of an alloy of magnesium with diameter 0.08 cm is initially 2.0 m long. When a 12 kg mass is hung from it, the wire stretches an amount 1.17 cm. A mole of magnesium has a mass of 24 grams, and its density is 1.74 g/cm3.Based on these experimental measurements, what is Young's modulus for this alloy of magnesium
The Young's modulus for the alloy of magnesium is approximately 1.01 × 10^10 N/m².
What is the value of Young's modulus for this alloy of magnesium?Young's modulus is a measure of the stiffness of a material and represents its ability to resist deformation under stress.
To calculate Young's modulus for the given alloy of magnesium, we need to use Hooke's Law, which states that the stress applied to a material is directly proportional to the strain it produces.
First, we calculate the strain of the wire using the formula:
\(strain = change\ in\ length / original\ length\)
In this case, the wire stretches by 1.17 cm, so the change in length is 0.0117 m. The original length of the wire is 2.0 m.
Next, we calculate the stress applied to the wire using the formula:
\(stress = force / cross-sectional\ area.\)
The force applied to the wire is the weight of the 12 kg mass, which is 12
kg × 9.8 m/s² = 117.6 N.
The cross-sectional area of the wire is given by the formula:
\(cross-sectional\ area = \pi * (diameter/2)\²\)
Substituting the values, we find the cross-sectional area to be approximately 5.03 × 10^(-6) m².
Now, we can calculate Young's modulus using the formula:
\(Young's\ modulus = stress / strain\)
Substituting the values, we get
\(Young's modulus = 117.6 N / (5.03 * 10 \^\ (-6) m\² / 0.0117 m) \\= 1.01 * 10^10 N/m\²\)
Therefore, the approximate value of Young's modulus for the alloy of magnesium is 1.01 × 10^10 N/m².
Learn more about Young's modulus
brainly.com/question/29134671
#SPJ11
Four students are looking in the mirror. Which student makes a correct statement about the light reflected in the mirror.
A- Alex says only the direction of the light is changing.
B- Ansley says the speed and direction of the light is changing.
C- Katherine says only the speed of the light is changing.
D- Max says neither the speed or the direction of the light is changing.
Out of the four students looking in the mirror, Max is the one who makes the correct statement about the light reflected in the mirror. Max says that neither the speed nor the direction of the light is changing (Statement D).
This is because the light that reflects off an object and into a mirror does not change its speed or direction. It simply bounces off the object and into the mirror, where it is reflected back to the observer's eyes.
Alex's statement is incorrect because the angle of incidence and angle of reflection determine the direction of the reflected light.
Ansley's statement is incorrect because the speed of light is constant and does not change when it reflects off an object and into a mirror. Katherine's statement is also incorrect because the speed of light is constant and does not change when it reflects off an object and into a mirror.
In summary, Max is correct in saying that neither the speed nor the direction of the light is changing when it is reflected off an object and into a mirror. This is due to the laws of reflection that dictate how light interacts with a mirror.
for more such question on direction of the light
https://brainly.com/question/28030896
#SPJ11
during each cycle of operation, the thermal energy input to a heat engine is 400 j and the exhaust is 300 j. this engine's efficiency is
The calculated efficiency of heat engine during each cycle is 25%.
What is heat engine and its efficiency?A heat engine is a machine that transforms heat energy into usable mechanical work for people. The process is carried out using a straightforward apparatus. The ratio of the work a heat engine performs to the heat it absorbs throughout each cycle is referred to as the heat engine's efficiency. It can also be referred to as the heat engine's thermal efficiency. If there is the greatest difference between the hot and cold reservoirs, a heat engine can operate at its maximum efficiency. There is no unit for efficiency.
A formula and a symbol can be used to indicate the efficiency of the heat engine, which is a fraction of the heat and useful work produced. The formula for heat engine efficiency is,
η= \(\frac{W}{Q1}\)
where,
η= Thermal efficiency, W= Acquired useful work, Q1= Given heat energy
The energy given to the heat engine= 400 Joule
And the energy exhausted by the heat engine= 300 Joule
So, during each cycle of operation, the engine's efficiency can be calculated by:
η= \(\frac{Q1-Q2}{Q1}\)
η= \(\frac{400-300}{400}\)
η= \(\frac{1}{4}\)
Therefore, this heat engine is found to be 25% efficient.
To know more about heat engine efficiency, visit:
https://brainly.com/question/13154811
#SPJ4
An object of mass 75 Kg is taken to moon, what will be its weight?(freefall acceleration on moon =1.6 m/s2)
Answer:
120 Newtons
Explanation:
Weight of an object is given by the relation
W = mg
where
W = weight
m = mass of the object
g = gravitational force or freefall acceleration
Given the numbers:
m = 75 kg
g = 1.6 m/s²
W = 75 x 16 = 120 kg m/s² or 120 Newtons
Select the correct answer. If the resistance remains constant and the voltage doubles, what effect will that have on the power? A. The power will remain the same. B. The power will decrease by a factor of 2. C. The power will decrease by a factor of 4. D. The power will increase by a factor of 2. E. The power will increase by a factor of 4.
If the resistance remains constant and the voltage doubles, the power will increase by a factor of 4 (option E)
How do i determine the new power?The following data were obtained from the question:
Initial power (P₁) = PInitial voltage (V₁) = VResistance = ConstantNew voltage (V₂) = 2VNew power (P₂) =?P = V² / R
Resistance is constant, we have
V₁² / P₁ = V₂² / P₂
V² / P = (2V)² / P₂
V² / P = 4V² / P₂
Cross multiply
V² × P₂ = P × 4V²
Divide both side by V²
P₂ = P × 4V² / V²
P₂ = P × 4
From the above, we can conclude that the power will increase by a factor of 4 (option E)
Learn more about electrical power:
https://brainly.com/question/23850602
#SPJ1
when the protostar has the following temperatures, what is its luminosity? what is the radius of a protostar with these temperatures and luminosities compared to the radius of the sun? what is happening to the protostar at 200 k? what is happening to the protostar at 1000 k?
The first stage in the evolution of stars is the protostellar phase. It lasts roughly 500,000 years for a low-mass star (sun-mass or less).
When a star is still gaining mass from its parent molecular cloud, it is referred to as a protostar. The first stage in the evolution of stars is the protostellar phase. It lasts roughly 500,000 years for a low-mass star (sun-mass or less). A molecular cloud fragment first experiences self-gravity-induced collapse before entering the phase, where an opaque, pressure-supported core develops inside the fragment. It comes to an end when the gas that is descending outruns it, leaving a pre-main-sequence star that subsequently contracts to become a main-sequence star at the start of hydrogen fusion that produces helium. Since the protostar is still contracting, its diameter and surface area are extremely large, and its luminosity may be approximately 100 times greater than when it is fully formed.
Learn more about Protostellar here:
https://brainly.com/question/9299884
#SPJ4
first to spell a eight letter word wins
Answer:
Strength
Explanation:
D X Answered-Incorrect. 1 attempt left An object is launched along the incline of angle 30 degrees with horizontal from its bottom level with initial velocity 7. 4 m/s. It reaches height 1. 1 m, comes to momentarily stop and slides back. When it comes back to initial point it has velocity 3. 5 m/s. Find coefficient of friction between object and an incline. 1. 764 X Answered-Incorrect Resubmit 5. E X Answered-Incorrect 2 attempts left A block of mass 3. 3 kg sliding along horizontal rough surface is traveling at a speed 3. 0 m/s when strikes a massless spring and compresses spring a distance 5. 0 cm before coming to stop. If the spring has stiffness constant 500. 0 N/m, find coefficient of friction between block and surface. 0. 879 X Answered-Incorrect
According to the given statement, the coefficient of friction between the block and the surface is approximately 0.000772.
The coefficient of friction is a measure of the interaction between two surfaces in contact. It represents the amount of resistance or friction between the surfaces. In the given problem, we need to find the coefficient of friction between the block and the surface.
To find the coefficient of friction, we can use the equation:
μ = (k * x) / (m * g)
where:
- μ is the coefficient of friction
- k is the stiffness constant of the spring
- x is the distance the spring is compressed
- m is the mass of the block
- g is the acceleration due to gravity (approximately 9.8 m/s²)
Given values:
- k = 500.0 N/m
- x = 5.0 cm = 0.05 m
- m = 3.3 kg
First, let's convert the distance x to meters by dividing it by 100:
x = 0.05 m
Now, we can substitute the given values into the equation:
μ = (500.0 N/m * 0.05 m) / (3.3 kg * 9.8 m/s²)
Calculating this expression:
μ = 0.025 / 32.34
μ ≈ 0.000772
Therefore, the coefficient of friction between the block and the surface is approximately 0.000772.
To more about mass visit:
https://brainly.com/question/11954533
#SPJ11
Which of the following summarizes cellular respiration?
Oxygen reacts with glucose to produce carbon dioxide and water, and release energy.
Light energy is changed into chemical energy.
Light energy is used to join water and carbon dioxide to make oxygen and glucose.
Chemical energy is changed into light energy.
The statement which summarizes cellular respiration is Oxygen reacts with glucose to produce carbon dioxide and water, and release energy.
What is cellular respiration?Cellular respiration is the process by which food, in the form of glucose is transformed into energy within cells.
The food is prepared by the plants by the process of photosynthesis in presence of sunlight. This food is in the form of glucose.
The respiration of plants is done by breaking of glucose by absorbing oxygen. This produces carbon- di- oxide and water along with the release of energy.
Thus, the cellular respiration is oxygen reacts with glucose to produce carbon dioxide and water, and release energy.
Learn more about cellular respiration.
https://brainly.com/question/13721588
#SPJ1
Is my girl pretty 〖〗Fonts for iPhone & Android - www.fontskeyboard.com/share( ˘ ³˘)♥︎༼ つ ◕◡◕ ༽つ
Answer:
your girl is very very very very very very very pretty
Answer:
very very pretty
Explanation:
A car goes forward along a level road with a certain acceleration, a. The additional force needed to bring the car into equilibrium is.
The additional force needed to bring the car into equilibrium is equal to the mass of the car times the acceleration of the car, or F = ma.
What is equilibrium?Equilibrium is a state of balance and stability between opposing forces or actions. In economics, it refers to the point where the supply and demand for a given product or service are equal, and the market price of the product or service is stable. In physics and chemistry, equilibrium is a state in which different competing forces are balanced, so that no net change is observed. In biology, it is the ability of an organism to maintain a stable internal environment despite changes in external conditions. Ultimately, equilibrium is a state of balance, stability, and homeostasis.
To learn more about equilibrium
brainly.com/question/28432246
#SPJ4
Find the force experienced by a particle with a charge of (3x10^-8 c) when it is a distance of (2x10^-2 m) away from a second particle with a charge of (6x10^-7 c)
The physical characteristic of matter that causes it to feel a force when exposed to an electromagnetic field is called electric charge. The two types of electric charges that protons and electrons most frequently carry are positive and negative charges.
Find the force experienced by a particle with a charge of (3x10^-8 c) when it is a distance of (2x10^-2 m) away from a second particle with a charge of (6x10^-7 c)
Each fee = -Q
L is the length between charges.
decreased force =
As seen above, two particles, each with a charge of Q, are locked at a distance L apart. A net electric force F acts on every atom. The initial two particles are now locked on either side of a particle with a charge of +q.
Having said that,
The pressure at either end is
...(I)
If the charge q is positioned in the middle, then
Each end charge is under a force of
....(II)
We must determine the value of q.
Equation use (II)
Fill out the formula using the value of F.
Consequently, q is valued at q/8
To know more about charge, click on the link below:
https://brainly.com/question/18485122
#SPJ4
Why do Tectonic Plates move?
A) convection currents in the atmosphere
B) convection currents in the crust
C) convection currents in the asthenosphere
D) Convection currents in the core
Answer:
c. convection currents in the asthenosphere
Explanation:
Why is data sent digitally from space probes instead of using an analog device?
the reflexive or automatic process of perceiving sound is called
The reflexive or automatic process of perceiving sound is called hearing.
Hearing is the reflexive or automatic process of perceiving sound. It involves the complex interplay between the ears, auditory system, and the brain. The detailed explanation is:
1. Sound Waves: Hearing begins with the presence of sound waves in the environment. Sound waves are created by vibrations in the air, which travel as waves of compression and rarefaction.
2. External Ear: The process of hearing starts with the external ear, also known as the pinna or auricle. The pinna collects sound waves from the surroundings and directs them into the ear canal.
3. Ear Canal: The ear canal is a tube-like structure that connects the pinna to the middle ear. It serves to amplify and direct the sound waves further into the ear.
4. Middle Ear: In the middle ear, sound waves encounter the eardrum, a thin membrane that vibrates in response to the incoming sound. The eardrum separates the middle ear from the outer ear. The vibration of the eardrum is then transmitted to the three small bones in the middle ear called the ossicles (malleus, incus, and stapes).
5. Ossicles: The ossicles amplify the vibrations of the eardrum and transmit them to the inner ear. The movement of the ossicles is crucial for converting the airborne sound waves into mechanical vibrations that can be processed by the inner ear.
6. Inner Ear: The inner ear contains the cochlea, a spiral-shaped structure filled with fluid. When the mechanical vibrations from the ossicles reach the cochlea, they cause movement of the fluid within it.
7. Hair Cells: Inside the cochlea, there are specialized sensory cells called hair cells. The movement of the fluid in the cochlea stimulates the hair cells, which convert the mechanical vibrations into electrical signals.
8. Auditory Nerve: The electrical signals generated by the hair cells are transmitted through the auditory nerve, also known as the cochlear nerve. The auditory nerve carries these signals to the brain for further processing.
9. Auditory Cortex: The auditory cortex, located in the brain's temporal lobes, receives the electrical signals from the auditory nerve and interprets them as sound. It processes various aspects of sound, such as pitch, volume, and timbre, allowing us to perceive and make sense of the auditory stimuli.
Hearing is a complex process that involves the reception, transmission, and interpretation of sound waves by the ears and the brain. It relies on the coordinated functioning of the outer ear, middle ear, inner ear, auditory nerve, and auditory cortex.
To know more about reflexive here
https://brainly.com/question/29119461
#SPJ4
(b) Complete the sentence about longitudinal
waves.
The vibrations of the air particles are.....
to the
direction of energy transfer.
(C) A stationary car horn emits a sound wave frequency 400 Hz. The wavelength of the wave is 0.85 m. Calculate the speed of sound.
Answer:
see below
Explanation:
b ) the vibrations of the air particles are parallel to the direction of energy transfer.
c) use formula
speed = wavelength x frequency
speed = 0.85 x 400
speed = 340 m/s
hope you get it
please mark
(a) Calculate the curl and divergence of a three dimensional flow field which is given
by v = i (y+z) + j zx + k xy .
(b) A table tennis ball of mass m = 0.0027 kg, with diameter D = 44 mm, is hit at a
velocity of U = 12 m/s in a horizontal direction with backspin of angular velocity ω
radians/sec. You may take the density of air to be 1.23 kg/m3. If the ball is to travel
on a horizontal path, not dropping due to the acceleration of gravity, explain why
mg = CLrhoU2A/2
where g is gravitational acceleration, CL is the coefficient of lift, rho is the density of
air and A is the projected area of the ball. Rearranging this expression write down
a formula for CL in terms of the other variables and evaluate this for the given
values.You are also told that the coefficient of lift is related to the angular velocity
by CL = 0.28(ωD/2U). Equating this formula with the formula you derived find the
value of ω in radians/sec that ensures the table tennis ball travels on a horizontal
path.
(c) An offshore wind turbine is supported on a vertical cylindrical pile. The diameter of
the pile is 5 m. The water depth at the site is 30 m and the maximum tidal current
at the surface is 1 m/s. Laboratory tests have indicated that the Strouhal number
is 0.3. Estimate the frequency of vortex shedding near the sea surface under peak
tidal flow conditions.
(d) The velocity potential for simple linear waves may be written as:
where H is the wave height, h is the still water depth, x is the horizontal distance,
z is vertical distance downward, t is time, k is the wave number and ω is the wave
frequency. Using the relationship u = ∂/∂x derive a formula for the horizontal
component of velocity, u. For a wave of height 2 m, period 7 s and wave length
100 m propagating in a water depth of 10m, determine the maximum horizontal
velocity at the seabed.
a) To calculate the curl and divergence of a three-dimensional flow field, we have the flow field given as
\(v = i(y + z) + j(zx) + k(xy).\)
The curl of v is defined as:
curl(v) = ∇ x vWhere ∇ is the vector differential operator.
The curl is evaluated as:
\(curl(v) = i[(∂vz/∂y) - (∂vy/∂z)] + j[(∂vx/∂z) - (∂vz/∂x)] + k[(∂vy/∂x) - (∂vx/∂y)]where vx = y, vy = x, and vz = 1.\)
The above equation can be rewritten as:
curl(v) = - i - j + kDivergence of v is defined as:
div(v) = ∇ . v
This can be written as:
\(div(v) = ∂vx/∂x + ∂vy/∂y + ∂vz/∂z\)
Given v, we can calculate div(v) as follows:
\(div(v) = ∂vx/∂x + ∂vy/∂y + ∂vz/∂z= ∂y(y+z)/∂x + ∂x(zx)/∂y + ∂(xy)/∂z= 0+0+0=0\)
div(v) = 0, and curl(v) = - i - j + k
(b) Given that mg = CLρU^2A/2 and CL = 0.28(ωD/2U)
where \(m = 0.0027 kg, D = 44 mm = 0.044 m, U = 12 m/s, g = 9.81 m/s^2, and ρ = 1.23 kg/m^3\)
We have to derive the formula for CL in terms of the given variables and evaluate for the given values.
substituting the given values in the equation, we get:
\(mg = CLρU^2A/2CL = 2mg/(ρU^2A) = 2*0.0027*9.81/(1.23*12^2*π(0.022)^2) ≈ 0.155\)
Given that CL = 0.28(ωD/2U)
we can equate this with the above formula to obtain:
\(0.155 = 0.28(ωD/2U)ω = 2*0.155*12/(0.28*0.044) ≈ 50.06 radians/s(c)\)
For an offshore wind turbine supported on a vertical cylindrical pile, the vortex shedding frequency can be estimated using the formula:
f = St*U/D
where St is the Strouhal number, U is the velocity of the tidal current, and D is the diameter of the pile. Given that D = 5 m, h = 30 m, H = U = 1 m/s,
St = 0.3 we can evaluate the frequency of vortex shedding as:
f = 0.3*1/5 = 0.06 Hz
(d) The horizontal component of velocity is given as
\(u = ∂ϕ/∂x\)
where ϕ is the velocity potential for simple linear waves given as:
\(ϕ = H cosh(k(z+h))/cosh(kh)cos(kx-ωt)\)
Given that H = 2 m, T = 7 s, λ = 100 m, h = 10 m and g = 9.81 m/s^2, we have:
\(T = 2π/ωλ = gT^2/2π = (9.81*7^2)/(2π) ≈ 193.13 m\)
To calculate k, we use the relation k = 2π/λ.
Therefore\(,k = 2π/λ = 2π/100 = 0.0628\)rad/mSubstituting the given values in the velocity potential, we have:
\(ϕ = 2 cosh(0.0628(z+10))/cosh(0.628)cos(0.0628x - ωt)\)
The horizontal component of velocity is given as:\(u = ∂ϕ/∂x = -0.0628*2 sinh(0.0628(z+10))/cosh(0.628)sin(0.0628x - ωt)At the seabed,\)
z = -10 m
t = 0
\(u = -0.0628*2 sinh(-0.628)/cosh(0.628)sin(0) ≈ 0 m/s\)
Therefore, the maximum horizontal velocity at the seabed is 0 m/s.
To know more about divergence visit:
https://brainly.com/question/30726405
#SPJ11
Sam is driving along the highway towards saint john.He travels 150km in 3.00hrs.What is the average speed for his trip?
Answer:
what kind of car
Explanation:
Answer:
50km/hr
Explanation:
Now I am assuming you want the answer in Km/hr. with that being said speed is just distance/time.
so speed = 150km/3hr = 50km/hr
Why is electricity created at peak times not as efficient?
Explanation:
electricity created at peak........
what work is required to lift a 215 kg mass a distance of 5.65 m using a machine that is 72.5fficient
1540.2 J of work is needed to lift a 215 kg mass 5.65 m using a machine with a 72.5% efficiency.
Using the equation work = force distance, the amount of work completed is determined. In this instance, the formula force = mass acceleration due to gravity can be used to calculate the force necessary to raise the mass. The force is equal to (215 kg) (9.8\(m/s^2\)) = 2107 N when the above numbers are substituted.
Work = (2107 N) (5.65 m) = 11902.55 J. The amount of work carried out by the machine is equal to the force times the distance. However, the machine's efficiency is just 72.5%, which means that only some of the energy supplied is turned into meaningful labour. By dividing the calculated work by the efficiency, we can determine the actual work completed by the machine: actual work = (11902.55 J) (0.725) = 8628.36 J.
Learn more about work here:
https://brainly.com/question/29698772
#SPJ11
can someone please please helppp... thank u <3
Answer:
uniformly accelerated motion
#CARRY ON LEARNING
#IM 100% SURE
#MARK ME AS BRAINLIEST
HELP ASAP!
A train with mass of 3.1x104 kg is pushed by an engine with a force of 5.0x104N for a distance of 450.0 meters in 3.5 minutes.
How much work was done on the train? ________________J
What was the Power exerted by the train? ________________W
Work was done on the train 225x10⁵ J
Power exerted by the train 1.07 x 10⁵ W
Explain work and power?Work is the amount of energy transferred to an object when it is moved a certain distance by an external force. Since work is defined as the amount of energy (transferred), it has units of energy, and work usually has units of J (joules). The equation describing the work (W) done on a body moving a distance (s) while a force (F) is acting on it in the same direction as its motion is given by:
W = F × s
Where,
W = work done
F = force applied
s = displacement
We can define force as the rate of work. It is work done in a unit of time. The SI unit for power is the watt (W), which is the joule per second (J/s). The formula for power is:
P = W / t
Where,
P = Power
W = work done
t = time taken
Now for the given question:
W = F × s
F = 5.0x10⁴ N
s = 450.0 meters
W = 5.0x10⁴ x 450.0
W = 225x10⁵J
P = W / t
P = \(\frac{225}{210}\) x10⁵
P =1.07 x 10⁵ W
To know more about work and power visit:
https://brainly.com/question/1550427
#SPJ1
pilar is playing with a remote-controlled toy boat in a lake. she navigates the boat 400 m away from herself, keeping it at a constant speed. steering it back toward herself, pilar navigates the boat over the same route and at the same speed for 2 minutes, and then she increases the boat's speed by 10 m/min. the return trip is 60 seconds faster. how long does the return trip take?
Pilar is playing with a remote-controlled toy boat in a lake. she navigates the boat 400 m away from herself, keeping it at a constant speed, the return trip takes 3 minutes.
To find the time it takes for the return trip:
On the initial trip away from herself, Pilar navigates the boat 400 m away, which takes:
Time = Distance / Speed
= 400 m / v m/min
= 400/v min
1. The time for the first 2 minutes of the return trip at the same speed:
Time = 2 min
2. The time for the remaining distance at the increased speed:
The increased speed is "v + 10" m/min. The time for this segment is given as 60 seconds (1 minute) less than the initial trip:
Time = (400 m) / (v + 10) m/min
= (400/v - 1) min
The total time for the return trip is the sum of the time for the two segments:
Total time = 2 min + (400/v - 1) min
Now,
Total time = 2 min + (400/v - 1) min
= 60 seconds faster than the initial trip
Since 60 seconds is equal to 1 minute, we have:
Total time = 2 min + (400/v - 1) min = 2 min + 1 min
Simplifying the equation:
400/v - 1 = 1
400/v = 2
v = 400/2
v = 200 m/min
So,
Total time = 2 min + (400/v - 1) min
Total time = 2 min + (400/200 - 1) min
Total time = 2 min + (2 - 1) min
Total time = 2 min + 1 min
Total time = 3 min
Thus, the return trip takes 3 minutes.
For more details regarding speed, visit:
https://brainly.com/question/6280317
#SPJ12
Urgent please!!!!!!!!!!!!!!!!!!!!!!
A program can only create one object of each class.
A. True
B. False
Mars rotates fast enough to make it an
electromagnet and have a magnetic
field, but it no longer has a liquid outer
core. Mars no longer has a magnetic
field to protect it.
What evidence do scientists have that
Mars used to have a magnetic field?
Mars has rocks on it that are magnetized.
The atmosphere of Mars contains evidence
of a magnetosphere.
There is no evidence. Scientists are just
speculating (guessing) based on videos
from the Mars roverto Settings to activate Windows.
The evidence that scientists have that Mars used to have a magnetic field is this:
B. The atmosphere of Mars contains evidence of a magnetosphere.
What evidence did scientists use to reach their conclusion?Scientists base whatever conclusions they reach on a subject matter on evidence. To reach their conclusion that mars had a magnetic field that protected it, they used a device known as an orbiter to measure the magnetic strength of mars.
Their discovery showed that the magnetic field on Mars was ten times as strong as the earth's field. This gives evidence of the fact that at a certain time, there was a strong magnetic field on Mars.
Learn more about Mars here:
https://brainly.com/question/644043
#SPJ1
Colors are barely seen or not at all in nighttime because moonlightA) has almost no colors in it.B) is too dim to activate the retina's cones.C) photons don't have enough energy to activate the retina's cones.D) is primarily yellow light.E) is only semi-transparent in Earth's atmosphere.
**Colors are barely seen or not at all in nighttime because moonlight** is **too dim to activate the retina's cones** and **is primarily yellow light**.
During nighttime, when the only available light source is the moonlight, colors appear less vibrant or may not be perceived at all. This is primarily because moonlight is much dimmer compared to daylight, making it challenging for the retina's cones (responsible for color vision) to be adequately stimulated. The dimness of moonlight affects the cones' ability to discern and process different wavelengths of light associated with various colors. Additionally, moonlight consists primarily of yellow light due to the way sunlight is scattered by the Earth's atmosphere. This dominant yellow hue further reduces the perception of distinct colors, resulting in a diminished or absent color experience during nighttime.
To learn more about moonlight
https://brainly.com/question/30438747
#SPJ11
muscles contracting and relaxing repeatedly and rapidly
what is that called?
please help
little girl tosses an apple up toward a boy in a tree with an initial velocity of 8.50 m/s at 72o.
A. What is the maximum height reached by the apple
The maximum height reached by the apple thrown with an initial velocity of 8.50 m / s at 72° is 6.65 m
H = u² sin²θ / g
H = Maximum height
u = Initial velocity
g = Acceleration due to gravity
u = 8.5 m / s
g = 9.8 m / s²
θ = 72°
H = 8.5² sin² ( 72° ) / 9.8
H = 72.25 * 0.9 / 9.8
H = 6.65 m
If an object is thrown with an initial velocity at angle with the ground, it will move in a projectile motion. The object thrown is called as a projectile.
Therefore, the maximum height reached by the apple is 6.65 m
To know more about projectile motion
https://brainly.com/question/11049671
#SPJ1
Surface tension of aqueous solution of polymers A, B, C and D are respectively 75 dynes/cm, 72 dynes / cm, 68 dynes/ cm and 64 dynes/cm. Which of these polymers will have the most tendency to interact with an anionic surfactant such as SDS?
Choices:
O Polymer A
O Polymer B
O Polymer C
O Polymer D
The polymer with the highest surface tension, in this case, is Polymer A with a surface tension of 75 dynes/cm. Therefore, Polymer A will have the most tendency to interact with an anionic surfactant such as SDS.
Surface tension is a measure of the cohesive forces between molecules at the surface of a liquid.
A higher surface tension indicates stronger intermolecular forces and greater resistance to disruption of the liquid's surface.
Anionic surfactants, such as SDS (sodium dodecyl sulfate), have a negatively charged hydrophilic head group. They are attracted to positively charged or polar surfaces, promoting adsorption and reducing surface tension.
Since Polymer A has the highest surface tension among the given polymers, it suggests that it has stronger cohesive forces and a higher degree of interaction between its molecules.
This increased tendency to interact makes Polymer A more favorable for the adsorption of an anionic surfactant like SDS.
Polymers B, C, and D have progressively lower surface tensions, indicating weaker intermolecular forces and reduced interaction with anionic surfactants compared to Polymer A.
To know more about "Surface tension" refer here:
https://brainly.com/question/30765667#
#SPJ11
at what time would the object reach a speed of 45 km/ hr? and what is the objects acceleration