1. Which of the following are properties of non-metals?
A. mostly solids, dull, brittle, reactive, conductors
B. mostly solids, luster, high density, conductors
C. mostly gases, brittle, dull, low density, insulators
D. solids, luster, brittle, conductors, medium density

Answers

Answer 1
I think is letter C

Related Questions

Production of 6.5 grams of C2H2 requires consumption of how many grams of H2O

Answers

Answer:

C

Explanation:

Grams 3/4

Answer:

9g

Explanation:

number of moles × the moleculars mass

Experiment 4: A chemist mixes aqueous solutions of sodium hydroxide and aluminum chloride in a double-displacement reaction, which forms a white solid precipitate and a clear solution. Write the complete, balanced molecular equation for the reaction. Include physical states.
balanced equation:

Answers

The balanced molecular equation for the reaction between sodium hydroxide (NaOH) and aluminum chloride (\(AlCl_3\)) in aqueous solution can be written as follows: 2NaOH(aq) + 3\(AlCl_3\)(aq) → 3NaCl(aq) + \(Al(OH)_3\)(s)

In this reaction, sodium hydroxide (NaOH) reacts with aluminum chloride (\(AlCl_3\)) to form sodium chloride (NaCl) and aluminum hydroxide (\(Al(OH)_3\)). The coefficients in the balanced equation indicate the stoichiometric ratio between the reactants and products.

The physical states of the substances are indicated by the symbols (aq) for aqueous solutions and (s) for the solid precipitate.

The reaction is a double-displacement reaction, also known as a precipitation reaction. Double-displacement reactions involve the exchange of ions between two compounds, resulting in the formation of a precipitate.

In this case, sodium hydroxide and aluminum chloride react to form sodium chloride and aluminum hydroxide, with aluminum hydroxide being the white solid precipitate.

It's worth noting that the actual reaction might involve hydrated forms of the compounds, such as NaOH·x\(H_2O\) and \(AlCl_3\)·y\(H_2O\). However, for simplicity, these hydrated forms are not included in the balanced equation.

Overall, the balanced equation represents the chemical reaction between sodium hydroxide and aluminum chloride, showing the reactants, products, and their stoichiometric ratios.

For more such question on balanced molecular equation visit:

https://brainly.com/question/11904811

#SPJ8

i need help with the question below

i need help with the question below

Answers

Technician A says that improper handling of a windshield wiper can lead to a broken windshield. Technician B says that dishwashing detergent works well as washer fluid. Who is correct?Select one:A.Technician AB.Technician BC.Both A and BD.Neither A nor B

What would be the volume in liters of an 25.15 liter sample of gas at 201 °C and 2.31 atm if conditions were changed to STP?

Answers

The volume of the gas at STP would be 23.93 liters.

The volume of gas at STP (Standard Temperature and Pressure), we need to use the Ideal Gas Law, which states that PV = nRT, where P is pressure, V is volume, n is the number of moles of gas, R is the gas constant, and T is temperature. First, we need to calculate the number of moles of gas in the initial sample. We can use the formula n = PV/RT, where P is the initial pressure, V is the initial volume, R is the gas constant, and T is the initial temperature.
n = (2.31 atm) x (25.15 L) / [(0.0821 L atm/mol K) x (201 + 273.15 K)]
n = 1.067 moles

Now, we can use the molar volume of gas at STP, which is 22.4 L/mol, to calculate the volume of gas at STP.
V = n x 22.4 L/mol
V = 1.067 moles x 22.4 L/mol
V = 23.93 L
Therefore, the volume of the gas at STP would be 23.93 liters.

For more such questions on gas

https://brainly.com/question/25736513

#SPJ11

Given the following equation: Mg + 2HCI → MgCl₂ + H₂
How many moles of H₂ can be produced by reacting 2 moles
of HCI?

Answers

Taking into account the reaction stoichiometry, 1 mole of H₂ can be produced by reacting 2 moles of HCI.

Reaction stoichiometry

In first place, the balanced reaction is:

Mg + 2 HCl  → MgCl₂ + H₂

By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:

Mg: 1 moleHCl: 2 molesMgCl₂: 1 moleH₂: 1 mole

Moles of H₂ produced

By reaction stoichiometry 2 moles of HCl form 1 mole of H₂.

Learn more about the reaction stoichiometry:

brainly.com/question/24741074

brainly.com/question/24653699

#SPJ1

At standard temperature and pressure, krypton has a density of 0.003749 g/mL. A sample of krypton has a mass of
3.09 g. What is the volume of the krypton?

Answers

The volume of krypton is 2824.213 ml

What is Volume?

Volume can be defined as a measure of occupied space of a closed container.

In the given question, the volume is gotten by dividing the mass by the density.

parameters given

Density=0.003749g/ml

mass= 3.09g

Volume= mass/density

volume=3.09/0.003749

volume= 2824.213 ml

In conclusion, volume of can be gotten by dividing mass by density.

Learn more about volume at:https://brainly.com/question/1789840

#SPJ1

which of the following alkenes will yield a meso dihalide when reacted with br2/ccl4 at room temperature?O IO IIO IIIO IV

Answers

The alkene that will yield a meso dihalide is option II as shown in the image below.

A meso compound is a molecule with multiple stereocenters that is superimposable on its mirror image. Meso compounds are easily identified by their internal plane of symmetry. Using this knowledge, and given that Br2BrX2 undergoes anti addition to alkenes, there are only really two answers that could possibly be meso compounds, B and D. Let us consider the products which is given in the image attached below.

Notice how only B has an internal plane of symmetry, and is therefore a meso compound.

In A and C option there is no symmetry. So they will never form meso compound and we are not considering them.

So option II is the answer.

To learn more about meso compound check the link below:

https://brainly.com/question/29522919

#SPJ4

Complete question:

which of the following alkenes will yield a meso dihalide when reacted with br2/ccl4 at room temperature?O IO IIO IIIO IV

which of the following alkenes will yield a meso dihalide when reacted with br2/ccl4 at room temperature?O
which of the following alkenes will yield a meso dihalide when reacted with br2/ccl4 at room temperature?O

PLEASE HELP QUICKLY!!!

HI gas is removed from the system
at equilibrium below. How does the
system adjust to reestablish
equilibrium?
51.8 kJ + H₂(g) + 1₂(g) = 2HI(g)
A. The reaction shifts to the right (products) and the concentrations
of I, and H₂ decrease.
B. The reaction shifts to the left (reactants) and the concentrations
of H₂ and I increase.
C. The reaction shifts to the right (products) and the concentrations
of I, and H₂ increase.
D. The reaction shifts to the left (reactants) and the concentration of
HI increases.

PLEASE HELP QUICKLY!!!HI gas is removed from the systemat equilibrium below. How does thesystem adjust

Answers

Answer:

A. The reaction shifts to the right (products) and the concentrations of I and H₂ decrease.

Explanation:

If gas is removed from the system at equilibrium, the system will try to compensate for the loss by shifting the reaction in a direction that produces more gas molecules. This is known as Le Chatelier's principle, which states that a system at equilibrium will respond to a disturbance by shifting in a way that minimizes the effect of the disturbance.

In this case, since gas is being removed from the system, the reaction will shift to the side that produces more gas molecules. Looking at the balanced equation, we can see that 2HI(g) has a greater number of gas molecules compared to H₂(g) and I₂(g). Therefore, the system will shift to the right (products) to produce more HI(g) and reestablish equilibrium.

HELPPPPP (100 POINTS)

Assume that the water stream is replaced by a stream of CCl4. Predict what would happen in each case.

a. charged acetate strip:

b. charged vinyl strip:

c. Explain your predictions.

Answers

Answer:c

Explanation:c

How many grams of ethanedioic acid is required to prepare 2M solution of the NaOH

Answers

Answer:

I don't know

Explanation:

kahit Hindi ko alam

Calculate the mass of NaCl in a 44 −mL sample of a 1.6 M NaCl solution

Answers

The mass of NaCl in 44mL of a 1.6M solution is 4.1grams.

How to calculate mass?

The mass of NaCl can be calculated by using the following formula;

Molarity = no. of moles ÷ volume

Molarity is the concentration of a substance in solution, expressed as the number moles of solute per litre of solution.

no of moles = 1.6M × 0.044L = 0.07moles

The mass of the sodium chloride solution can be calculated by multiplying the molar mass of the salt by the number of moles present in the solution.

The molar mass of NaCl solution can be calculated as follows;

M.M = 23g/mol + 35.5g/mol = 58.5g/mol

mass of NaCl = 58.5 × 0.07 = 4.1grams.

Therefore, 4.1grams is the mass of NaCl solution.

Learn more about molarity at: https://brainly.com/question/12127540

#SPJ1

Using the periodic table provided, identify the atomic mass of sodium (Na) . Your answer should have 5 significant figures. Provide your answer below: __ amu

Answers

Answer:

Your answer will either be 22.9897 or 22.990 !!

Explanation:

Which term related to electromagnetism applies only to magnetic force

Answers

Electromagnetism is a branch of Physics, that deals with the electromagnetic force that occurs between electrically charged particles. The electromagnetic force is one of the four fundamental forces and exhibits electromagnetic fields such as magnetic fields, electric fields, and light.

Answer the question plssss

Answer the question plssss

Answers

Answer: warmer because its an  exothermic reaction.

Explanation: the passage states as the products form thermal energy is absorbed thermal means heat also carbon dioxide creates bubbles

When hydrogen reacts with calcium metal, what are the oxidation numbers of the calcium and hydrogen in the CaH2 product?

Ca(s)+ H2(g) → CaH2

a. +2 and -1
b. +1 and -2
c. +2 and 2
d. 0 and 0
e. -2 and +1

Answers

Answer:  e. -2 and +1

Explanation:

Oxidation number or oxidation state : It represent the number of electrons lost or gained by the atoms of an element in a compound.

Oxidation reaction is defined as the reaction in which a substance looses its electrons. The oxidation number of the substance increases.

Reduction reaction is defined as the reaction in which a substance gains electrons. The oxidation number of the substance gets reduced.

 \(Ca(s)+H_2(g)\rightarrow CaH_2\)

The oxidation number of calcium (Ca) in free state is 0 and in \(CaH_2\) , it is -2.

The oxidation number of hydrogen in \(H_2\) is zero and oxidation number of hydrogen in \(CaH_2\)  is +1 as in hydrides hydrogen loses electrons.

The oxidation number of calcium has been +2, and the oxidation number of hydrogen has been -1. Thus, the correct option is A.

The oxidation number can be defined as the number of electrons that have been lost by an atom in a chemical reaction.

The oxidation number can be calculated as the:

The oxidation number of Hydrogen when it combines with the less electronegative element has been -1.

There have been 2 atoms of Hydrogen that lose an electron, thus the total oxidation contribution of hydrogen has been -2.

The oxidation number of hydrogen has been -1.

The oxidation number of Calcium has been:

Ca atom has taken an electron from the hydrogen.

\(\rm Ca\;+\;e^-\;\rightarrow\;Ca^-\)

The calcium takes one electron from each atom bonded. Thus the oxidation number of calcium has been +2.

The oxidation number of calcium has been +2, and the oxidation number of hydrogen has been -1. Thus, the correct option is A.

For more information about oxidation numbers, refer to the link:

https://brainly.com/question/15167411

In a common reaction in living things, glucose combines with oxygen to form carbon dioxide and water vapor. In an experiment on this reaction, the masses of glucose, oxygen, and carbon dioxide are measured. This data table shows the measurements. What is the mass of the water vapor? please help

Answers

Multiply the number of moles of glucose by the molar mass of water (18.015 g/mol) to find the mass of water vapor produced.

To determine the mass of water vapor produced in the reaction, we need to analyze the data provided in the data table. The reaction mentioned is the process of cellular respiration, where glucose (C6H12O6) combines with oxygen (O2) to produce carbon dioxide (CO2) and water (H2O). We can use the principle of conservation of mass to calculate the mass of water vapor produced.The data table should provide the initial masses of glucose and oxygen, as well as the final mass of carbon dioxide. From these measurements, we can calculate the mass of water vapor.First, determine the number of moles of glucose and oxygen by dividing their respective masses by their molar masses. Then, use the balanced equation for cellular respiration to determine the mole ratios between glucose, oxygen, carbon dioxide, and water.

The balanced equation for cellular respiration is:

C6H12O6 + 6O2 -> 6CO2 + 6H2O

Based on this equation, we know that for every mole of glucose, 6 moles of water are produced.In conclusion, by using the principles of conservation of mass and stoichiometry, you can calculate the mass of water vapor produced in the reaction based on the given measurements.

for such more questions on moles

https://brainly.com/question/15356425

#SPJ8

find the number of hydrogen atoms of an alkyl group with 2 carbon atoms if n=2​

Answers

Answer:

5

Explanation:

An alkyl group is a functional group that contains only hydrogen and carbon atoms. It has the general formula: CnH2n+1.

Since n=2, plug it into the formula.

C2H2(2)+1

=

C₂H₅

Hope that helps.

what does cost-effective mean? im kind of confused on cost-effective and time-effective things and i keep getting mixed up :(

Answers

Cost-effective definition: producing good results without costing a lot of money. E.g: that machine is very cost effective, it made 200 shirts with only a dollar.

Time effective definition: how well time was used. E.g that machine is very time-effective, it made 200 pants in one hour!

Would appreciate brainly <3

help w this please and thank you.

help w this please and thank you.

Answers

Answer: see below

Explanation: filling the blanks in this order

point source

Pollution

Wastewater

waste

Nonpoint source

Contaminants

fertiliser

suburban yards

A sea turtle is 3feet below the surface of the sea ??? Help me ple

A sea turtle is 3feet below the surface of the sea ??? Help me ple

Answers

I think I THINK it would be the surface of the sea ?

Richard sketched models of two different neutral isotopes of oxygen. If the
isotope models are accurate, which statement might be true? (Refer to the
periodic table if necessary.)
A. One shows 7 protons, and one shows 9.
B. One shows 8 neutrons, and one shows 9.
C. One shows 8 electrons, and one shows 9.
D. One shows 8 protons, and one shows 7.

Answers

Answer:

its b

Explanation:

just did the test on A P E X

If the isotope models are accurate, One shows 8 neutrons, and one shows 9. Therefore, the correct option is option B.

What is isotope?

A chemical element's isotope is one of more than one species of atoms that share the same atomic number, spot on the periodic table, and almost identical chemical activity, but differ in atomic mass and physical characteristics. There are a number of isotopes for each chemical element.

The first step in identifying and labelling an atom is to count the protons within its nucleus. Usually, this nuclear number is denoted by the letter Z. The fact that all atoms possessing the same number of electrons have essentially equal chemical characteristics lends the atomic number its enormous significance. If the isotope models are accurate, One shows 8 neutrons, and one shows 9.

Therefore, the correct option is option B. If the isotope models are accurate, One shows 8 neutrons, and one shows 9.

To know more about isotope, here:

https://brainly.com/question/11680817

#SPJ5

The radius of the moon is approximately 1,350,000m. What is the radius in miles ( 1 mile= 1600m)

Answers

Answer:

843.75

Explanation:

ok so the moon radius is 1,350,000meters right so meters to miles

1 mile=1600meters

1,350,000/1600=843.75

843.75 miles

Hope that helps!

Merry Christmas!

28.25 What two aldoses yield D-xylose on Wohl degradation?

Answers

56.5

Explanation:

the degradation would be 28.25 times 2

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

How many moles of NaHCO3
are in 27.5 g NaHCO3
?

Answers

I am pretty sure it is 4

Do step 3 as outlined in the lab guide. Record your results in the appropriate blanks.

A =
B =
C =
D =
E =
F =
G =
H =

Answers

Some tips to follow when doing lab practical are:

Avoid parallax errorsRecord your observations and data accuratelyUse the appropriate lab equipment.

How do we know?

From the table, Column 1 represents the time in half-life cycles, ranging from the initial state to 8 cycles. Column 2 shows the predicted number of radioactive atoms at each time point, based on the assumption that the number of atoms reduces by half in each half-life cycle.

Column 3 represents the simulated number of radioactive atoms at each time point and corresponds to the predicted values of the simulation.

In conclusion, the results as outlined in the lab guide are A=  27 B=  16 C=  9 D=  4 E=  2 F=  2 G=  0 H= 0.

Learn more about half-life cycles at:

https://brainly.com/question/15976750

#SPJ1

#complete question:

Do step 3 as outlined in the lab guide. Record your results in the appropriate blanks. A = B = C = D = E = F = G = H = A 3-column table with 9 rows. Column 1 is labeled Time half-life cycles, n with entries Initial, 1, 2, 3, 4, 5, 6, 7, 8. Column 2 is labeled Predicted radioactive atoms with entries 100, 50, 25, 13, 6, 3, 2, 1, 0. Column 3 is labeled Simulated radioactive atoms with entries 100, A, B, C, D, E, F, G, H.

Which statement best describes the structure of a lipid molecule?
A phospholipid has a charged head and an uncharged tail.
A lipid is made up of a long chain of phosphorus molecules.
Lipids contain proteins and glycerol.
The ends of the lipid are attached to each other.​

Answers

A phospholipid has a charged head and an uncharged tail.

You want to compare the malleability of
two metals. Plan an investigation that would allow you to determine
which metal is more malleable .

Answers

One way you could measure this is hitting the two metals with a mallet and seeing which one has more of a dent

The temperature and the strength of the metallic link are the two most crucial variables that can impact how malleable a metal or alloy is.

What is metal ?

A metal is a substance that has a shiny look when freshly processed, polished, or shattered, and conducts electricity and heat rather effectively. Generally speaking, metals are malleable and ductile.

The amount of pressure that a metal can sustain without breaking can be used to gauge its malleability. Varied metals have different degrees of malleability because of variations in their crystal structures.

The temperature of the metal and the strength of the metallic connection are the two parameters that define how malleable a metal or metal alloy will be.

Thus,  The kind of the metallic connection can have a significant impact on how easily metal atoms can rearrange themselves.

To learn more about metal, follow the link;

https://brainly.com/question/18153051

#SPJ2

Choose the option that would convert mg/L
into molarity (mol/L).

A. Convert mg/L to get g/L then multiply by the volume (L).

B Convert mg/L to g/L then divide by molar
mass (g/mol).

C. Convert mg/L to g/L then divide by the volume (L).

D. Convert mg/L to g/L then divide by the
number of moles (mol).

Answers

The correct option that would convert mg/L into molarity (mol/L)- Convert mg/L to get g/L then multiply by the volume (L). so, option (a) is correct.

What is molarity ?

The amount of solute in one mole per liter of solution is known as molarity. For instance, when table salt is dissolved in water, the solute is salt, and the solution is water. 58.44 grams make up one mole of sodium chloride. One molar solution, often known as 1M, is created when 58.44 grams of sodium chloride are dissolved in one liter of water.

What is volume ?

Volume, a three-dimensional quantity, is used to calculate the capacity of a solid shape. It suggests that the volume of a closed figure determines the amount of three-dimensional space it can occupy.

Therefore, the correct option that would convert mg/L into molarity (mol/L)- Convert mg/L to get g/L then multiply by the volume (L). so, option (a) is correct.

Learn more about molarity from the given link.

https://brainly.com/question/26873446

#SPJ1

Answer: Not A, its B

Explanation: B

Please help me answer this question:(

Please help me answer this question:(

Answers

If the line is located In The positive area also the slope would be positive and the slope is on the y axis
Other Questions
Given: XWU ZVT; ZTV XUW; TU VW Triangles Z V T and X W U overlap and intersect at point Y. Angles Z T U and W U W are congruent. Angles Z V T and X W U are congruent. Lines segment T U and V W are congruent. A line is drawn through point Y to point S on side X W and to point R on side Z T. Another line connects points Z and X. Which relationship in the diagram is true? XYZ XYS by SSS ZYX VYU by AAS RYZ XZY by SAS ZVT XWU by ASA if a bond is immunized against interest rate risk, a dollar decline in the bond's price, resulting from rising interest rates, will be approximately offset by a dollar increase in the a) bond issuer's common stock. b) income from coupons reinvested over the investment horizon. c) price of comparable bonds in the market. d) bond's call price. a 71-year-old woman presents to her primary care physician complaining of rectal bleeding. she had some mild left-sided abdominal cramps that subsided within a few minutes. she has never had a prior episode of rectal bleeding. physical examination reveals mild left lower quadrant abdominal pain without evidence of guarding or rebound tenderness. rectal examination reveals no fresh blood in the rectal vault. colonoscopy reveals several outpouchings of the sigmoid colon wall without evidence of bleeding or perforation. the remainder of the colonoscopy is within normal limits. white blood cell count is normal. what is the most appropriate treatment for this patient? At the beach, differences in temperature create wind which transfer heat between the land and the water. The same process is also seen in the ocean as the Gulf Stream carries heat from the tropics northward. Heat transfer through any intermediate fluid is know asA. CondensationB. ConductionC. ConvectionD. Radition if you have a properly adjusted flame, which is pale blue, what is observed if the gas control valve is slightly closed 13. In terms of tones, a half note is considered a ______note.*shorttallfarlong Suppose an individual organism aids the survival and reproductive success of the offspring of its sibling. How might this behavior result in indirect selection for certain genes carried by that individual? Tyler was looking at this system of equations: x+y=5 and x+y=7He said, "Just looking at the system, I can see it has no solution. If you add two numbers the sum can;t be equal to two different numbers. " Do you agree with Tyler? chloroplasts are thought to have evolved from cyanobacteria. which observations support this hypothesis? select all that apply. both chloroplasts and cyanobacteria have similar internal membranes that organize the light reactions of photosynthesis. both chloroplasts and cyanobacteria have cell walls. both chloroplasts and cyanobacteria have the capability of movement through flagella. both chloroplasts and cyanobacteria have small, circular dn What is ONE danger in focusing a financial analysis solely on the data found in the historical financial statements? Chloe drives from her house to her Grandma's house 48 miles away in an hour and 12 minutes. How far could she travel in 9 minutes?A) 24 milesB) milesC) 6 milesD) 12 miles Why is the amount of gas you measured only an estimate of the atp produced? consider what you know about liquids and gases. how can you change the setup to make it more accurate? Animals produce a substance called insulin, which helps them maintain healthy levels of glucose in their blood. Insulin is most directly related to which function? movement feeding reproduction homeostasis consider a soluble salt in which the absolute value of the heat of hydration is more than the absolute value of the lattice enthalpy. what are the signs of standard gibbs energy, enthalpy and entropy of precipitation? select the words positive, zero, negative, or unknown in each of the boxes when adding a solid salt to water. Your new credit card has a 15% nominal interest rate which is compounded daily. This is equivalent to an effective annual interest rate of aboutA. 15%B. 1.25%C. 14%D. 16.18% Claire is paid $90 for 5 hours at this rate how many hours does it take for her to earn $126 a simple undirected graph has 10 edges. 2 of the vertices are of degree 4, and the rest of the vertices are of degree 3. how many vertices are in this graph? What are a) the ratio of the perimeters and b) the ratio of the areas of the larger figure to the smaller figure? The figures are not drawn to scale. A. 5/2 and 25/4 B. 5/2 and 7/4 C. 7/2 and 25/4 D. 7/2 and 7/4SOMEONE PLEAS HELP! Which of the following statements does not pertain to non-comparative scales? A) Noncomparative scales are often referred to as monadic scales. B) Respondents using a non-comparative scale employ whatever rating standard seems appropriate. C) Data must be interpreted in relative terms and have only ordinal or rank order properties. D) Non-comparative techniques consist of continuous and itemized rating scales. : Which of the following was a result of the rapid increase in home prices beginning in 2003? Check all that apply. Investors began to invest more in mortgages Investors began to invest less in mortgages Home builders began constructing more new homes. Investors began requiring less equity investment than was typically required for an individual to purchase a home.